prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nc2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1",
"old_substring": "c18ccc9nn1"
} |
Can you make molecule Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)n2C)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)n2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&n1C",
"old_substring": "c18ccc9nn1"
} |
Can you make molecule Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nc2C)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c18ccc9nn1"
} |
Can you make molecule Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CSc2ccn(-c3cccs3)c2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 | Cc1ccc(CNC(=O)CSc2ccn(-c3cccs3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c18ccc9nn1"
} |
Can you make molecule Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)CSc2ccc3nc(-c4cccs4)cn3c2)cc1 | Cc1ccc(CNC(=O)CSc2ccc(-c3cccs3)nn2)cc1 | Cc1ccc(CNC(=O)CSc2ccc3nc(-c4cccs4)cn3c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2nc&cn2c1",
"old_substring": "c18ccc9nn1"
} |
Can you make molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)SC(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)SC(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C1=C(N=Cc2cc(Cl)c3c(c2)OCCCO3)CCS1 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C1=C(N=Cc2cc(Cl)c3c(c2)OCCCO3)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C(N=Cc1cc(Cl)c2c(c1)OCCCO2)=C(Cl)Cl | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C(N=Cc1cc(Cl)c2c(c1)OCCCO2)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C(C=Cc1cc(Cl)c2c(c1)OCCCO2)=C(Cl)Cl | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C(C=Cc1cc(Cl)c2c(c1)OCCCO2)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C[S@+]([O-])CCC=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C(=O)C=Cc1cc(Cl)c2c(c1)OCCCO2 | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1CN(C)C[S@+]([O-])CCC=Cc1cc(Cl)c2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=5"
} |
Can you make molecule O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1Cl)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1Cl)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccc(I)cc1)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccc(I)cc1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](NC(=O)Cc2csc(-c3ccoc3)n2)C2CCC2)cc1I | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 | Cc1ccc([C@@H](NC(=O)Cc2csc(-c3ccoc3)n2)C2CCC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1cccc(Br)c1)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1cccc(Br)c1)C1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@@H](NC(=O)Cc2csc(-c3ccoc3)n2)C2CCC2)c1C | O=C(Cc1csc(-c2ccoc2)n1)N[C@H](c1ccccc1)C1CCC1 | Cc1cccc([C@@H](NC(=O)Cc2csc(-c3ccoc3)n2)C2CCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C=CSN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | C=CSN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "C8C"
} |
Can you make molecule CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | C=CCCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "C8C"
} |
Can you make molecule CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCl)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CCCCl)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "C8C"
} |
Can you make molecule CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCS)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CCCCS)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "C8C"
} |
Can you make molecule CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCBr)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CC)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | CCN(CCCBr)c1ccc(CNC(=O)N2CCN(C(=O)N(C)C)CC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "C8C"
} |
Can you make molecule CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=S)Sc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOC(=S)Sc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=N)Cc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOC(=N)Cc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCC(=O)c1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCC(=O)CCC(=O)c1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)CCc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CC[C@H](O)CCc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O45"
} |
Can you make molecule CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)/C=C/Sc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCOc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | CCC(=O)/C=C/Sc1cc(CN2CC[NH+]3CCCC[C@@H]3C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)cc(CCCCN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CCCCN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C67"
} |
Can you make molecule COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)cc(CCCCCN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CCCCCN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C67"
} |
Can you make molecule COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)cc(C2CC(N3C[C@@H]4CCC[NH+]4C[C@H]3C)C2)c1OC | COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(C2CC(N3C[C@@H]4CCC[NH+]4C[C@H]3C)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C67"
} |
Can you make molecule COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)cc(SC(=S)ON2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(SC(=S)ON2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C67"
} |
