prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2(Cc3cc4cccc(C)c4[nH]c3=O)CCN(C(=O)c3ccncc3)C2)c1C | Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C | Cc1cccc(C2(Cc3cc4cccc(C)c4[nH]c3=O)CCN(C(=O)c3ccncc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N456"
} |
Can you make molecule Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2(Cc3cc4cccc(C)c4[nH]c3=O)CCCN(C(=O)c3ccncc3)C2)c1C | Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C | Cc1cccc(C2(Cc3cc4cccc(C)c4[nH]c3=O)CCCN(C(=O)c3ccncc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N456"
} |
Can you make molecule Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2c(Cc3cc4cccc(C)c4[nH]c3=O)oc(C(=O)c3ccncc3)c2C#N)c1C | Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C | Cc1cccc(-c2c(Cc3cc4cccc(C)c4[nH]c3=O)oc(C(=O)c3ccncc3)c2C#N)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N456"
} |
Can you make molecule Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@]2(Cc3cc4cccc(C)c4[nH]c3=O)CCCN(C(=O)c3ccncc3)C2)c1C | Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C | Cc1cccc([C@]2(Cc3cc4cccc(C)c4[nH]c3=O)CCCN(C(=O)c3ccncc3)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N456"
} |
Can you make molecule Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2N(Cc3cc4cccc(C)c4[nH]c3=O)CCCN2C(=O)c2ccncc2)c1C | Cc1cccc(N(Cc2cc3cccc(C)c3[nH]c2=O)C(=O)c2ccncc2)c1C | Cc1cccc([C@H]2N(Cc3cc4cccc(C)c4[nH]c3=O)CCCN2C(=O)c2ccncc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&[C@@H]1&",
"old_substring": "N456"
} |
Can you make molecule O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2ccccc2oc1=O)N[C@H]1CC(=O)N(c2cccc(F)c2)C1 | O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O | O=C(/C=C/Sc1cc2ccccc2oc1=O)N[C@H]1CC(=O)N(c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@H]2CC(=O)N(c3cccc(F)c3)C2)nc1-c1cc2ccccc2oc1=O | O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O | O=Cc1sc(N[C@H]2CC(=O)N(c3cccc(F)c3)C2)nc1-c1cc2ccccc2oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@H]2CC(=O)N(c3cccc(F)c3)C2)sc1-c1cc2ccccc2oc1=O | O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O | O=Cc1nc(N[C@H]2CC(=O)N(c3cccc(F)c3)C2)sc1-c1cc2ccccc2oc1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](NC(=O)n2nc(-c3cc4ccccc4oc3=O)oc2=S)CN1c1cccc(F)c1 | O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O | O=C1C[C@H](NC(=O)n2nc(-c3cc4ccccc4oc3=O)oc2=S)CN1c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](NO/N=C/c2ccc(-c3cc4ccccc4oc3=O)o2)CN1c1cccc(F)c1 | O=C(N[C@H]1CC(=O)N(c2cccc(F)c2)C1)c1cc2ccccc2oc1=O | O=C1C[C@H](NO/N=C/c2ccc(-c3cc4ccccc4oc3=O)o2)CN1c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1noc(CC[C@@H](C(C)C)N2Cc3ccccc3C2=O)n1 | CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC(C)Cc1noc(CC[C@@H](C(C)C)N2Cc3ccccc3C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "CC[C@@H]34"
} |
Can you make molecule CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CCC[C@@H](CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "CC[C@@H]34"
} |
Can you make molecule CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1noc([C@H]2CCC=C2CCN2Cc3ccccc3C2=O)n1 | CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC(C)Cc1noc([C@H]2CCC=C2CCN2Cc3ccccc3C2=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "CC[C@@H]34"
} |
Can you make molecule CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CCCC[C@@H](CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC[C@@H]34"
} |
Can you make molecule CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC[C@H](c1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | CC[C@](C)(CCc1nc(CC(C)C)no1)N1Cc2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "CC[C@@H]34"
} |
Can you make molecule Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c(=O)c(CC(=O)SNc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(CC(=O)SNc3cnn(-c4ccccc4)c3)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c(=O)c(C(=O)CCCC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)CCCC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c(=O)c(C(C)(C)CC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(C)(C)CC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c(=O)c(C(C)(C)CCC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(C)(C)CCC(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c(=O)c([C@H](C)C(=O)SNc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c(C(=O)Nc3cnn(-c4ccccc4)c3)cnc2s1 | Cc1cn2c(=O)c([C@H](C)C(=O)SNc3cnn(-c4ccccc4)c3)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)NC2CCN(Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NC2CCN(Cc3ccccc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C17CC[NH+]5CC1"
} |
Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)NC2CCC(Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NC2CCC(Cc3ccccc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C17CC[NH+]5CC1"
} |
Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)NC2CC(Cc3ccccc3)C2)c1 | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NC2CC(Cc3ccccc3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C17CC[NH+]5CC1"
} |
Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(NC(=O)c2cccc(N(C)C)c2)CCN1Cc1ccccc1 | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | C[C@@H]1CN(NC(=O)c2cccc(N(C)C)c2)CCN1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&[C@H](C)C1",
"old_substring": "C17CC[NH+]5CC1"
} |
