prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)CCC(=O)Nc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(NC(=O)CCC(=O)C2OCc3ccccc3CO2)cc1 | COC(=O)CCC(=O)Nc1ccc(N)cc1 | Nc1ccc(NC(=O)CCC(=O)C2OCc3ccccc3CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)CCC(=O)Nc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(NC(=O)CCC(=O)C2(O)Cc3ccccc3C2)cc1 | COC(=O)CCC(=O)Nc1ccc(N)cc1 | Nc1ccc(NC(=O)CCC(=O)C2(O)Cc3ccccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)CCC(=O)Nc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC(C(=O)CCC(=O)Nc2ccc(N)cc2)=CC2=NN2C1 | COC(=O)CCC(=O)Nc1ccc(N)cc1 | C[C@H]1COC(C(=O)CCC(=O)Nc2ccc(N)cc2)=CC2=NN2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)CCC(=O)Nc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(NC(=O)CCC(=O)N2CCOC23CCCCC3)cc1 | COC(=O)CCC(=O)Nc1ccc(N)cc1 | Nc1ccc(NC(=O)CCC(=O)N2CCOC23CCCCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC12CCCCC2",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)CCC(=O)Nc1ccc(N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(NC(=O)CCC(=O)N2CCOC3(CCC3)C2)cc1 | COC(=O)CCC(=O)Nc1ccc(N)cc1 | Nc1ccc(NC(=O)CCC(=O)N2CCOC3(CCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H](CCCN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CCCN(C)C2(C[NH3+])CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C35"
} |
Can you make molecule CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H](CCCCN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CCCCN(C)C2(C[NH3+])CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H](CCCCCN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CCCCCN(C)C2(C[NH3+])CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H](C2CC(N(C)C3(C[NH3+])CCCCC3)C2)C1 | CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](C2CC(N(C)C3(C[NH3+])CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCO[C@@H](SC(=S)ON(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](CN(C)C2(C[NH3+])CCCCC2)C1 | CN1CCO[C@@H](SC(=S)ON(C)C2(C[NH3+])CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)cc1I | Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1ccc(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccccc14"
} |
Can you make molecule Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)cc1Cl | Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1ccc(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccccc14"
} |
Can you make molecule Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1cc(I)ccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccccc14"
} |
Can you make molecule Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)c1 | Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1ccc(I)c(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccccc14"
} |
Can you make molecule Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)c1 | Cc1ccccc1CC[NH+]1[C@@H]2CC[C@H]1CC(=O)C2 | Cc1ccc(Br)c(CC[NH+]2[C@@H]3CC[C@H]2CC(=O)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccccc14"
} |
Can you make molecule COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ncccc1CC(=O)SNC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1CC(=O)SNC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ncccc1C(=O)CCCC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)CCCC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ncccc1C(C)(C)CC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(C)(C)CC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ncccc1C(C)(C)CCC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(C)(C)CCC(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ncccc1[C@H](C)C(=O)SNC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1C(=O)NC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | COc1ncccc1[C@H](C)C(=O)SNC[C@H]1C[C@H](O)C[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule CCCCOC(=O)CNc1cc(C)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1c(O)ccc(C(=O)CNc2cc(C)cc(F)c2)c2noc1-2 | CCCCOC(=O)CNc1cc(C)cc(F)c1 | CCCCc1c(O)ccc(C(=O)CNc2cc(C)cc(F)c2)c2noc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCCCOC(=O)CNc1cc(C)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1ccc2c(c1)CN(C(=O)CNc1cc(C)cc(F)c1)CCO2 | CCCCOC(=O)CNc1cc(C)cc(F)c1 | CCCCc1ccc2c(c1)CN(C(=O)CNc1cc(C)cc(F)c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCCCOC(=O)CNc1cc(C)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1cnc2ccc-2cc(C(=O)CNc2cc(C)cc(F)c2)c1=O | CCCCOC(=O)CNc1cc(C)cc(F)c1 | CCCCn1cnc2ccc-2cc(C(=O)CNc2cc(C)cc(F)c2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCCCOC(=O)CNc1cc(C)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ccc2nc-2ccc(C(=O)CNc2cc(C)cc(F)c2)c1=O | CCCCOC(=O)CNc1cc(C)cc(F)c1 | CCCCn1ccc2nc-2ccc(C(=O)CNc2cc(C)cc(F)c2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCCCOC(=O)CNc1cc(C)cc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCn1ccc2nc-2ncc(C(=O)CNc2cc(C)cc(F)c2)c1=O | CCCCOC(=O)CNc1cc(C)cc(F)c1 | CCCCn1ccc2nc-2ncc(C(=O)CNc2cc(C)cc(F)c2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2ccc(N=C3CCC(=Cc4cccc(Cl)c4Cl)C3=O)cc2N1 | O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 | O=C1COc2ccc(N=C3CCC(=Cc4cccc(Cl)c4Cl)C3=O)cc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C3C=5"