Can you make molecule COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Cl)cc(NC(=S)SN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(CN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | COc1cc(Cl)cc(NC(=S)SN2C[C@@H]3CCC[NH+]3C[C@H]2C)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C67"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 | C[C@H](CC(C)(C)c1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]56"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)N1c2ccccc2C[C@H]1C)CC(=O)c1nc(C(C)(C)C)no1 | C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 | C[C@@H](CCNC(=O)N1c2ccccc2C[C@H]1C)CC(=O)c1nc(C(C)(C)C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]56"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)NCC[C@H](Cl)c1nc(C(C)(C)C)no1 | C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 | C[C@@H]1Cc2ccccc2N1C(=O)NCC[C@H](Cl)c1nc(C(C)(C)C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]56"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 | CCC[C@H](CC(=O)c1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]56"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | C[C@@H]1Cc2ccccc2N1C(=O)N[C@H](C)c1nc(C(C)(C)C)no1 | CC(C)[C@H](CCc1nc(C(C)(C)C)no1)NC(=O)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]56"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc(F)c(CC(=O)SNc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(CC(=O)SNc2ccc(C(C)=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)CCCC(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)CCCC(=O)Nc2ccc(C(C)=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc(F)c(C(C)(C)CC(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(C)(C)CC(=O)Nc2ccc(C(C)=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc(F)c(C(C)(C)CCC(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(C)(C)CCC(=O)Nc2ccc(C(C)=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc(F)c([C@H](C)C(=O)SNc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc(C(C)=O)cc2)c1 | CCN(CC)S(=O)(=O)c1ccc(F)c([C@H](C)C(=O)SNc2ccc(C(C)=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OCCOc2c1cnc1cc(SC(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(SC(F)(F)F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OCCOc2c1cnc1cc(CCCC(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(CCCC(F)(F)F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OCCOc2c1cnc1cc(CCCCC(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(CCCCC(F)(F)F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OCCOc2c1cnc1cc(C(F)(F)C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)C(F)(F)F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OCCOc2c1cnc1cc(CC(F)(F)C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(C(F)(F)F)ccc21 | O=C1OCCOc2c1cnc1cc(CC(F)(F)C(F)(F)F)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C3(F)(F)F"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)C(C)C)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)CC(C)C)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(=O)(=O)CC(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(CCCCS(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(CCCCS(C)(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(C(=O)N=S(C)(C)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(C(=O)N=S(C)(C)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(CS(=O)(=O)C(C)C)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(S(C)(=O)=O)CC1 | COc1ccc(C)cc1NC(=O)[C@H](C)N1CCN(CS(=O)(=O)C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccn1)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 | C[C@H](CC(C)(C)c1ccccn1)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)CC(=O)c1ccccn1 | C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 | C[C@H](CC[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)CC(=O)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccccn1)[C@H](C)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 | C[C@H](Cc1ccccn1)[C@H](C)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)CC(=O)c1ccccn1 | C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 | C[C@@H](CC[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)CC(=O)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]24"
} |
Can you make molecule C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccccn1)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | C[C@H]([NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1)c1ccccn1 | CCC[C@@H](CCc1ccccn1)[NH2+][C@@H](CC(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]24"
} |
Can you make molecule O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Br)cc1I)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1I)[C@H](O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Br)cc1Br)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1Br)[C@H](O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc(Br)ccc1I)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1cc(Br)ccc1I)[C@H](O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Br)c(Cl)c1F)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)c(Cl)c1F)[C@H](O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cc(Br)ccc1Cl)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1ccc(Br)cc1)[C@H](O)c1c[nH]c2ccccc12 | O=C(c1cc(Br)ccc1Cl)[C@H](O)c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c13ccc(Br)cc1"
} |
Can you make molecule COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | COCc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | COCSc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | CC(=O)Sc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(OC(=O)c2ccc(F)cc2)c(C(=O)CS)c1 | COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | O=Cc1ccc(OC(=O)c2ccc(F)cc2)c(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(OC(=O)c2ccc(F)cc2)c(C(=O)CI)c1 | COc1cc(C=O)ccc1OC(=O)c1ccc(F)cc1 | O=Cc1ccc(OC(=O)c2ccc(F)cc2)c(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCN(c2ccc(OC(F)(F)Cl)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(OC(F)(F)Cl)cn2)CC1)N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O4C(F)F"
} |
Can you make molecule O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCN(c2ccc(SC(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(SC(F)F)cn2)CC1)N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1CCN(c2ccc([C@@H](O)CC(F)(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 | O=C(C1CCN(c2ccc([C@@H](O)CC(F)(F)F)cn2)CC1)N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1cc(F)c(-c2ccc(N3CCC(C(=O)N4CCc5ccccc54)CC3)nc2)c(F)c1 | O=C(C1CCN(c2ccc(OC(F)F)cn2)CC1)N1CCc2ccccc21 | O=Cc1cc(F)c(-c2ccc(N3CCC(C(=O)N4CCc5ccccc54)CC3)nc2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O4C(F)F"