Can you make molecule CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1cccc(C(=O)NCC2=CN=N[C@H]2Cc2ccccc2)c1 | CN(C)c1cccc(C(=O)NC2CC[NH+](Cc3ccccc3)CC2)c1 | CN(C)c1cccc(C(=O)NCC2=CN=N[C@H]2Cc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C17CC[NH+]5CC1"
} |
Can you make molecule Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cn2ccnc2c(N[C@@H]2C=CCC2)n1 | Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 | Brc1cn2ccnc2c(N[C@@H]2C=CCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=CCC1",
"old_substring": "[C@H]14CCCOC1"
} |
Can you make molecule Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cn2ccnc2c(N[C@@H]2CCCSC2)n1 | Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 | Brc1cn2ccnc2c(N[C@@H]2CCCSC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@H]14CCCOC1"
} |
Can you make molecule Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cn2ccnc2c(N[C@H]2CSCCS2)n1 | Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 | Brc1cn2ccnc2c(N[C@H]2CSCCS2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]14CCCOC1"
} |
Can you make molecule Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Brc1cn2ccnc2c(N[C@H]2CC=CS2)n1 | Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 | Brc1cn2ccnc2c(N[C@H]2CC=CS2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]14CCCOC1"
} |
Can you make molecule Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1Nc1nc(Br)cn2ccnc12 | Brc1cn2ccnc2c(N[C@H]2CCCOC2)n1 | CC1(C)CCC[C@@H]1Nc1nc(Br)cn2ccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]14CCCOC1"
} |
Can you make molecule CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(c2ccc([C@@H](C)[NH3+])cc2F)C1 | CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | CC1CC(c2ccc([C@@H](C)[NH3+])cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CC1CCN3CC1"
} |
Can you make molecule CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(C)(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | CC1CCC(C)(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CCC&(C)CC1",
"old_substring": "CC1CCN3CC1"
} |
Can you make molecule CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])c1ccc(C2CCCCC2)c(F)c1 | CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | C[C@@H]([NH3+])c1ccc(C2CCCCC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "CC1CCN3CC1"
} |
Can you make molecule CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])c1ccc(C2CCC(C)(C)CC2)c(F)c1 | CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | C[C@@H]([NH3+])c1ccc(C2CCC(C)(C)CC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC1CCN3CC1"
} |
Can you make molecule CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])c1ccc(C2CCC(Cl)CC2)c(F)c1 | CC1CCN(c2ccc([C@@H](C)[NH3+])cc2F)CC1 | C[C@@H]([NH3+])c1ccc(C2CCC(Cl)CC2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "CC1CCN3CC1"
} |
Can you make molecule CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | CC(C)CCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)N(CCCCBr)c1ccccc1 | CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | O=C(CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)N(CCCCBr)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | C=CCCCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)N(CCCCCl)c1ccccc1 | CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | O=C(CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)N(CCCCCl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | CC(C)N(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | C=CCCCCN(C(=O)CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2ccc(CNC(=O)NC[C@H](C)C[C@H](C)O)cc2I)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 | Cc1cccc(-c2ccc(CNC(=O)NC[C@H](C)C[C@H](C)O)cc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18cccc7c1"
} |
Can you make molecule Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cc(CNC(=O)NC[C@H](C)C[C@H](C)O)ccc2Br)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 | Cc1cccc(-c2cc(CNC(=O)NC[C@H](C)C[C@H](C)O)ccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18cccc7c1"
} |
Can you make molecule Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2ccc(CNC(=O)NC[C@H](C)C[C@H](C)O)cc2Cl)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 | Cc1cccc(-c2ccc(CNC(=O)NC[C@H](C)C[C@H](C)O)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18cccc7c1"
} |
Can you make molecule Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2Br)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18cccc7c1"
} |
Can you make molecule Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2Cl)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2)c1 | Cc1cccc(-c2cccc(CNC(=O)NC[C@H](C)C[C@H](C)O)c2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18cccc7c1"
} |
Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(I)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccc(I)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c13ccco1"
} |
Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Br)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccc(Br)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c13ccco1"
} |
Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc(Cl)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccc(Cl)o1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c13ccco1"
} |
Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1occc1Br)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1occc1Br)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c13ccco1"
