prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COCSC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | CC(=O)SC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | CON(C)CCCC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | CC(=O)CCCC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCBr)C(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | COC(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | O=C(CCBr)C(=O)[C@H](Cc1ccc(O)cc1)Nc1ncnc2sc3c(c12)CCNC3 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1I | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)ccc1Br | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 | COc1cc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1Cl | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)c1Br | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 | COc1cccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)c1Cl | COc1ccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)cc1 | COc1cccc(N2CCN(C(=O)COC(=O)c3ccc(C)c(C)c3)CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17ccc8cc1"
} |
Can you make molecule C[NH2+]C[C@H](C)[C@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C[C@H](C)[C@H](C)n1cc(I)cn1 | C[NH2+]C[C@H](C)[C@H](C)n1cccn1 | C[NH2+]C[C@H](C)[C@H](C)n1cc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n13cccn1"
} |
Can you make molecule C[NH2+]C[C@H](C)[C@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C=Cn1cc([C@@H](C)[C@@H](C)C[NH2+]C)cn1 | C[NH2+]C[C@H](C)[C@H](C)n1cccn1 | C=Cn1cc([C@@H](C)[C@@H](C)C[NH2+]C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=Cn1cc&cn1",
"old_substring": "n13cccn1"
} |
Can you make molecule C[NH2+]C[C@H](C)[C@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C[C@H](C)[C@H](C)n1cc(C)c(I)n1 | C[NH2+]C[C@H](C)[C@H](C)n1cccn1 | C[NH2+]C[C@H](C)[C@H](C)n1cc(C)c(I)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(C)c(I)n1",
"old_substring": "n13cccn1"
} |
Can you make molecule C[NH2+]C[C@H](C)[C@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C[C@H](C)[C@H](C)n1ccsc1=O | C[NH2+]C[C@H](C)[C@H](C)n1cccn1 | C[NH2+]C[C@H](C)[C@H](C)n1ccsc1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccsc1=O",
"old_substring": "n13cccn1"
} |
Can you make molecule C[NH2+]C[C@H](C)[C@H](C)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C[C@H](C)[C@H](C)n1nc(C)cc1C | C[NH2+]C[C@H](C)[C@H](C)n1cccn1 | C[NH2+]C[C@H](C)[C@H](C)n1nc(C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&nc(C)cc1C",
"old_substring": "n13cccn1"
} |
Can you make molecule NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CSCSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)CSCSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S46"
} |
Can you make molecule NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN1CCSc2ccc(-c3ncc4c(n3)-c3ccccc3N(Cc3ccccc3)S4(=O)=O)cc21 | NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)CN1CCSc2ccc(-c3ncc4c(n3)-c3ccccc3N(Cc3ccccc3)S4(=O)=O)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S46"
} |
Can you make molecule NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CC[S@@+]([O-])C(Cl)(Cl)c1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)CC[S@@+]([O-])C(Cl)(Cl)c1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S46"
} |
Can you make molecule NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | N#C/C(Nc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O)=C(/Cl)SCC(N)=O | NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | N#C/C(Nc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O)=C(/Cl)SCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S46"
} |
Can you make molecule NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)Cn1c(=S)n(-c2ncc3c(n2)-c2ccccc2N(Cc2ccccc2)S3(=O)=O)c2ccccc21 | NC(=O)CSc1ncc2c(n1)-c1ccccc1N(Cc1ccccc1)S2(=O)=O | NC(=O)Cn1c(=S)n(-c2ncc3c(n2)-c2ccccc2N(Cc2ccccc2)S3(=O)=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S46"
} |
Can you make molecule C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCNSC(=O)C[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNSC(=O)C[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCNCC(=C=O)C[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNCC(=C=O)C[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCNC(=O)CCCC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)CCCC(=O)[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCNC(=O)CC(C)(C)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)CC(C)(C)[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCNC[S@+]([O-])CCC[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC(=O)[C@H]1COc2ccc(F)cc2C1 | C#CCCCCNC[S@+]([O-])CCC[C@H]1COc2ccc(F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule NNc1nnc(SC2CCCCC2)n1N less soluble in water? The output molecule should be similar to the input molecule. | NNc1nnc(SC2CCCCCCC2)n1N | NNc1nnc(SC2CCCCC2)n1N | NNc1nnc(SC2CCCCCCC2)n1N | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule NNc1nnc(SC2CCCCC2)n1N less soluble in water? The output molecule should be similar to the input molecule. | NNc1nnc(SSC2=CCCCCC2)n1N | NNc1nnc(SC2CCCCC2)n1N | NNc1nnc(SSC2=CCCCCC2)n1N | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule NNc1nnc(SC2CCCCC2)n1N less soluble in water? The output molecule should be similar to the input molecule. | NNc1nnc(SC2CCCCCCCCCCC2)n1N | NNc1nnc(SC2CCCCC2)n1N | NNc1nnc(SC2CCCCCCCCCCC2)n1N | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule NNc1nnc(SC2CCCCC2)n1N less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Sc2nnc(NN)n2N)CCCCCCC1 | NNc1nnc(SC2CCCCC2)n1N | N#CC1(Sc2nnc(NN)n2N)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C14CCCCC1"