} |
Can you make molecule O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1cccc(Br)c1)C(=O)Cc1cnn(-c2ccccc2)c1 | O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 | CCC[C@@H](CCc1cccc(Br)c1)C(=O)Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1=CN=N[C@H]1c1cccc(Br)c1)Cc1cnn(-c2ccccc2)c1 | O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 | O=C(CC1=CN=N[C@H]1c1cccc(Br)c1)Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1=CN=N[C@@H]1c1cccc(Br)c1)Cc1cnn(-c2ccccc2)c1 | O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 | O=C(CC1=CN=N[C@@H]1c1cccc(Br)c1)Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@@H]&N=N1",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1=CC[C@@H](c2cccc(Br)c2)O1)Cc1cnn(-c2ccccc2)c1 | O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 | O=C(CC1=CC[C@@H](c2cccc(Br)c2)O1)Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CC[C@@H]&O1",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)c1cccc(Br)c1)C(=O)Cc1cnn(-c2ccccc2)c1 | O=C(Cc1cnn(-c2ccccc2)c1)N1CCC[C@H]1c1cccc(Br)c1 | CCC[C@@H](CC(=O)c1cccc(Br)c1)C(=O)Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&=O",
"old_substring": "N13CCC[C@H]16"
} |
Can you make molecule COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NSC(=O)Cc2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NSC(=O)Cc2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C49=O"
} |
Can you make molecule COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CCCC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)CCCC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C49=O"
} |
Can you make molecule COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CC(C)(C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)CC(C)(C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)CCC(C)(C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)CCC(C)(C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C49=O"
} |
Can you make molecule COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NSC(=O)[C@@H](C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NC(=O)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | COc1cc(NSC(=O)[C@@H](C)c2ccc(CN3CCOCC3)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C49=O"
} |
Can you make molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(O)c(CC(=O)SNc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(CC(=O)SNc2ccccc2N2CCOCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(O)c(C(=O)CCCC(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)CCCC(=O)Nc2ccccc2N2CCOCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(O)c(C(C)(C)CC(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(C)(C)CC(=O)Nc2ccccc2N2CCOCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(O)c(C(C)(C)CCC(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(C)(C)CCC(=O)Nc2ccccc2N2CCOCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(O)c([C@H](C)C(=O)SNc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c(C(=O)Nc2ccccc2N2CCOCC2)c1 | Cc1cc(C)c(O)c([C@H](C)C(=O)SNc2ccccc2N2CCOCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(CC(=O)SN(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(CC(=O)SN(C)C3CCCCC3)cc2nc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(C(=O)CCCC(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)CCCC(=O)N(C)C3CCCCC3)cc2nc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(C(C)(C)CC(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(C)(C)CC(=O)N(C)C3CCCCC3)cc2nc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc(C(C)(C)CCC(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(C)(C)CCC(=O)N(C)C3CCCCC3)cc2nc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2ccc([C@H](C)C(=O)SN(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc(C(=O)N(C)C3CCCCC3)cc2nc1C | Cc1nc2ccc([C@H](C)C(=O)SN(C)C3CCCCC3)cc2nc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)c1ccc(I)cc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccc(I)cc1F)C(=O)O[C@@H](C)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c16ccccc1F"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)c1cc(I)ccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1cc(I)ccc1F)C(=O)O[C@@H](C)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c16ccccc1F"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)c1ccccc1Cl)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1Cl)C(=O)O[C@@H](C)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1F"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)c1cc(F)ccc1Br)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1cc(F)ccc1Br)C(=O)O[C@@H](C)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c16ccccc1F"
} |
Can you make molecule CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NC(=O)c1ccc(F)cc1Cl)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccccc1F)C(=O)O[C@@H](C)c1ccccn1 | CC(C)[C@@H](NC(=O)c1ccc(F)cc1Cl)C(=O)O[C@@H](C)c1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c16ccccc1F"
} |
Can you make molecule CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCCC(C)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CCC8"
} |
Can you make molecule CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CBr)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCC(CBr)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CBr",
"old_substring": "CCC8"
} |
Can you make molecule CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCl)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CC(CCl)=NC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&CCl",
"old_substring": "CCC8"
} |
Can you make molecule CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | CC(C)CCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC8"
} |
Can you make molecule CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=O)C1(c2ccc(Cl)cc2)CCCC1)NC(=O)NCCCCBr | CCCNC(=O)NC(=O)COC(=O)C1(c2ccc(Cl)cc2)CCCC1 | O=C(COC(=O)C1(c2ccc(Cl)cc2)CCCC1)NC(=O)NCCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC8"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.