prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](C)[C@@H](O)Cc1ccn(C2(C)CCCC2)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C2(C)CCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C3(C)C"
} |
Can you make molecule CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](C)[C@@H](O)Cc1ccn(C(Cl)(Cl)Cl)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(Cl)(Cl)Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C3(C)C"
} |
Can you make molecule CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)n1ccc(C[C@H](O)[C@@H](C)OC)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 | CCCC(C)(C)n1ccc(C[C@H](O)[C@@H](C)OC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C3(C)C"
} |
Can you make molecule CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)n1ccc(C[C@H](O)[C@@H](C)OC)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 | CCC(C)(CC)n1ccc(C[C@H](O)[C@@H](C)OC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C3(C)C"
} |
Can you make molecule CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](C)[C@@H](O)Cc1ccn(C2(C=O)CCCCCC2)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C(C)C)n1 | CO[C@H](C)[C@@H](O)Cc1ccn(C2(C=O)CCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C3(C)C"
} |
Can you make molecule CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC[C@H](CC(=O)SNc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](CC(=O)SNc2c(C)cccc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC[C@H](CC(=C=O)CNc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](CC(=C=O)CNc2c(C)cccc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC[C@H](C(=O)CCCC(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)CCCC(=O)Nc2c(C)cccc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC[C@H](C(C)(C)CC(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(C)(C)CC(=O)Nc2c(C)cccc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC[C@H](CCC[S@@+]([O-])CNc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](C(=O)Nc2c(C)cccc2CC)C1 | CCOC(=O)N1CCC[C@H](CCC[S@@+]([O-])CNc2c(C)cccc2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C58=O"
} |
Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)Cc1ccccc1)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CCC(CC)(C(=O)Cc1ccccc1)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(SSC(=O)c2ccccc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(SSC(=O)c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCc1ccccc1)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CCC(CC)(C(=O)CCc1ccccc1)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)c1ccccc1)C(=O)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CC[C@@H](C(=O)c1ccccc1)C(=O)N1C(=O)N[C@](CC)(c2ccc(Cl)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(C(=O)C[C@H](C)C(=O)c2ccccc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(CC(=O)c2ccccc2)C1=O | CC[C@]1(c2ccc(Cl)cc2)NC(=O)N(C(=O)C[C@H](C)C(=O)c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@H](CNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 | CC[NH+]1CCC[C@H](CNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]14CCC[C@@H]17"
} |
Can you make molecule CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(CNC(=O)N2CCC[C@H]([NH+](C)C)C2)C[C@@H]1C | CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 | CC[C@H]1CN(CNC(=O)N2CCC[C@H]([NH+](C)C)C2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]14CCC[C@@H]17"
} |
Can you make molecule CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(CNC(=O)N2CCC[C@H]([NH+](C)C)C2)C[C@H]1O | CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 | CC[C@H]1CN(CNC(=O)N2CCC[C@H]([NH+](C)C)C2)C[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@H]1O",
"old_substring": "[NH+]14CCC[C@@H]17"
} |
Can you make molecule CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC=C(CCNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 | CC[NH+]1CC=C(CCNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]14CCC[C@@H]17"
} |
Can you make molecule CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CC=C(CCCNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | CC[NH+]1CCC[C@@H]1CNC(=O)N1CCC[C@H]([NH+](C)C)C1 | CC[NH+]1CC=C(CCCNC(=O)N2CCC[C@H]([NH+](C)C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]14CCC[C@@H]17"
} |
Can you make molecule COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCCCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCCCCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C47"
} |
Can you make molecule COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCCCCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCCCCCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C47"
} |
Can you make molecule COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1NC(=O)[C@H](C)[S@+]([O-])c1ccc(C2CC(OC)C2)cc1 | COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COc1ccc(C)cc1NC(=O)[C@H](C)[S@+]([O-])c1ccc(C2CC(OC)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C47"
