prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)C(=O)Nc1c(C(C)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(C)=O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)C(=O)Nc1c(CCCCC(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(CCCCC(N)=O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)C(=O)Nc1c(CC/C(N)=N/O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(CC/C(N)=N/O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)C(=O)Nc1c(CC/C(N)=N\O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(CC/C(N)=N\O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)NC(=O)C(=O)Nc1c(CC(N)=S)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(C(N)=O)oc2ccccc12 | CC[C@H](C)NC(=O)C(=O)Nc1c(CC(N)=S)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C7(N)=O"
} |
Can you make molecule Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2ncc(NSC(=O)Cc3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NSC(=O)Cc3ccc(F)c(Br)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2ncc(NC(=O)CCCC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)CCCC(=O)c3ccc(F)c(Br)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2ncc(NC(=O)CC(C)(C)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)CC(C)(C)c3ccc(F)c(Br)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2ncc(NC(=O)CCC(C)(C)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)CCC(C)(C)c3ccc(F)c(Br)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc2ncc(NSC(=O)[C@@H](C)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NC(=O)c3ccc(F)c(Br)c3)cc12 | Cc1noc2ncc(NSC(=O)[C@@H](C)c3ccc(F)c(Br)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(nnc3c(=O)n(CCCN4CCCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCCC4)ccc32)c1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(nnc3c(=O)n(CCCN4CCCCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCCCC4)ccc32)c1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(nnc3c(=O)n(CCCN4CCSCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCSCC4)ccc32)c1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(nnc3c(=O)n(CCCN4CC=CC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CC=CC4)ccc32)c1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2c(nnc3c(=O)n(CCCSSN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | Cc1nn2c(nnc3c(=O)n(CCCSSN4CCOCC4)ccc32)c1-c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OSC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OSC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CCCC(=O)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CCCC(=O)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C8"
} |
Can you make molecule C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CC(C)(C)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CC(C)(C)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC[S@+]([O-])CCCNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC[S@+]([O-])CCCNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C8"
} |
Can you make molecule C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](OC(=O)CCC(C)(C)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | C[C@H](OC(=O)CCC(C)(C)NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)Nc1ncc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C8"
} |
Can you make molecule Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCOCC4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCOCC4)c(=O)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@H]16CCCO1"
} |
Can you make molecule Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CSCCS4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CSCCS4)c(=O)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CSCCS1",
"old_substring": "[C@H]16CCCO1"
} |
Can you make molecule Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CC=CS4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CC=CS4)c(=O)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]16CCCO1"
} |
Can you make molecule Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@@H]4CCSC4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@@H]4CCSC4)c(=O)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@H]16CCCO1"
} |
Can you make molecule Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CC45CCOCC5)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CCCO4)c(=O)c23)cc1 | Cc1ccc(-c2csc3[nH]c(=S)n(C[C@H]4CC45CCOCC5)c(=O)c23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCOCC2",
"old_substring": "[C@H]16CCCO1"
} |
Can you make molecule Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC(=O)SN[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(CC(=O)SN[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCCC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)CCCC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(C)(C)CC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(C)(C)CCC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(C)(C)CCC(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C)C(=O)SN[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc(C(=O)N[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | Cc1ccc([C@H](C)C(=O)SN[C@@H](C)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2C(=O)C[C@@H](SN3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](SN3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N18CCN7CC1"
} |
Can you make molecule COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2C(=O)C[C@@H](N3CC(c4ccc5c(c4)OCO5)C3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CC(c4ccc5c(c4)OCO5)C3)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N18CCN7CC1"
} |
Can you make molecule COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2C(=O)C[C@@H](N3CCCN(c4ccc5c(c4)OCO5)C3=O)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCCN(c4ccc5c(c4)OCO5)C3=O)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N18CCN7CC1"
} |
Can you make molecule COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2C(=O)C[C@@H](N3CCN=C3Sc3ccc4c(c3)OCO4)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN=C3Sc3ccc4c(c3)OCO4)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N18CCN7CC1"
} |
Can you make molecule COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)C(C)(C)C3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)CC3)C2=O)c1 | COc1cccc(N2C(=O)C[C@@H](N3CCN(c4ccc5c(c4)OCO5)C(C)(C)C3)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N18CCN7CC1"
} |
Can you make molecule Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(F)ccc([N-]S(=O)(=O)C=C2CCC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)C=C2CCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(F)ccc([N-]S(=O)(=O)CC2CCCCC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CCCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(F)ccc([N-]S(=O)(=O)C=C2CCCC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)C=C2CCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(F)ccc([N-]S(=O)(=O)CC2SCCCS2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2SCCCS2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(F)ccc([N-]S(=O)(=O)CC2SCSCS2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2CC2)c1F | Nc1c(F)ccc([N-]S(=O)(=O)CC2SCSCS2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCSCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S45"
} |
Can you make molecule C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CN1CCSc2ccc(Cc3ccc(Cl)cc3)cc21 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CN1CCSc2ccc(Cc3ccc(Cl)cc3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S45"
} |
Can you make molecule C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CC[S@@+]([O-])C(Cl)(Cl)Cc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CC[S@@+]([O-])C(Cl)(Cl)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S45"
} |
Can you make molecule C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CS/C(Cl)=C(\C#N)NCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CS/C(Cl)=C(\C#N)NCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S45"
} |
Can you make molecule C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)Cn1c(=S)n(Cc2ccc(Cl)cc2)c2ccccc21 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)CSCc1ccc(Cl)cc1 | C[C@@H]1[C@H](C)[S@@+]([O-])CCN1C(=O)Cn1c(=S)n(Cc2ccc(Cl)cc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S45"
} |
