prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2ccncc2)CCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 | CCC1(c2ccncc2)CCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2ccncc2)CCCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 | CCC1(c2ccncc2)CCCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C(=O)c2cnc([C@H]3CCCO3)s2)c(C#N)c1-c1ccncc1 | CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 | CCc1oc(C(=O)c2cnc([C@H]3CCCO3)s2)c(C#N)c1-c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(c2ccncc2)CCC(=O)N(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 | CCC1(c2ccncc2)CCC(=O)N(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@]1(c2ccncc2)CCCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | CCN(C(=O)c1cnc([C@H]2CCCO2)s1)c1ccncc1 | CC[C@@]1(c2ccncc2)CCCN(C(=O)c2cnc([C@H]3CCCO3)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CCCCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(CCCCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C8C5"
} |
Can you make molecule CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CCCCCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(CCCCCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C8C5"
} |
Can you make molecule CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C2CC(NC(=O)C(=O)Nc3cccc(SC)c3)C2)cc1 | CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(C2CC(NC(=O)C(=O)Nc3cccc(SC)c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C8C5"
} |
Can you make molecule CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(C2CCN(NC(=O)C(=O)Nc3cccc(SC)c3)CC2)cc1 | CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(C2CCN(NC(=O)C(=O)Nc3cccc(SC)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C8C5"
} |
Can you make molecule CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@@H](C)CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc(CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | CCc1ccc([C@@H](C)CCNC(=O)C(=O)Nc2cccc(SC)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C8C5"
} |
Can you make molecule C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCCCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CC(C)=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CC(C)=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC=&C",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCCCCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCCC=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC=&",
"old_substring": "C=CC3"
} |
Can you make molecule C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(F)=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCNC(=O)NNC(=O)Cc1ccc(Cl)cc1 | C=CCC(F)=NC(=O)NNC(=O)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC=&F",
"old_substring": "C=CC3"
} |
Can you make molecule O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)CCN1c1cccnc1 | O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 | O=C1C2=CC=CC2=C(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)CCN1c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)cc(-c2cccnc2)ccc2oc1-2 | O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 | O=Cc1c(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)cc(-c2cccnc2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cccnc1)N[C@H](N1CCOCC1)C(Cl)(Cl)Cl | O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 | O=C(/C=C/Sc1cccnc1)N[C@H](N1CCOCC1)C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)nc1-c1cccnc1 | O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 | O=Cc1sc(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)nc1-c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C25"
} |
Can you make molecule O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)sc1-c1cccnc1 | O=C(N[C@H](N1CCOCC1)C(Cl)(Cl)Cl)c1cccnc1 | O=Cc1nc(N[C@H](N2CCOCC2)C(Cl)(Cl)Cl)sc1-c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C25"
} |
Can you make molecule CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCc1ncc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1ncc(NC(=O)Nc2cn(C)nc2CC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c17nnc5s1"
} |
Can you make molecule CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCc1ncc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1ncc(NC(=O)Nc2cn(C)nc2CC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1nc&sc1&",
"old_substring": "c17nnc5s1"
} |
Can you make molecule CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCc1nn(NC(=O)Nc2cn(C)nc2CC)c(=S)s1 | CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nn(NC(=O)Nc2cn(C)nc2CC)c(=S)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)s1",
