prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH+]1CCCC1(C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+]1CCCC1(C)C)NC(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]4(C)C"
} |
Can you make molecule C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[N+](C)(C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[N+](C)(C)C)NC(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "[NH+]4(C)C"
} |
Can you make molecule C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH+]1CC(C)(C)C1)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+]1CC(C)(C)C1)NC(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]4(C)C"
} |
Can you make molecule C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH+]1CCC(C)(C)C1)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@H](CC[NH+]1CCC(C)(C)C1)NC(=O)Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]4(C)C"
} |
Can you make molecule C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[NH+]2CC(C(=O)Cc3cccc(Cl)c3)(CCCN1)C2 | C[C@H](CC[NH+](C)C)NC(=O)Cc1cccc(Cl)c1 | C[C@@H]1CC[NH+]2CC(C(=O)Cc3cccc(Cl)c3)(CCCN1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH+]4(C)C"
} |
Can you make molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCC[C@@H](CO)C1)Nc1cccc(OC[C@H]2CCCO2)c1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 | O=C(/C=C/SN1CCC[C@@H](CO)C1)Nc1cccc(OC[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 less soluble in water? The output molecule should be similar to the input molecule. | OC[C@@H]1CCCN(c2ccc(/C=N/ONc3cccc(OC[C@H]4CCCO4)c3)o2)C1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 | OC[C@@H]1CCCN(c2ccc(/C=N/ONc3cccc(OC[C@H]4CCCO4)c3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCC[C@@H](CO)C2)CC1)Nc1cccc(OC[C@H]2CCCO2)c1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 | O=C(NN=C1CCC(N2CCC[C@@H](CO)C2)CC1)Nc1cccc(OC[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)C1=CC[C@H](N2CCC[C@@H](CO)C2)S1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)C1=CC[C@H](N2CCC[C@@H](CO)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCC[C@@H](CO)C1)Nc1cccc(OC[C@H]2CCCO2)c1 | O=C(Nc1cccc(OC[C@H]2CCCO2)c1)N1CCC[C@@H](CO)C1 | O=C(/N=c1\ccccn1N1CCC[C@@H](CO)C1)Nc1cccc(OC[C@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC(=S)NCc1ccco1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NCc1ccco1)C1CCCCC1 | O=C(NC(=S)NCc1ccco1)C1CC1 | O=C(NC(=S)NCc1ccco1)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule O=C(NC(=S)NCc1ccco1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NCc1ccco1)C1SCCCS1 | O=C(NC(=S)NCc1ccco1)C1CC1 | O=C(NC(=S)NCc1ccco1)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule O=C(NC(=S)NCc1ccco1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NCc1ccco1)C1SCSCS1 | O=C(NC(=S)NCc1ccco1)C1CC1 | O=C(NC(=S)NCc1ccco1)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule O=C(NC(=S)NCc1ccco1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NCc1ccco1)C1CCCCCC1 | O=C(NC(=S)NCc1ccco1)C1CC1 | O=C(NC(=S)NCc1ccco1)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule O=C(NC(=S)NCc1ccco1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NCc1ccco1)C1CSCCSC1 | O=C(NC(=S)NCc1ccco1)C1CC1 | O=C(NC(=S)NCc1ccco1)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C14CC1"
} |
Can you make molecule N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCNC(=O)c2sc(C3CC3)nc2Cl)cc1 | N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 | N#Cc1ccc(OCCNC(=O)c2sc(C3CC3)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17scnc18"
} |
Can you make molecule N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)NCCOc2ccc(C#N)cc2)sc2ncc(C3CC3)cc12 | N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 | Cc1c(C(=O)NCCOc2ccc(C#N)cc2)sc2ncc(C3CC3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ncc&cc2c1C",
"old_substring": "c17scnc18"
} |
Can you make molecule N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCNC(=O)c2sc(C3CC3)cc2Br)cc1 | N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 | N#Cc1ccc(OCCNC(=O)c2sc(C3CC3)cc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&cc1Br",
"old_substring": "c17scnc18"
} |
Can you make molecule N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCNC(=O)c2csc(C3CC3)c2)cc1 | N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 | N#Cc1ccc(OCCNC(=O)c2csc(C3CC3)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c17scnc18"
} |
Can you make molecule N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OCCNC(=O)c2nc3sc(C4CC4)cc3s2)cc1 | N#Cc1ccc(OCCNC(=O)c2scnc2C2CC2)cc1 | N#Cc1ccc(OCCNC(=O)c2nc3sc(C4CC4)cc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2sc&cc2s1",
"old_substring": "c17scnc18"
} |