} |
Can you make molecule NNc1nnc(SC2CCCCC2)n1N less soluble in water? The output molecule should be similar to the input molecule. | NNc1nnc(SC2C3=CC=CC=C2CCCC3)n1N | NNc1nnc(SC2CCCCC2)n1N | NNc1nnc(SC2C3=CC=CC=C2CCCC3)n1N | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C14CCCCC1"
} |
Can you make molecule COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)SN2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(CC(=O)SN2CCN(Cc3ccc(F)cc3)CC2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CCCC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)CCCC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)(C)CC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(C)(C)CC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)(C)CCC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(C)(C)CCC(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)C(=O)SN2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc(C(=O)N2CCN(Cc3ccc(F)cc3)CC2)ccc1C | COc1cc([C@H](C)C(=O)SN2CCN(Cc3ccc(F)cc3)CC2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccc2cn[nH]c12)[C@@H](C)CO | C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C | C[C@H](Cc1cccc2cn[nH]c12)[C@@H](C)CO | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@@H](C)CO",
"old_substring": "C[C@H]1[C@@H](C)SCC[NH+]13"
} |
Can you make molecule C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCN1Cc1cccc2cn[nH]c12 | C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C | C[C@H]1CCCCN1Cc1cccc2cn[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCN1&",
"old_substring": "C[C@H]1[C@@H](C)SCC[NH+]13"
} |
Can you make molecule C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H](Cc2cccc3cn[nH]c23)CN1C | C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C | C[C@H]1C[C@@H](Cc2cccc3cn[nH]c23)CN1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@@H]&CN1C",
"old_substring": "C[C@H]1[C@@H](C)SCC[NH+]13"
} |
Can you make molecule C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1SCCC[C@@H]1Cc1cccc2cn[nH]c12 | C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C | C[C@H]1SCCC[C@@H]1Cc1cccc2cn[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "C[C@H]1[C@@H](C)SCC[NH+]13"
} |
Can you make molecule C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@H](Cc2cccc3cn[nH]c23)CCN1C | C[C@H]1SCC[NH+](Cc2cccc3cn[nH]c23)[C@H]1C | C[C@H]1C[C@H](Cc2cccc3cn[nH]c23)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@H]&CCN1C",
"old_substring": "C[C@H]1[C@@H](C)SCC[NH+]13"
} |
Can you make molecule CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@H]1CCC[C@@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 | CN[C@@H]1CCC[C@@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]234"
} |
Can you make molecule CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@H]1CC[C@@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 | CN[C@H]1CC[C@@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@@H]234"
} |
Can you make molecule CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@H]1CC[C@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 | CN[C@H]1CC[C@](c2cc(C)c[nH+]c2N)([C@@H]2CSCCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@@H]234"
} |
Can you make molecule CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@H](CCC[C@@H]1CSCCO1)C(C)(C)c1cc(C)c[nH+]c1N | CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 | CN[C@@H](CCC[C@@H]1CSCCO1)C(C)(C)c1cc(C)c[nH+]c1N | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@@H]234"
} |
Can you make molecule CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CNCC[C@H](C[C@@H]1CSCCO1)C(=O)c1cc(C)c[nH+]c1N | CN[C@@H](c1cc(C)c[nH+]c1N)[C@@H]1CSCCO1 | CNCC[C@H](C[C@@H]1CSCCO1)C(=O)c1cc(C)c[nH+]c1N | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "[C@@H]234"
} |
Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(n2c(C[NH+]3CCCCCC3)nc3cc(NC(=O)C(C)C)ccc32)C1 | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CC1CC(n2c(C[NH+]3CCCCCC3)nc3cc(NC(=O)C(C)C)ccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CC(C)CCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc2c(c1)nc(C[NH+]1CCCCCC1)n2CCCCBr | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CC(C)C(=O)Nc1ccc2c(c1)nc(C[NH+]1CCCCCC1)n2CCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | C=CCCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)Nc1ccc2c(c1)nc(C[NH+]1CCCCCC1)n2CCCCCl | CCCn1c(C[NH+]2CCCCCC2)nc2cc(NC(=O)C(C)C)ccc21 | CC(C)C(=O)Nc1ccc2c(c1)nc(C[NH+]1CCCCCC1)n2CCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CC(C)=NC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC5"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | C=CSNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=NC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CC(I)=NC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC5"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | C=CCCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NNc1ccc(Cl)nn1)Nc1cccc(C(=O)N=CCCl)c1 | CCNC(=O)c1cccc(NC(=O)NNc2ccc(Cl)nn2)c1 | O=C(NNc1ccc(Cl)nn1)Nc1cccc(C(=O)N=CCCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC5"
