prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(SC(=S)N(C)C(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(SC(=S)N(C)C(=O)NC2(C)Cc3ccccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(SC2=NCCN2C(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(SC2=NCCN2C(=O)NC2(C)Cc3ccccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N47"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(-c2sc(C(=O)NC3(C)Cc4ccccc4C3)cc2C#N)cc1 | CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(-c2sc(C(=O)NC3(C)Cc4ccccc4C3)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N47"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(-c2ccc(C(=O)NC3(C)Cc4ccccc4C3)cc2C#N)cc1 | CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(-c2ccc(C(=O)NC3(C)Cc4ccccc4C3)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N47"
} |
Can you make molecule CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)c1ccc(N2CCC(=NOC(=O)NC3(C)Cc4ccccc4C3)CC2)cc1 | CCS(=O)(=O)c1ccc(NC(=O)NC2(C)Cc3ccccc3C2)cc1 | CCS(=O)(=O)c1ccc(N2CCC(=NOC(=O)NC3(C)Cc4ccccc4C3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N47"
} |
Can you make molecule Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C([NH2+]CC[C@@H]2CSCCN2)N2CCC2=C1 | Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1C1=CC=C([NH2+]CC[C@@H]2CSCCN2)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1-c1ncnc2sc-2c(C)c1[NH2+]CC[C@@H]1CSCCN1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=CC=C2SCCN2C([NH2+]CC[C@@H]2CSCCN2)=C1 | Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1C1=CC=C2SCCN2C([NH2+]CC[C@@H]2CSCCN2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1C1=C2CCN2CC([NH2+]CC[C@@H]2CSCCN2)=CC=C1 | Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1C1=C2CCN2CC([NH2+]CC[C@@H]2CSCCN2)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C25"
} |
Can you make molecule Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cscc1-c1ccc([NH2+]CC[C@@H]2CSCCN2)c(C)c2sc-2n1 | Cc1cscc1C[NH2+]CC[C@@H]1CSCCN1 | Cc1cscc1-c1ccc([NH2+]CC[C@@H]2CSCCN2)c(C)c2sc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C25"
} |
Can you make molecule CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CNSC(=O)Cc1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNSC(=O)Cc1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CNC(=O)CCCC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)CCCC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CNC(=O)CC(C)(C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)CC(C)(C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CNC(=O)CCC(C)(C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)CCC(C)(C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CNSC(=O)[C@@H](C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNC(=O)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | CC(C)[C@H](CNSC(=O)[C@@H](C)c1ccc2c(c1)CCC(=O)N2C)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO less soluble in water? The output molecule should be similar to the input molecule. | COCOOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO | COCOOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C5CO"
} |
Can you make molecule COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO less soluble in water? The output molecule should be similar to the input molecule. | C=COOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO | C=COOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C5CO"
} |
Can you make molecule COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)Oc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO | CCC(=O)Oc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C5CO"
} |
Can you make molecule COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO less soluble in water? The output molecule should be similar to the input molecule. | C=C=COOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO | C=C=COOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C5CO"
} |
Can you make molecule COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | COc1cc(CNC(=O)Nc2cccc(Br)c2)ccc1OCCO | CCOc1ccc(CNC(=O)Nc2cccc(Br)c2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C5CO"
} |
Can you make molecule CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CCCC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CCCCC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)CCCc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CCC(=O)CCCc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC5=O"
} |
Can you make molecule CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Cc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CC(=O)c1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | CCCCC(=O)Cc1cn(CCC(=O)N[C@@H]2CCC[NH+](C)C2)c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC(=O)C&",
"old_substring": "CC5=O"
} |
