prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CC(C)CC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CC[NH+](CCCCBr)CC1 | CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CN(C(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CC[NH+](CCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | C=CCCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CC[NH+](CCCCCl)CC1 | CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CN(C(=O)NC[C@H]1CCCN(c2ncccn2)C1)C1CC[NH+](CCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | CCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | C=CCCCC[NH+]1CCC(N(C)C(=O)NC[C@H]2CCCN(c3ncccn3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCSC1=CCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCSC1=CCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1CCCCCCCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCCCCCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(CCC(=O)NNC(=O)[C@@H](O)c2ccccc2)CCCCCCC1 | O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | N#CC1(CCC(=O)NNC(=O)[C@@H](O)c2ccccc2)CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C12CCCCC1"
} |
Can you make molecule O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1C2=CC=CC=C1CCCC2)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1CCCCC1)NNC(=O)[C@@H](O)c1ccccc1 | O=C(CCC1C2=CC=CC=C1CCCC2)NNC(=O)[C@@H](O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C12CCCCC1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1Cl | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccc(I)cc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccc(C)c(I)c1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccc(C)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1cccc(Br)c1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1cccc(C)c1C | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1ccccc1 | CC(=O)Nc1cc(C(=O)NCCCO)nn1-c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)C(=O)NCc1ccccc1OCC | CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C | CCCCC[C@@H](C)C(=O)NCc1ccccc1OCC | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H](CC)C(=O)NCc1ccccc1OCC | CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C | C=CCC[C@H](CC)C(=O)NCc1ccccc1OCC | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC[C@@H]&CC",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1CNC(=O)N1CCCCCCCC1 | CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C | CCOc1ccccc1CNC(=O)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1CNC(=O)N1CCc2sccc2[C@H]1C | CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C | CCOc1ccccc1CNC(=O)N1CCc2sccc2[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2sccc2[C@H]1C",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CC(=O)NCc1ccccc1OCC | CCOc1ccccc1CNC(=O)N1CCCC[C@H]1C | CCCC[C@H](CC)CC(=O)NCc1ccccc1OCC | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "N13CCCC[C@H]1C"
} |
Can you make molecule CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccsc1C(=O)[C@H](N)CCCCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)[C@H](N)CCCCN(C)C(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N36C"
} |
Can you make molecule CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccsc1C(=O)N1CCN=C1CCCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)N1CCN=C1CCCN(C)C(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N36C"
} |
Can you make molecule CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccsc1C(=O)c1cc(C#N)c(CCN(C)C(=O)OC(C)(C)C)s1 | CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)c1cc(C#N)c(CCN(C)C(=O)OC(C)(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N36C"
} |
Can you make molecule CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccsc1C(=O)c1ccc(CCN(C)C(=O)OC(C)(C)C)c(C#N)c1 | CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)c1ccc(CCN(C)C(=O)OC(C)(C)C)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N36C"
} |
Can you make molecule CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccsc1C(=O)ON=C1CCN(CCN(C)C(=O)OC(C)(C)C)CC1 | CCc1ccsc1C(=O)N(C)CCN(C)C(=O)OC(C)(C)C | CCc1ccsc1C(=O)ON=C1CCN(CCN(C)C(=O)OC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N36C"
} |
Can you make molecule O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)c(Cl)c1 | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c14ccc(Cl)nc1Cl"
} |
Can you make molecule O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)cc1I | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c14ccc(Cl)nc1Cl"
} |
Can you make molecule O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2ccc(F)cc21)c1cc(Cl)sc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1cc(Cl)sc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c14ccc(Cl)nc1Cl"
} |
Can you make molecule O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)c(Cl)c1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c14ccc(Cl)nc1Cl"
} |
