prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(N2CC[C@H](NC(=O)CC(C)(C)Sc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)CC(C)(C)Sc3ccccn3)C2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)CC5"
} |
Can you make molecule Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(N2CC[C@H](NC(=O)CCC(C)(C)Sc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)CCC(C)(C)Sc3ccccn3)C2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)CC5"
} |
Can you make molecule Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(N2CC[C@H](NC(=O)C[C@@H](Br)Sc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 | Cn1cc(N2CC[C@H](NC(=O)C[C@@H](Br)Sc3ccccn3)C2=O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)CC5"
} |
Can you make molecule Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Sc1ccccn1)C(=O)SN[C@H]1CCN(c2cnn(C)c2)C1=O | Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 | C[C@@H](Sc1ccccn1)C(=O)SN[C@H]1CCN(c2cnn(C)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)CC5"
} |
Can you make molecule Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCSc1ccccn1)C(=O)N[C@H]1CCN(c2cnn(C)c2)C1=O | Cn1cc(N2CC[C@H](NC(=O)CCSc3ccccn3)C2=O)cn1 | C[C@H](CCSc1ccccn1)C(=O)N[C@H]1CCN(c2cnn(C)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C4(=O)CC5"
} |
Can you make molecule CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1ccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)cc1I | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 | CC(C)Oc1ccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16cccc8c1"
} |
Can you make molecule CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)ccc1Br | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 | CC(C)Oc1cc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16cccc8c1"
} |
Can you make molecule CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1ccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)cc1Cl | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 | CC(C)Oc1ccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16cccc8c1"
} |
Can you make molecule CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1Br | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16cccc8c1"
} |
Can you make molecule CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1Cl | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1 | CC(C)Oc1cccc(C(=O)NC(=S)Nc2cccc3c2C(=O)N(c2ccccc2)C3=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16cccc8c1"
} |
Can you make molecule Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1CCCCSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CCCCSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1CCCCCSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CCCCCSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1C1CC(SCC(=O)N(C)[C@@H]2CCCc3ccccc32)C1 | Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1C1CC(SCC(=O)N(C)[C@@H]2CCCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1SC(=S)OSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1SC(=S)OSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1NC(=S)SSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1CSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | Cc1nn(C)c(Cl)c1NC(=S)SSCC(=O)N(C)[C@@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C46"
} |
Can you make molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(Cl)(Cl)Cl)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(Cl)(Cl)Cl)nc2c1c(=O)n(C)c(=O)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)CC(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)CC(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)(C)CC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCC(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCC(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCC(F)(F)F)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCC(F)(F)F)nc2c1c(=O)n(C)c(=O)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCCC(F)(F)F)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(C(C)(C)C)nc2c1c(=O)n(C)c(=O)n2C | C[C@H]1CC(=O)Nc2ccccc2N1C(=O)CSc1nc(CCCCC(F)(F)F)nc2c1c(=O)n(C)c(=O)n2C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C5(C)(C)C"
} |
Can you make molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CCCC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CCCCC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)CCCc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CCC(=O)CCCc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Cc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CC(=O)c1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | CCCCC(=O)Cc1cccc(O[C@@H](C)C(=O)Nc2c(C(C)C)cccc2C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC(=O)C&",
"old_substring": "CC7=O"
} |
Can you make molecule CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)C/C(C)=N\ON1CCNCC1 | CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 | CC[C@H](C)[NH+](C)C/C(C)=N\ON1CCNCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C2=O"
} |
Can you make molecule CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)C(CC)(CC)C(=O)CN1CCNCC1 | CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 | CC[C@H](C)[NH+](C)C(CC)(CC)C(=O)CN1CCNCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C2=O"
} |
Can you make molecule CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)SSC(=O)N1CCNCC1 | CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 | CC[C@H](C)[NH+](C)SSC(=O)N1CCNCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C2=O"
} |
Can you make molecule CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[NH+](C)C(CC)(CC)C(=O)CCN1CCNCC1 | CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 | CC[C@H](C)[NH+](C)C(CC)(CC)C(=O)CCN1CCNCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C2=O"
} |
Can you make molecule CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1CCNCC1)C(=O)[NH+](C)[C@@H](C)CC | CC[C@H](C)[NH+](C)CC(=O)N1CCNCC1 | CC[C@@H](C(=O)N1CCNCC1)C(=O)[NH+](C)[C@@H](C)CC | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C4C2=O"
} |
Can you make molecule Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc2cc3oc(=O)c(CCC(=O)SN4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)SN4CCc5ccccc5C4)c(C)c3cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCc2ccccc2C1",
"old_substring": "N16CCc2ccccc2C1"
} |
Can you make molecule Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCCSc5ccccc54)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCCSc5ccccc54)c(C)c3cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCSc2ccccc21",
"old_substring": "N16CCc2ccccc2C1"
} |
Can you make molecule Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5c(Br)cccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5c(Br)cccc5C4)c(C)c3cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(Br)cccc2C1",
"old_substring": "N16CCc2ccccc2C1"
} |
Can you make molecule Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCSc5ccc(Cl)cc54)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCSc5ccc(Cl)cc54)c(C)c3cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc(Cl)cc21",
