prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCS[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | COCS[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)S[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | CC(=O)S[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)O[C@@H]3CCC[C@H](C(=O)CI)C3)n2c1 | CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | Cc1ccc2ncc(C(=O)O[C@@H]3CCC[C@H](C(=O)CI)C3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)O[C@@H]3CCC[C@H](C(=O)CBr)C3)n2c1 | CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | Cc1ccc2ncc(C(=O)O[C@@H]3CCC[C@H](C(=O)CBr)C3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CBr",
"old_substring": "CO5"
} |
Can you make molecule CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCC[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | CO[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | CON(C)CCC[C@H]1CCC[C@@H](OC(=O)c2cnc3ccc(C)cn23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO5"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CCC(CO)=Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CCCC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)SNc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CCCCC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CC(=O)Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | CCC(C=O)=Nc1ccc(S(=O)(=O)NCCC(=O)N[C@@H]2CCCc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Can you make molecule CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@H](C#N)N(C)C.CC1(C)COCCN1 | CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C | CC(=O)[C@H](C#N)N(C)C.CC1(C)COCCN1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)[C@@H]&C#N",
"old_substring": "C2(=O)C[C@@H]3C[NH3+]"
} |
Can you make molecule CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@H](C)N(C)C.CC1(C)COCCN1 | CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C | CC(=O)[C@H](C)N(C)C.CC1(C)COCCN1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)[C@@H]&C",
"old_substring": "C2(=O)C[C@@H]3C[NH3+]"
} |
Can you make molecule CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)COCCN1.C[C@@H](O)CC(=O)N(C)C | CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C | CC1(C)COCCN1.C[C@@H](O)CC(=O)N(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H](C)O",
"old_substring": "C2(=O)C[C@@H]3C[NH3+]"
} |
Can you make molecule CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@H](O)N(C)C.CC1(C)COCCN1 | CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C | C=C(C)[C@H](O)N(C)C.CC1(C)COCCN1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)[C@@H]&O",
"old_substring": "C2(=O)C[C@@H]3C[NH3+]"
} |
Can you make molecule CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC[C@@H](O)N(C)C.CC1(C)COCCN1 | CN(C)C(=O)C[C@H](C[NH3+])N1CCOCC1(C)C | C=CC[C@@H](O)N(C)C.CC1(C)COCCN1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CC[C@H]&O",
"old_substring": "C2(=O)C[C@@H]3C[NH3+]"
} |
Can you make molecule C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(C=CC2=CN=N[C@H]2c2cc(C(=O)[O-])cc(C(=O)[O-])c2)cc1 | C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 | C=CCOc1ccc(C=CC2=CN=N[C@H]2c2cc(C(=O)[O-])cc(C(=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C1=8SC(=S)N9C1=O"
} |
Can you make molecule C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(C=C2CC(F)(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2)cc1 | C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 | C=CCOc1ccc(C=C2CC(F)(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=8SC(=S)N9C1=O"
} |
Can you make molecule C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(C=NC(=S)N2CCC(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)CC2)cc1 | C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 | C=CCOc1ccc(C=NC(=S)N2CCC(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C1=8SC(=S)N9C1=O"
} |
Can you make molecule C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(C=C2CC(C#N)(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2)cc1 | C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 | C=CCOc1ccc(C=C2CC(C#N)(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(C#N)C1",
"old_substring": "C1=8SC(=S)N9C1=O"
} |
Can you make molecule C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(C=CC2=CN=N[C@@H]2c2cc(C(=O)[O-])cc(C(=O)[O-])c2)cc1 | C=CCOc1ccc(C=C2SC(=S)N(c3cc(C(=O)[O-])cc(C(=O)[O-])c3)C2=O)cc1 | C=CCOc1ccc(C=CC2=CN=N[C@@H]2c2cc(C(=O)[O-])cc(C(=O)[O-])c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@@H]&N=N1",
"old_substring": "C1=8SC(=S)N9C1=O"
} |
Can you make molecule C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Nc1ccc(CN2CCCCC2=O)cc1I)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1ccc(CN2CCCCC2=O)cc1I)C(=O)Nc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Nc1cc(CN2CCCCC2=O)ccc1Br)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cc(CN2CCCCC2=O)ccc1Br)C(=O)Nc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Nc1ccc(CN2CCCCC2=O)cc1Cl)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1ccc(CN2CCCCC2=O)cc1Cl)C(=O)Nc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Nc1cccc(CN2CCCCC2=O)c1Br)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1Br)C(=O)Nc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc8c1"
