prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C[NH+]2CCC(C3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(C[NH+]2CCC(C3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]45C"
} |
Can you make molecule C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(CC[NH+](C)CC2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(CC[NH+](C)CC2CCC(c3ccc(O)cc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+](C&)C&",
"old_substring": "[NH+]45C"
} |
Can you make molecule C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(CC[NH+]2CCC(C3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(CC[NH+]2CCC(C3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]45C"
} |
Can you make molecule C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C[NH+]2CC=C(CC3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(C[NH+]2CC=C(CC3CCC(c4ccc(O)cc4)CC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]45C"
} |
Can you make molecule C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C[NH+]2Cc3cc(C4CCC(c5ccc(O)cc5)CC4)sc3C2)CC1 | C[NH+]1CCC(C[NH+](C)C2CCC(c3ccc(O)cc3)CC2)CC1 | C[NH+]1CCC(C[NH+]2Cc3cc(C4CCC(c5ccc(O)cc5)CC4)sc3C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]45C"
} |
Can you make molecule COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COCc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COCSc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1SC(C)=O | COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1C(=O)CS | COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1C(=O)CI | COc1ccc(-c2nnc3sc(-c4ccccc4Cl)nn23)cc1OC | COc1cc(-c2nnc3sc(-c4ccccc4Cl)nn23)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CNSC(=O)Cc2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNSC(=O)Cc2cccc(C(F)(F)F)c2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CNC(=O)CCCC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)CCCC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CNC(=O)CC(C)(C)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)CC(C)(C)c2cccc(C(F)(F)F)c2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CNC(=O)CCC(C)(C)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | Cn1c(CNC(=O)CCC(C)(C)c2cccc(C(F)(F)F)c2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNCc1nc2ccccc2n1C)c1cccc(C(F)(F)F)c1 | Cn1c(CNC(=O)c2cccc(C(F)(F)F)c2)nc2ccccc21 | C[C@H](C(=O)SNCc1nc2ccccc2n1C)c1cccc(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1ccc(Cl)cc1Cl)CC(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@@H](CCOc1ccc(Cl)cc1Cl)CC(=O)Nc1ccc(N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOc1ccc(Cl)cc1Cl)CC(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@H](CCOc1ccc(Cl)cc1Cl)CC(=O)Nc1ccc(N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNc1ccc(N2CCOCC2)cc1)Oc1ccc(Cl)cc1Cl | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@@H](CCNc1ccc(N2CCOCC2)cc1)Oc1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)Nc1ccc(N2CCOCC2)cc1)Oc1ccc(Cl)cc1Cl | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@H](CC(C)(C)Nc1ccc(N2CCOCC2)cc1)Oc1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(Oc2ccc(Cl)cc2Cl)O[C@@H](Nc2ccc(N3CCOCC3)cc2)CS1 | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(N2CCOCC2)cc1 | C[C@@]1(Oc2ccc(Cl)cc2Cl)O[C@@H](Nc2ccc(N3CCOCC3)cc2)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&O[C@@H]&CS1",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc2c1nc([C@@H](CCl)C(C)C)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](CCl)C(C)C)n2[C@H](C)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)C(C)C",
"old_substring": "[C@H]5(C)Cl"
} |
Can you make molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc2c1nc([C@](C)(Cl)Br)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@](C)(Cl)Br)n2[C@H](C)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@]&(C)(Cl)Br",
"old_substring": "[C@H]5(C)Cl"
} |
Can you make molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc2c1nc([C@@H](Cl)C(F)(F)F)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](Cl)C(F)(F)F)n2[C@H](C)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Cl)C(F)(F)F",
"old_substring": "[C@H]5(C)Cl"
} |
Can you make molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc2c1nc([C@@H](C)CCC(C)(C)C)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)CCC(C)(C)C)n2[C@H](C)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@H]5(C)Cl"
} |
Can you make molecule COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ncnc2c1nc([C@H]1CCCC1(C)C)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@@H](C)Cl)n2[C@H](C)C(N)=O | COc1ncnc2c1nc([C@H]1CCCC1(C)C)n2[C@H](C)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]5(C)Cl"
} |
Can you make molecule C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)c1ccc(F)cc1)NSC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NSC(=O)C=C1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C=5"
} |