} |
Can you make molecule O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2ccc(N=C3CCCC(=Cc4cccc(Cl)c4Cl)C(=O)C3=O)cc2N1 | O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 | O=C1COc2ccc(N=C3CCCC(=Cc4cccc(Cl)c4Cl)C(=O)C3=O)cc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCCC=&C1=O",
"old_substring": "O=C3C=5"
} |
Can you make molecule O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2ccc(NC(=O)NN=C3CCC(=Cc4cccc(Cl)c4Cl)CC3)cc2N1 | O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 | O=C1COc2ccc(NC(=O)NN=C3CCC(=Cc4cccc(Cl)c4Cl)CC3)cc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C=5"
} |
Can you make molecule O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2ccc(NC(=O)C3=C(N=Cc4cccc(Cl)c4Cl)CCS3)cc2N1 | O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 | O=C1COc2ccc(NC(=O)C3=C(N=Cc4cccc(Cl)c4Cl)CCS3)cc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "O=C3C=5"
} |
Can you make molecule O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1COc2ccc(NC(=O)C(N=Cc3cccc(Cl)c3Cl)=C(Cl)Cl)cc2N1 | O=C(C=Cc1cccc(Cl)c1Cl)Nc1ccc2c(c1)NC(=O)CO2 | O=C1COc2ccc(NC(=O)C(N=Cc3cccc(Cl)c3Cl)=C(Cl)Cl)cc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "O=C3C=5"
} |
Can you make molecule O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | O=C(/C=C/Sn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(n2cccc(C(F)(F)F)c2=O)CC1)N1CCCc2c(Cl)ccc(F)c21 | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | O=C(NN=C1CCC(n2cccc(C(F)(F)F)c2=O)CC1)N1CCCc2c(Cl)ccc(F)c21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCCc2c(Cl)ccc(F)c21)C(=O)Sn1cccc(C(F)(F)F)c1=O | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | C/C(=N\ON1CCCc2c(Cl)ccc(F)c21)C(=O)Sn1cccc(C(F)(F)F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=CC[C@H](n2cccc(C(F)(F)F)c2=O)S1)N1CCCc2c(Cl)ccc(F)c21 | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | O=C(C1=CC[C@H](n2cccc(C(F)(F)F)c2=O)S1)N1CCCc2c(Cl)ccc(F)c21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C4"
} |
Can you make molecule O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-n2cccc(C(F)(F)F)c2=O)cc1)N1CCCc2c(Cl)ccc(F)c21 | O=C(Cn1cccc(C(F)(F)F)c1=O)N1CCCc2c(Cl)ccc(F)c21 | O=C(NN=Cc1ccc(-n2cccc(C(F)(F)F)c2=O)cc1)N1CCCc2c(Cl)ccc(F)c21 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C4"
} |
Can you make molecule CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cc(Br)cc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cc(Br)cc3Cl)c(C)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c18c(Cl)cccc1Cl"
} |
Can you make molecule CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)ccc(Cl)c3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)ccc(Cl)c3Cl)c(C)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c18c(Cl)cccc1Cl"
} |
Can you make molecule CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cc(Cl)cc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cc(Cl)cc3Cl)c(C)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c18c(Cl)cccc1Cl"
} |
Can you make molecule CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3cc(Cl)cc(Cl)c3Br)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3cc(Cl)cc(Cl)c3Br)c(C)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c18c(Cl)cccc1Cl"
} |
Can you make molecule CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 less soluble in water? The output molecule should be similar to the input molecule. | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3cc(Br)cc(Br)c3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3c(Cl)cccc3Cl)c(C)n2n1 | CSc1nc2nc(C)c(CCC(=O)Nc3ccnn3Cc3cc(Br)cc(Br)c3Cl)c(C)n2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cc(Br)c1Cl",
"old_substring": "c18c(Cl)cccc1Cl"
} |
Can you make molecule CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(NC(=O)CCc2nc(-c3cc(C)c(C)s3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3cc(C)c(C)s3)no2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c18ccsc1"
} |
Can you make molecule CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(NC(=O)CCc2nc(-c3cc(C)sc3C)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3cc(C)sc3C)no2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c18ccsc1"
} |
Can you make molecule CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(NC(=O)CCc2nc(-c3sccc3Br)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3sccc3Br)no2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c18ccsc1"
} |
Can you make molecule CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(NC(=O)CCc2nc(-c3cc4sccc4s3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3cc4sccc4s3)no2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c18ccsc1"
} |
Can you make molecule CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(NC(=O)CCc2nc(-c3cc(Cl)sc3Cl)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3ccsc3)no2)n[nH]1 | CCCc1cc(NC(=O)CCc2nc(-c3cc(Cl)sc3Cl)no2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c18ccsc1"