} |
Can you make molecule C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Nc1cccc(CN2CCCCC2=O)c1Cl)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 | C[C@H](Nc1cccc(CN2CCCCC2=O)c1Cl)C(=O)Nc1cccc([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc8c1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1ccc(Cl)s1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1ccc(Cl)s1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1ccc(Br)s1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1ccc(Br)s1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c16cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1sccc1Br)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1sccc1Br)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c16cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1csc(I)c1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1csc(I)c1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c16cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1cc2c(s1)CSC2)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cccs1)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | CN(CCc1cc2c(s1)CSC2)C(=O)C(=O)Nc1cc(CC(C)(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c16cccs1"
} |
Can you make molecule CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2c(C)nn(CC)c2Cl)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2c(C)nn(CC)c2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)nn&c1Cl",
"old_substring": "c17cnn8c1"
} |
Can you make molecule CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2nc(CC)ncc2I)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2nc(CC)ncc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17cnn8c1"
} |
Can you make molecule CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn3ccc(CC)cc23)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn3ccc(CC)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnn2ccc&cc12",
"old_substring": "c17cnn8c1"
} |
Can you make molecule CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2sc(CC)nc2Cl)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2sc(CC)nc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc&nc1Cl",
"old_substring": "c17cnn8c1"
} |
Can you make molecule CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2ncc(CC)s2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2cnn(CC)c2)C1 | CCCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)c2ncc(CC)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&s1",
"old_substring": "c17cnn8c1"
} |
Can you make molecule C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)co1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c16nc8no1"
} |
Can you make molecule C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(-c2ccccc2)ncnc1[C@H](C)CNC(=O)c1ccn(C2CCCC2)n1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 | Cc1c(-c2ccccc2)ncnc1[C@H](C)CNC(=O)c1ccn(C2CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c16nc8no1"
} |
Can you make molecule C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2ccccc2)nc1[C@H](C)CNC(=O)c1ccn(C2CCCC2)n1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 | Cc1cnc(-c2ccccc2)nc1[C@H](C)CNC(=O)c1ccn(C2CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c16nc8no1"
} |
Can you make molecule C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1ncnc(-c2ccccc2)c1F | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1ncnc(-c2ccccc2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c16nc8no1"
} |
Can you make molecule C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)ncc1I | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)no1 | C[C@H](CNC(=O)c1ccn(C2CCCC2)n1)c1nc(-c2ccccc2)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c16nc8no1"
} |
Can you make molecule CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | C=CSOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | C=CCCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCCl)cc1 | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCCl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCCS)cc1 | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCBr)cc1 | CCOC(=O)[C@@H]([NH3+])[C@@H](O)c1ccc(S(C)(=O)=O)cc1 | CS(=O)(=O)c1ccc([C@H](O)[C@H]([NH3+])C(=O)OCCCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)cc2cc(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)oc12 | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 | Cc1cc(Br)cc2cc(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Br)cc2cc&oc12",
"old_substring": "Cc1ccc2c6cc(=O)oc2c1"
} |
Can you make molecule Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)c(Br)oc2c1 | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)c(Br)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc2c&c(Br)oc2c1",
"old_substring": "Cc1ccc2c6cc(=O)oc2c1"
} |
Can you make molecule Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CN2c3ccccc3[C@@H](C(N)=O)C[C@@H]2C)oc2cc(Br)ccc12 | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 | Cc1c(CN2c3ccccc3[C@@H](C(N)=O)C[C@@H]2C)oc2cc(Br)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&oc2cc(Br)ccc12",