} |
Can you make molecule O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1C(=O)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | O=C(c1ccco1)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | Cc1ccsc1C(=O)N1N=C2CCCCC[C@@H]2[C@]1(O)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c13ccco1"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)O)SC(=O)C[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)SC(=O)C[C@H]1C[C@@H]2C=C[C@H]1C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(=C=O)C[C@H]1C[C@@H]2C=C[C@H]1C2)CC(C)(C)O | CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(=C=O)C[C@H]1C[C@@H]2C=C[C@H]1C2)CC(C)(C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)O)C(=O)CCCC(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)C(=O)CCCC(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)O)C(=O)CC(C)(C)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(CC(C)(C)O)C(=O)CC(C)(C)[C@H]1C[C@@H]2C=C[C@H]1C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[S@+]([O-])CCC[C@H]1C[C@@H]2C=C[C@H]1C2)CC(C)(C)O | CCN(CC(C)(C)O)C(=O)[C@H]1C[C@@H]2C=C[C@H]1C2 | CCN(C[S@+]([O-])CCC[C@H]1C[C@@H]2C=C[C@H]1C2)CC(C)(C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccccc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccc(I)nc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccc(I)nc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc([C@H]2CCCN(C(=O)Cc3cc4cnsc4s3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cc4cnsc4s3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccc(C)nc3C)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccc(C)nc3C)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccncc3Cl)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3cccnc3)C2)n1 | Cc1cncc([C@H]2CCCN(C(=O)Cc3ccncc3Cl)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c15cccnc1"
} |
Can you make molecule Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1I | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc4cc1"
} |
Can you make molecule Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1Cl | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc4cc1"
} |
Can you make molecule Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1[C@@]12CCC(=O)N1CCC[NH2+]2 | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 | Cc1cc(I)ccc1[C@@]12CCC(=O)N1CCC[NH2+]2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc4cc1"
} |
Can you make molecule Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c([C@@]23CCC(=O)N2CCC[NH2+]3)c1 | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 | Cc1ccc(I)c([C@@]23CCC(=O)N2CCC[NH2+]3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc4cc1"
} |
Can you make molecule Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c([C@@]23CCC(=O)N2CCC[NH2+]3)c1 | Cc1ccc([C@@]23CCC(=O)N2CCC[NH2+]3)cc1 | Cc1ccc(Br)c([C@@]23CCC(=O)N2CCC[NH2+]3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc4cc1"
} |
Can you make molecule CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1cc(Cl)ccc1OCC(=O)NC(C)(C)C | CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O | CC(=O)c1cc(Cl)ccc1OCC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C6(N)=O"
} |
Can you make molecule CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CCCCC(N)=O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CCCCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C6(N)=O"
} |
Can you make molecule CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC/C(N)=N/O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC/C(N)=N/O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C6(N)=O"
} |
Can you make molecule CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC/C(N)=N\O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC/C(N)=N\O | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C6(N)=O"
} |
Can you make molecule CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC(N)=S | CC(C)(C)NC(=O)COc1ccc(Cl)cc1C(N)=O | CC(C)(C)NC(=O)COc1ccc(Cl)cc1CC(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C6(N)=O"
} |
Can you make molecule CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=C(C)C(C)(C)C)C(=O)N1CCN(C(=O)c2ccoc2)CC1 | CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | C=C(C=C(C)C(C)(C)C)C(=O)N1CCN(C(=O)c2ccoc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=6C3=O"
} |
Can you make molecule CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=CCCN1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=CCCN1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=6C3=O"
} |
Can you make molecule CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=C/C(C)=N\ON1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=C/C(C)=N\ON1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C=6C3=O"
} |
Can you make molecule CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=[SH]SC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(=[SH]SC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C=6C3=O"
} |
Can you make molecule CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(CCN1CCN(C(=O)c2ccoc2)CC1)=C(C)C(C)(C)C | CC(=CC(=O)N1CCN(C(=O)c2ccoc2)CC1)C(C)(C)C | CC(CCN1CCN(C(=O)c2ccoc2)CC1)=C(C)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=6C3=O"
} |
Can you make molecule Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccs3)C2)c2ccccc12 | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccs3)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]ccs1",
