prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](CCCBr)[C@H](OCC(C)(C)C(=O)NN)C1 | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | C[C@H]1CC[C@@H](CCCBr)[C@H](OCC(C)(C)C(=O)NN)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | CC(C)CC[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](CCCCBr)[C@H](OCC(C)(C)C(=O)NN)C1 | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | C[C@H]1CC[C@@H](CCCCBr)[C@H](OCC(C)(C)C(=O)NN)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | C=CCCC[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](CCCCCl)[C@H](OCC(C)(C)C(=O)NN)C1 | CC(C)[C@@H]1CC[C@H](C)C[C@H]1OCC(C)(C)C(=O)NN | C[C@H]1CC[C@@H](CCCCCl)[C@H](OCC(C)(C)C(=O)NN)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC4C"
} |
Can you make molecule CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)c[nH]1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c[nH]1",
"old_substring": "c17cc4[nH]n1"
} |
Can you make molecule CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 | CCc1ccc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&[nH]1",
"old_substring": "c17cc4[nH]n1"
} |
Can you make molecule CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2[nH]c(NC(=O)c3cnn(C(C)C)c3C(F)(F)F)nc2c1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 | CCc1ccc2[nH]c(NC(=O)c3cnn(C(C)C)c3C(F)(F)F)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]c&nc2c1",
"old_substring": "c17cc4[nH]n1"
} |
Can you make molecule CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2[nH]cc(NC(=O)c3cnn(C(C)C)c3C(F)(F)F)c2n1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 | CCc1ccc2[nH]cc(NC(=O)c3cnn(C(C)C)c3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]cc&c2n1",
"old_substring": "c17cc4[nH]n1"
} |
Can you make molecule CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)c2cc[nH]c2n1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)[nH]n1 | CCc1cc(NC(=O)c2cnn(C(C)C)c2C(F)(F)F)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c2cc[nH]c2n1",
"old_substring": "c17cc4[nH]n1"
} |
Can you make molecule CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](NC2=CC=CC=C3CC3(C)C2)[C@H]2CN(C)CCO2)c1 | CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 | Cc1cccc([C@H](NC2=CC=CC=C3CC3(C)C2)[C@H]2CN(C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CC2"
} |
Can you make molecule CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](NC2=NC3=C(CCCC2(C)C)S3)[C@H]2CN(C)CCO2)c1 | CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 | Cc1cccc([C@H](NC2=NC3=C(CCCC2(C)C)S3)[C@H]2CN(C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CC2"
} |
Can you make molecule CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](NC2=CC=C3C=C3CC(C)(C)O2)[C@H]2CN(C)CCO2)c1 | CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 | Cc1cccc([C@H](NC2=CC=C3C=C3CC(C)(C)O2)[C@H]2CN(C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CC2"
} |
Can you make molecule CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](NC2=CC=C3C=C3CCN2C)[C@H]2CN(C)CCO2)c1 | CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 | Cc1cccc([C@H](NC2=CC=C3C=C3CCN2C)[C@H]2CN(C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CC2"
} |
Can you make molecule CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](NCCCCC23CC2C3)[C@H]2CN(C)CCO2)c1 | CCN[C@@H](c1cccc(C)c1)[C@H]1CN(C)CCO1 | Cc1cccc([C@H](NCCCCC23CC2C3)[C@H]2CN(C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CC2"
} |
Can you make molecule CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCC(CC)(CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "[NH+]13CCC67C1"
} |
Can you make molecule CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCCC(CC)(CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "[NH+]13CCC67C1"
} |
Can you make molecule CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CC(CC)(CC)CCC1=O | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CC(CC)(CC)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "[NH+]13CCC67C1"
} |
Can you make molecule CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[C@H]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[C@H]1CCC(CC)(CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[NH+]13CCC67C1"
} |
Can you make molecule CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCCN(CC)[C@@H]1CC | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1C[NH+]1CCC(CC)(CC)C1 | CCC[NH2+][C@@H]1CC[C@@H](C)C[C@@H]1CN1CCCN(CC)[C@@H]1CC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&[C@@H]1&",
"old_substring": "[NH+]13CCC67C1"
} |
