prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=S)Sc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](OC(=S)Sc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=N)Cc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](OC(=N)Cc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)CCC(=O)c1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](C(=O)CCC(=O)c1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NC[C@H]1CCC[C@@H]1O)[C@H](O)CCc1ccc(Cl)c(Cl)c1 | C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@@H](C(=O)NC[C@H]1CCC[C@@H]1O)[C@H](O)CCc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)/C=C/Sc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](Oc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | C[C@H](C(=O)/C=C/Sc1ccc(Cl)c(Cl)c1)C(=O)NC[C@H]1CCC[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1CN(Cc2cc(C)n(Cc3ccco3)c2C)C[C@@H]1C | COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CN(Cc2cc(C)n(Cc3ccco3)c2C)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]18CCC[NH+]5C1"
} |
Can you make molecule COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1C=C[C@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1C=C[C@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]18CCC[NH+]5C1"
} |
Can you make molecule COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1CCC[C@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CCC[C@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]18CCC[NH+]5C1"
} |
Can you make molecule COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1C=C[C@@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1C=C[C@@H](Cc2cc(C)n(Cc3ccco3)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]18CCC[NH+]5C1"
} |
Can you make molecule COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H]1CCC[C@H](Cc2cc(C)n(Cc3ccco3)c2C)CC1 | COC[C@H]1CCC[NH+](Cc2cc(C)n(Cc3ccco3)c2C)C1 | COC[C@H]1CCC[C@H](Cc2cc(C)n(Cc3ccco3)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]18CCC[NH+]5C1"
} |
Can you make molecule Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCC[C@@H](CCl)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc(CCC[C@@H](CCl)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]68C"
} |
Can you make molecule Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCC2=CN=N[C@H]2NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc(CCC2=CN=N[C@H]2NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]68C"
} |
Can you make molecule Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CC[C@@H](NC(=O)CN(C)C(=O)OC(C)(C)C)C2)cc1F | Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc([C@@H]2CC[C@@H](NC(=O)CN(C)C(=O)OC(C)(C)C)C2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]68C"
} |
Can you make molecule Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(C)(C)[C@@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | Cc1ccc(CC(C)(C)[C@@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]68C"
} |
Can you make molecule Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)CN(C)C(=O)OC(C)(C)C | Cc1ccc([C@H](C)NC(=O)CN(C)C(=O)OC(C)(C)C)cc1F | CC[C@@H](CCc1ccc(C)c(F)c1)NC(=O)CN(C)C(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]68C"
} |
Can you make molecule CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=NCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CCC(CO)=NCCC(=O)N1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CCCC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)SNCCC(=O)N1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CCCCC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=NCCC(=O)N1CCC[C@@H](C)C1 | CC(=O)NCCC(=O)N1CCC[C@@H](C)C1 | CCC(C=O)=NCCC(=O)N1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC2=O"
} |
Can you make molecule COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c2nn(CCCCC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CCCCC(N)=O)c(=O)c3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c2nn(CC(N)=S)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=S)c(=O)c3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C6C(N)=O"
} |
Can you make molecule COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c2nn(CC(C)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(C)=O)c(=O)c3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c2nn(CC/C(N)=N/O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC/C(N)=N/O)c(=O)c3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCn3c2nn(CC/C(N)=N\O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC(N)=O)c(=O)c3=O)cc1 | COc1ccc(N2CCn3c2nn(CC/C(N)=N\O)c(=O)c3=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C6C(N)=O"
} |
Can you make molecule ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | ClC(Cl)=C(Cl)Cc1nonc1C(Cl)(Cl)Cl | ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl | ClC(Cl)=C(Cl)Cc1nonc1C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C(Cl)=C(Cl)Cl",
