prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCC[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])CCC[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCC&",
"old_substring": "O=C6[O-]"
} |
Can you make molecule O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCCCC[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])CCCCC[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCCCC&",
"old_substring": "O=C6[O-]"
} |
Can you make molecule O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])CCCC(=O)[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])CCCC(=O)[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C([O-])CCCC&=O",
"old_substring": "O=C6[O-]"
} |
Can you make molecule O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=CO[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=CO[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=CO&",
"old_substring": "O=C6[O-]"
} |
Can you make molecule O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NO)[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C([O-])[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | O=C(NO)[C@H]1C=C[C@H](NS(=O)(=O)c2ccc3c(c2)CCO3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NO",
"old_substring": "O=C6[O-]"
} |
Can you make molecule CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCC1CCN(C(=O)[C@@H](CC=C(C)C)C(C)(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@@H](CC=C(C)C)C(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC&)C(C)(C)C",
"old_substring": "[C@H]16[C@@H](C=7)C1(C)C"
} |
Can you make molecule CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCC1CCN(C(=O)[C@@H](C)CC(C)(C)C=C(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@@H](C)CC(C)(C)C=C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CC(C)(C)C&",
"old_substring": "[C@H]16[C@@H](C=7)C1(C)C"
} |
Can you make molecule CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(C=C(C)C)CC(=O)N1CCC(CNC(C)=O)CC1 | CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 | CCC[C@@](C)(C=C(C)C)CC(=O)N1CCC(CNC(C)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@](C)(C&)C&",
"old_substring": "[C@H]16[C@@H](C=7)C1(C)C"
} |
Can you make molecule CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)NCC1CCN(C(=O)[C@@H](CBr)CCC=C(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 | CC(=O)NCC1CCN(C(=O)[C@@H](CBr)CCC=C(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]16[C@@H](C=7)C1(C)C"
} |
Can you make molecule CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC=C(C)C)C(=O)N1CCC(CNC(C)=O)CC1 | CC(=O)NCC1CCN(C(=O)[C@H]2[C@@H](C=C(C)C)C2(C)C)CC1 | CCC[C@@H](CC=C(C)C)C(=O)N1CCC(CNC(C)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "[C@H]16[C@@H](C=7)C1(C)C"
} |
Can you make molecule CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOSC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C2(=O)C=6"
} |
Can you make molecule CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C1=C(N=CC(=O)N[C@H](C)c2ccccc2)CCS1 | CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOC(=O)C1=C(N=CC(=O)N[C@H](C)c2ccccc2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C2(=O)C=6"
} |
Can you make molecule CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C(N=CC(=O)N[C@H](C)c1ccccc1)=C(Cl)Cl | CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOC(=O)C(N=CC(=O)N[C@H](C)c1ccccc1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C2(=O)C=6"
} |
Can you make molecule CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C(C=CC(=O)N[C@H](C)c1ccccc1)=C(Cl)Cl | CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOC(=O)C(C=CC(=O)N[C@H](C)c1ccccc1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C2(=O)C=6"
} |
Can you make molecule CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCC=CC(=O)N[C@H](C)c1ccccc1 | CCOC(=O)C=CC(=O)N[C@H](C)c1ccccc1 | CCOC[S@+]([O-])CCC=CC(=O)N[C@H](C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C2(=O)C=6"
} |
Can you make molecule Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(CCCCOc2ccc(CNn3cnnc3)cc2)cc1 | Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 | Clc1ccc(CCCCOc2ccc(CNn3cnnc3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(CCCCCOc2ccc(CNn3cnnc3)cc2)cc1 | Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 | Clc1ccc(CCCCCOc2ccc(CNn3cnnc3)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc(C2CC(Oc3ccc(CNn4cnnc4)cc3)C2)cc1 | Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 | Clc1ccc(C2CC(Oc3ccc(CNn4cnnc4)cc3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(OOc1ccc(CNn2cnnc2)cc1)Sc1ccc(Cl)cc1 | Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 | S=C(OOc1ccc(CNn2cnnc2)cc1)Sc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(Nc1ccc(Cl)cc1)SOc1ccc(CNn2cnnc2)cc1 | Clc1ccc(COc2ccc(CNn3cnnc3)cc2)cc1 | S=C(Nc1ccc(Cl)cc1)SOc1ccc(CNn2cnnc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C46"
} |
Can you make molecule CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC[C@@H](c1ccc(Br)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(Br)o1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c16ccc(C)o1"
} |
