prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC1([C@@H](C)C[C@@H]2CCCC[NH2+]2)C[NH+](C[C@@H]2CCCC[NH+]2C)C1 | C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C | CCC1([C@@H](C)C[C@@H]2CCCC[NH2+]2)C[NH+](C[C@@H]2CCCC[NH+]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CCCC[NH2+]1.C[NH+](C)C[C@@H]1CCCC[NH+]1C | C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C | CCC[C@@H]1CCCC[NH2+]1.C[NH+](C)C[C@@H]1CCCC[NH+]1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]&(C)C",
"old_substring": "[NH2+]23"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC1([C@@H](C)C[C@@H]2CCCC[NH2+]2)C[NH+](C[C@@H]2CCCC[NH+]2C)C1 | C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C | CCCC1([C@@H](C)C[C@@H]2CCCC[NH2+]2)C[NH+](C[C@@H]2CCCC[NH+]2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH2+]23"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CCCC[NH2+]1.C[NH+]1CCCC[C@H]1C[N+]#N | C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C | CCC[C@@H]1CCCC[NH2+]1.C[NH+]1CCCC[C@H]1C[N+]#N | 102 | {
"fragment_index": 0,
"new_substring": "[N+]&#N",
"old_substring": "[NH2+]23"
} |
Can you make molecule C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CCCC[NH2+]1.C[NH+]1CCCC[C@H]1C[NH+]1CCCC1 | C[C@@H](C[C@@H]1CCCC[NH2+]1)[NH2+]C[C@@H]1CCCC[NH+]1C | CCC[C@@H]1CCCC[NH2+]1.C[NH+]1CCCC[C@H]1C[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH2+]23"
} |
Can you make molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=S)Sc1ccccn1)NCc1ccc(F)cc1 | O=C(COc1ccccn1)NCc1ccc(F)cc1 | O=C(COC(=S)Sc1ccccn1)NCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccccn1)OCC(=O)NCc1ccc(F)cc1 | O=C(COc1ccccn1)NCc1ccc(F)cc1 | N=C(Cc1ccccn1)OCC(=O)NCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccccn1)CC(=O)NCc1ccc(F)cc1 | O=C(COc1ccccn1)NCc1ccc(F)cc1 | O=C(CCC(=O)c1ccccn1)CC(=O)NCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H](O)CCc1ccccn1)NCc1ccc(F)cc1 | O=C(COc1ccccn1)NCc1ccc(F)cc1 | O=C(C[C@H](O)CCc1ccccn1)NCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccccn1)NCc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccccn1)CC(=O)NCc1ccc(F)cc1 | O=C(COc1ccccn1)NCc1ccc(F)cc1 | O=C(/C=C/Sc1ccccn1)CC(=O)NCc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(Cl)(Cl)Cl)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(Cl)(Cl)Cl)cc2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)CC(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)CC(C)(C)C)cc2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCC(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCC(C)(C)C)cc2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCC(F)(F)F)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCC(F)(F)F)cc2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCCC(F)(F)F)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(C(C)(C)C)cc2)C[C@H](C)O1 | C[C@@H]1CN(S(=O)(=O)CC[NH2+]Cc2ccc(CCCCC(F)(F)F)cc2)C[C@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(c2ncnc3sc(-c4ccccc4)cc23)C1 | CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1CC(c2ncnc3sc(-c4ccccc4)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(C)(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1CCC(C)(c2ncnc3sc(-c4ccccc4)cc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CCC&(C)CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(-c2cc3c(C4CCCCC4)ncnc3s2)cc1 | CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 | c1ccc(-c2cc3c(C4CCCCC4)ncnc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1(C)CCC(c2ncnc3sc(-c4ccccc4)cc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | ClC1CCC(c2ncnc3sc(-c4ccccc4)cc23)CC1 | CC1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 | ClC1CCC(c2ncnc3sc(-c4ccccc4)cc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "CC1CCN5CC1"
} |
Can you make molecule C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)NN2CCC3(CCC(n4cccn4)CC3)CC2)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)NN2CCC3(CCC(n4cccn4)CC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "[C@@H]17CCCC[C@@H]18"
} |
Can you make molecule C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)Nc2cc(-n3cccn3)cc3c2CCC3(C)C)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)Nc2cc(-n3cccn3)cc3c2CCC3(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "[C@@H]17CCCC[C@@H]18"
} |
Can you make molecule C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)Nc2ccc(-n3cccn3)c3c2CCCC3)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)Nc2ccc(-n3cccn3)c3c2CCCC3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c2c1CCCC2",
"old_substring": "[C@@H]17CCCC[C@@H]18"
} |
Can you make molecule C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@H](C)C[NH+]2CCC[C@@H](C)C2)c(Cl)cc1-n1cccn1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 | Cc1cc(NC(=O)N[C@H](C)C[NH+]2CCC[C@@H](C)C2)c(Cl)cc1-n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1&",