Can you make molecule N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCSN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | N#CCSN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N16CCN7CC1"
} |
Can you make molecule N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN=C1CCc1cccc(OCc2ccccc2C#N)c1 | N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | N#CCN1CCN=C1CCc1cccc(OCc2ccccc2C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N16CCN7CC1"
} |
Can you make molecule N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCCN(Cc2cccc(OCc3ccccc3C#N)c2)C1=O | N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | N#CCN1CCCN(Cc2cccc(OCc3ccccc3C#N)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N16CCN7CC1"
} |
Can you make molecule N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCN1CCN=C1SCc1cccc(OCc2ccccc2C#N)c1 | N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | N#CCN1CCN=C1SCc1cccc(OCc2ccccc2C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N16CCN7CC1"
} |
Can you make molecule N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(CC#N)CCN1Cc1cccc(OCc2ccccc2C#N)c1 | N#CCN1CCN(Cc2cccc(OCc3ccccc3C#N)c2)CC1 | CC1(C)CN(CC#N)CCN1Cc1cccc(OCc2ccccc2C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N16CCN7CC1"
} |
Can you make molecule Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(CBr)=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C | CC(CBr)=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CBr",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC2(C)CCCC2)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC2(C)CCCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(Cl)(Cl)Cl)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(Cl)(Cl)Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)C(C)=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C | CCC(CC)C(C)=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C)N1CCCC1 | Cc1cccc(Nc2ccccc2C(=O)NNC(=O)C(=O)NC(C)C)c1C | CC(=NC(=O)C(=O)NNC(=O)c1ccccc1Nc1cccc(C)c1C)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)N1CCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CC[C@@H](N3CCCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CC[C@@H](N3CCCCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCCCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CC[C@@H](N3CCSCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCSCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CC[C@@H](N3CC=CC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CC=CC3)[C@H](O)C2)[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CC[C@@H](SSN3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](N3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | Cc1c(C[NH+]2CC[C@@H](SSN3CCOCC3)[C@H](O)C2)[nH]c2c(C)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)NCCCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NCCCCNC(=O)c2ccc(F)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C7"
} |
Can you make molecule Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)N=CCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)N=CCCNC(=O)c2ccc(F)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C6C7"
} |
Can you make molecule Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)NCCCCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NCCCCCNC(=O)c2ccc(F)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C7"
} |
Can you make molecule Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)NC2CC(NC(=O)c3ccc(F)cc3)C2)c1Cl | Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl | Cc1cccc(NC(=O)NC2CC(NC(=O)c3ccc(F)cc3)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C7"
} |
Can you make molecule Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(CCNC(=O)c1ccc(F)cc1)=NC(=O)Nc1cccc(C)c1Cl | Cc1cccc(NC(=O)NCCNC(=O)c2ccc(F)cc2)c1Cl | CC(CCNC(=O)c1ccc(F)cc1)=NC(=O)Nc1cccc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C6C7"
} |
Can you make molecule CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn(-c2ccc(OCCCS(C)(=O)=O)cc2)n1 | CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 | Cc1ccn(-c2ccc(OCCCS(C)(=O)=O)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(C)n1",
"old_substring": "n15cncn1"
} |
Can you make molecule CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CCCOc1ccc(-n2cc(I)cn2)cc1 | CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 | CS(=O)(=O)CCCOc1ccc(-n2cc(I)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n15cncn1"
} |
Can you make molecule CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cncc1-c1ccc(OCCCS(C)(=O)=O)cc1 | CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 | Cn1cncc1-c1ccc(OCCCS(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1cncc1&",
"old_substring": "n15cncn1"
} |