} |
Can you make molecule CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(N[C@H]2CCCC2(C)C)c(N)c1 | CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N | CC(=O)c1ccc(N[C@H]2CCCC2(C)C)c(N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Nc1ccc(CCCCC(N)=O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(CCCCC(N)=O)cc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Nc1ccc(CC/C(N)=N/O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(CC/C(N)=N/O)cc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Nc1ccc(CC/C(N)=N\O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(CC/C(N)=N\O)cc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Nc1ccc(CC(N)=S)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(C(N)=O)cc1N | CC1(C)CCC[C@@H]1Nc1ccc(CC(N)=S)cc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C4(N)=O"
} |
Can you make molecule CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCc1ccc(CCS(=O)(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(CCS(=O)(=O)[O-])o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCc1ccc(C(=O)CO)o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)CO)o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCc1ccc(C(O)O)o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(O)O)o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCc1ccc(C(CC)(CC)C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(CC)(CC)C(=O)[O-])o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NCc1ccc(CCCS(=O)(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(C(=O)[O-])o1)c1ccccc1 | CC[C@H](C(=O)NCc1ccc(CCCS(=O)(=O)[O-])o1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCN(C(=O)CC(C)(C)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)CC(C)(C)NCc2ccnc(OC3CCC3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCN(C(=O)CCC(C)(C)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)CCC(C)(C)NCc2ccnc(OC3CCC3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCN(C(=O)C[C@@H](Br)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(C(=O)C[C@@H](Br)NCc2ccnc(OC3CCC3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCN(c2cc(C)n(NCc3ccnc(OC4CCC4)c3)c(=O)c2)CC1 | COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(c2cc(C)n(NCc3ccnc(OC4CCC4)c3)c(=O)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCN(c2c(C)n(NCc3ccnc(OC4CCC4)c3)ccc2=O)CC1 | COC1CCN(C(=O)NCc2ccnc(OC3CCC3)c2)CC1 | COC1CCN(c2c(C)n(NCc3ccnc(OC4CCC4)c3)ccc2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cc2I)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cc2I)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(Cl)cn1"
} |
Can you make molecule COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)s2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)s2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17ccc(Cl)cn1"
} |
Can you make molecule COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cc2Br)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cc2Br)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)cn1"
} |
Can you make molecule COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N[C@H](C)C(=O)Nc2cc3c(Cl)cccc3n2C)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2cc3c(Cl)cccc3n2C)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(Cl)cccc2n1C",
"old_substring": "c17ccc(Cl)cn1"
} |
Can you make molecule COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)c3ncccc23)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)cn2)cc(OC)c1 | COc1cc(N[C@H](C)C(=O)Nc2ccc(Cl)c3ncccc23)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c2ncccc12",
"old_substring": "c17ccc(Cl)cn1"
} |
Can you make molecule O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1cc(I)ccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1cc(I)ccc1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1cc(Br)ccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1cc(Br)ccc1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1sc2sccc2c1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1sc2sccc2c1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1sc2ccccc2c1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1sc2ccccc2c1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNc1cc(Br)c(F)cc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1ccccc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(CNc1cc(Br)c(F)cc1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1ccc(C(F)(F)F)cc1I | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1ccc(C(F)(F)F)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c13cccc4c1"