"old_substring": "c17nnc5s1"
} |
Can you make molecule CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCc1nc(C)c(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nc(C)c(NC(=O)Nc2cn(C)nc2CC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&s1",
"old_substring": "c17nnc5s1"
} |
Can you make molecule CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCc1nc2sc(NC(=O)Nc3cn(C)nc3CC)nc2s1 | CCCCCc1nnc(NC(=O)Nc2cn(C)nc2CC)s1 | CCCCCc1nc2sc(NC(=O)Nc3cn(C)nc3CC)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2sc&nc2s1",
"old_substring": "c17nnc5s1"
} |
Can you make molecule NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@H]1CCN(c2nc3c(Br)cccn3n2)C1 | NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@H]1CCN(c2nc3c(Br)cccn3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&N&C1",
"old_substring": "[C@H]14C[NH2+]CCN13"
} |
Can you make molecule NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@H]1CNCCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@H]1CNCCN1c1nc2c(Br)cccn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&CCN1&",
"old_substring": "[C@H]14C[NH2+]CCN13"
} |
Can you make molecule NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@H]1CCN(c2nc3c(Br)cccn3n2)C1 | NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@H]1CCN(c2nc3c(Br)cccn3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&N&C1",
"old_substring": "[C@H]14C[NH2+]CCN13"
} |
Can you make molecule NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@H]1CCCN(c2nc3c(Br)cccn3n2)C1 | NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@H]1CCCN(c2nc3c(Br)cccn3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&CN&C1",
"old_substring": "[C@H]14C[NH2+]CCN13"
} |
Can you make molecule NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H]1CCN(c2nc3c(Br)cccn3n2)C1 | NC(=O)[C@H]1C[NH2+]CCN1c1nc2c(Br)cccn2n1 | NC(=O)[C@@H]1CCN(c2nc3c(Br)cccn3n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C[C@H]&N&C1",
"old_substring": "[C@H]14C[NH2+]CCN13"
} |
Can you make molecule C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3SCCS3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3SCCS3)c3ccccc3)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Oc2ccc(N[C@H](C(=O)N=C3CCC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)N=C3CCC3)c3ccccc3)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C17CC1"
} |
Can you make molecule C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CCCCC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CCCCC3)c3ccccc3)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Oc2ccc(N[C@H](C(=O)N=C3CCCC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)N=C3CCCC3)c3ccccc3)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3SCCCS3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3CC3)c3ccccc3)cc2NC1=O | C[C@@H]1Oc2ccc(N[C@H](C(=O)NC3SCCCS3)c3ccccc3)cc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COCCCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC5"
} |
Can you make molecule COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(Nc2nc(-c3ccccc3)nc3nc(-c4ccccc4)oc23)CC1 | COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COC1CCC(Nc2nc(-c3ccccc3)nc3nc(-c4ccccc4)oc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COCC(C)(C)CNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COCC(C)(C)CNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC5"
} |
Can you make molecule COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COC1CCC(=Nc2nc(-c3ccccc3)nc3nc(-c4ccccc4)oc23)CC1 | COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | COC1CCC(=Nc2nc(-c3ccccc3)nc3nc(-c4ccccc4)oc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12)OC | COCCCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12 | CCC[C@@H](CCNc1nc(-c2ccccc2)nc2nc(-c3ccccc3)oc12)OC | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC5"
} |