Can you make molecule O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1csc(-c2ccco2)n1)NC[C@@H]1CCOC1 | O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 | O=C(/C=C/Sc1csc(-c2ccco2)n1)NC[C@@H]1CCOC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC[C@@H]2CCOC2)nc1-c1csc(-c2ccco2)n1 | O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 | O=Cc1sc(NC[C@@H]2CCOC2)nc1-c1csc(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC[C@@H]2CCOC2)sc1-c1csc(-c2ccco2)n1 | O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 | O=Cc1nc(NC[C@@H]2CCOC2)sc1-c1csc(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCOC1)n1nc(-c2csc(-c3ccco3)n2)oc1=S | O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 | O=C(NC[C@@H]1CCOC1)n1nc(-c2csc(-c3ccco3)n2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONC[C@@H]1CCOC1)\c1ccc(-c2csc(-c3ccco3)n2)o1 | O=C(NC[C@@H]1CCOC1)c1csc(-c2ccco2)n1 | C(=N/ONC[C@@H]1CCOC1)\c1ccc(-c2csc(-c3ccco3)n2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(c2ccc(SN3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(SN3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(c2ccc(N3CC(c4cccc(Cl)c4)C3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CC(c4cccc(Cl)c4)C3)c([N+](=O)[O-])c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(c2ccc(N3CCCN(c4cccc(Cl)c4)C3=O)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCCN(c4cccc(Cl)c4)C3=O)c([N+](=O)[O-])c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(c2ccc(N3CCN=C3Sc3cccc(Cl)c3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN=C3Sc3cccc(Cl)c3)c([N+](=O)[O-])c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)C(C)(C)C3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)CC3)c([N+](=O)[O-])c2)C1=O | C[C@H]1CC(=O)N(c2ccc(N3CCN(c4cccc(Cl)c4)C(C)(C)C3)c([N+](=O)[O-])c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1I | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)ccc1Br | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 | CCOc1cc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1Cl | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)c1Br | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 | CCOc1cccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)c1Cl | CCOc1ccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)cc1 | CCOc1cccc(NC(=O)c2cccc3c2N[C@H](c2ccccc2C)[C@H]2CC=C[C@H]32)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule O=C(CCC1CCOCC1)NCCc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCOCC1)NCCCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NCCCCc1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(CCC1CCOCC1)NCCc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCOCC1)N=CCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NCCc1ccc[nH]1 | O=C(CCC1CCOCC1)N=CCCc1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(CCC1CCOCC1)NCCc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCOCC1)NCCCCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NCCCCCc1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C4"
} |
Can you make molecule O=C(CCC1CCOCC1)NCCc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCOCC1)NC1CC(c2ccc[nH]2)C1 | O=C(CCC1CCOCC1)NCCc1ccc[nH]1 | O=C(CCC1CCOCC1)NC1CC(c2ccc[nH]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C4"
} |
Can you make molecule O=C(CCC1CCOCC1)NCCc1ccc[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1ccc[nH]1)=NC(=O)CCC1CCOCC1 | O=C(CCC1CCOCC1)NCCc1ccc[nH]1 | CC(CCc1ccc[nH]1)=NC(=O)CCC1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C3C4"
} |
Can you make molecule CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1Cl | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)cc1I | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)cc1Br | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1cc(C)c(I)cc1C | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1cc(C)c(I)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)c(I)c1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(C)cc1 | CC[C@H](NC(=O)c1cccc(S(=O)(=O)NC(C)C)c1)c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c17ccc(C)cc1"
} |
Can you make molecule CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C2(C)CCCC2)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C2(C)CCCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C5(C)C"
} |
Can you make molecule CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(Cl)(Cl)Cl)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(Cl)(Cl)Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)C"
} |
Can you make molecule CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1nnc(NC(=O)[C@@H](CC)Sc2nncn2C)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 | CCCC(C)(C)c1nnc(NC(=O)[C@@H](CC)Sc2nncn2C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C5(C)C"
} |
Can you make molecule CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)(CC)CC)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)(CC)CC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C5(C)C"
} |
Can you make molecule CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C2(C=O)CCCCCC2)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C(C)C)s1 | CC[C@@H](Sc1nncn1C)C(=O)Nc1nnc(C2(C=O)CCCCCC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C5(C)C"
} |
