prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | COCc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | COCSc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | CC(=O)Sc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1C(=O)Nc2nc(-c3ccc(C(=O)CS)cc3)nn21)Nc1ccccc1 | COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | O=C(C[C@H]1C(=O)Nc2nc(-c3ccc(C(=O)CS)cc3)nn21)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1C(=O)Nc2nc(-c3ccc(C(=O)CI)cc3)nn21)Nc1ccccc1 | COc1ccc(-c2nc3n(n2)[C@@H](CC(=O)Nc2ccccc2)C(=O)N3)cc1 | O=C(C[C@H]1C(=O)Nc2nc(-c3ccc(C(=O)CI)cc3)nn21)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | C=CSOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | C=CCCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C=C(C(=O)OCCCCl)c2nccn2Cc2ccccc2)cc(C)c1O | CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | Cc1cc(C=C(C(=O)OCCCCl)c2nccn2Cc2ccccc2)cc(C)c1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C=C(C(=O)OCCCCS)c2nccn2Cc2ccccc2)cc(C)c1O | CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | Cc1cc(C=C(C(=O)OCCCCS)c2nccn2Cc2ccccc2)cc(C)c1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C=C(C(=O)OCCCBr)c2nccn2Cc2ccccc2)cc(C)c1O | CCOC(=O)C(=Cc1cc(C)c(O)c(C)c1)c1nccn1Cc1ccccc1 | Cc1cc(C=C(C(=O)OCCCBr)c2nccn2Cc2ccccc2)cc(C)c1O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COCCCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COCCCCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CC(N2C(=O)c3ccccc3[C@@H](C(=O)[O-])[C@H]2c2[nH+]ccn2C)C1 | COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COC1CC(N2C(=O)c3ccccc3[C@@H](C(=O)[O-])[C@H]2c2[nH+]ccn2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C4"
} |
Can you make molecule COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | CO[C@@H](C)CCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3C4"
} |
Can you make molecule COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(N2C(=O)c3ccccc3[C@@H](C(=O)[O-])[C@H]2c2[nH+]ccn2C)CC1 | COCCN1C(=O)c2ccccc2[C@@H](C(=O)[O-])[C@H]1c1[nH+]ccn1C | COC1CCC(N2C(=O)c3ccccc3[C@@H](C(=O)[O-])[C@H]2c2[nH+]ccn2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C3C4"
} |
Can you make molecule CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN=C=S)cc1)C[C@@H]1CCCO1 | CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN=C=S)cc1)C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN7C"
} |
Can you make molecule CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C=S)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | O=C(N=C=S)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N=C=S",
"old_substring": "CN7C"
} |
Can you make molecule CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN2CCSCC2)cc1)C[C@@H]1CCCO1 | CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN2CCSCC2)cc1)C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN7C"
} |
Can you make molecule CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCc1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | CON(C)CCCc1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CN7C"
} |
Can you make molecule CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN2CCCCC2)cc1)C[C@@H]1CCCO1 | CN(C)c1ccc(CN(C[C@@H]2CCCO2)C(=O)c2n[nH]c3ccc([N+](=O)[O-])cc23)cc1 | O=C(c1n[nH]c2ccc([N+](=O)[O-])cc12)N(Cc1ccc(CN2CCCCC2)cc1)C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCCCC1",
"old_substring": "CN7C"
} |
Can you make molecule Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COc3ccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)cc3I)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 | Cc1ccc2nc(COc3ccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)cc3I)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17cccc9c1"
} |
Can you make molecule Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COc3cc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)ccc3Br)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 | Cc1ccc2nc(COc3cc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)ccc3Br)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17cccc9c1"
} |
Can you make molecule Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COc3ccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)cc3Cl)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 | Cc1ccc2nc(COc3ccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)cc3Cl)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17cccc9c1"
} |
Can you make molecule Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3Br)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3Br)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17cccc9c1"
} |