Can you make molecule CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncn(-c2ccc(OCCCS(C)(=O)=O)cc2)c1C | CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 | Cc1ncn(-c2ccc(OCCCS(C)(=O)=O)cc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc(C)c1C",
"old_substring": "n15cncn1"
} |
Can you make molecule CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1-c1ccc(OCCCS(C)(=O)=O)cc1 | CS(=O)(=O)CCCOc1ccc(-n2cncn2)cc1 | Cc1nccn1-c1ccc(OCCCS(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccnc1C",
"old_substring": "n15cncn1"
} |
Can you make molecule Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1Cl | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccc(I)cc1 | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C)nn3c(C)c(C(=O)C=Cc4ccccc4)nnc23)cc1I | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 | Cc1ccc(-c2c(C)nn3c(C)c(C(=O)C=Cc4ccccc4)nnc23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1cccc(Br)c1 | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2c(C)nn3c(C)c(C(=O)C=Cc4ccccc4)nnc23)c1C | Cc1nn2c(C)c(C(=O)C=Cc3ccccc3)nnc2c1-c1ccccc1 | Cc1cccc(-c2c(C)nn3c(C)c(C(=O)C=Cc4ccccc4)nnc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(NC(=O)CC(C)(C)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)CC(C)(C)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(NC(=O)CCC(C)(C)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)CCC(C)(C)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(NC(=O)C[C@@H](Br)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(NC(=O)C[C@@H](Br)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(Nc2cc(C)n(NC[C@@H](C)[NH+]3CCC[C@H](C)C3)c(=O)c2)ccc1OC | CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(Nc2cc(C)n(NC[C@@H](C)[NH+]3CCC[C@H](C)C3)c(=O)c2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(Nc2c(C)n(NC[C@@H](C)[NH+]3CCC[C@H](C)C3)ccc2=O)ccc1OC | CCOc1cc(NC(=O)NC[C@@H](C)[NH+]2CCC[C@H](C)C2)ccc1OC | CCOc1cc(Nc2c(C)n(NC[C@@H](C)[NH+]3CCC[C@H](C)C3)ccc2=O)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1I | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)ccc1Br | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 | CC(C)Oc1cc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1Cl | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)c1Br | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 | CC(C)Oc1cccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)c1Cl | CC(C)Oc1ccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)cc1 | CC(C)Oc1cccc(CC[C@@H](C)NC(=O)[C@@H]2CCN(C)C(=O)C2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc8cc1"
} |
Can you make molecule Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1CNC(=O)CC(C)(C)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)CC(C)(C)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1CNC(=O)CCC(C)(C)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)CCC(C)(C)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncnc1CNC(=O)C[C@@H](Br)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)C[C@@H](Br)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NCc2ncnn2C)cc(=O)n1N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cc1cc(NCc2ncnn2C)cc(=O)n1N1CCC[C@@H]1c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(NCc2ncnn2C)c(=O)ccn1N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cn1ncnc1CNC(=O)N1CCC[C@@H]1c1ccc2c(c1)OCO2 | Cc1c(NCc2ncnn2C)c(=O)ccn1N1CCC[C@@H]1c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](CCS(=O)(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](CCS(=O)(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(=O)CO)CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(=O)CO)CC[NH+]1CC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(O)O)CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(O)O)CC[NH+]1CC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1[C@H](C(F)(F)C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | C[C@H]1[C@H](C(F)(F)C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])[C@@H]1CC[NH+](CC(=O)NC(C)(C)C)[C@H]1C | C[C@H]1[C@H](C(=O)[O-])CC[NH+]1CC(=O)NC(C)(C)C | CCC(CC)(C(=O)[O-])[C@@H]1CC[NH+](CC(=O)NC(C)(C)C)[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | C=CSc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC8"
} |
Can you make molecule CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | CC(C)c1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC8"
} |
Can you make molecule CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | C=CCCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC8"
} |
Can you make molecule CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS[C@H]1N=NC(=O)[C@H]2C=C(c3ccc(CCCCl)cc3)NN12)c1ccc2c(c1)OCO2 | CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | O=C(CS[C@H]1N=NC(=O)[C@H]2C=C(c3ccc(CCCCl)cc3)NN12)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC8"