"old_substring": "ClC2(Cl)Cl"
} |
Can you make molecule ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(c1nonc1C(Cl)(Cl)Cl)C(C)C | ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl | CC(C)C(c1nonc1C(Cl)(Cl)Cl)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "ClC2(Cl)Cl"
} |
Can you make molecule ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(c2nonc2C(Cl)(Cl)Cl)CC1 | ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl | CC1(C)CCC(c2nonc2C(Cl)(Cl)Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "ClC2(Cl)Cl"
} |
Can you make molecule ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc(Cl)c1-c1nonc1C(Cl)(Cl)Cl | ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl | Clc1cccc(Cl)c1-c1nonc1C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "ClC2(Cl)Cl"
} |
Can you make molecule ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](C)c1nonc1C(Cl)(Cl)Cl | ClC(Cl)(Cl)c1nonc1C(Cl)(Cl)Cl | CC(C)CC[C@H](C)c1nonc1C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC[C@@H]&C",
"old_substring": "ClC2(Cl)Cl"
} |
Can you make molecule CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(C(=O)N2CCN([C@@H]3CCCN(c4ccccc4)C3=O)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H]3CCCN(c4ccccc4)C3=O)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&C1=O",
"old_substring": "[C@@H]58C(N)=O"
} |
Can you make molecule CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(C(=O)N2CCN([C@H](C)N(C)Oc3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@H](C)N(C)Oc3ccccc3)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "[C@@H]58C(N)=O"
} |
Can you make molecule CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(C(=O)N2CCN([C@@H]3C=C(Cc4ccccc4)N=N3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H]3C=C(Cc4ccccc4)N=N3)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]58C(N)=O"
} |
Can you make molecule CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(C(=O)N2CCN([C@@H]3CCCCN(c4ccccc4)C3=O)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H]3CCCCN(c4ccccc4)C3=O)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]58C(N)=O"
} |
Can you make molecule CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc(C(=O)N2CCN([C@H]3CC(Cc4ccccc4)=NO3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@@H](C(N)=O)c3ccccc3)CC2)cc1C | CCc1sc(C(=O)N2CCN([C@H]3CC(Cc4ccccc4)=NO3)CC2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@@H]58C(N)=O"
} |
Can you make molecule C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=Cc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | C[NH+]1CCC(=Cc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC=&CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NOCc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | C[NH+]1CCC(=NOCc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | C[N+](C)(C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)N1CCCCCC1)Nc1cc(CC[NH+]2CCCSCC2)n[nH]1 | C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | O=C(CCCC(=O)N1CCCCCC1)Nc1cc(CC[NH+]2CCCSCC2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC(Cc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | C[NH+](C)Cc1cc(NC(=O)CCCC(=O)N2CCCCCC2)[nH]n1 | C[N+]1(C)CCC(Cc2cc(NC(=O)CCCC(=O)N3CCCCCC3)[nH]n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(COC(C)(C)C)cc1I)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1I)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1cc(COC(C)(C)C)ccc1Br)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 | C[C@@H](Nc1cc(COC(C)(C)C)ccc1Br)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1ccc(COC(C)(C)C)cc1Cl)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1Cl)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1cccc(COC(C)(C)C)c1Br)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 | C[C@@H](Nc1cccc(COC(C)(C)C)c1Br)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Nc1cccc(COC(C)(C)C)c1Cl)c1ccc(C#N)cc1 | C[C@@H](Nc1ccc(COC(C)(C)C)cc1)c1ccc(C#N)cc1 | C[C@@H](Nc1cccc(COC(C)(C)C)c1Cl)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc7cc1"
} |
Can you make molecule NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1I | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1cc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)ccc1Br | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 | NC(=O)c1cc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1Cl | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1cccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)c1Br | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 | NC(=O)c1cccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1cccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)c1Cl | NC(=O)c1ccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)cc1 | NC(=O)c1cccc(NC(=O)c2cccn(Cc3ccc(F)cc3)c2=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc5cc1"