Can you make molecule CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | CC(C)CC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)NC2(CC[NH+](CCCCBr)CC2)C1=O)NCc1ccco1 | CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | O=C(CN1C(=O)NC2(CC[NH+](CCCCBr)CC2)C1=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | C=CCCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)NC2(CC[NH+](CCCCCl)CC2)C1=O)NCc1ccco1 | CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | O=C(CN1C(=O)NC2(CC[NH+](CCCCCl)CC2)C1=O)NCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC4"
} |
Can you make molecule CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | CCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | C=CCCCC[NH+]1CCC2(CC1)NC(=O)N(CC(=O)NCc1ccco1)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | C=CSOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | C=CCCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCCl | CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCCS | CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCBr | CCOc1ccc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)cc1OC | COc1cc(-c2nc3ncccn3c2NCc2ccc(Cl)cc2)ccc1OCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=C(C)CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=C(C)CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=6C3"
} |
Can you make molecule CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=CCC[C@H](C)C[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CCC[C@H](C)C[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@H](C)C&",
"old_substring": "C=6C3"
} |
Can you make molecule CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=CCC[C@@H](C)C[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CCC[C@@H](C)C[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "C=6C3"
} |
Can you make molecule CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=CC1=CN=N[C@H]1[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=CC1=CN=N[C@H]1[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C=6C3"
} |
Can you make molecule CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NC(=S)NN=C1CCC([NH+]2CCC3(CC2)CN(CCN2CC[NH+](C(C)C)CC2)C(=O)O3)CC1 | CC(C)=CC[NH+]1CCC2(CC1)CN(CCN1CC[NH+](C(C)C)CC1)C(=O)O2 | CC(C)=NC(=S)NN=C1CCC([NH+]2CCC3(CC2)CN(CCN2CC[NH+](C(C)C)CC2)C(=O)O3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)NN=C1CCC&CC1",
"old_substring": "C=6C3"
} |
Can you make molecule Nc1cnccc1SCc1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cnccc1C1=CC=C2SCCN2C(Cc2ncon2)=C1 | Nc1cnccc1SCc1ncon1 | Nc1cnccc1C1=CC=C2SCCN2C(Cc2ncon2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S24"
} |
Can you make molecule Nc1cnccc1SCc1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cnccc1SCSCc1ncon1 | Nc1cnccc1SCc1ncon1 | Nc1cnccc1SCSCc1ncon1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S24"
} |
Can you make molecule Nc1cnccc1SCc1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cnccc1-n1cc2cc-2sc(Cc2ncon2)c1 | Nc1cnccc1SCc1ncon1 | Nc1cnccc1-n1cc2cc-2sc(Cc2ncon2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn&cc2s1",
"old_substring": "S24"
} |
Can you make molecule Nc1cnccc1SCc1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cnccc1-c1ccc(Cc2ncon2)n2ccc-2c1 | Nc1cnccc1SCc1ncon1 | Nc1cnccc1-c1ccc(Cc2ncon2)n2ccc-2c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2cc&ccc21",
"old_substring": "S24"
} |
Can you make molecule Nc1cnccc1SCc1ncon1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cnccc1-c1nc(Cc2ncon2)cc2ccc-2s1 | Nc1cnccc1SCc1ncon1 | Nc1cnccc1-c1nc(Cc2ncon2)cc2ccc-2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc&nc2c1",
"old_substring": "S24"
} |
Can you make molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCCC(=O)N[C@H](CCl)CCCc1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@H](CCl)CCCc1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]56C"
} |
Can you make molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCCC(=O)N[C@@H]1N=NC=C1CCc1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@@H]1N=NC=C1CCc1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]56C"
} |
Can you make molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCCC(=O)N[C@@H]1CC[C@@H](c2cccc(C#N)c2)C1 | Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@@H]1CC[C@@H](c2cccc(C#N)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]56C"
} |
Can you make molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C)c1OCCC(=O)N[C@H](C)C(C)(C)Cc1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 | Cc1cccc(C)c1OCCC(=O)N[C@H](C)C(C)(C)Cc1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]56C"
} |
Can you make molecule Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1cccc(C#N)c1)NC(=O)CCOc1c(C)cccc1C | Cc1cccc(C)c1OCCC(=O)N[C@@H](C)c1cccc(C#N)c1 | CC[C@@H](CCc1cccc(C#N)c1)NC(=O)CCOc1c(C)cccc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]56C"
} |
Can you make molecule Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1N1CCCC2=CC=CC2=C1Nc1cc(Cl)ccc1C#N | Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1N1CCCC2=CC=CC2=C1Nc1cc(Cl)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cccc&c21",
"old_substring": "C4CC2"
} |