Can you make molecule Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3Cl)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3)cn2c1 | Cc1ccc2nc(COc3cccc(C(=O)N(C)[C@@H]4CCS(=O)(=O)C4)c3Cl)cn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17cccc9c1"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CC[C@@H](CC(=O)SNc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](CC(=O)SNc2ccc(F)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CC[C@@H](CC(=C=O)CNc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](CC(=C=O)CNc2ccc(F)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)CCCC(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)CCCC(=O)Nc2ccc(F)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CC[C@@H](C(C)(C)CC(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(C)(C)CC(=O)Nc2ccc(F)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)cc1N1CC[C@@H](CCC[S@@+]([O-])CNc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](C(=O)Nc2ccc(F)cc2F)C1=O | Cc1ccc(Cl)cc1N1CC[C@@H](CCC[S@@+]([O-])CNc2ccc(F)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](CO)C[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | COC[C@H](CO)C[C@H]1CCOC2(CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C&)CO",
"old_substring": "C3[C@H]4O"
} |
Can you make molecule COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CC[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | CO[C@@H](C)CC[C@H]1CCOC2(CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3[C@H]4O"
} |
Can you make molecule COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COC[C@@H](C)C(=O)[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](C)C(=O)[C@H]1CCOC2(CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C3[C@H]4O"
} |
Can you make molecule COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)C[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | CO[C@@H](C)C[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C[C@H]&O",
"old_substring": "C3[C@H]4O"
} |
Can you make molecule COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@@H](C)CC(=O)[C@H]1CCOC2(CCSCC2)C1 | COC[C@@H](O)[C@H]1CCOC2(CCSCC2)C1 | COCC[C@@H](C)CC(=O)[C@H]1CCOC2(CCSCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C3[C@H]4O"
} |
Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCSCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCSCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N57"
} |
Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCC1CN(C(=O)c2ccco2)C1)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCC1CN(C(=O)c2ccco2)C1)Nc1cnn(C[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N57"
} |
Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(NC(=O)c1ccco1)SCCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | N=C(NC(=O)c1ccco1)SCCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N57"
} |
Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)c2ccco2)nsc1CCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | Nc1c(C(=O)c2ccco2)nsc1CCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N57"
} |
Can you make molecule O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1ccco1)C(=S)SCCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | O=C(NCCNC(=O)c1ccco1)Nc1cnn(C[C@@H]2CCCO2)c1 | CN(C(=O)c1ccco1)C(=S)SCCNC(=O)Nc1cnn(C[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N57"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1I | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1Br | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)c(I)c1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)Cc1cc(Cl)ccc1Cl | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)c(Cl)c1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)cc1 | CCc1nn(C)c(OC)c1CNC(=O)Cc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c17ccc(Cl)cc1"
} |
Can you make molecule CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | C=CSc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCO)CNC(=O)c1c(N)c(C(C)C)nn1C | CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | CC[C@@H](CCO)CNC(=O)c1c(N)c(C(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | C=CCCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCO)CNC(=O)c1c(N)c(CCCCl)nn1C | CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | CC[C@@H](CCO)CNC(=O)c1c(N)c(CCCCl)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCO)CNC(=O)c1c(N)c(CCCCS)nn1C | CCc1nn(C)c(C(=O)NC[C@@H](CC)CCO)c1N | CC[C@@H](CCO)CNC(=O)c1c(N)c(CCCCS)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N[C@@H](CC1OCc2ccccc2CO1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 | O=S(=O)(N[C@@H](CC1OCc2ccccc2CO1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N[C@@H](CC1(O)Cc2ccccc2C1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 | O=S(=O)(N[C@@H](CC1(O)Cc2ccccc2C1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=C[C@H](NS(=O)(=O)c2ccc(Cl)nc2)c2ccc(F)c(F)c2)Oc2ccccc21 | COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 | O=C1C(=C[C@H](NS(=O)(=O)c2ccc(Cl)nc2)c2ccc(F)c(F)c2)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&Oc2ccccc2C1=O",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N[C@@H](C=C1CCOC2(CCC2)C1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 | O=S(=O)(N[C@@H](C=C1CCOC2(CCC2)C1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N[C@@H](C=C(O)c1cc2ccccc2o1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | COC[C@H](NS(=O)(=O)c1ccc(Cl)nc1)c1ccc(F)c(F)c1 | O=S(=O)(N[C@@H](C=C(O)c1cc2ccccc2o1)c1ccc(F)c(F)c1)c1ccc(Cl)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(O)c1cc2ccccc2o1",