Can you make molecule Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1noc(CN2CCN(CCC(CO)=C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(CCC(CO)=C3CC3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1noc(CN2CCN(SC(=O)CC3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(SC(=O)CC3CC3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1noc(CN2CCN(CC(=C=O)CC3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(CC(=C=O)CC3CC3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1noc(CN2CCN(C(=O)CCCC(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)CCCC(=O)C3CC3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1-c1noc(CN2CCN(C(=O)CC(C)(C)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)C3CC3)CC2)n1 | Cc1ccccc1-c1noc(CN2CCN(C(=O)CC(C)(C)C3CC3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CC(=O)SN2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(CC(=O)SN2CCC(Oc3cccnc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)CCCC(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)CCCC(=O)N2CCC(Oc3cccnc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)(C)CC(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(C)(C)CC(=O)N2CCC(Oc3cccnc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)(C)CCC(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(C)(C)CCC(=O)N2CCC(Oc3cccnc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](C)C(=O)SN2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc(C(=O)N2CCC(Oc3cccnc3)CC2)c1 | Cc1cccc([C@H](C)C(=O)SN2CCC(Oc3cccnc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/C=C\c1ccco1)N1CCOc2ccc(Cc3ccc(Cl)cc3Cl)cc2C1 | O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl | O=C(N/C=C\c1ccco1)N1CCOc2ccc(Cc3ccc(Cl)cc3Cl)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O24"
} |
Can you make molecule O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/C=C\c1ccco1)c1cc2ccc-2ncn(Cc2ccc(Cl)cc2Cl)c1=O | O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl | O=C(N/C=C\c1ccco1)c1cc2ccc-2ncn(Cc2ccc(Cl)cc2Cl)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O24"
} |
Can you make molecule O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/C=C\c1ccco1)c1ccc2nc-2ccn(Cc2ccc(Cl)cc2Cl)c1=O | O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl | O=C(N/C=C\c1ccco1)c1ccc2nc-2ccn(Cc2ccc(Cl)cc2Cl)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O24"
} |
Can you make molecule O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(C(=O)N/C=C\c2ccco2)oc2ccc(Cc3ccc(Cl)cc3Cl)cc12 | O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl | O=Cc1c(C(=O)N/C=C\c2ccco2)oc2ccc(Cc3ccc(Cl)cc3Cl)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O24"
} |
Can you make molecule O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N/C=C\c1ccco1)OC(=S)SCc1ccc(Cl)cc1Cl | O=C(N/C=C\c1ccco1)OCc1ccc(Cl)cc1Cl | O=C(N/C=C\c1ccco1)OC(=S)SCc1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O24"
} |
Can you make molecule C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CCC[NH+]2CCC(Cc3c([C@@H]4CCC[NH2+]C4)[nH]c4ncccc34)CC2)cc1 | C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 | c1ccc(CCC[NH+]2CCC(Cc3c([C@@H]4CCC[NH2+]C4)[nH]c4ncccc34)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH+]34"
} |
Can you make molecule C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | C1=C(CCCc2ccccc2)C[NH+](Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC1 | C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 | C1=C(CCCc2ccccc2)C[NH+](Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH+]34"
} |
Can you make molecule C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC1(CCc2ccccc2)CC[NH+](Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC1 | C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 | CC1(CCc2ccccc2)CC[NH+](Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH+]34"
} |
Can you make molecule C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC1(Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC[NH+](CCCc2ccccc2)CC1 | C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 | CC1(Cc2c([C@@H]3CCC[NH2+]C3)[nH]c3ncccc23)CC[NH+](CCCc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH+]34"
} |
Can you make molecule C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc(CCC[NH+]2CC[C@@H](Cc3c([C@@H]4CCC[NH2+]C4)[nH]c4ncccc34)C2)cc1 | C[NH+](CCc1ccccc1)Cc1c([C@@H]2CCC[NH2+]C2)[nH]c2ncccc12 | c1ccc(CCC[NH+]2CC[C@@H](Cc3c([C@@H]4CCC[NH2+]C4)[nH]c4ncccc34)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CC[C@@H]&C1",
"old_substring": "C[NH+]34"
} |
Can you make molecule COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1C(=O)Nc1c(F)cc(-c2ccc(CO)o2)cc1Cl | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C | COc1ccc(Cl)cc1C(=O)Nc1c(F)cc(-c2ccc(CO)o2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(F)cc&cc1Cl",
"old_substring": "c15cc8ccc1C"
} |
Can you make molecule COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)c(F)cc1Cl | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)c(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(F)cc1Cl",
"old_substring": "c15cc8ccc1C"
} |