Can you make molecule Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CCCCC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CCCCC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(Br)cc1S(=O)(=O)NCC(=C1CCCC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(=C1CCCC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1SCCCS1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1SCSCS1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1sc(Br)cc1S(=O)(=O)NCC(=C1CCCCC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(C1CC1)C1CC1 | Cc1sc(Br)cc1S(=O)(=O)NCC(=C1CCCCC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)C(=O)N(C)Cc2nc(Br)nn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2nc(Br)nn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(Br)nn1C",
"old_substring": "c17ncnn1C"
} |
Can you make molecule CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)C(=O)N(C)Cn2cnc(I)n2)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cn2cnc(I)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1ncn&n1",
"old_substring": "c17ncnn1C"
} |
Can you make molecule CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncncc2Cl)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncncc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1Cl",
"old_substring": "c17ncnn1C"
} |
Can you make molecule CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)C(=O)N(C)Cc2snnc2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2snnc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&snnc1C",
"old_substring": "c17ncnn1C"
} |
Can you make molecule CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)C(=O)N(C)Cc2nonc2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2ncnn2C)c1 | CCc1cccc(NC(=O)C(=O)N(C)Cc2nonc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nonc1C",
"old_substring": "c17ncnn1C"
} |
Can you make molecule CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CCC(CO)=Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CCCC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)SNc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CCCCC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CC(=O)Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | CCC(C=O)=Nc1cccc(-n2nnnc2SCCOc2cccc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(Cl)(Cl)Cl)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(Cl)(Cl)Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)CC(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)CC(C)(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCC(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCC(C)(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCC(F)(F)F)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCC(F)(F)F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCCC(F)(F)F)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2C(C)(C)C)s1 | CC(C)Cc1nnc(NC(=O)c2cn(C)nc2CCCCC(F)(F)F)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(C)(C)C"
} |
Can you make molecule C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)Oc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@H](CC(C)(C)Oc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]6C5"
} |
Can you make molecule C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCOC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1)CC(=O)Oc1ccccc1 | C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@H](CCOC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1)CC(=O)Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]6C5"
} |
Can you make molecule C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](COc1ccccc1)[C@H](C)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@H](COc1ccccc1)[C@H](C)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]6C5"
} |
Can you make molecule C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1)CC(=O)Oc1ccccc1 | C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@@H](CCOC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1)CC(=O)Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]6C5"
} |
Can you make molecule C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OC[C@@H](Cl)CCOc1ccccc1)[C@H]1CCCN(C(=O)c2cccs2)C1 | C[C@@H](COc1ccccc1)OC(=O)[C@H]1CCCN(C(=O)c2cccs2)C1 | O=C(OC[C@@H](Cl)CCOc1ccccc1)[C@H]1CCCN(C(=O)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C[C@H]6C5"
} |
Can you make molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NSC(=O)Cc2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NSC(=O)Cc2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CCCC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)CCCC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CC(C)(C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)CC(C)(C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CCC(C)(C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)CCC(C)(C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NSC(=O)[C@@H](C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NC(=O)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | COc1ccc(NSC(=O)[C@@H](C)c2ccc3c(c2)C(=O)N([C@@H](C)c2ccccc2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | C=CSOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | C=CCCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCCl)n1 | CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCCl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCCS)n1 | CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCCS)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCBr)n1 | CCOC(=O)c1nc(-c2cc([N+](=O)[O-])ccc2OC)n[n-]1 | COc1ccc([N+](=O)[O-])cc1-c1n[n-]c(C(=O)OCCCBr)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(C)cc1I | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc(C)c5c1"
} |
Can you make molecule Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(C)cc1Br | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1ccc(C)c5c1"
} |
Can you make molecule Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(Cl)cc1F | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 | Cc1cc(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1F",
"old_substring": "Cc1ccc(C)c5c1"
} |
Can you make molecule Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1Cl | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1Cl",
"old_substring": "Cc1ccc(C)c5c1"
} |
Can you make molecule Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=NS(=O)(=O)c2cc3c(cc2Br)OCCO3)cc1Br | Cc1ccc(C)c(NS(=O)(=O)c2cc3c(cc2Br)OCCO3)c1 | Cc1ccc(C=NS(=O)(=O)c2cc3c(cc2Br)OCCO3)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C=&)cc1Br",
"old_substring": "Cc1ccc(C)c5c1"
} |
Can you make molecule NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1Cl | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1Br | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)c(Cl)c1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(I)cc1F | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1cc2c(F)cccc2s1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2cc(Br)ccc2F)nc2c1[nH]c(=O)n2-c1cc2c(F)cccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)c(C3CC3)cc2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)c(C3CC3)cc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c&cc1C",
"old_substring": "c17cc(C)n9c1C"
} |
Can you make molecule CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(Cl)c(C3CC3)cc2Cl)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(Cl)c(C3CC3)cc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c&cc1Cl",
"old_substring": "c17cc(C)n9c1C"
} |
Can you make molecule CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)nc3ccc(C4CC4)cc23)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)nc3ccc(C4CC4)cc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)nc2ccc&cc12",
"old_substring": "c17cc(C)n9c1C"
} |
Can you make molecule CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)c(C3CC3)c(C)c2)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)c(C3CC3)c(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c&c(C)c1",
"old_substring": "c17cc(C)n9c1C"
} |
Can you make molecule CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(Br)c(C3CC3)cc2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(C)n(C3CC3)c2C)c1 | CNS(=O)(=O)c1cccc(CNC(=O)c2cc(Br)c(C3CC3)cc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1C",
"old_substring": "c17cc(C)n9c1C"
} |
Can you make molecule CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CCC(CO)=Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CCCC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)SNc1c(C)nn([C@H](C)C(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CCCCC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CC(=O)Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | CCC(C=O)=Nc1c(C)nn([C@H](C)C(=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC2=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.