Can you make molecule C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C1=C(N=C2CCSCC2)CCS1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C1=C(N=C2CCSCC2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C2(=O)C=5"
} |
Can you make molecule C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C(N=C1CCSCC1)=C(Cl)Cl | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C(N=C1CCSCC1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C2(=O)C=5"
} |
Can you make molecule C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C(C=C1CCSCC1)=C(Cl)Cl | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C(C=C1CCSCC1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C2(=O)C=5"
} |
Can you make molecule C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(=O)c1ccc(F)cc1)NC[S@+]([O-])CCC=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC(=O)C=C1CCSCC1 | C[C@@H](CC(=O)c1ccc(F)cc1)NC[S@+]([O-])CCC=C1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C=5"
} |
Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1csc(-c2ccsc2)n1)Nc1ccccc1F | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | O=C(/C=C/Sc1csc(-c2ccsc2)n1)Nc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2csc(-c3ccsc3)n2)CC1)Nc1ccccc1F | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | O=C(NN=C1CCC(c2csc(-c3ccsc3)n2)CC1)Nc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1ccccc1F)C(=O)Sc1csc(-c2ccsc2)n1 | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | C/C(=N\ONc1ccccc1F)C(=O)Sc1csc(-c2ccsc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1F)C1=CC[C@H](c2csc(-c3ccsc3)n2)S1 | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | O=C(Nc1ccccc1F)C1=CC[C@H](c2csc(-c3ccsc3)n2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-c2csc(-c3ccsc3)n2)cc1)Nc1ccccc1F | O=C(Cc1csc(-c2ccsc2)n1)Nc1ccccc1F | O=C(NN=Cc1ccc(-c2csc(-c3ccsc3)n2)cc1)Nc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C5"
} |
Can you make molecule CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CSC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)NNC&=O",
"old_substring": "C2C(=O)NNC3=O"
} |
Can you make molecule CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CSCC(=O)NNC(=O)CCCc1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)CCCc1c(O)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=O)NNC(=O)CCC&",
"old_substring": "C2C(=O)NNC3=O"
} |
Can you make molecule CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CSC(=O)NNCc1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSC(=O)NNCc1c(O)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)NNC&",
"old_substring": "C2C(=O)NNC3=O"
} |
Can you make molecule CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CSCCS(=O)(=O)c1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSCCS(=O)(=O)c1c(O)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CS&(=O)=O",
"old_substring": "C2C(=O)NNC3=O"
} |
Can you make molecule CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CSC(=O)NOc1c(O)cc(Cl)cc1Cl | CSCC(=O)NNC(=O)c1c(O)cc(Cl)cc1Cl | CSC(=O)NOc1c(O)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)NO&",
"old_substring": "C2C(=O)NNC3=O"
} |
Can you make molecule CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H](COC)[C@H]1CN(C2(C)CCCC2)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C2(C)CCCC2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C5(C)C"
} |
Can you make molecule CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H](COC)[C@H]1CN(C(Cl)(Cl)Cl)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(Cl)(Cl)Cl)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)C"
} |
Can you make molecule CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)(C)CCC)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)(C)CCC)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C5(C)C"
} |
Can you make molecule CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)(CC)CC)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)(CC)CC)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C5(C)C"
} |
Can you make molecule CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H](COC)[C@H]1CN(C2(C=O)CCCCCC2)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C(C)C)CCO1 | CCC[NH2+][C@@H](COC)[C@H]1CN(C2(C=O)CCCCCC2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C5(C)C"
} |
Can you make molecule C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)c(F)c1)NSC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NSC(=O)Cc1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CCCC(=O)c1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CCCC(=O)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CC(C)(C)c1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CC(C)(C)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)c(F)c1)NC[S@+]([O-])CCCc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC[S@+]([O-])CCCc1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C4"
} |
Can you make molecule C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CCC(C)(C)c1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)Cc1ccc[nH]1 | C[C@H](CCc1ccc(F)c(F)c1)NC(=O)CCC(C)(C)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)C4"