} |
Can you make molecule CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)CN1CCN(Cc2nc(C(C)C)co2)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)co2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c17nc8no1"
} |
Can you make molecule CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)CN1CCN(Cc2ncnc(C(C)C)c2C)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 | CCNC(=O)CN1CCN(Cc2ncnc(C(C)C)c2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)CN1CCN(Cc2nc(C(C)C)ncc2C)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)ncc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)CN1CCN(Cc2ncnc(C(C)C)c2F)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 | CCNC(=O)CN1CCN(Cc2ncnc(C(C)C)c2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c17nc8no1"
} |
Can you make molecule CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)CN1CCN(Cc2nc(C(C)C)ncc2I)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)no2)CC1 | CCNC(=O)CN1CCN(Cc2nc(C(C)C)ncc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)NC1CCC(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1CCC(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)NC1CCC(C)(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1CCC(C)(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)NC1(C#N)CCC(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NC1(C#N)CCC(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)NCCCCCC(=O)C(=O)Nc1ccc(F)cc1F | Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NCCCCCC(=O)C(=O)Nc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1occc1C(=O)NN1CCC=C(CC(=O)C(=O)Nc2ccc(F)cc2F)C1 | Cc1occc1C(=O)NC1CCN(C(=O)C(=O)Nc2ccc(F)cc2F)CC1 | Cc1occc1C(=O)NN1CCC=C(CC(=O)C(=O)Nc2ccc(F)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "C17CCN4CC1"
} |
Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccc1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c16ccccn1"
} |
Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccc(I)cn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c16ccccn1"
} |
Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cccc(Cl)n1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cccc(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)n1",
"old_substring": "c16ccccn1"
} |
Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cc(Br)ccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cc(Br)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccn1",
"old_substring": "c16ccccn1"
} |
Can you make molecule C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cc2sccn2c1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1ccccn1 | C[C@@H](OC(=O)[C@@H]1C[C@@H]1c1ccc(OC(F)(F)F)cc1)c1cc2sccn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c16ccccn1"
} |
Can you make molecule COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | COCc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | COCSc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | CC(=O)Sc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c([C@H]2CC(=O)N(Cc3ccc(C(=O)CS)cc3)C2)nc2ccccc21 | COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | Cn1c([C@H]2CC(=O)N(Cc3ccc(C(=O)CS)cc3)C2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c([C@H]2CC(=O)N(Cc3ccc(C(=O)CI)cc3)C2)nc2ccccc21 | COc1ccc(CN2C[C@@H](c3nc4ccccc4n3C)CC2=O)cc1 | Cn1c([C@H]2CC(=O)N(Cc3ccc(C(=O)CI)cc3)C2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=C1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | CC(I)=C1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC4"
} |
Can you make molecule CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | C=CCCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@]1(C2(O)CCC(CCCCl)CC2)CCOc2ccccc21 | CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | [NH3+]C[C@]1(C2(O)CCC(CCCCl)CC2)CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]C[C@]1(C2(O)CCC(CCCCS)CC2)CCOc2ccccc21 | CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | [NH3+]C[C@]1(C2(O)CCC(CCCCS)CC2)CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(Br)=C1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | CCC1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | CC(Br)=C1CCC(O)([C@@]2(C[NH3+])CCOc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&Br",
"old_substring": "CC4"
} |
Can you make molecule COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=S)NN2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1ccc(C(=S)NN2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C(=S)N&)cc1",
"old_substring": "c16ccc(S7(=O)=O)cc1"
} |
Can you make molecule COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(/C=N/ON2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1ccc(/C=N/ON2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(/C=N/O&)cc1",
"old_substring": "c16ccc(S7(=O)=O)cc1"
} |
Can you make molecule COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(O)c(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c1 | COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1cc(Br)c(O)c(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(O)c(Br)c1",