Can you make molecule O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)cc1Br | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)nc1Cl | O=C(N[C@H]1CCCc2ccc(F)cc21)c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c14ccc(Cl)nc1Cl"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccco1)Nc1ccc2c(c1)OCCO2 | O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 | O=C(/C=C/Sc1ccco1)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2ccc3c(c2)OCCO3)nc1-c1ccco1 | O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 | O=Cc1sc(Nc2ccc3c(c2)OCCO3)nc1-c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2ccc3c(c2)OCCO3)sc1-c1ccco1 | O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 | O=Cc1nc(Nc2ccc3c(c2)OCCO3)sc1-c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc2c(c1)OCCO2)n1nc(-c2ccco2)oc1=S | O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 | O=C(Nc1ccc2c(c1)OCCO2)n1nc(-c2ccco2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONc1ccc2c(c1)OCCO2)\c1ccc(-c2ccco2)o1 | O=C(Nc1ccc2c(c1)OCCO2)c1ccco1 | C(=N/ONc1ccc2c(c1)OCCO2)\c1ccc(-c2ccco2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1CCC(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1CCC(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C189CC1"
} |
Can you make molecule CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1CCC(=CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1CCC(=CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C189CC1"
} |
Can you make molecule CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1N=NC=C1CCCNC(=O)C(=O)Nc1cc(F)ccc1N1CCCCC1 | CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CC[C@@H]1N=NC=C1CCCNC(=O)C(=O)Nc1cc(F)ccc1N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "C189CC1"
} |
Can you make molecule CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCCNC(=O)C(=O)Nc1cc(F)ccc1N1CCCCC1 | CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCCCCCCNC(=O)C(=O)Nc1cc(F)ccc1N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C189CC1"
} |
Can you make molecule CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1CCC(C)(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | CCC1CCC(C)(CNC(=O)C(=O)Nc2cc(F)ccc2N2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C189CC1"
} |
Can you make molecule NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1 | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] | Cc1cc(C)cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)cc(C)c1",
"old_substring": "c14cc(Cl)cc([N+](=O)[O-])c1[O-]"
} |
Can you make molecule NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)ccc1O | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)ccc1O",
"old_substring": "c14cc(Cl)cc([N+](=O)[O-])c1[O-]"
} |
Can you make molecule NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] less soluble in water? The output molecule should be similar to the input molecule. | N=C(O)c1cccc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1 | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] | N=C(O)c1cccc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C(=N)O)c1",
"old_substring": "c14cc(Cl)cc([N+](=O)[O-])c1[O-]"
} |
Can you make molecule NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N)cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1C | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] | Cc1cc(N)cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(N)cc(C)c1C",
"old_substring": "c14cc(Cl)cc([N+](=O)[O-])c1[O-]"
} |
Can you make molecule NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)ccc1O | NC(=O)CN1c2ccccc2C(=O)N[C@H]1c1cc(Cl)cc([N+](=O)[O-])c1[O-] | Cc1cc([C@@H]2NC(=O)c3ccccc3N2CC(N)=O)ccc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(O)c(C)c1",
"old_substring": "c14cc(Cl)cc([N+](=O)[O-])c1[O-]"
} |
Can you make molecule CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn2c(=O)cc(COc3ccc(NSC(=O)Cc4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NSC(=O)Cc4ccccc4F)cc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C59=O"
} |
Can you make molecule CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CCCC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CCCC(=O)c4ccccc4F)cc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C59=O"
} |
Can you make molecule CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CC(C)(C)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CC(C)(C)c4ccccc4F)cc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CCC(C)(C)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)CCC(C)(C)c4ccccc4F)cc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn2c(=O)cc(COc3ccc(NSC(=O)[C@@H](C)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NC(=O)c4ccccc4F)cc3)nc2s1 | CCc1nn2c(=O)cc(COc3ccc(NSC(=O)[C@@H](C)c4ccccc4F)cc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C59=O"
} |
Can you make molecule C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cl)CCn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(Cl)CCn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(Cl)CC&",
"old_substring": "C=C(C)C6"
} |
Can you make molecule C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(C)(C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)CC(C)(C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC&(C)C",