"old_substring": "Cc1ccc2c6cc(=O)oc2c1"
} |
Can you make molecule Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C=CN2c3ccccc3[C@@H](C(N)=O)C[C@@H]2C)cc1Br | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 | Cc1ccc(C=CN2c3ccccc3[C@@H](C(N)=O)C[C@@H]2C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C=&)cc1Br",
"old_substring": "Cc1ccc2c6cc(=O)oc2c1"
} |
Can you make molecule Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1C[C@H](C(N)=O)c2ccccc2N1Cc1ccnc2c(Cl)c(Cl)ccc12 | Cc1ccc2c(CN3c4ccccc4[C@@H](C(N)=O)C[C@@H]3C)cc(=O)oc2c1 | C[C@H]1C[C@H](C(N)=O)c2ccccc2N1Cc1ccnc2c(Cl)c(Cl)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc2c&ccnc2c1Cl",
"old_substring": "Cc1ccc2c6cc(=O)oc2c1"
} |
Can you make molecule Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NSC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NSC(=O)CC2(n3cccc3)CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CC(C)(C)C2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC(C)(C)C2(n3cccc3)CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC[S@+]([O-])CCCC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC[S@+]([O-])CCCC2(n3cccc3)CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCC(C)(C)C2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CCC(C)(C)C2(n3cccc3)CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C[C@H](C)C2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)CC2(n3cccc3)CCCCC2)n1 | Cc1cccc(NC(=O)C[C@H](C)C2(n3cccc3)CCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(N2CCC(C(=O)c3sccc3N)CC2)CC1 | CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 | CC1(C)CCC(N2CCC(C(=O)c3sccc3N)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)c1sccc1N)C(=S)SC1CCC(C)(C)CC1 | CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 | CN(C(=O)c1sccc1N)C(=S)SC1CCC(C)(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(C2CCN(CC(=O)c3sccc3N)CC2)CC1 | CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 | CC1(C)CCC(C2CCN(CC(=O)c3sccc3N)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(N2CN(C(=O)c3sccc3N)CSC2=S)CC1 | CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 | CC1(C)CCC(N2CN(C(=O)c3sccc3N)CSC2=S)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN23"
} |
Can you make molecule CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(C2CCC(C#N)(C(=O)c3sccc3N)CC2)CC1 | CN(C(=O)c1sccc1N)C1CCC(C)(C)CC1 | CC1(C)CCC(C2CCC(C#N)(C(=O)c3sccc3N)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@H](C#N)NC(C)(C)CC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)NC(C)(C)CC(=O)OC(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@H](C#N)NC(C)(C)CCC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)NC(C)(C)CCC(=O)OC(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@H](C#N)N[C@H](Br)CC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)N[C@H](Br)CC(=O)OC(C)(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@H](C#N)Nn2c(C)cc(OC(C)(C)C)cc2=O)cs1 | Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)Nn2c(C)cc(OC(C)(C)C)cc2=O)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@H](C#N)Nn2ccc(=O)c(OC(C)(C)C)c2C)cs1 | Cc1nc([C@H](C#N)NC(=O)OC(C)(C)C)cs1 | Cc1nc([C@H](C#N)Nn2ccc(=O)c(OC(C)(C)C)c2C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(OC(=O)c2ccn(-c3c(Cl)cccc3Cl)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3c(Cl)cccc3Cl)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c19cccc(Cl)c1"
} |
Can you make molecule COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)cc3I)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)cc3I)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c19cccc(Cl)c1"
} |
Can you make molecule COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)cc3Br)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)cc3Br)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c19cccc(Cl)c1"
} |
Can you make molecule COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)c(I)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)c(I)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c19cccc(Cl)c1"
} |
Can you make molecule COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)c(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3cccc(Cl)c3)n2)cc1 | COC(=O)c1ccc(OC(=O)c2ccn(-c3ccc(Cl)c(Cl)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c19cccc(Cl)c1"
} |