Can you make molecule CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(C(=O)C2CCN(C3CCCCC3)CC2)Oc2ccccc2NC1=O | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 | C[C@@]1(C(=O)C2CCN(C3CCCCC3)CC2)Oc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C(=S)SC1CCCCC1 | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C(=S)SC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(C(=O)CN2CCC(C3CCCCC3)CC2)Oc2ccccc2NC1=O | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 | C[C@@]1(C(=O)CN2CCC(C3CCCCC3)CC2)Oc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(C(=O)N2CSC(=S)N(C3CCCCC3)C2)Oc2ccccc2NC1=O | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 | C[C@@]1(C(=O)N2CSC(=S)N(C3CCCCC3)C2)Oc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(C(=O)C2(C#N)CCC(C3CCCCC3)CC2)Oc2ccccc2NC1=O | CN(C(=O)[C@]1(C)Oc2ccccc2NC1=O)C1CCCCC1 | C[C@@]1(C(=O)C2(C#N)CCC(C3CCCCC3)CC2)Oc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CC(C)C[NH+](C)CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1=CN=N[C@H]1[NH+](C)CCC(=O)[O-] | CC(C)C[NH+](C)CCC(=O)[O-] | CC(C)C1=CN=N[C@H]1[NH+](C)CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C1=CN=N[C@H]1&",
"old_substring": "CC(C)C1"
} |
Can you make molecule CC(C)C[NH+](C)CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(C(C)C)[NH+](C)CCC(=O)[O-] | CC(C)C[NH+](C)CCC(=O)[O-] | CC(C)C(C(C)C)[NH+](C)CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)C1"
} |
Can you make molecule CC(C)C[NH+](C)CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)[NH+](C)CCC(=O)[O-] | CC(C)C[NH+](C)CCC(=O)[O-] | CC(C)CCCC(=O)[NH+](C)CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)C1"
} |
Can you make molecule CC(C)C[NH+](C)CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](CCC(=O)[O-])CC(C)(C)CCC#N | CC(C)C[NH+](C)CCC(=O)[O-] | C[NH+](CCC(=O)[O-])CC(C)(C)CCC#N | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)CCC#N",
"old_substring": "CC(C)C1"
} |
Can you make molecule CC(C)C[NH+](C)CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CI)[NH+](C)CCC(=O)[O-] | CC(C)C[NH+](C)CCC(=O)[O-] | CC(C)[C@H](CI)[NH+](C)CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CI",
"old_substring": "CC(C)C1"
} |
Can you make molecule Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC(=S)N(C)C(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(SC(=S)N(C)C(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC2=NCCN2C(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(SC2=NCCN2C(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N35"
} |
Can you make molecule Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2CCN(CC(=O)Nc3cc(Br)c(=O)n(C)c3)CC2)cc1 | Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(C2CCN(CC(=O)Nc3cc(Br)c(=O)n(C)c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N35"
} |
Can you make molecule Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2sc(C(=O)Nc3cc(Br)c(=O)n(C)c3)cc2C#N)cc1 | Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(-c2sc(C(=O)Nc3cc(Br)c(=O)n(C)c3)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N35"
} |
Can you make molecule Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2ccc(C(=O)Nc3cc(Br)c(=O)n(C)c3)cc2C#N)cc1 | Cc1ccc(NC(=O)Nc2cc(Br)c(=O)n(C)c2)cc1 | Cc1ccc(-c2ccc(C(=O)Nc3cc(Br)c(=O)n(C)c3)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N35"
} |
Can you make molecule C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccc1)NC(=O)C=C1Sc2ccccc2NC1=O | C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 | C[C@H](CC(C)(C)c1ccccc1)NC(=O)C=C1Sc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)C=C1Sc2ccccc2NC1=O)CC(=O)c1ccccc1 | C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 | C[C@H](CCNC(=O)C=C1Sc2ccccc2NC1=O)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccccc1)[C@H](C)NC(=O)C=C1Sc2ccccc2NC1=O | C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 | C[C@H](Cc1ccccc1)[C@H](C)NC(=O)C=C1Sc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)C=C1Sc2ccccc2NC1=O)CC(=O)c1ccccc1 | C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 | C[C@@H](CCNC(=O)C=C1Sc2ccccc2NC1=O)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccccc1)NC(=O)C=C1Sc2ccccc2NC1=O | C[C@H](NC(=O)C=C1Sc2ccccc2NC1=O)c1ccccc1 | CCC[C@@H](CCc1ccccc1)NC(=O)C=C1Sc2ccccc2NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]46"
} |
Can you make molecule COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C[C@H](NC(=O)Nc1cccc(SC(F)F)c1)C(C)C | COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)C[C@H](NC(=O)Nc1cccc(SC(F)F)c1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C2(=O)[C@H](C)C5"
} |
Can you make molecule COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)CCNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 | CO[C@@H](C)CCNC(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C2(=O)[C@H](C)C5"
} |
Can you make molecule COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)NC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)CCC(C)(C)NC(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C2(=O)[C@H](C)C5"
} |
Can you make molecule COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C(C)(C)CCCNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)C(C)(C)CCCNC(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C2(=O)[C@H](C)C5"
} |
Can you make molecule COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)NC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)[C@H](C)CNC(=O)Nc1cccc(SC(F)F)c1 | COC(=O)CC(C)(C)NC(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C2(=O)[C@H](C)C5"
} |