} |
Can you make molecule CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1ccc(Cl)cc1)C1CCN(c2ccccc2)CC1 | CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 | O=C(CNc1ccc(Cl)cc1)C1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CNc1ccc(Cl)cc1)C(=S)Sc1ccccc1 | CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 | CN(C(=O)CNc1ccc(Cl)cc1)C(=S)Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN24"
} |
Can you make molecule CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1ccc(Cl)cc1)CN1CCC(c2ccccc2)CC1 | CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 | O=C(CNc1ccc(Cl)cc1)CN1CCC(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1ccc(Cl)cc1)N1CSC(=S)N(c2ccccc2)C1 | CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 | O=C(CNc1ccc(Cl)cc1)N1CSC(=S)N(c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN24"
} |
Can you make molecule CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)CNc2ccc(Cl)cc2)CCC(c2ccccc2)CC1 | CN(C(=O)CNc1ccc(Cl)cc1)c1ccccc1 | N#CC1(C(=O)CNc2ccc(Cl)cc2)CCC(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule COc1cccc(Sc2cc(C)ccc2N)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(Sc2cc(C)ccc2N)c1 | COc1cccc(Sc2cc(C)ccc2N)c1 | COCc1cccc(Sc2cc(C)ccc2N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(Sc2cc(C)ccc2N)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(Sc2cc(C)ccc2N)c1 | COc1cccc(Sc2cc(C)ccc2N)c1 | COCSc1cccc(Sc2cc(C)ccc2N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(Sc2cc(C)ccc2N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(Sc2cc(C)ccc2N)c1 | COc1cccc(Sc2cc(C)ccc2N)c1 | CC(=O)Sc1cccc(Sc2cc(C)ccc2N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(Sc2cc(C)ccc2N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N)c(Sc2cccc(C(=O)CS)c2)c1 | COc1cccc(Sc2cc(C)ccc2N)c1 | Cc1ccc(N)c(Sc2cccc(C(=O)CS)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(Sc2cc(C)ccc2N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N)c(Sc2cccc(C(=O)CI)c2)c1 | COc1cccc(Sc2cc(C)ccc2N)c1 | Cc1ccc(N)c(Sc2cccc(C(=O)CI)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NN(c2ccccc2)C(=O)C1(N1CCCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NN(c2ccccc2)C(=O)C1(N1CCCCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCCCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCSCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NN(c2ccccc2)C(=O)C1(N1CC=CC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CC=CC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NN(c2ccccc2)C(=O)C1(SSN1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(N1CCOCC1)N1CCOCC1 | CC1=NN(c2ccccc2)C(=O)C1(SSN1CCOCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N13CCOCC1"
} |
Can you make molecule COc1ccc(NC(=O)C=CC2CC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC(=O)C=CC2CC2)c(C)c1 | COc1ccc(NC(=O)C=CC2CC2)c(C)c1 | COCc1ccc(NC(=O)C=CC2CC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)C=CC2CC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC(=O)C=CC2CC2)c(C)c1 | COc1ccc(NC(=O)C=CC2CC2)c(C)c1 | COCSc1ccc(NC(=O)C=CC2CC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)C=CC2CC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(NC(=O)C=CC2CC2)c(C)c1 | COc1ccc(NC(=O)C=CC2CC2)c(C)c1 | CC(=O)Sc1ccc(NC(=O)C=CC2CC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)C=CC2CC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)CS)ccc1NC(=O)C=CC1CC1 | COc1ccc(NC(=O)C=CC2CC2)c(C)c1 | Cc1cc(C(=O)CS)ccc1NC(=O)C=CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(NC(=O)C=CC2CC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)CI)ccc1NC(=O)C=CC1CC1 | COc1ccc(NC(=O)C=CC2CC2)c(C)c1 | Cc1cc(C(=O)CI)ccc1NC(=O)C=CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCCC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1=O",
"old_substring": "N15CCNC1=O"
} |
Can you make molecule O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCC2)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC1",
"old_substring": "N15CCNC1=O"
} |
Can you make molecule O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCCCCC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCCCCC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N15CCNC1=O"
} |
Can you make molecule O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCOC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCOC2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCOC1=O",
"old_substring": "N15CCNC1=O"
} |
Can you make molecule O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCNC2=S)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCNC2=O)C1 | O=C(CCCn1cncn1)N1CCC[C@@H](N2CCCNC2=S)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCNC1=S",
"old_substring": "N15CCNC1=O"
} |