"old_substring": "[C@@H]17CCCC[C@@H]18"
} |
Can you make molecule C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C)c(-n2cccn2)c(C)c(C)c1NC(=O)N[C@H](C)C[NH+]1CCC[C@@H](C)C1 | C[C@@H]1CCC[NH+](C[C@@H](C)NC(=O)N[C@@H]2CCCC[C@@H]2n2cccn2)C1 | Cc1c(C)c(-n2cccn2)c(C)c(C)c1NC(=O)N[C@H](C)C[NH+]1CCC[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "[C@@H]17CCCC[C@@H]18"
} |
Can you make molecule C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SC(Cl)(Cl)Cl)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(Cl)(Cl)Cl)C(=O)N1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SC(C)(C)CC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)CC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCCCC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SCCCC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCCCC(F)(F)F)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SCCCC(F)(F)F)C(=O)N1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(C)=[SH][C@@H](C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | C[C@H](SC(C)(C)C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | CCC(CC)C(C)=[SH][C@@H](C)C(=O)N1CCN(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(C[NH+](C)C)=N/ON1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | C/C(C[NH+](C)C)=N/ON1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C8C4=O"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)[NH+](C)C | C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | CCC(CC)(C(=O)CN1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C8C4=O"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)SSC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | C[NH+](C)SSC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C8C4=O"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)[NH+](C)C | C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | CCC(CC)(C(=O)CCN1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C8C4=O"
} |
Can you make molecule C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)C(=O)[NH+](C)C | C[NH+](C)CC(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1 | CC[C@@H](C(=O)N1CCN(C(=O)c2ccc(COc3ccccc3)cc2)CC1)C(=O)[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C8C4=O"
} |
Can you make molecule [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@@H](c1ccc(F)cc1)[C@H]1CSC(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@H]1CSC(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSC(=O)C1",
"old_substring": "[C@@H]12CCS(=O)(=O)C1"
} |
Can you make molecule [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CC(F)(F)CN1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CC(F)(F)CN1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC(F)(F)CN1",
"old_substring": "[C@@H]12CCS(=O)(=O)C1"
} |
Can you make molecule [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCSC1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]12CCS(=O)(=O)C1"
} |
Can you make molecule [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1C=C(O)N=N1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1C=C(O)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(O)N=N1",
"old_substring": "[C@@H]12CCS(=O)(=O)C1"
} |
Can you make molecule [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CC=CO1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CCS(=O)(=O)C1 | [NH3+]C[C@@H](c1ccc(F)cc1)[C@@H]1CC=CO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=CO1",
"old_substring": "[C@@H]12CCS(=O)(=O)C1"
} |
Can you make molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C(=N)NC(=O)N1C=C1CCC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1C=C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CCCCC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C(=N)NC(=O)N1C=C1CCCC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1C=C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1SCCCS1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1SCSCS1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1CC1 | CC(C)C[C@@H]1C(=N)NC(=O)N1CC1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCN(N)C[C@H]1S(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H]1CCN(N)C[C@H]1S(=O)(=O)C1CCS(=O)(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&C[C@H]1&",
"old_substring": "C[C@@H]2CCC[NH3+]"
} |
Can you make molecule C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](N)CCS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](N)CCS(=O)(=O)C1CCS(=O)(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]2CCC[NH3+]"
} |
Can you make molecule C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](N)CC(C)(C)S(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@@H](N)CC(C)(C)S(=O)(=O)C1CCS(=O)(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]2CCC[NH3+]"
} |