"old_substring": "CO2"
} |
Can you make molecule COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1Cl | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccc(I)cc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)c1cc2sc(C)cc2n1C=Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1C=Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccc(C)c(I)c1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)c1cc2sc(C)cc2n1Cc1cccc(Br)c1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1ccccc1 | COCCNC(=O)c1cc2sc(C)cc2n1Cc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCCCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CCOCC1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCCCCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CCOCC1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CSCCSC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CSCCSC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C17CCOCC1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CC(C)C2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CC(C)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "C17CCOCC1"
} |
Can you make molecule COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2(C)CCCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2CCOCC2)cc1 | COc1ccc([C@H]([NH2+]Cc2cc[nH]n2)C2(C)CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C17CCOCC1"
} |
Can you make molecule Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1CC(=O)SN(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1CC(=O)SN(CCN1CCOCC1)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(=O)CCCC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(=O)CCCC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(C)(C)CC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(C)(C)CC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nccc1C(C)(C)CCC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | Cn1nccc1C(C)(C)CCC(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN(CCN1CCOCC1)c1nc2ccccc2s1)c1ccnn1C | Cn1nccc1C(=O)N(CCN1CCOCC1)c1nc2ccccc2s1 | C[C@H](C(=O)SN(CCN1CCOCC1)c1nc2ccccc2s1)c1ccnn1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)co1 | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1ncnc(-c2ccc3c(c2)OCO3)c1C | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1ncnc(-c2ccc3c(c2)OCO3)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2ccc3c(c2)OCO3)nc1-c1c(C)cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 | Cc1cnc(-c2ccc3c(c2)OCO3)nc1-c1c(C)cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1ncnc(-c2ccc3c(c2)OCO3)c1F | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1ncnc(-c2ccc3c(c2)OCO3)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c17nc8no1"
} |
Can you make molecule Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)ncc1I | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)no1 | Cc1cc(C)n(CC(=O)Nc2ccc(F)c(Cl)c2)c(=O)c1-c1nc(-c2ccc3c(c2)OCO3)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17nc8no1"
} |
Can you make molecule O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1nc2c(Cl)cccc2[nH]1)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1nc2c(Cl)cccc2[nH]1)c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc2[nH]c&nc12",
"old_substring": "c14cccc2[nH]ncc12"
} |
Can you make molecule O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cccc2nscc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2nscc12)c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2nscc12",
"old_substring": "c14cccc2[nH]ncc12"
} |
Can you make molecule O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N=c1cc[nH]c2ccsc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 | O=S(=O)(N=c1cc[nH]c2ccsc12)c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH+]c2ccsc12",
"old_substring": "c14cccc2[nH]ncc12"
} |
Can you make molecule O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N=c1cc[nH]c2ccccc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 | O=S(=O)(N=c1cc[nH]c2ccccc12)c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH+]c2ccccc12",
"old_substring": "c14cccc2[nH]ncc12"
} |
Can you make molecule O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(N=c1[nH]ccc2sccc12)c1ccc2c(c1)COC2 | O=S(=O)([N-]c1cccc2[nH]ncc12)c1ccc2c(c1)COC2 | O=S(=O)(N=c1[nH]ccc2sccc12)c1ccc2c(c1)COC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]ccc2sccc12",
"old_substring": "c14cccc2[nH]ncc12"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCC(=O)N(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 | CCC[C@H]1CCC(=O)N(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC(=O)N&C1",