} |
Can you make molecule COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COOC(=S)Sc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COOC(=S)Sc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C47"
} |
Can you make molecule COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=S)Nc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COCc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | COSC(=S)Nc1ccc([S@@+]([O-])[C@@H](C)C(=O)Nc2cc(C)ccc2OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C47"
} |
Can you make molecule O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc2ccccc2c1)N1CCCc2cc(-c3nc4ccccc4o3)ccc2C1 | O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 | O=C(c1ccc2ccccc2c1)N1CCCc2cc(-c3nc4ccccc4o3)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N14CCC6CC1"
} |
Can you make molecule O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccc2ccccc2c1)C1CCC(c2nc3ccccc3o2)CC1 | O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 | O=C(c1ccc2ccccc2c1)C1CCC(c2nc3ccccc3o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N14CCC6CC1"
} |
Can you make molecule O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCCCc1nc2ccccc2o1)c1ccc2ccccc2c1 | O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 | O=C(CCCCCc1nc2ccccc2o1)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N14CCC6CC1"
} |
Can you make molecule O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)c2ccc3ccccc3c2)CCC(c2nc3ccccc3o2)CC1 | O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 | N#CC1(C(=O)c2ccc3ccccc3c2)CCC(c2nc3ccccc3o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "N14CCC6CC1"
} |
Can you make molecule O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(c2nc3ccccc3o2)CCC(C(=O)c2ccc3ccccc3c2)CC1 | O=C(c1ccc2ccccc2c1)N1CCC(c2nc3ccccc3o2)CC1 | CC1(c2nc3ccccc3o2)CCC(C(=O)c2ccc3ccccc3c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "N14CCC6CC1"
} |
Can you make molecule COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC(=S)N(C)S(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(SC(=S)N(C)S(=O)(=O)c2cn(C)nc2C)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SC2=NCCN2S(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(SC2=NCCN2S(=O)(=O)c2cn(C)nc2C)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N56"
} |
Can you make molecule COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C2CCN(CS(=O)(=O)c3cn(C)nc3C)CC2)c(OC)c1 | COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(C2CCN(CS(=O)(=O)c3cn(C)nc3C)CC2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cccc(S(=O)(=O)c3cn(C)nc3C)c2N)c(OC)c1 | COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(-c2cccc(S(=O)(=O)c3cn(C)nc3C)c2N)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc(N)cc(S(=O)(=O)c3cn(C)nc3C)c2)c(OC)c1 | COc1ccc(NS(=O)(=O)c2cn(C)nc2C)c(OC)c1 | COc1ccc(-c2cc(N)cc(S(=O)(=O)c3cn(C)nc3C)c2)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1cc&cc&c1",
"old_substring": "N56"
} |
Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1Cl)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1Cl)c(=O)n2-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccc(I)cc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccc(I)cc1)c(=O)n2-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(C=Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(C=Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2c(=O)n(-c3ccc(F)cc3)c3nc(-c4ccc5c(c4)OCCO5)nc(C(N)=O)c32)cc1I | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | Cc1ccc(Cn2c(=O)n(-c3ccc(F)cc3)c3nc(-c4ccc5c(c4)OCCO5)nc(C(N)=O)c32)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1cccc(Br)c1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1ccccc1)c(=O)n2-c1ccc(F)cc1 | NC(=O)c1nc(-c2ccc3c(c2)OCCO3)nc2c1n(Cc1cccc(Br)c1)c(=O)n2-c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(SC(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(SC(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CCCC(=O)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CCCC(=O)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CC(C)(C)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CC(C)(C)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C[S@+]([O-])CCCS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C[S@+]([O-])CCCS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C5"
} |
Can you make molecule C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCN(C(=O)CCC(C)(C)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CS[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | C[C@H]1CCCN(C(=O)CCC(C)(C)S[C@@H]2[NH+]=c3ccc(Cl)cc3=[NH+]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C5"
} |