Can you make molecule CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC[C@@H](c1ccc(Cl)s1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(Cl)s1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c16ccc(C)o1"
} |
Can you make molecule CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC[C@@H](c1cccc(C)c1C)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1cccc(C)c1C)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccc(C)o1"
} |
Can you make molecule CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC[C@@H](c1cc2cc(C)ccc2o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1cc2cc(C)ccc2o1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(C)ccc2o1",
"old_substring": "c16ccc(C)o1"
} |
Can you make molecule CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1CNC[C@@H](c1cc2cc(Cl)ccc2o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1ccc(C)o1)N1CCOCC1 | CCc1nn(C)cc1CNC[C@@H](c1cc2cc(Cl)ccc2o1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c16ccc(C)o1"
} |
Can you make molecule NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)N1CCC2(CCC(=CC(=O)OCC(=O)Nc3c(Cl)cc(Cl)cc3Cl)CC2)CC1 | NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 | NC(=O)N1CCC2(CCC(=CC(=O)OCC(=O)Nc3c(Cl)cc(Cl)cc3Cl)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "c17ccc(C=8)cc1"
} |
Can you make molecule NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC=CC(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(N)=O | NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 | CCCC[C@@H](CC=CC(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "c17ccc(C=8)cc1"
} |
Can you make molecule NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(C=CC(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl)CC(N)=O | NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 | CCC[C@@](C)(C=CC(=O)OCC(=O)Nc1c(Cl)cc(Cl)cc1Cl)CC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@](C)(C&)C&",
"old_substring": "c17ccc(C=8)cc1"
} |
Can you make molecule NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1ccc(C=CC(=O)OCCC(CO)=Nc2c(Cl)cc(Cl)cc2Cl)cc1 | NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 | NC(=O)c1ccc(C=CC(=O)OCCC(CO)=Nc2c(Cl)cc(Cl)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C4=O"
} |
Can you make molecule NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COC(=O)C=Cc1ccc(C(N)=O)cc1)=N/ONc1c(Cl)cc(Cl)cc1Cl | NC(=O)c1ccc(C=CC(=O)OCC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 | C/C(COC(=O)C=Cc1ccc(C(N)=O)cc1)=N/ONc1c(Cl)cc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2I)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2Br)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)c(I)c2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)c(I)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2cc(Cl)ccc2Cl)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2cc(Cl)ccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)c(Cl)c2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)cc2)CC1 | O=C(NC[C@H]1Cc2cccc(-c3cncnc3)c2O1)C1(c2ccc(Cl)c(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c18ccc(Cl)cc1"
} |
Can you make molecule Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(F)(F)CBr)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)(F)CBr)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)CBr",
"old_substring": "C7(F)F"
} |
Can you make molecule Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(SC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(SC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C7(F)F"
} |
Can you make molecule Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCCC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(CCCC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(F)F"
} |
Can you make molecule Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CCCCC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(CCCCC(F)(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(F)F"
} |
Can you make molecule Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CC(F)(F)C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | Cc1cc(CC(F)(F)C(F)F)n2ncc(C(=O)Nc3ccc(Br)cc3C(F)(F)F)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C7(F)F"
} |
Can you make molecule COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1c(F)cc(NC(=O)CC(C)(C)c2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CC(C)(C)c2cnn(-c3ccccc3)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1c(F)cc(NC(=O)CCC(C)(C)c2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCC(C)(C)c2cnn(-c3ccccc3)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1c(F)cc(NC(=O)C[C@H](C)c2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)C[C@H](C)c2cnn(-c3ccccc3)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1c(F)cc(NC(=O)C[C@@H](Br)c2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)C[C@@H](Br)c2cnn(-c3ccccc3)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1c(F)cc(NSC(=O)[C@@H](C)c2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NC(=O)CCc2cnn(-c3ccccc3)c2)cc1F | COc1c(F)cc(NSC(=O)[C@@H](C)c2cnn(-c3ccccc3)c2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)CC7"
} |