Can you make molecule CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(SC(=O)Cc1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(SC(=O)Cc1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CCCC(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)CCCC(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CC(C)(C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)CC(C)(C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CCC(C)(C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)CCC(C)(C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(SC(=O)[C@@H](C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(C(=O)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | CCN(SC(=O)[C@@H](C)c1n[nH]c(C)n1)[C@@H]1CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CCCCc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](CCCCc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](CCCCCc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](CCCCCc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](C2CC(c3ccc(CNC(=O)NNC(=O)C(C)(C)C)cc3)C2)C1 | C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](C2CC(c3ccc(CNC(=O)NNC(=O)C(C)(C)C)cc3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](OC(=S)Sc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](OC(=S)Sc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[NH+](SC(=S)Nc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](Cc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | C[C@H]1CCC[NH+](SC(=S)Nc2ccc(CNC(=O)NNC(=O)C(C)(C)C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C46"
} |
Can you make molecule CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCO)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](CCO)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCO",
"old_substring": "CC[C@@H]6O"
} |
Can you make molecule CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CC(=O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@@H](C)CC(=O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C)CC&=O",
"old_substring": "CC[C@@H]6O"
} |
Can you make molecule CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@@H](C)C(=O)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C)C(=O)C&",
"old_substring": "CC[C@@H]6O"
} |
Can you make molecule CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CS)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](CS)Cc1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CS",
"old_substring": "CC[C@@H]6O"
} |
Can you make molecule CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C(=O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | CC[C@H](C)C(=O)c1ccc(O[C@@H]2CCOC3(CCCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)C&=O",
"old_substring": "CC[C@@H]6O"
} |
Can you make molecule C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1Cl | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccc(I)cc1 | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N(C)C(=O)[C@H](C)SCCOc2ccccc2F)cc1I | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 | Cc1ccc(N(C)C(=O)[C@H](C)SCCOc2ccccc2F)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1cccc(Br)c1 | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N(C)C(=O)[C@H](C)SCCOc2ccccc2F)c1C | C[C@H](SCCOc1ccccc1F)C(=O)N(C)c1ccccc1 | Cc1cccc(N(C)C(=O)[C@H](C)SCCOc2ccccc2F)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCCC(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCCC(=O)Nc2cncc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C5=O"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCC(=O)CNc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCC(=O)CNc2cncc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C4(=O)C5=O"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC[S@+]([O-])CCC(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC[S@+]([O-])CCC(=O)Nc2cncc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C4(=O)C5=O"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCCS(=O)(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)CCCS(=O)(=O)Nc2cncc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C4(=O)C5=O"
} |
Can you make molecule CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(C)(F)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(=O)Nc2cncc(C)c2)c1 | CC[C@@H](C)C(=O)Nc1cccc(CNC(=O)C(C)(F)C(=O)Nc2cncc(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C4(=O)C5=O"
} |
Can you make molecule N#CCOc1ccccc1N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC12CC(Oc3ccccc3N3CCCCC3=O)=CC=CC=C1C2 | N#CCOc1ccccc1N1CCCCC1=O | N#CC12CC(Oc3ccccc3N3CCCCC3=O)=CC=CC=C1C2 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&Cc2ccccc2C1",
"old_substring": "N#CC2"
} |
Can you make molecule N#CCOc1ccccc1N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC(F)(F)Oc1ccccc1N1CCCCC1=O | N#CCOc1ccccc1N1CCCCC1=O | N#CC(F)(F)Oc1ccccc1N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N#CC2"
} |
Can you make molecule N#CCOc1ccccc1N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCC(=O)Oc1ccccc1N1CCCCC1=O | N#CCOc1ccccc1N1CCCCC1=O | N#CCCCC(=O)Oc1ccccc1N1CCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N#CCCCC&=O",
"old_substring": "N#CC2"
} |
Can you make molecule N#CCOc1ccccc1N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Oc2ccccc2N2CCCCC2=O)CCOCC1 | N#CCOc1ccccc1N1CCCCC1=O | N#CC1(Oc2ccccc2N2CCCCC2=O)CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCOCC1",
"old_substring": "N#CC2"
} |
Can you make molecule N#CCOc1ccccc1N1CCCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Oc2ccccc2N2CCCCC2=O)CCCCC1 | N#CCOc1ccccc1N1CCCCC1=O | N#CC1(Oc2ccccc2N2CCCCC2=O)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC1&CCCCC1",
"old_substring": "N#CC2"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.