Can you make molecule COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | COCSC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | CC(=O)SC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | CON(C)CCCC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | CC(=O)CCCC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CC(=O)C(=O)CCBr)c(C)c1CNc1ncnc2sccc12 | COC(=O)Cn1nc(C)c(CNc2ncnc3sccc23)c1C | Cc1nn(CC(=O)C(=O)CCBr)c(C)c1CNc1ncnc2sccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NSC(=O)Cc2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NSC(=O)Cc2ccccc2CSc2ncn[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CCCC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)CCCC(=O)c2ccccc2CSc2ncn[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CC(C)(C)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)CC(C)(C)c2ccccc2CSc2ncn[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NC(=O)CCC(C)(C)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)CCC(C)(C)c2ccccc2CSc2ncn[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)c(NSC(=O)[C@@H](C)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NC(=O)c2ccccc2CSc2ncn[nH]2)c1 | COc1ccc(F)c(NSC(=O)[C@@H](C)c2ccccc2CSc2ncn[nH]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(CCc1ccc(Cl)s1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1ccc(Cl)s1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(CCc1ccc(Br)s1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1ccc(Br)s1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(CCc1sccc1Br)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1sccc1Br)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c18cccs1"
} |
Can you make molecule O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(CCc1csc(I)c1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1csc(I)c1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c18cccs1"
} |
Can you make molecule O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N(CCc1cc2c(s1)CSC2)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cccs1)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | O=C(N(CCc1cc2c(s1)CSC2)Cc1ccoc1)C12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c18cccs1"
} |
Can you make molecule OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | OCCOc1ccc(NCc2ccc(F)cc2Cl)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2Cl)c(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccc(F)cc1F"
} |
Can you make molecule OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | OCCOc1ccc(NCc2ccc(F)cc2Br)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2Br)c(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c17ccc(F)cc1F"
} |
Can you make molecule OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | OCCOc1ccc(NCc2ccc(F)c(Cl)c2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)c(Cl)c2F)c(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1F",
"old_substring": "c17ccc(F)cc1F"
} |
Can you make molecule OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=CNc1ccc(OCCO)cc1C(F)(F)F)c1ccc(F)cc1F | OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 | CC(=CNc1ccc(OCCO)cc1C(F)(F)F)c1ccc(F)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccc(F)cc1F",
"old_substring": "c17ccc(F)cc1F"
} |
Can you make molecule OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | OCCOc1ccc(NCc2ccc(Cl)c(F)c2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(F)cc2F)c(C(F)(F)F)c1 | OCCOc1ccc(NCc2ccc(Cl)c(F)c2F)c(C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(F)c1F",
"old_substring": "c17ccc(F)cc1F"
} |
Can you make molecule O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C(/C=C/SNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCC2(c3ccccc3)CCCC2)CCC1=NC(=O)c1cccc(Br)c1 | O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C1C(=NCC2(c3ccccc3)CCCC2)CCC1=NC(=O)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN1CCC(=NONCC2(c3ccccc3)CCCC2)CC1)c1cccc(Br)c1 | O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C(NN1CCC(=NONCC2(c3ccccc3)CCCC2)CC1)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCC2(c3ccccc3)CCCC2)COCC1=NC(=O)c1cccc(Br)c1 | O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C1C(=NCC2(c3ccccc3)CCCC2)COCC1=NC(=O)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&COCC1=&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC1(c2ccccc2)CCCC1)NN=C1CCN(NC(=O)c2cccc(Br)c2)CC1 | O=C(CNC(=O)c1cccc(Br)c1)NCC1(c2ccccc2)CCCC1 | O=C(NCC1(c2ccccc2)CCCC1)NN=C1CCN(NC(=O)c2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCN&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1SC(=O)Cc1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1SC(=O)Cc1ccc([N-]S(=O)(=O)c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CCCC(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CCCC(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CC(C)(C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)CCC(C)(C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1c2ccccc2C[C@H]1C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@@H]1Cc2ccccc2N1C(=O)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | C[C@H](C(=O)SN1c2ccccc2C[C@H]1C)c1ccc([N-]S(=O)(=O)c2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(=O)n(CCCCCOc2ccc(F)cc2)n1 | CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 | CC(C)(C)c1ccc(=O)n(CCCCCOc2ccc(F)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5CC3"