Can you make molecule Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n2nc(CC(=O)NCSCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCSCc3nc(C)c(C)s3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n2nc(CC(=O)NC(=N)SCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)NC(=N)SCc3nc(C)c(C)s3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n2nc(CC(=O)c3nsc(Cc4nc(C)c(C)s4)c3N)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)c3nsc(Cc4nc(C)c(C)s4)c3N)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n2nc(CC(=O)N(C)C(=S)SCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)N(C)C(=S)SCc3nc(C)c(C)s3)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n2nc(CC(=O)c3ccc(Cc4nc(C)c(C)s4)n3N)nc2n1 | Cc1cc(C)n2nc(CC(=O)NCc3nc(C)c(C)s3)nc2n1 | Cc1cc(C)n2nc(CC(=O)c3ccc(Cc4nc(C)c(C)s4)n3N)nc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N45"
} |
Can you make molecule CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCS[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | COCS[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)S[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | CC(=O)S[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1CCC(=O)O[C@H]1CCC[C@@H](C(=O)CI)C1 | CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | Cc1nn(C)c(C)c1CCC(=O)O[C@H]1CCC[C@@H](C(=O)CI)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(C)c1CCC(=O)O[C@H]1CCC[C@@H](C(=O)CBr)C1 | CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | Cc1nn(C)c(C)c1CCC(=O)O[C@H]1CCC[C@@H](C(=O)CBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CBr",
"old_substring": "CO4"
} |
Can you make molecule CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCC[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | CO[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | CON(C)CCC[C@@H]1CCC[C@H](OC(=O)CCc2c(C)nn(C)c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO4"
} |
Can you make molecule CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C#N)C(C)C)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C#N)C(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C#N)C(C)C",
"old_substring": "[C@H]5(C)[C@H](C)CO"
} |
Can you make molecule CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)CCC(C)(C)C)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)CCC(C)(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@H]5(C)[C@H](C)CO"
} |
Can you make molecule CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](CCl)C(C)C)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](CCl)C(C)C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)C(C)C",
"old_substring": "[C@H]5(C)[C@H](C)CO"
} |
Can you make molecule CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)C(F)(F)F)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)C(F)(F)F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)C(F)(F)F",
"old_substring": "[C@H]5(C)[C@H](C)CO"
} |
Can you make molecule CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](Cl)C(F)(F)F)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](C)[C@H](C)CO)cc1C | CC(=O)Nc1c(C)cc(NC(=O)N[C@@H](Cl)C(F)(F)F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Cl)C(F)(F)F",
"old_substring": "[C@H]5(C)[C@H](C)CO"
} |
Can you make molecule O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@H]1CCCN(C(=O)c2ccccc2F)C1)Nc1nccs1 | O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=C(/C=C/S[C@H]1CCCN(C(=O)c2ccccc2F)C1)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2nccs2)nc1[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=Cc1sc(Nc2nccs2)nc1[C@H]1CCCN(C(=O)c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2nccs2)sc1[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=Cc1nc(Nc2nccs2)sc1[C@H]1CCCN(C(=O)c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/C[C@H]1CCCN(C(=O)c2ccccc2F)C1)Nc1nccs1 | O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=C(N/N=C/C[C@H]1CCCN(C(=O)c2ccccc2F)C1)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1F)N1CCC[C@H](N2CCC(=NONc3nccs3)CC2)C1 | O=C(Nc1nccs1)[C@H]1CCCN(C(=O)c2ccccc2F)C1 | O=C(c1ccccc1F)N1CCC[C@H](N2CCC(=NONc3nccs3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C36"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(I)o1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(I)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c16ccco1"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(Br)o1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c16ccco1"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(Cl)o1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccc(Cl)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c16ccco1"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1occc1Br | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1occc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c16ccco1"
} |
Can you make molecule O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1CN1C[C@@H](C(=O)N2CCC[C@H]2c2cccs2)CC1=O | O=C1C[C@H](C(=O)N2CCC[C@H]2c2cccs2)CN1Cc1ccco1 | Cc1ccsc1CN1C[C@@H](C(=O)N2CCC[C@H]2c2cccs2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c16ccco1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.