Can you make molecule COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CC(C)(C)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)CC(C)(C)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)CCC(C)(C)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)CCC(C)(C)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=O)C[C@@H](Br)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(NC(=O)C[C@@H](Br)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C56=O"
} |
Can you make molecule COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Nc2cc(C)n(N3CCC(S(=O)(=O)c4ccc(-c5ccco5)cc4)CC3)c(=O)c2)c1 | COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(Nc2cc(C)n(N3CCC(S(=O)(=O)c4ccc(-c5ccco5)cc4)CC3)c(=O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C56=O"
} |
Can you make molecule COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Nc2c(C)n(N3CCC(S(=O)(=O)c4ccc(-c5ccco5)cc4)CC3)ccc2=O)c1 | COc1cccc(NC(=O)N2CCC(S(=O)(=O)c3ccc(-c4ccco4)cc3)CC2)c1 | COc1cccc(Nc2c(C)n(N3CCC(S(=O)(=O)c4ccc(-c5ccco5)cc4)CC3)ccc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C56=O"
} |
Can you make molecule CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1(C)SCCS1)[C@@](C)(CC)[C@@H](C)O | CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O | CC[NH+](C1(C)SCCS1)[C@@](C)(CC)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CC1"
} |
Can you make molecule CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C1(C)CCOCC1)[C@@](C)(CC)[C@@H](C)O | CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O | CC[NH+](C1(C)CCOCC1)[C@@](C)(CC)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC1&CCOCC1",
"old_substring": "CC1"
} |
Can you make molecule CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C(C)(C)CCC1CC1)[C@@](C)(CC)[C@@H](C)O | CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O | CC[NH+](C(C)(C)CCC1CC1)[C@@](C)(CC)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC1"
} |
Can you make molecule CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C(C)CCC1(O)CC1)[C@@](C)(CC)[C@@H](C)O | CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O | CC[NH+](C(C)CCC1(O)CC1)[C@@](C)(CC)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC1CCC&(O)CC1",
"old_substring": "CC1"
} |
Can you make molecule CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C(C)CCC1(C)CC1)[C@@](C)(CC)[C@@H](C)O | CC[NH+](CC)[C@@](C)(CC)[C@@H](C)O | CC[NH+](C(C)CCC1(C)CC1)[C@@](C)(CC)[C@@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "CC1CCC&(C)CC1",
"old_substring": "CC1"
} |
Can you make molecule O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccccc1-c1ccccc1)Nc1ccc(N2CCCC2=O)cc1I | O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O | O=C(COc1ccccc1-c1ccccc1)Nc1ccc(N2CCCC2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccccc16"
} |
Can you make molecule O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccccc1-c1ccccc1)Nc1cc(N2CCCC2=O)ccc1Br | O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O | O=C(COc1ccccc1-c1ccccc1)Nc1cc(N2CCCC2=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccccc16"
} |
Can you make molecule O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccccc1-c1ccccc1)Nc1ccc(N2CCCC2=O)cc1Cl | O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O | O=C(COc1ccccc1-c1ccccc1)Nc1ccc(N2CCCC2=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccccc16"
} |
Can you make molecule O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccccc1-c1ccccc1)Nc1cccc(N2CCCC2=O)c1Br | O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O | O=C(COc1ccccc1-c1ccccc1)Nc1cccc(N2CCCC2=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccccc16"
} |
Can you make molecule O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1ccccc1-c1ccccc1)Nc1cccc(N2CCCC2=O)c1Cl | O=C(COc1ccccc1-c1ccccc1)Nc1ccccc1N1CCCC1=O | O=C(COc1ccccc1-c1ccccc1)Nc1cccc(N2CCCC2=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccccc16"
} |
Can you make molecule CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1I | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)ccc1Br | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 | CCOc1cc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1Cl | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)c1Br | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 | CCOc1cccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)c1Cl | CCOc1ccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)cc1 | CCOc1cccc([C@H]2Nn3c(nnc3-c3ccccc3)S[C@H]2C(=O)N2CCOCC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc8cc1"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(I)o4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(I)o4)o3)cc2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(Br)o4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(Br)o4)o3)cc2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(Cl)o4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccc(Cl)o4)o3)cc2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4occc4Br)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4occc4Br)o3)cc2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1-c1nnc(NC(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)o1 | C[C@@H]1CN(S(=O)(=O)c2ccc(C(=O)Nc3nnc(-c4ccco4)o3)cc2)C[C@@H](C)O1 | Cc1ccsc1-c1nnc(NC(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c19ccco1"
} |