Can you make molecule O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCCS)CN1C(=O)Cc2ccc(Cl)cc21 | O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 | CCCC[C@@H](CCCS)CN1C(=O)Cc2ccc(Cl)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "C134CCCCC1"
} |
Can you make molecule O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CCS)CCN1C(=O)Cc2ccc(Cl)cc21 | O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 | CCC[C@@](C)(CCS)CCN1C(=O)Cc2ccc(Cl)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@](C)(C&)C&",
"old_substring": "C134CCCCC1"
} |
Can you make molecule O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C)c(CN2C(=O)Cc3ccc(Cl)cc32)c(C)c(C)c1CS | O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 | Cc1c(C)c(CN2C(=O)Cc3ccc(Cl)cc32)c(C)c(C)c1CS | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(C)c(C)c&c1C",
"old_substring": "C134CCCCC1"
} |
Can you make molecule O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCc2c(CN3C(=O)Cc4ccc(Cl)cc43)cc(CS)cc21 | O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 | CC1(C)CCc2c(CN3C(=O)Cc4ccc(Cl)cc43)cc(CS)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc2c1CCC2(C)C",
"old_substring": "C134CCCCC1"
} |
Can you make molecule O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CN2C(=O)Cc3ccc(Cl)cc32)c(Cl)cc1CS | O=C1Cc2ccc(Cl)cc2N1CC1(CS)CCCCC1 | Cc1cc(CN2C(=O)Cc3ccc(Cl)cc32)c(Cl)cc1CS | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1&",
"old_substring": "C134CCCCC1"
} |
Can you make molecule CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=S)Sc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOC(=S)Sc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=N)Cc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOC(=N)Cc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCC(=O)c1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCC(=O)CCC(=O)c1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)CCc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CC[C@H](O)CCc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)/C=C/Sc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCOc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | CCC(=O)/C=C/Sc1ccc(Cl)cc1S(=O)(=O)Nc1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | C=CSOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | C=CCCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCCl)c(C)c1 | CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCCl)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCCS)c(C)c1 | CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCCS)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCBr)c(C)c1 | CCOC(=O)c1c(C)[nH]c(C)c1S(=O)(=O)Nc1ccc(C)cc1C | Cc1ccc(NS(=O)(=O)c2c(C)[nH]c(C)c2C(=O)OCCCBr)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(CCCCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(CCCCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC5"
} |
Can you make molecule C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(C2CCC(NC(=O)C(=O)c3ccc(Br)cc3)CC2)CC1 | C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(C2CCC(NC(=O)C(=O)c3ccc(Br)cc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(CC(C)(C)CNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(CC(C)(C)CNC(=O)C(=O)c2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC5"
} |
Can you make molecule C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCN(C2CCC(=NC(=O)C(=O)c3ccc(Br)cc3)CC2)CC1 | C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | C[NH+]1CCN(C2CCC(=NC(=O)C(=O)c3ccc(Br)cc3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCNC(=O)C(=O)c1ccc(Br)cc1)N1CC[NH+](C)CC1 | C[NH+]1CCN(CCCNC(=O)C(=O)c2ccc(Br)cc2)CC1 | CCC[C@@H](CCNC(=O)C(=O)c1ccc(Br)cc1)N1CC[NH+](C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC5"
} |
Can you make molecule C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1nccs1)NC(=O)N[C@H](c1ccccc1)c1nccn1C | C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 | C[C@H](CC(C)(C)c1nccs1)NC(=O)N[C@H](c1ccccc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCNC(=O)N[C@H](c1ccccc1)c1nccn1C)CC(=O)c1nccs1 | C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 | C[C@H](CCNC(=O)N[C@H](c1ccccc1)c1nccn1C)CC(=O)c1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1nccs1)[C@H](C)NC(=O)N[C@H](c1ccccc1)c1nccn1C | C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 | C[C@H](Cc1nccs1)[C@H](C)NC(=O)N[C@H](c1ccccc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)N[C@H](c1ccccc1)c1nccn1C)CC(=O)c1nccs1 | C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 | C[C@@H](CCNC(=O)N[C@H](c1ccccc1)c1nccn1C)CC(=O)c1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]46"
} |
Can you make molecule C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1nccs1)NC(=O)N[C@H](c1ccccc1)c1nccn1C | C[C@H](NC(=O)N[C@H](c1ccccc1)c1nccn1C)c1nccs1 | CCC[C@@H](CCc1nccs1)NC(=O)N[C@H](c1ccccc1)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]46"
} |