Can you make molecule C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](N)[C@H](C)CS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](N)[C@H](C)CS(=O)(=O)C1CCS(=O)(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@@H]2CCC[NH3+]"
} |
Can you make molecule C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN)CC(=O)S(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@H](CCC[NH3+])NS(=O)(=O)C1CCS(=O)(=O)CC1 | C[C@@H](CCN)CC(=O)S(=O)(=O)C1CCS(=O)(=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]2CCC[NH3+]"
} |
Can you make molecule O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CCN(S(=O)(=O)c2cccs2)CC1)NCc1cccc(Cl)c1 | O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(/C=C/SC1CCN(S(=O)(=O)c2cccs2)CC1)NCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2cccc(Cl)c2)nc1C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 | O=Cc1sc(NCc2cccc(Cl)c2)nc1C1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2cccc(Cl)c2)sc1C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 | O=Cc1nc(NCc2cccc(Cl)c2)sc1C1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cccc(Cl)c1)N/N=C/CC1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NCc1cccc(Cl)c1)N/N=C/CC1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCc2cccc(Cl)c2)CCC1=C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C(NCc1cccc(Cl)c1)C1CCN(S(=O)(=O)c2cccs2)CC1 | O=C1C(=NCc2cccc(Cl)c2)CCC1=C1CCN(S(=O)(=O)c2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C36"
} |
Can you make molecule Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(S[C@H](C)C(C)(C)CN2CCOCC2)n1C | Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C | Cc1nnc(S[C@H](C)C(C)(C)CN2CCOCC2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(S[C@H](CCl)CCCN2CCOCC2)n1C | Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C | Cc1nnc(S[C@H](CCl)CCCN2CCOCC2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(S[C@@H]2C=C(CN3CCOCC3)N=N2)n1C | Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C | Cc1nnc(S[C@@H]2C=C(CN3CCOCC3)N=N2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(S[C@]2(C)CCCN(N3CCOCC3)C2)n1C | Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C | Cc1nnc(S[C@]2(C)CCCN(N3CCOCC3)C2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(C)CCCN&C1",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(S[C@@H](CBr)CCN2CCOCC2)n1C | Cc1nnc(S[C@H](C)C(=O)N2CCOCC2)n1C | Cc1nnc(S[C@@H](CBr)CCN2CCOCC2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@@H]4(C)C3=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C[S@+]([O-])CCCC(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1C[S@+]([O-])CCCC(=O)Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C4S2(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H](C)S(=O)(=O)CNc1ccc(F)c(F)c1 | Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1[C@@H](C)S(=O)(=O)CNc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&S(=O)(=O)C&",
"old_substring": "C4S2(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C[S@@+]([O-])CCCC(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1C[S@@+]([O-])CCCC(=O)Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@@](=O)CCCC&=O",
"old_substring": "C4S2(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1cccc(C)c1S(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1-c1cccc(C)c1S(=O)(=O)Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1S&(=O)=O",
"old_substring": "C4S2(=O)=O"
} |
Can you make molecule Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C(=O)CCCC(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1CS(=O)(=O)Nc1ccc(F)c(F)c1 | Cc1ccccc1C(=O)CCCC(=O)Nc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4S2(=O)=O"
} |
Can you make molecule C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH+]1CCC(Cc2cnc(Cl)s2)CC1)C(C)(C)C | C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C | C[C@H]([NH+]1CCC(Cc2cnc(Cl)s2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH+]1Cc2cc(Cc3cnc(Cl)s3)sc2C1)C(C)(C)C | C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C | C[C@H]([NH+]1Cc2cc(Cc3cnc(Cl)s3)sc2C1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH+]1CCc2nc(Cc3cnc(Cl)s3)sc2C1)C(C)(C)C | C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C | C[C@H]([NH+]1CCc2nc(Cc3cnc(Cl)s3)sc2C1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2nc&sc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([NH+]1CCc2sc(Cc3cnc(Cl)s3)cc2C1)C(C)(C)C | C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C | C[C@H]([NH+]1CCc2sc(Cc3cnc(Cl)s3)cc2C1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2sc&cc2C1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[NH+]1CCC(Cc2cnc(Cl)s2)CC1)C(C)(C)C | C[C@H]([NH+](C)Cc1cnc(Cl)s1)C(C)(C)C | C[C@H](C[NH+]1CCC(Cc2cnc(Cl)s2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]23C"
} |