} |
Can you make molecule Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)CC(=O)c1cc(C)nc2c1c(C)nn2C | Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 | CC[C@@H](CCCl)CC(=O)c1cc(C)nc2c1c(C)nn2C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "N13CC[C@H](C)C[C@H]1C"
} |
Can you make molecule Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)C(=O)c1cc(C)nc2c1c(C)nn2C | Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 | CC[C@@H](C)C[C@H](CC)C(=O)c1cc(C)nc2c1c(C)nn2C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "N13CC[C@H](C)C[C@H]1C"
} |
Can you make molecule Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC[C@H](C)[C@@H](C)C(=O)c1cc(C)nc2c1c(C)nn2C | Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 | C=CC[C@H](C)[C@@H](C)C(=O)c1cc(C)nc2c1c(C)nn2C | 102 | {
"fragment_index": 0,
"new_substring": "C=CC[C@H](C)[C@H]&C",
"old_substring": "N13CC[C@H](C)C[C@H]1C"
} |
Can you make molecule Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)CC(=O)c1cc(C)nc2c1c(C)nn2C | Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 | CC[C@H](CCCl)CC(=O)c1cc(C)nc2c1c(C)nn2C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "N13CC[C@H](C)C[C@H]1C"
} |
Can you make molecule Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCCC(=O)c1cc(C)nc2c1c(C)nn2C | Cc1cc(C(=O)N2CC[C@H](C)C[C@H]2C)c2c(C)nn(C)c2n1 | CC[C@@H](Cl)CCCC(=O)c1cc(C)nc2c1c(C)nn2C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "N13CC[C@H](C)C[C@H]1C"
} |
Can you make molecule Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cn1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2)=N/ON1C[C@H](C)C[C@H](C)C1 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | C/C(Cn1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2)=N/ON1C[C@H](C)C[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C7C5=O"
} |
Can you make molecule Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1C[C@H](C)C[C@H](C)C1)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | CCC(CC)(C(=O)CN1C[C@H](C)C[C@H](C)C1)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7C5=O"
} |
Can you make molecule Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(SSC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(SSC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C7C5=O"
} |
Can you make molecule Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1C[C@H](C)C[C@H](C)C1)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | CCC(CC)(C(=O)CCN1C[C@H](C)C[C@H](C)C1)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7C5=O"
} |
Can you make molecule Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1C[C@H](C)C[C@H](C)C1)C(=O)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | Cc1c(C(=O)N2CCCC2)oc2c1-c1nn(CC(=O)N3C[C@H](C)C[C@H](C)C3)cc1CC2 | CC[C@@H](C(=O)N1C[C@H](C)C[C@H](C)C1)C(=O)n1cc2c(n1)-c1c(oc(C(=O)N3CCCC3)c1C)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C7C5=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)CC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)CCCC(C)(C)C)c1 | Cc1cc(C)cc(NC(=O)CC(C)C)c1 | Cc1cc(C)cc(NC(=O)CCCC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC(C)(C)C",
"old_substring": "C2(=O)CC(C)C"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)CC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(N=CC(C)(C)C)c1 | Cc1cc(C)cc(NC(=O)CC(C)C)c1 | Cc1cc(C)cc(N=CC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C=&",
"old_substring": "C2(=O)CC(C)C"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)CC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)CCCCCCl)c1 | Cc1cc(C)cc(NC(=O)CC(C)C)c1 | Cc1cc(C)cc(NC(=O)CCCCCCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCCCCl",
"old_substring": "C2(=O)CC(C)C"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)CC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)CCC(C)(C)C)c1 | Cc1cc(C)cc(NC(=O)CC(C)C)c1 | Cc1cc(C)cc(NC(=O)CCC(C)(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(C)(C)C",
"old_substring": "C2(=O)CC(C)C"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)CC(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NCC(C)(C)CBr)c1 | Cc1cc(C)cc(NC(=O)CC(C)C)c1 | Cc1cc(C)cc(NCC(C)(C)CBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CBr",
"old_substring": "C2(=O)CC(C)C"
} |