"old_substring": "c16[nH+]ccn1C"
} |
Can you make molecule Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]c4ccccc4n3C)C2)c2ccccc12 | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]c4ccccc4n3C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c2ccccc2n1C",
"old_substring": "c16[nH+]ccn1C"
} |
Can you make molecule Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]cnc([C@@H]2CCCN(C(=O)Cn3c(=O)cc(C)c4ccccc43)C2)c1C | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 | Cc1[nH+]cnc([C@@H]2CCCN(C(=O)Cn3c(=O)cc(C)c4ccccc43)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1[nH+]cnc&c1C",
"old_substring": "c16[nH+]ccn1C"
} |
Can you make molecule Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]nc([C@@H]2CCCN(C(=O)Cn3c(=O)cc(C)c4ccccc43)C2)c1C | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 | Cc1[nH]nc([C@@H]2CCCN(C(=O)Cn3c(=O)cc(C)c4ccccc43)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1[nH]nc&c1C",
"old_substring": "c16[nH+]ccn1C"
} |
Can you make molecule Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]cnc1[C@@H]1CCCN(C(=O)Cn2c(=O)cc(C)c3ccccc32)C1 | Cc1cc(=O)n(CC(=O)N2CCC[C@@H](c3[nH+]ccn3C)C2)c2ccccc12 | Cc1[nH]cnc1[C@@H]1CCCN(C(=O)Cn2c(=O)cc(C)c3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc[nH]c1C",
"old_substring": "c16[nH+]ccn1C"
} |
Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=C(/C=C/Sc1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCC(Cn3cnc4ccccc43)CC2)nc1-c1ccc(Cl)cc1 | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=Cc1sc(N2CCC(Cn3cnc4ccccc43)CC2)nc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCC(Cn3cnc4ccccc43)CC2)sc1-c1ccc(Cl)cc1 | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=Cc1nc(N2CCC(Cn3cnc4ccccc43)CC2)sc1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCC(Cn2cnc3ccccc32)CC1)n1nc(-c2ccc(Cl)cc2)oc1=S | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | O=C(N1CCC(Cn2cnc3ccccc32)CC1)n1nc(-c2ccc(Cl)cc2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C45"
} |
Can you make molecule O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(-c2ccc(/C=N/ON3CCC(Cn4cnc5ccccc54)CC3)o2)cc1 | O=C(c1ccc(Cl)cc1)N1CCC(Cn2cnc3ccccc32)CC1 | Clc1ccc(-c2ccc(/C=N/ON3CCC(Cn4cnc5ccccc54)CC3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C45"
} |
Can you make molecule O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNCc1cccc(Oc2ccccc2)c1)NCCCO | O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 | O=C(/C=C/SNCc1cccc(Oc2ccccc2)c1)NCCCO | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCCO)nc1NCc1cccc(Oc2ccccc2)c1 | O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 | O=Cc1sc(NCCCO)nc1NCc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCCO)sc1NCc1cccc(Oc2ccccc2)c1 | O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 | O=Cc1nc(NCCCO)sc1NCc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCCCO)CCC1=NCc1cccc(Oc2ccccc2)c1 | O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 | O=C1C(=NCCCO)CCC1=NCc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCO)n1nc(NCc2cccc(Oc3ccccc3)c2)oc1=S | O=C(NCCCO)NCc1cccc(Oc2ccccc2)c1 | O=C(NCCCO)n1nc(NCc2cccc(Oc3ccccc3)c2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C34"
} |
Can you make molecule O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=Cc1ccc(OCC(=O)[O-])c([N+](=O)[O-])c1)C(=O)c1ccc(F)cc1F | O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] | C=C(C=Cc1ccc(OCC(=O)[O-])c([N+](=O)[O-])c1)C(=O)c1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=6C5=O"
} |
Can you make molecule O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])COc1ccc(C=CCCc2ccc(F)cc2F)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=CCCc2ccc(F)cc2F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=6C5=O"
} |
Can you make molecule O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(OCC(=O)[O-])c([N+](=O)[O-])c1)CCc1ccc(F)cc1F | O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] | CC(=Cc1ccc(OCC(=O)[O-])c([N+](=O)[O-])c1)CCc1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=6C5=O"
} |
Can you make molecule O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])COc1ccc(C=CCCc2ccc(F)cc2F)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=CCCc2ccc(F)cc2F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C=6C5=O"
} |
Can you make molecule O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])COc1ccc(C=C2CCC(O)(c3ccc(F)cc3F)CC2)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=CC(=O)c2ccc(F)cc2F)cc1[N+](=O)[O-] | O=C([O-])COc1ccc(C=C2CCC(O)(c3ccc(F)cc3F)CC2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(O)CC1",
"old_substring": "C=6C5=O"
} |
Can you make molecule CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | C=CSn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)n1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CC(C)n1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC5"
} |
Can you make molecule CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | C=CCCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@@H]1NS(=O)(=O)c1cn(CCCCl)nc1N | CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CC1(C)CCCC[C@@H]1NS(=O)(=O)c1cn(CCCCl)nc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@@H]1NS(=O)(=O)c1cn(CCCCS)nc1N | CCn1cc(S(=O)(=O)N[C@H]2CCCCC2(C)C)c(N)n1 | CC1(C)CCCC[C@@H]1NS(=O)(=O)c1cn(CCCCS)nc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.