Can you make molecule COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1C(=O)Nc1cc(Br)c(-c2ccc(CO)o2)cc1C | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C | COc1ccc(Cl)cc1C(=O)Nc1cc(Br)c(-c2ccc(CO)o2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1C",
"old_substring": "c15cc8ccc1C"
} |
Can you make molecule COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1Br | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cc8ccc1C"
} |
Can you make molecule COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1C(=O)Nc1cccc(-c2ccc(CO)o2)c1Br | COc1ccc(Cl)cc1C(=O)Nc1cc(-c2ccc(CO)o2)ccc1C | COc1ccc(Cl)cc1C(=O)Nc1cccc(-c2ccc(CO)o2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cc8ccc1C"
} |
Can you make molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCC4)nn3)c2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N18CCCC1"
} |
Can you make molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCC4)nn3)c2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N18CCCC1"
} |
Can you make molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCC(C)CC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCC(C)CC4)nn3)c2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N18CCCC1"
} |
Can you make molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCCC4)nn3)c2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N18CCCC1"
} |
Can you make molecule COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCC4=O)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCC4)nn3)c2)cc(OC)c1 | COc1cc(NC(=O)c2cccc(-c3ccc(N4CCCCCCC4=O)nn3)c2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N18CCCC1"
} |
Can you make molecule CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC(c2nc(C(=O)N(CC(N)=O)C3CCCC3)n[nH]2)C1 | CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | CC1CC(c2nc(C(=O)N(CC(N)=O)C3CCCC3)n[nH]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | CC(C)CCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN(C(=O)c1n[nH]c(CCCCBr)n1)C1CCCC1 | CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | NC(=O)CN(C(=O)c1n[nH]c(CCCCBr)n1)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | C=CCCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC7"
} |
Can you make molecule CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN(C(=O)c1n[nH]c(CCCCCl)n1)C1CCCC1 | CCCc1nc(C(=O)N(CC(N)=O)C2CCCC2)n[nH]1 | NC(=O)CN(C(=O)c1n[nH]c(CCCCCl)n1)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC7"
} |
Can you make molecule COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.Cc1nc2ccccc2[nH]1 | COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.Cc1nc2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc2c&cccc2[nH]1",
"old_substring": "c1%10nc2ccccc2[nH]1"
} |
Can you make molecule COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2[nH]ccc2c1 | COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2[nH]ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2[nH]1",
"old_substring": "c1%10nc2ccccc2[nH]1"
} |
Can you make molecule COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2scnc2c1 | COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2scnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2s1",
"old_substring": "c1%10nc2ccccc2[nH]1"
} |
Can you make molecule COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2ocnc2c1 | COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1ccc2ocnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2o1",
"old_substring": "c1%10nc2ccccc2[nH]1"
} |
Can you make molecule COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1cc2occc2[nH]1 | COc1cc(C(=O)N2CCC[C@@H](c3nc4ccccc4[nH]3)C2)cc(Cl)c1OC(C)C | COc1cc(C(=O)N2CCCCC2)cc(Cl)c1OC(C)C.c1cc2occc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2[nH]1",
"old_substring": "c1%10nc2ccccc2[nH]1"
} |
Can you make molecule C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC=CC[C@H]1c1cc2c(cc1Br)C(=O)C(=O)N2 | C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 | C[C@H]1CC=CC[C@H]1c1cc2c(cc1Br)C(=O)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC=CC[C@H]1&",
"old_substring": "C[C@H]1CN4C[C@H](C)S1"
} |
Can you make molecule C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@@H](c2cc3c(cc2Br)C(=O)C(=O)N3)CS1 | C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 | C[C@H]1C[C@@H](c2cc3c(cc2Br)C(=O)C(=O)N3)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@@H]&CS1",
"old_substring": "C[C@H]1CN4C[C@H](C)S1"
} |
Can you make molecule C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@]1(c2cc3c(cc2Br)C(=O)C(=O)N3)CCCS1 | C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 | C[C@]1(c2cc3c(cc2Br)C(=O)C(=O)N3)CCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@]1&CCCS1",