Can you make molecule COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COCc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COCSc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1SC(C)=O | COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1C(=O)CS | COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1C(=O)CI | COc1ccc(-c2noc([C@H]3CCO[C@H]3C)n2)cc1OC | COc1cc(-c2noc([C@H]3CCO[C@H]3C)n2)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(Cl)sc2Cl)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(Cl)sc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c13cc(C)sc1C"
} |
Can you make molecule Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)c(Br)s2)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)c(Br)s2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c(Br)s1",
"old_substring": "c13cc(C)sc1C"
} |
Can you make molecule Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H](C#N)C(=O)c2oc3c(Cl)cccc3c2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2oc3c(Cl)cccc3c2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2c(Cl)cccc2c1C",
"old_substring": "c13cc(C)sc1C"
} |
Can you make molecule Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H](C#N)C(=O)c2ccc(I)c(C)c2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2ccc(I)c(C)c2C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(C)c1C",
"old_substring": "c13cc(C)sc1C"
} |
Can you make molecule Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(Br)ccc2Cl)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(C)sc2C)n1 | Cc1cc(C)nc([C@H](C#N)C(=O)c2cc(Br)ccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c13cc(C)sc1C"
} |
Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(NCCC(CO)=C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NCCC(CO)=C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C48=O"
} |
Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(NSC(=O)CC3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NSC(=O)CC3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(N=CC(=O)C=C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(N=CC(=O)C=C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C48=O"
} |
Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(NCC(=C=O)CC3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NCC(=C=O)CC3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCN(c2ccc(NC(=O)CCCC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | CC[NH+]1CCN(c2ccc(NC(=O)CCCC(=O)C3C[C@H](C)O[C@@H](C)C3)c(C)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CSN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CC(c3ccccc3[C@@H](O)c3nccs3)C2)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CN2CC(c3ccccc3[C@@H](O)c3nccs3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCCN(c3ccccc3[C@@H](O)c3nccs3)C2=O)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CN2CCCN(c3ccccc3[C@@H](O)c3nccs3)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCN=C2Sc2ccccc2[C@@H](O)c2nccs2)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CN2CCN=C2Sc2ccccc2[C@@H](O)c2nccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)C(C)(C)C2)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)CC2)c1 | COc1cccc(CN2CCN(c3ccccc3[C@@H](O)c3nccs3)C(C)(C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[NH+]1CC=C(CCCC[NH3+])CC1 | CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] | CC1(C)CCCC[C@H]1[NH+]1CC=C(CCCC[NH3+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(CC[NH3+])C[C@@H]1[C@@H]1CCCCC1(C)C | CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] | C[C@H]1CN(CC[NH3+])C[C@@H]1[C@@H]1CCCCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[C@H]1CCC[C@H](CC[NH3+])C1 | CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] | CC1(C)CCCC[C@H]1[C@H]1CCC[C@H](CC[NH3+])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[C@H]1CCC[C@H](CC[NH3+])CC1 | CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] | CC1(C)CCCC[C@H]1[C@H]1CCC[C@H](CC[NH3+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCCC[C@H]1[C@@H]1NC[C@@H](CC[NH3+])S1 | CC1(C)CCCC[C@H]1[NH+]1CCCC[C@@H]1CC[NH3+] | CC1(C)CCCC[C@H]1[C@@H]1NC[C@@H](CC[NH3+])S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NC[C@@H]&S1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CCCC2(C)C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CCCC2(C)C)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]18N=C(C)C=C1C"
} |
Can you make molecule CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CC=CC=C2Cl)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CC=CC=C2Cl)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]18N=C(C)C=C1C"
} |
Can you make molecule CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CCC=CCCC2)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CCC=CCCC2)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]18N=C(C)C=C1C"
} |
Can you make molecule CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)[C@@H](CCl)C(C)C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@@H](CCl)C(C)C)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)C(C)C",
"old_substring": "[C@H]18N=C(C)C=C1C"
} |
Can you make molecule CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CC23CCCC3)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2N=C(C)C=C2C)ccc1OC | CCCCC(=O)Nc1cc(NC(=O)[C@H]2CC23CCCC3)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCC2",
"old_substring": "[C@H]18N=C(C)C=C1C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.