"old_substring": "C=C(C)C6"
} |
Can you make molecule C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC[C@@H](C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)CC[C@@H](C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC[C@H]&C",
"old_substring": "C=C(C)C6"
} |
Can you make molecule C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CCC[C@@H](O)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)CCC[C@@H](O)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CCC[C@H]&O",
"old_substring": "C=C(C)C6"
} |
Can you make molecule C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C[C@@H](CC(C)C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)Cn1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | C=C(C)C[C@@H](CC(C)C)n1c(=O)c2c(nc3n(-c4ccccc4OC)c(C)cn23)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C[C@H]&CC(C)C",
"old_substring": "C=C(C)C6"
} |
Can you make molecule CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](S)COCc2ccccc2Cl)CC1 | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](S)COCc2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)N1CCC[NH+](C[C@@H](O)C(C)(C)OCc2ccccc2Cl)CC1 | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 | CC(C)(C)C(=O)N1CCC[NH+](C[C@@H](O)C(C)(C)OCc2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[NH+]1CCCN(C(=O)C(C)(C)C)CC1)C(=O)OCc1ccccc1Cl | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 | C[C@H](C[NH+]1CCCN(C(=O)C(C)(C)C)CC1)C(=O)OCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C[C@@H](O)C[NH+]1CCCN(C(=O)C(C)(C)C)CC1)OCc1ccccc1Cl | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 | C[C@@H](C[C@@H](O)C[NH+]1CCCN(C(=O)C(C)(C)C)CC1)OCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](O)C[C@@H]&C",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH+]1CCCN(C(=O)C(C)(C)C)CC1)CC(=O)OCc1ccccc1Cl | CC(C)(C)C(=O)N1CCC[NH+](C[C@H](O)COCc2ccccc2Cl)CC1 | C[C@H](CC[NH+]1CCCN(C(=O)C(C)(C)C)CC1)CC(=O)OCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C6[C@H](O)C4"
} |
Can you make molecule Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)NNC(=O)c2cc3c(s2)CCCCCC3)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2cc3c(s2)CCCCCC3)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CCCCCC2",
"old_substring": "c14ccc2c(c1)CCCC2"
} |
Can you make molecule Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2sc(C(=O)NNC(=O)Cc3nc4ccccc4n3C)c(Cl)c12 | Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 | Cc1cccc2sc(C(=O)NNC(=O)Cc3nc4ccccc4n3C)c(Cl)c12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2cccc(C)c2c1Cl",
"old_substring": "c14ccc2c(c1)CCCC2"
} |
Can you make molecule Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)NNC(=O)c2csc3ccc(Cl)cc23)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2csc3ccc(Cl)cc23)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccc(Cl)cc12",
"old_substring": "c14ccc2c(c1)CCCC2"
} |
Can you make molecule Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)c(C(=O)NNC(=O)Cc2nc3ccccc3n2C)cc1Cl | Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 | Cc1cc(Cl)c(C(=O)NNC(=O)Cc2nc3ccccc3n2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)c(C)cc1Cl",
"old_substring": "c14ccc2c(c1)CCCC2"
} |
Can you make molecule Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)NNC(=O)c2cc3sc(Cl)cc3s2)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2ccc3c(c2)CCCC3)nc2ccccc21 | Cn1c(CC(=O)NNC(=O)c2cc3sc(Cl)cc3s2)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sc(Cl)cc2s1",
"old_substring": "c14ccc2c(c1)CCCC2"
} |
Can you make molecule C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NCSCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCSCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N35"
} |
Can you make molecule C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NC(=N)SCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NC(=N)SCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N35"
} |
Can you make molecule C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)c1nsc(Cc2cccs2)c1N)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)c1nsc(Cc2cccs2)c1N)N1CCn2c(nn(C)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N35"
} |
Can you make molecule C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)N(C)C(=S)SCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)N(C)C(=S)SCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N35"
} |
Can you make molecule C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)c1ccc(Cc2cccs2)n1N)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)NCc1cccs1)N1CCn2c(nn(C)c2=O)C1 | C[C@@H](C(=O)c1ccc(Cc2cccs2)n1N)N1CCn2c(nn(C)c2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N35"
} |
Can you make molecule CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCCCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCSCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCSCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CC=CC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CC=CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)SSN2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)N2CCOCC2)cc1 | CC(=O)Nc1ccc(C(=O)N[C@@H](C)[C@H](C)SSN2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N16CCOCC1"