"old_substring": "[C@H]18CN3CCO1"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCS1 | CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 | CCC[C@@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@H]18CN3CCO1"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCCCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 | CCC[C@H]1CCCCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1",
"old_substring": "[C@H]18CN3CCO1"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H]1CCCCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1=O | CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 | CCC[C@H]1CCCCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCCN&C1=O",
"old_substring": "[C@H]18CN3CCO1"
} |
Can you make molecule CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | CCC[C@H]1CN(C(=O)Nc2cc(OC)c(OC)cc2F)CCO1 | CCC[C@@H]1CCN(C(=O)Nc2cc(OC)c(OC)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN&C1",
"old_substring": "[C@H]18CN3CCO1"
} |
Can you make molecule COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCC[C@H](SC)CC2)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCC[C@H](SC)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@@H]17CCC[C@H]18"
} |
Can you make molecule COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCCC[C@H](SC)C2)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCCC[C@H](SC)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]17CCC[C@H]18"
} |
Can you make molecule COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H](CBr)CCCSC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H](CBr)CCCSC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@@H]17CCC[C@H]18"
} |
Can you make molecule COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)c(NC(=O)C(=O)NCCC2=CCC[C@@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)NCCC2=CCC[C@@H]2SC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "[C@@H]17CCC[C@H]18"
} |
Can you make molecule COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCc3sc(SC)cc3C2)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@@H]2CCC[C@H]2SC)c1 | COc1ccc(Cl)c(NC(=O)C(=O)N[C@H]2CCc3sc(SC)cc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2sc&cc2C1",
"old_substring": "[C@@H]17CCC[C@H]18"
} |
Can you make molecule COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H](C)CC(C)(C)NC(=O)N(C)C(C)C | COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C | COc1ccccc1[C@H](C)CC(C)(C)NC(=O)N(C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C7[C@@H]5C(C)C"
} |
Can you make molecule COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H](CCl)CCCNC(=O)N(C)C(C)C | COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C | COc1ccccc1[C@H](CCl)CCCNC(=O)N(C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "C7[C@@H]5C(C)C"
} |
Can you make molecule COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](CBr)CCCNC(=O)N(C)C(C)C | COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C | COc1ccccc1[C@@H](CBr)CCCNC(=O)N(C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "C7[C@@H]5C(C)C"
} |
Can you make molecule COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H](C)C(C)(C)CNC(=O)N(C)C(C)C | COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C | COc1ccccc1[C@H](C)C(C)(C)CNC(=O)N(C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "C7[C@@H]5C(C)C"
} |
Can you make molecule COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](CCNC(=O)N(C)C(C)C)C(C)C | COc1ccccc1C[C@@H](NC(=O)N(C)C(C)C)C(C)C | COc1ccccc1[C@@H](CCNC(=O)N(C)C(C)C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C7[C@@H]5C(C)C"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)NC(=S)N1CCOCC1 | C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 | CC[C@@H](C)C[C@H](CC)NC(=S)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "C[C@@H]1CCCC[C@H]12"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](Br)CNC(=S)N1CCOCC1 | C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 | CC(C)CC[C@H](Br)CNC(=S)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "C[C@@H]1CCCC[C@H]12"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(N=CC1CCCCCC1)N1CCOCC1 | C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 | S=C(N=CC1CCCCCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCCCC1",
"old_substring": "C[C@@H]1CCCC[C@H]12"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(NC1CCCCCCC1)N1CCOCC1 | C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 | S=C(NC1CCCCCCC1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C[C@@H]1CCCC[C@H]12"
} |
Can you make molecule C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)=NC(=S)N1CCOCC1 | C[C@@H]1CCCC[C@H]1NC(=S)N1CCOCC1 | CCCC(CCC)=NC(=S)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&CCC",
"old_substring": "C[C@@H]1CCCC[C@H]12"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.