Can you make molecule COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COCc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COCSc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(SC(C)=O)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(SC(C)=O)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CS)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(C(=O)CS)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CI)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(OC)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | COc1cc(C(=O)CI)cc([C@H]2CC[NH+](CCC(F)(F)F)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccnc(N2CCCC[C@@H](N3CCN(C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CCN(C)CC3)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN(C)CC1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccnc(N2CCCC[C@@H](N3CC(C)C3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC(C)C3)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC(C)C1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccnc(N2CCCC[C@@H](N3C[C@@H](C)CC3=O)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3C[C@@H](C)CC3=O)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@@H](C)CC1=O",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccnc(N2CCCC[C@@H](N3CC[C@H](C)C3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[C@H](C)C3)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC[C@H](C)C1",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccnc(N2CCCC[C@@H](N3C[C@H](C#N)CC3=O)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3CC[NH+](C)CC3)C2)c1=O | CCn1ccnc(N2CCCC[C@@H](N3C[C@H](C#N)CC3=O)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H](C#N)CC1=O",
"old_substring": "N15CC[NH+](C)CC1"
} |
Can you make molecule C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@](O)(c2ccc(Cl)cc2I)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@](O)(c2ccc(Cl)cc2Br)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@](O)(c2ccc(Cl)c(I)c2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)c(I)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@](O)(c2cc(Cl)sc2Cl)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 | C[C@@H]1CCC[C@](O)(c2cc(Cl)sc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[C@](O)(c2ccc(Cl)c(Cl)c2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)s2)CC1 | C[C@@H]1CCC[C@](O)(c2ccc(Cl)c(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | C=CSOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | C=CCCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCCl)CC2 | CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCCl)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCCS)CC2 | CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCCS)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCBr)CC2 | CCOC(=O)C[C@H](C)CNC(=O)C(=O)N1CCc2ccc(C)cc21 | Cc1ccc2c(c1)N(C(=O)C(=O)NC[C@@H](C)CC(=O)OCCCBr)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC6"
} |
Can you make molecule COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COCc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COCSc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | CC(=O)Sc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | O=C(CS)c1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | COc1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | O=C(CI)c1ccccc1C[NH+]1CCC[C@H](N2CCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CCNc1ccc2c(OC)ccc(F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C)C(=S)Sc1ccc2c(OC)ccc(F)c2n1 | CCNc1ccc2c(OC)ccc(F)c2n1 | CCN(C)C(=S)Sc1ccc2c(OC)ccc(F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule CCNc1ccc2c(OC)ccc(F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(-c2ccc3c(OC)ccc(F)c3n2)c(N)o1 | CCNc1ccc2c(OC)ccc(F)c2n1 | CCc1cc(-c2ccc3c(OC)ccc(F)c3n2)c(N)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N45"
} |
Can you make molecule CCNc1ccc2c(OC)ccc(F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN=C1Sc1ccc2c(OC)ccc(F)c2n1 | CCNc1ccc2c(OC)ccc(F)c2n1 | CCN1CCN=C1Sc1ccc2c(OC)ccc(F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45"
} |
Can you make molecule CCNc1ccc2c(OC)ccc(F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCC(c2ccc3c(OC)ccc(F)c3n2)CC1 | CCNc1ccc2c(OC)ccc(F)c2n1 | CCCN1CCC(c2ccc3c(OC)ccc(F)c3n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N45"
} |
Can you make molecule CCNc1ccc2c(OC)ccc(F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(-c2ccc3c(OC)ccc(F)c3n2)c1N | CCNc1ccc2c(OC)ccc(F)c2n1 | CCc1cccc(-c2ccc3c(OC)ccc(F)c3n2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N45"
} |
Can you make molecule Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2Cl)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2Cl)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccc(I)cc2)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccc(I)cc2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CC[NH+](Cc3ccccc3)C2c2ccc(O)cc2O)cc1I | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 | Cc1ccc(C[NH+]2CC[NH+](Cc3ccccc3)C2c2ccc(O)cc2O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2cccc(Br)c2)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2cccc(Br)c2)c(O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[NH+]2CC[NH+](Cc3ccccc3)C2c2ccc(O)cc2O)c1C | Oc1ccc(C2[NH+](Cc3ccccc3)CC[NH+]2Cc2ccccc2)c(O)c1 | Cc1cccc(C[NH+]2CC[NH+](Cc3ccccc3)C2c2ccc(O)cc2O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.