Can you make molecule C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/NC(=O)COc1ccccc1Cl)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1Cl)c1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/NC(=O)COc1ccc(I)cc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccc(I)cc1)c1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/NC(=O)COc1ccc(C)c(I)c1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccc(C)c(I)c1)c1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/NC(=O)COc1cccc(Br)c1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1cccc(Br)c1)c1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/NC(=O)COc1cccc(C)c1C)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1ccccc1)c1cccc([N+](=O)[O-])c1 | C/C(=N/NC(=O)COc1cccc(C)c1C)c1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N(C)CCC(CO)=Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | C[C@@H](C(=O)N(C)CCC(CO)=Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CN(C)C(=O)[C@H](C)n1cccn1)=N/ONc1ccc([S@@+](C)[O-])cc1 | C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | C/C(CN(C)C(=O)[C@H](C)n1cccn1)=N/ONc1ccc([S@@+](C)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1ccc([S@@+](C)[O-])cc1)N(C)C(=O)[C@H](C)n1cccn1 | C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | CCC(CC)(C(=O)CNc1ccc([S@@+](C)[O-])cc1)N(C)C(=O)[C@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N(C)SSC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | C[C@@H](C(=O)N(C)SSC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1ccc([S@@+](C)[O-])cc1)N(C)C(=O)[C@H](C)n1cccn1 | C[C@@H](C(=O)N(C)CC(=O)Nc1ccc([S@@+](C)[O-])cc1)n1cccn1 | CCC(CC)(C(=O)CCNc1ccc([S@@+](C)[O-])cc1)N(C)C(=O)[C@H](C)n1cccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)N1CCN=C1Sc1ncnc2c1cnn2CC(=O)OC | CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC | CCC(CC)N1CCN=C1Sc1ncnc2c1cnn2CC(=O)OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45C"
} |
Can you make molecule CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)c1nc(C#N)c(-c2ncnc3c2cnn3CC(=O)OC)o1 | CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC | CCC(CC)c1nc(C#N)c(-c2ncnc3c2cnn3CC(=O)OC)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N45C"
} |
Can you make molecule CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)c1cc(C#N)c(-c2ncnc3c2cnn3CC(=O)OC)s1 | CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC | CCC(CC)c1cc(C#N)c(-c2ncnc3c2cnn3CC(=O)OC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)c1ccc(-c2ncnc3c2cnn3CC(=O)OC)c(C#N)c1 | CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC | CCC(CC)c1ccc(-c2ncnc3c2cnn3CC(=O)OC)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N45C"
} |
Can you make molecule CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)ON=C1CCN(c2ncnc3c2cnn3CC(=O)OC)CC1 | CCC(CC)N(C)c1ncnc2c1cnn2CC(=O)OC | CCC(CC)ON=C1CCN(c2ncnc3c2cnn3CC(=O)OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N45C"
} |
Can you make molecule CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)Nc1cc(C(F)(F)F)ccc1F)C(=S)SCCS(C)(=O)=O | CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F | CN(C(=O)Nc1cc(C(F)(F)F)ccc1F)C(=S)SCCS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN24"
} |
Can you make molecule CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CCC1CCN(CC(=O)Nc2cc(C(F)(F)F)ccc2F)CC1 | CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F | CS(=O)(=O)CCC1CCN(CC(=O)Nc2cc(C(F)(F)F)ccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CCN1CN(C(=O)Nc2cc(C(F)(F)F)ccc2F)CSC1=S | CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F | CS(=O)(=O)CCN1CN(C(=O)Nc2cc(C(F)(F)F)ccc2F)CSC1=S | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN24"
} |
Can you make molecule CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CCC1CCC(C#N)(C(=O)Nc2cc(C(F)(F)F)ccc2F)CC1 | CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F | CS(=O)(=O)CCC1CCC(C#N)(C(=O)Nc2cc(C(F)(F)F)ccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN24"
} |
Can you make molecule CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)CCc1snc2sc-2c(N)c1C(=O)Nc1cc(C(F)(F)F)ccc1F | CN(CCS(C)(=O)=O)C(=O)Nc1cc(C(F)(F)F)ccc1F | CS(=O)(=O)CCc1snc2sc-2c(N)c1C(=O)Nc1cc(C(F)(F)F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "CN24"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNSC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNSC(=O)Cc2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C7"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CCCC(=O)c2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CCCC(=O)c2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C7"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CC(C)(C)c2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CC(C)(C)c2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C7"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC[S@+]([O-])CCCc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC[S@+]([O-])CCCc2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C7"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CCC(C)(C)c2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)Cc2ccc(Cl)cc2)cc1 | Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2CCNC(=O)CCC(C)(C)c2ccc(Cl)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C7"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.