"old_substring": "C[C@H]1CN4C[C@H](C)S1"
} |
Can you make molecule C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1SCCC[C@@H]1c1cc2c(cc1Br)C(=O)C(=O)N2 | C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 | C[C@H]1SCCC[C@@H]1c1cc2c(cc1Br)C(=O)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "C[C@H]1CN4C[C@H](C)S1"
} |
Can you make molecule C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCS)CCc1cc2c(cc1Br)C(=O)C(=O)N2 | C[C@H]1CN(c2cc3c(cc2Br)C(=O)C(=O)N3)C[C@H](C)S1 | C[C@H](CCS)CCc1cc2c(cc1Br)C(=O)C(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCS",
"old_substring": "C[C@H]1CN4C[C@H](C)S1"
} |
Can you make molecule Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@]2(c3ccccn3)CCC[C@@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 | Clc1ccc([C@]2(c3ccccn3)CCC[C@@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]48C7"
} |
Can you make molecule Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@]2(c3ccccn3)CC[C@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 | Clc1ccc([C@]2(c3ccccn3)CC[C@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@@H]48C7"
} |
Can you make molecule Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(c1ccccn1)[C@H](CCCc1ccc(Cl)cc1)[NH2+]C[C@H]1C[NH+]2CCN1CC2 | Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 | CC(C)(c1ccccn1)[C@H](CCCc1ccc(Cl)cc1)[NH2+]C[C@H]1C[NH+]2CCN1CC2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@@H]48C7"
} |
Can you make molecule Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@@]2(c3ccccn3)CC[C@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 | Clc1ccc([C@@]2(c3ccccn3)CC[C@H]([NH2+]C[C@H]3C[NH+]4CCN3CC4)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@@H]48C7"
} |
Can you make molecule Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc([C@H]2CC([NH2+]C[C@H]3C[NH+]4CCN3CC4)C[C@@H](c3ccccn3)C2)cc1 | Clc1ccc([C@H](Cc2ccccn2)[NH2+]C[C@H]2C[NH+]3CCN2CC3)cc1 | Clc1ccc([C@H]2CC([NH2+]C[C@H]3C[NH+]4CCN3CC4)C[C@@H](c3ccccn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "[C@@H]48C7"
} |
Can you make molecule c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 | C[C@H]1CCCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@H](C)CC1",
"old_substring": "N16C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1"
} |
Can you make molecule c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 | CC1CCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N16C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1"
} |
Can you make molecule c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 | C[C@@H]1CCCN(c2cc(-c3ccccc3)[nH+]c3ccccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H](C)CC1",
"old_substring": "N16C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1"
} |
Can you make molecule c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)c1cc(-c2ccccc2)[nH+]c2ccccc12 | c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 | CC[C@@H](C)C[C@H](CC)c1cc(-c2ccccc2)[nH+]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "N16C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1"
} |
Can you make molecule c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C[C@H](C)CO)c1cc(-c2ccccc2)[nH+]c2ccccc12 | c1ccc(-c2cc(N3C[C@@H]4[C@H](C3)[C@H]3CC[C@@H]4O3)c3ccccc3[nH+]2)cc1 | CC[C@@H](C[C@H](C)CO)c1cc(-c2ccccc2)[nH+]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CO",
"old_substring": "N16C[C@@H]2[C@H](C1)[C@H]1CC[C@@H]2O1"
} |
Can you make molecule C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CC(C)(C)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)CC(C)(C)NCC1([NH+](C)C)CCCCC1)c1nncn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCC(C)(C)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)CCC(C)(C)NCC1([NH+](C)C)CCCCC1)c1nncn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N[C@@H](C)c2nncn2C)c(=O)n(NCC2([NH+](C)C)CCCCC2)n1C | C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C | Cc1c(N[C@@H](C)c2nncn2C)c(=O)n(NCC2([NH+](C)C)CCCCC2)n1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)c(N[C@@H](C)c2nncn2C)nn1NCC1([NH+](C)C)CCCCC1 | C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C | Cc1cc(=O)c(N[C@@H](C)c2nncn2C)nn1NCC1([NH+](C)C)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)C[C@@H](Br)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)NCC1([NH+](C)C)CCCCC1)c1nncn1C | C[C@H](NC(=O)C[C@@H](Br)NCC1([NH+](C)C)CCCCC1)c1nncn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.