} |
Can you make molecule Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(F)(F)Cl)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)(F)Cl)c(C(=O)N2CCSC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(F)(F)Cl",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(F)(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(C(F)(F)F)c(C(=O)N2CCSC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(SC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(SC(F)F)c(C(=O)N2CCSC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H](O)CC(F)(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc([C@@H](O)CC(F)(F)F)c(C(=O)N2CCSC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2c(F)cc(C=O)cc2F)c(C(=O)N2CCSC2)s1 | Cc1cc(OC(F)F)c(C(=O)N2CCSC2)s1 | Cc1cc(-c2c(F)cc(C=O)cc2F)c(C(=O)N2CCSC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1cc(F)c&c(F)c1",
"old_substring": "O4C(F)F"
} |
Can you make molecule Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCN2C(=O)CC(C)(C)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)CC(C)(C)NCc2ccsc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCN2C(=O)CCC(C)(C)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)CCC(C)(C)NCc2ccsc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCN2C(=O)C[C@@H](Br)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2C(=O)C[C@@H](Br)NCc2ccsc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCN2c2cc(C)n(NCc3ccsc3)c(=O)c2)c1 | Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2c2cc(C)n(NCc3ccsc3)c(=O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCCN2c2c(C)n(NCc3ccsc3)ccc2=O)c1 | Cc1cccc([C@H]2CCCN2C(=O)NCc2ccsc2)c1 | Cc1cccc([C@H]2CCCN2c2c(C)n(NCc3ccsc3)ccc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1F | O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 | O=C(/C=C/SN1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(N2CCN(c3ccc(/C=N/ONc4ccc(Cl)cc4F)o3)CC2)cc1 | O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 | Fc1ccc(N2CCN(c3ccc(/C=N/ONc4ccc(Cl)cc4F)o3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N2CCN(c3ccc(F)cc3)CC2)CC1)Nc1ccc(Cl)cc1F | O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 | O=C(NN=C1CCC(N2CCN(c3ccc(F)cc3)CC2)CC1)Nc1ccc(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)cc1F)C1=CC[C@H](N2CCN(c3ccc(F)cc3)CC2)S1 | O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 | O=C(Nc1ccc(Cl)cc1F)C1=CC[C@H](N2CCN(c3ccc(F)cc3)CC2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1F | O=C(Nc1ccc(Cl)cc1F)N1CCN(c2ccc(F)cc2)CC1 | O=C(/N=c1\ccccn1N1CCN(c2ccc(F)cc2)CC1)Nc1ccc(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Can you make molecule CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc(=O)c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCn1ccc(=O)c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(=O)c&n1",
"old_substring": "n17cc([N+](=O)[O-])c6n1"
} |
Can you make molecule CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)c(=O)cc1C | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCn1cc(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)c(=O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c(=O)cc1C",
"old_substring": "n17cc([N+](=O)[O-])c6n1"
} |
Can you make molecule CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)cn1C | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCc1cc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(S&(=O)=O)cn1C",
"old_substring": "n17cc([N+](=O)[O-])c6n1"
} |
Can you make molecule CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)ccn1 | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCc1cc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(S&(=O)=O)ccn1",
"old_substring": "n17cc([N+](=O)[O-])c6n1"
} |
Can you make molecule CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)cn1 | CCn1cc([N+](=O)[O-])c(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)n1 | CCc1ccc(S(=O)(=O)C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(S&(=O)=O)cn1",
"old_substring": "n17cc([N+](=O)[O-])c6n1"
} |
Can you make molecule COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)C[C@@H](CC(=O)SN1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](CC(=O)SN1CC[S@@+]([O-])C(C)(C)C1)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)C[C@@H](CC(=C=O)CN1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](CC(=C=O)CN1CC[S@@+]([O-])C(C)(C)C1)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)C[C@@H](C(=O)CCCC(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)CCCC(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)C[C@@H](C(C)(C)CC(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(C)(C)CC(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)C[C@@H](CCC[S@@+]([O-])CN1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](C(=O)N1CC[S@@+]([O-])C(C)(C)C1)CO2 | COc1ccc2c(c1)C[C@@H](CCC[S@@+]([O-])CN1CC[S@@+]([O-])C(C)(C)C1)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.