"old_substring": "c16ccc(S7(=O)=O)cc1"
} |
Can you make molecule COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c1F | COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1ccc(F)c(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c&c1F",
"old_substring": "c16ccc(S7(=O)=O)cc1"
} |
Can you make molecule COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c(F)cc1F | COc1ccc(S(=O)(=O)N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)cc1 | COc1cc(N2C[C@H](O)C[C@@H]2C(=O)OCc2nc3sc(C)c(C)c3c(=O)[nH]2)c(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(F)cc1F",
"old_substring": "c16ccc(S7(=O)=O)cc1"
} |
Can you make molecule COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Clc1ccc2c(c1)C1O[C@H]([C@H]3CN4CCC[C@@H]4CO3)[C@@H]2O1 | COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 | CO.Clc1ccc2c(c1)C1O[C@H]([C@H]3CN4CCC[C@@H]4CO3)[C@@H]2O1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&O[C@H]&[C@@H]&O1",
"old_substring": "C5[C@@H]4[NH3+]"
} |
Can you make molecule COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Clc1ccc2c(c1)[C@@H]1C[C@H]([C@H]3CN4CCC[C@@H]4CO3)N2C1 | COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 | CO.Clc1ccc2c(c1)[C@@H]1C[C@H]([C@H]3CN4CCC[C@@H]4CO3)N2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C[C@H]&N&C1",
"old_substring": "C5[C@@H]4[NH3+]"
} |
Can you make molecule COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Clc1ccc2c(c1)[C@@H]1CC[C@H]([C@H]3CN4CCC[C@@H]4CO3)N21 | COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 | CO.Clc1ccc2c(c1)[C@@H]1CC[C@H]([C@H]3CN4CCC[C@@H]4CO3)N21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&N1&",
"old_substring": "C5[C@@H]4[NH3+]"
} |
Can you make molecule COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Clc1ccc2c(c1)C1C[C@@H]2C[C@@H]([C@H]2CN3CCC[C@@H]3CO2)C1 | COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 | CO.Clc1ccc2c(c1)C1C[C@@H]2C[C@@H]([C@H]2CN3CCC[C@@H]3CO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "C5[C@@H]4[NH3+]"
} |
Can you make molecule COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 less soluble in water? The output molecule should be similar to the input molecule. | CO.Clc1ccc2c(c1)[C@H]1C[C@H]([C@H]3CN4CCC[C@@H]4CO3)N2C1 | COc1ccc(Cl)cc1C[C@H]([NH3+])[C@H]1CN2CCC[C@@H]2CO1 | CO.Clc1ccc2c(c1)[C@H]1C[C@H]([C@H]3CN4CCC[C@@H]4CO3)N2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&N&C1",
"old_substring": "C5[C@@H]4[NH3+]"
} |
Can you make molecule COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COSC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)CCCC(=O)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C6"
} |
Can you make molecule COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)CC(C)(C)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC[S@+]([O-])CCCn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC[S@+]([O-])CCCn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)Cn1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | COC(=O)CCC(C)(C)n1cc(C=C2C(=O)N(c3cccc(F)c3)C(=O)N=C2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](O)c1ccc(Cl)cc1I)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)cc1I)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](O)c1ccc(Cl)cc1Br)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)cc1Br)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](O)c1ccc(Cl)c(I)c1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)c(I)c1)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](O)c1cc(Cl)sc1Cl)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 | CC(C)([C@H](O)c1cc(Cl)sc1Cl)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](O)c1ccc(Cl)c(Cl)c1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)s1)[NH+]1CCCC1 | CC(C)([C@H](O)c1ccc(Cl)c(Cl)c1)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c13ccc(Cl)s1"
} |
Can you make molecule CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | C=CSOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | C=CCCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCCl)N1CCOCC1 | CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCCl)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCCS)N1CCOCC1 | CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCCS)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCBr)N1CCOCC1 | CCOc1cc(C(=O)N2CCN(C(=O)C3CC3)CC2)ccc1OCC(=O)N1CCOCC1 | O=C(COc1ccc(C(=O)N2CCN(C(=O)C3CC3)CC2)cc1OCCCBr)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC7"
} |
Can you make molecule COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COCc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COCSc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1SC(C)=O | COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1C(=O)CS | COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1C(=O)CI | COc1cc(OC)c([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)cc1OC | COc1cc([C@H]2CC(=O)N3CN(c4ccccc4F)CSC3=C2C#N)c(OC)cc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.