Can you make molecule Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1N1CCCC2=CC2=CC=C(Nc2cc(Cl)ccc2C#N)C1 | Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1N1CCCC2=CC2=CC=C(Nc2cc(Cl)ccc2C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "C4CC2"
} |
Can you make molecule Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1CCCCCNc1cc(Cl)ccc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC2"
} |
Can you make molecule Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CC1=CC2=CC=CC2=C(Nc2cc(Cl)ccc2C#N)OC1 | Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1CC1=CC2=CC=CC2=C(Nc2cc(Cl)ccc2C#N)OC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=Cc2cccc&c2OC1",
"old_substring": "C4CC2"
} |
Can you make molecule Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1N1CCC2(CCC2CCNc2cc(Cl)ccc2C#N)CC1 | Cc1noc(C)c1CCCNc1cc(Cl)ccc1C#N | Cc1noc(C)c1N1CCC2(CCC2CCNc2cc(Cl)ccc2C#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "C4CC2"
} |
Can you make molecule O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cnns1)SNCc1ccc(C(=O)[O-])o1 | O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 | O=C(Cc1cnns1)SNCc1ccc(C(=O)[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCC(=O)c1cnns1)NCc1ccc(C(=O)[O-])o1 | O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 | O=C(CCCC(=O)c1cnns1)NCc1ccc(C(=O)[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NCc1ccc(C(=O)[O-])o1)c1cnns1 | O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 | CC(C)(CC(=O)NCc1ccc(C(=O)[O-])o1)c1cnns1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NCc1ccc(C(=O)[O-])o1)c1cnns1 | O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 | CC(C)(CCC(=O)NCc1ccc(C(=O)[O-])o1)c1cnns1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNCc1ccc(C(=O)[O-])o1)c1cnns1 | O=C([O-])c1ccc(CNC(=O)c2cnns2)o1 | C[C@H](C(=O)SNCc1ccc(C(=O)[O-])o1)c1cnns1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c(C)c1C | Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1[nH]c(C(=O)NCc2ccnc(OC(C)(C)C)c2)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1[nH]c&c(C)c1C",
"old_substring": "Cc1[nH]ccc16"
} |
Can you make molecule Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]n(C(=O)NCc2ccnc(OC(C)(C)C)c2)c(=O)c1Br | Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1[nH]n(C(=O)NCc2ccnc(OC(C)(C)C)c2)c(=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1[nH]n&c(=O)c1Br",
"old_substring": "Cc1[nH]ccc16"
} |
Can you make molecule Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1I | Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1I",
"old_substring": "Cc1[nH]ccc16"
} |
Can you make molecule Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1Br | Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1Br",
"old_substring": "Cc1[nH]ccc16"
} |
Can you make molecule Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1Cl | Cc1[nH]ccc1C(=O)NCc1ccnc(OC(C)(C)C)c1 | Cc1nc(C(=O)NCc2ccnc(OC(C)(C)C)c2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1Cl",
"old_substring": "Cc1[nH]ccc16"
} |
Can you make molecule C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccccc1Cl)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1ccccc1Cl)[NH+]1Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc(I)cc1)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1ccc(I)cc1)[NH+]1Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@@H](C)[NH+]2Cc3ccccc3C2)cc1I | C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 | Cc1ccc(C[C@@H](C)[NH+]2Cc3ccccc3C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1cccc(Br)c1)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 | C[C@H](Cc1cccc(Br)c1)[NH+]1Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[C@@H](C)[NH+]2Cc3ccccc3C2)c1C | C[C@H](Cc1ccccc1)[NH+]1Cc2ccccc2C1 | Cc1cccc(C[C@@H](C)[NH+]2Cc3ccccc3C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)COc2ccc(Cl)cc2)nsc1-c1ccc(S(N)(=O)=O)cc1 | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | Nc1c(C(=O)COc2ccc(Cl)cc2)nsc1-c1ccc(S(N)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N36"
} |
Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)COc1ccc(Cl)cc1)C(=S)Sc1ccc(S(N)(=O)=O)cc1 | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | CN(C(=O)COc1ccc(Cl)cc1)C(=S)Sc1ccc(S(N)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N36"
} |
Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1oc(C(=O)COc2ccc(Cl)cc2)cc1-c1ccc(S(N)(=O)=O)cc1 | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | Nc1oc(C(=O)COc2ccc(Cl)cc2)cc1-c1ccc(S(N)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N36"
} |
Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1ccc(SC2=NCCN2C(=O)COc2ccc(Cl)cc2)cc1 | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | NS(=O)(=O)c1ccc(SC2=NCCN2C(=O)COc2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N36"
} |
Can you make molecule NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NS(=O)(=O)c1ccc(C2CCN(CC(=O)COc3ccc(Cl)cc3)CC2)cc1 | NS(=O)(=O)c1ccc(NC(=O)COc2ccc(Cl)cc2)cc1 | NS(=O)(=O)c1ccc(C2CCN(CC(=O)COc3ccc(Cl)cc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N36"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.