Can you make molecule C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(C)(C)CC[C@@H]1NSC(=O)Cc1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NSC(=O)Cc1cnc([C@@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CCCC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CCCC(=O)c1cnc([C@@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CC(C)(C)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CC(C)(C)c1cnc([C@@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CCC(C)(C)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)CCC(C)(C)c1cnc([C@@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@H]1CCC(C)(C)C[C@H]1C)c1cnc([C@@H]2CCCO2)s1 | C[C@@H]1CC(C)(C)CC[C@@H]1NC(=O)c1cnc([C@@H]2CCCO2)s1 | C[C@H](C(=O)SN[C@H]1CCC(C)(C)C[C@H]1C)c1cnc([C@@H]2CCCO2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | COCc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | COCSc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | CC(=O)Sc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CNC(=O)Nc1ccc(C(=O)CS)c(Cl)c1 | COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | O=C([O-])CNC(=O)Nc1ccc(C(=O)CS)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CNC(=O)Nc1ccc(C(=O)CI)c(Cl)c1 | COc1ccc(NC(=O)NCC(=O)[O-])cc1Cl | O=C([O-])CNC(=O)Nc1ccc(C(=O)CI)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(SC(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(SC(F)(F)F)[nH]n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CCCC(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CCCC(F)(F)F)[nH]n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CCCCC(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CCCCC(F)(F)F)[nH]n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)C(F)(F)F)[nH]n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CC(F)(F)C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(C(F)(F)F)[nH]n3)C2)n1 | Cc1nccc(C(=O)N2CCC[C@@H](c3cc(CC(F)(F)C(F)(F)F)[nH]n3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CN(C(=O)CC(C)(C)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)CC(C)(C)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CN(C(=O)CCC(C)(C)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)CCC(C)(C)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CN(C(=O)C[C@@H](Br)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(C(=O)C[C@@H](Br)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CN(c2cc(C)n(Nc3cccc(S(C)(=O)=O)c3C)c(=O)c2)CCO1 | CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(c2cc(C)n(Nc3cccc(S(C)(=O)=O)c3C)c(=O)c2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CN(c2c(C)n(Nc3cccc(S(C)(=O)=O)c3C)ccc2=O)CCO1 | CCC[C@H]1CN(C(=O)Nc2cccc(S(C)(=O)=O)c2C)CCO1 | CCC[C@H]1CN(c2c(C)n(Nc3cccc(S(C)(=O)=O)c3C)ccc2=O)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Cl)cc(N[C@@H](CCc2noc(C)n2)C(C)C)n1 | CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 | Cc1nc(Cl)cc(N[C@@H](CCc2noc(C)n2)C(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]24"
} |
Can you make molecule CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1noc(C)n1)Nc1cc(Cl)nc(C)n1 | CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 | CCC[C@@H](CCc1noc(C)n1)Nc1cc(Cl)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC[C@@H]24"
} |
Can you make molecule CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Cl)cc(N=CCC[C@@H](C)Cc2noc(C)n2)n1 | CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 | Cc1nc(Cl)cc(N=CCC[C@@H](C)Cc2noc(C)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "CC[C@@H]24"
} |
Can you make molecule CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(Cl)cc(NCCC2=CCC[C@@H]2c2noc(C)n2)n1 | CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 | Cc1nc(Cl)cc(NCCC2=CCC[C@@H]2c2noc(C)n2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]24"
} |
Can you make molecule CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1noc(C)n1)Nc1cc(Cl)nc(C)n1 | CC[C@@H](Nc1cc(Cl)nc(C)n1)c1noc(C)n1 | CCCC[C@@H](CCc1noc(C)n1)Nc1cc(Cl)nc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC[C@@H]24"
} |
Can you make molecule O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1cccn1-c1ccc(F)cc1Cl)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1Cl)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1cccn1-c1ccc(F)cc1Br)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1Br)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1cccn1-c1ccc(F)c(Cl)c1)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)c(Cl)c1)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1cccn1-c1ccc(I)cc1F)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 | O=C(N/N=C/c1cccn1-c1ccc(I)cc1F)c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]ncc2cccn2c2cc1c(F)cccc(-c1ccncc1)s2 | O=C(N/N=C/c1cccn1-c1ccc(F)cc1)c1ccncc1 | O=c1[nH]ncc2cccn2c2cc1c(F)cccc(-c1ccncc1)s2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c13ccc(F)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.