} |
Can you make molecule C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cc(C(F)(F)F)ccc1Br | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cc(C(F)(F)F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c13cccc4c1"
} |
Can you make molecule C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1ccc(C(F)(F)F)cc1Cl | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1ccc(C(F)(F)F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c13cccc4c1"
} |
Can you make molecule C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1Br | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c13cccc4c1"
} |
Can you make molecule C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1Cl | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 | C[C@@H](c1ccccc1F)S(=O)(=O)Cc1cccc(C(F)(F)F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c13cccc4c1"
} |
Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=CN=N[C@H]1NC(=O)C(=O)Nc1cc(NC(=O)C2CC2)ccc1C.Cc1ccc(C)o1 | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | CCC1=CN=N[C@H]1NC(=O)C(=O)Nc1cc(NC(=O)C2CC2)ccc1C.Cc1ccc(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]7%11C"
} |
Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)N=N1.Cc1ccc(C)o1 | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | CC1=C[C@@H](NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)N=N1.Cc1ccc(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]7%11C"
} |
Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)N[C@H]1C[CH]CC1 | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)N[C@H]1C[CH]CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]7%11C"
} |
Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)N[C@@H]1N=N[CH]S1 | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)N[C@@H]1N=N[CH]S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=N[C@H]&S1",
"old_substring": "[C@@H]7%11C"
} |
Can you make molecule Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)NCC[CH]Cl | Cc1cc([C@H](C)NC(=O)C(=O)Nc2cc(NC(=O)C3CC3)ccc2C)c(C)o1 | Cc1ccc(C)o1.Cc1ccc(NC(=O)C2CC2)cc1NC(=O)C(=O)NCC[CH]Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "[C@@H]7%11C"
} |
Can you make molecule COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(S(=O)(=O)c2nc(C#N)c([C@H]3CCC[C@H](C)C3)o2)s1 | COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 | COC(=O)Cc1ccc(S(=O)(=O)c2nc(C#N)c([C@H]3CCC[C@H](C)C3)o2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N45C"
} |
Can you make molecule COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(S(=O)(=O)c2cc(C#N)c([C@H]3CCC[C@H](C)C3)s2)s1 | COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 | COC(=O)Cc1ccc(S(=O)(=O)c2cc(C#N)c([C@H]3CCC[C@H](C)C3)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(S(=O)(=O)c2ccc([C@H]3CCC[C@H](C)C3)c(C#N)c2)s1 | COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 | COC(=O)Cc1ccc(S(=O)(=O)c2ccc([C@H]3CCC[C@H](C)C3)c(C#N)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N45C"
} |
Can you make molecule COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(S(=O)(=O)ON=C2CCN([C@H]3CCC[C@H](C)C3)CC2)s1 | COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 | COC(=O)Cc1ccc(S(=O)(=O)ON=C2CCN([C@H]3CCC[C@H](C)C3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N45C"
} |
Can you make molecule COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)Cc1ccc(S(=O)(=O)c2cnc(C#N)c([C@H]3CCC[C@H](C)C3)c2)s1 | COC(=O)Cc1ccc(S(=O)(=O)N(C)[C@H]2CCC[C@H](C)C2)s1 | COC(=O)Cc1ccc(S(=O)(=O)c2cnc(C#N)c([C@H]3CCC[C@H](C)C3)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N45C"
} |
Can you make molecule C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OCCN(Cc2cc(Br)c(F)cc2Cl)[C@H]1C | C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C | C[C@H]1OCCN(Cc2cc(Br)c(F)cc2Cl)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c13cccc(F)c1Cl"
} |
Can you make molecule C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OCCN(Cc2cc(Br)ccc2Cl)[C@H]1C | C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C | C[C@H]1OCCN(Cc2cc(Br)ccc2Cl)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c13cccc(F)c1Cl"
} |
Can you make molecule C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OCCN(c2cc(F)ccc3c(Cl)c(s2)C3)[C@H]1C | C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C | C[C@H]1OCCN(c2cc(F)ccc3c(Cl)c(s2)C3)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cc(F)ccc2c1Cl",
"old_substring": "c13cccc(F)c1Cl"
} |
Can you make molecule C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OCCN(c2cccc(F)c3c(Cl)c(s2)C3)[C@H]1C | C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C | C[C@H]1OCCN(c2cccc(F)c3c(Cl)c(s2)C3)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cccc(F)c2c1Cl",
"old_substring": "c13cccc(F)c1Cl"
} |
Can you make molecule C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1OCCN(Cc2ccc(Cl)cc2Br)[C@H]1C | C[C@H]1OCCN(Cc2cccc(F)c2Cl)[C@H]1C | C[C@H]1OCCN(Cc2ccc(Cl)cc2Br)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13cccc(F)c1Cl"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.