} |
Can you make molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCOc1ccc(F)cc1)n1nc(C(C)(C)C)ccc1=O | CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 | C[C@@H](CCOc1ccc(F)cc1)n1nc(C(C)(C)C)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5CC3"
} |
Can you make molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(=O)n(C2CCC(Oc3ccc(F)cc3)CC2)n1 | CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 | CC(C)(C)c1ccc(=O)n(C2CCC(Oc3ccc(F)cc3)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5CC3"
} |
Can you make molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(COc1ccc(F)cc1)Cn1nc(C(C)(C)C)ccc1=O | CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 | CC(C)(COc1ccc(F)cc1)Cn1nc(C(C)(C)C)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C5CC3"
} |
Can you make molecule CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1ccc(=O)n(C2CC(F)(Oc3ccc(F)cc3)C2)n1 | CC(C)(C)c1ccc(=O)n(CCCOc2ccc(F)cc2)n1 | CC(C)(C)c1ccc(=O)n(C2CC(F)(Oc3ccc(F)cc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C5CC3"
} |
Can you make molecule Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(Cl)(Cl)Cl)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(Cl)(Cl)Cl)c3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)CC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)CC(C)(C)C)c3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCC(C)(C)C)c3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCC(F)(F)F)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCC(F)(F)F)c3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCCC(F)(F)F)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OC(C)(C)C)c3)cc2)o1 | Cc1nnc(-c2ccc(NC(=O)NCc3ccnc(OCCCCC(F)(F)F)c3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(C)(C)C"
} |
Can you make molecule CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1CC1CCN(c2cccc(F)c2C(N)=[NH2+])CC1 | CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] | Cn1cc[nH+]c1CC1CCN(c2cccc(F)c2C(N)=[NH2+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1[nH+]ccn1C)C(=S)Sc1cccc(F)c1C(N)=[NH2+] | CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] | CN(Cc1[nH+]ccn1C)C(=S)Sc1cccc(F)c1C(N)=[NH2+] | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1CCN1CCC(c2cccc(F)c2C(N)=[NH2+])CC1 | CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] | Cn1cc[nH+]c1CCN1CCC(c2cccc(F)c2C(N)=[NH2+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1CN1CSC(=S)N(c2cccc(F)c2C(N)=[NH2+])C1 | CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] | Cn1cc[nH+]c1CN1CSC(=S)N(c2cccc(F)c2C(N)=[NH2+])C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN23"
} |
Can you make molecule CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc[nH+]c1CC1(C#N)CCC(c2cccc(F)c2C(N)=[NH2+])CC1 | CN(Cc1[nH+]ccn1C)c1cccc(F)c1C(N)=[NH2+] | Cn1cc[nH+]c1CC1(C#N)CCC(c2cccc(F)c2C(N)=[NH2+])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN23"
} |
Can you make molecule COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2nnc(CC(=O)SNc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(CC(=O)SNc3ccc(C)cc3)c2N)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2nnc(C(=O)CCCC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)CCCC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2nnc(C(C)(C)CC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(C)(C)CC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2nnc(C(C)(C)CCC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(C)(C)CCC(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-n2nnc([C@H](C)C(=O)SNc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc(C(=O)Nc3ccc(C)cc3)c2N)ccc1Cl | COc1cc(-n2nnc([C@H](C)C(=O)SNc3ccc(C)cc3)c2N)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCCCNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CCCCNC(=O)N1CCSC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCC=NC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CCC=NC(=O)N1CCSC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C45"
} |
Can you make molecule Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCCCCNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CCCCCNC(=O)N1CCSC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1C1CC(NC(=O)N2CCSC(C)(C)C2)C1 | Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1C1CC(NC(=O)N2CCSC(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1SC(=S)ONC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1CNC(=O)N1CCSC(C)(C)C1 | Cc1ccccc1SC(=S)ONC(=O)N1CCSC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.