} |
Can you make molecule CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS[C@H]1N=NC(=O)[C@H]2C=C(c3ccc(CCCCS)cc3)NN12)c1ccc2c(c1)OCO2 | CCc1ccc(C2=C[C@@H]3C(=O)N=N[C@H](SCC(=O)c4ccc5c(c4)OCO5)N3N2)cc1 | O=C(CS[C@H]1N=NC(=O)[C@H]2C=C(c3ccc(CCCCS)cc3)NN12)c1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC8"
} |
Can you make molecule O=C(CCOc1cccc(Br)c1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCOc1cccc(Br)c1)N1CCCCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N12CCCC1"
} |
Can you make molecule O=C(CCOc1cccc(Br)c1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCOc1cccc(Br)c1)N1CCCCCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N12CCCC1"
} |
Can you make molecule O=C(CCOc1cccc(Br)c1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(C(=O)CCOc2cccc(Br)c2)CC1 | O=C(CCOc1cccc(Br)c1)N1CCCC1 | CC1CCN(C(=O)CCOc2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N12CCCC1"
} |
Can you make molecule O=C(CCOc1cccc(Br)c1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCOc1cccc(Br)c1)N1CCCCCCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCC1 | O=C(CCOc1cccc(Br)c1)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N12CCCC1"
} |
Can you make molecule O=C(CCOc1cccc(Br)c1)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCCCCN1C(=O)CCOc1cccc(Br)c1 | O=C(CCOc1cccc(Br)c1)N1CCCC1 | O=C1CCCCCCN1C(=O)CCOc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N12CCCC1"
} |
Can you make molecule O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@@H]1CC[C@@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1CC[C@@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]15"
} |
Can you make molecule O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1C=C[C@@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 | O=C([C@H]1C=C[C@@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]15"
} |
Can you make molecule O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1C=C[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 | O=C([C@H]1C=C[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]15"
} |
Can you make molecule O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1CCC[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 | O=C([C@H]1CCC[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]15"
} |
Can you make molecule O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1CCCC[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | O=C([C@@H]1C[C@@H]1c1cc(F)ccc1F)N1CCc2cc(F)ccc2C1 | O=C([C@H]1CCCC[C@H](c2cc(F)ccc2F)C1)N1CCc2cc(F)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]15"
} |
Can you make molecule CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCCS2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCCS2)C1)N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CCCCC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CCCCC2)C1)N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCCCS2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCCCS2)C1)N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCSCS2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2SCSCS2)C1)N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CCCCCC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CC2)C1)N1CCCCC1=O | CC(C)C[C@@H](C(=O)N[C@H]1CC(=O)N(C2CCCCCC2)C1)N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2Cl)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccc(I)cc2)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccc(I)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc(NC(=O)C(=O)N/N=C/c3ccco3)s2)cc1I | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 | Cc1ccc(-c2nnc(NC(=O)C(=O)N/N=C/c3ccco3)s2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2cccc(Br)c2)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2cccc(Br)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nnc(NC(=O)C(=O)N/N=C/c3ccco3)s2)c1C | O=C(N/N=C/c1ccco1)C(=O)Nc1nnc(-c2ccccc2)s1 | Cc1cccc(-c2nnc(NC(=O)C(=O)N/N=C/c3ccco3)s2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | C=CS[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | C=CCC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCCCl)CCNc1cc2ccccc2c(Cl)n1 | CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | C[NH+](CCCCl)CCNc1cc2ccccc2c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCCCS)CCNc1cc2ccccc2c(Cl)n1 | CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | C[NH+](CCCCS)CCNc1cc2ccccc2c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCCBr)CCNc1cc2ccccc2c(Cl)n1 | CC[NH+](C)CCNc1cc2ccccc2c(Cl)n1 | C[NH+](CCCBr)CCNc1cc2ccccc2c(Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.