"old_substring": "N16CCc2ccccc2C1"
} |
Can you make molecule Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc2cc3oc(=O)c(CCC(=O)C4(C)Cc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)N4CCc5ccccc5C4)c(C)c3cc2c1C | Cc1oc2cc3oc(=O)c(CCC(=O)C4(C)Cc5ccccc5C4)c(C)c3cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "N16CCc2ccccc2C1"
} |
Can you make molecule Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(CC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(CC(F)(F)F)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)F",
"old_substring": "O5C(F)(F)F"
} |
Can you make molecule Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(SC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(SC(F)(F)F)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "O5C(F)(F)F"
} |
Can you make molecule Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc([C@@H](O)CCC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc([C@@H](O)CCC(F)(F)F)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CCC(F)(F)F",
"old_substring": "O5C(F)(F)F"
} |
Can you make molecule Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(CCCC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(CCCC(F)(F)F)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "O5C(F)(F)F"
} |
Can you make molecule Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(C(=O)C(F)(F)C(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(OC(F)(F)F)c3)C2=O)cc1 | Cc1ccc([C@]2(C)NC(=O)N(CC(=O)Nc3cccc(C(=O)C(F)(F)C(F)(F)F)c3)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C(F)(F)C(F)(F)F",
"old_substring": "O5C(F)(F)F"
} |
Can you make molecule COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | COCc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | COCSc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | CC(=O)Sc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O)c(CN2CCOCC2)c2c1C(=O)C(=Cc1cccc(C(=O)CS)c1)O2 | COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | Cc1cc(O)c(CN2CCOCC2)c2c1C(=O)C(=Cc1cccc(C(=O)CS)c1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(O)c(CN2CCOCC2)c2c1C(=O)C(=Cc1cccc(C(=O)CI)c1)O2 | COc1cccc(C=C2Oc3c(CN4CCOCC4)c(O)cc(C)c3C2=O)c1 | Cc1cc(O)c(CN2CCOCC2)c2c1C(=O)C(=Cc1cccc(C(=O)CI)c1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COCSC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1=C(C(=O)SC(C)=O)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COC(=O)C1=C(C(=O)SC(C)=O)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1=C(C(=O)CCCN(C)OC)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COC(=O)C1=C(C(=O)CCCN(C)OC)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1=C(C(=O)CCCC(C)=O)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COC(=O)C1=C(C(=O)CCCC(C)=O)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1=C(C(=O)C(=O)CCBr)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | COC(=O)C1=C(C(=O)OC)[C@@](O)(c2ccccc2)[C@@H](c2ccccc2)O1 | COC(=O)C1=C(C(=O)C(=O)CCBr)O[C@H](c2ccccc2)[C@]1(O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Can you make molecule Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CCCCC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CCCCC2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC[NH2+][C@H](C)C=C2CCCC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)C=C2CCCC2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2SCCCS2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2SCCCS2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2SCSCS2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2SCSCS2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC[NH2+][C@H](C)C=C2CCCCC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)CC2CC2)c(Cl)c1 | Cc1ccc(NC(=O)CC[NH2+][C@H](C)C=C2CCCCC2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NSC(=O)C[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NSC(=O)C[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NCC(=C=O)C[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NCC(=C=O)C[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CCCC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)CCCC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC(=O)CC(C)(C)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)CC(C)(C)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(NC[S@+]([O-])CCC[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC(=O)[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | COc1ccc(NC[S@+]([O-])CCC[C@H]2CCCN(S(=O)(=O)c3c[nH]cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C48=O"
} |
Can you make molecule CC[C@H](C)[C@@H](CO)c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](CO)c1sc2ccccc2c1C | CC[C@H](C)[C@@H](CO)c1ccccc1C | CC[C@H](C)[C@@H](CO)c1sc2ccccc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1C",
"old_substring": "c12ccccc1C"
} |
Can you make molecule CC[C@H](C)[C@@H](CO)c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](CO)c1sc2sccc2c1Cl | CC[C@H](C)[C@@H](CO)c1ccccc1C | CC[C@H](C)[C@@H](CO)c1sc2sccc2c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c12ccccc1C"
} |
Can you make molecule CC[C@H](C)[C@@H](CO)c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](CO)c1ccc(C)c(Cl)c1 | CC[C@H](C)[C@@H](CO)c1ccccc1C | CC[C@H](C)[C@@H](CO)c1ccc(C)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c12ccccc1C"
} |
Can you make molecule CC[C@H](C)[C@@H](CO)c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](CO)c1ccc(Br)cc1C | CC[C@H](C)[C@@H](CO)c1ccccc1C | CC[C@H](C)[C@@H](CO)c1ccc(Br)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c12ccccc1C"
} |
Can you make molecule CC[C@H](C)[C@@H](CO)c1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)[C@@H](CO)c1cccc(Br)c1C | CC[C@H](C)[C@@H](CO)c1ccccc1C | CC[C@H](C)[C@@H](CO)c1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c12ccccc1C"
} |
Can you make molecule O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=C(/C=C/Sc1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCCC2)nc1-c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2 | O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=Cc1sc(N2CCCC2)nc1-c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCCC2)sc1-c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2 | O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=Cc1nc(N2CCCC2)sc1-c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCCC1)n1nc(-c2cc3n(n2)CCN(Cc2coc4ccccc4c2=O)C3)oc1=S | O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=C(N1CCCC1)n1nc(-c2cc3n(n2)CCN(Cc2coc4ccccc4c2=O)C3)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c(CN2CCn3nc(-c4ccc(/C=N/ON5CCCC5)o4)cc3C2)coc2ccccc12 | O=C(c1cc2n(n1)CCN(Cc1coc3ccccc3c1=O)C2)N1CCCC1 | O=c1c(CN2CCn3nc(-c4ccc(/C=N/ON5CCCC5)o4)cc3C2)coc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C46"
} |
Can you make molecule CCOCCCc1cnc(C[NH2+]C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(O)c(CCCc2cnc(C[NH2+]C)o2)c2onc1-2 | CCOCCCc1cnc(C[NH2+]C)o1 | CCc1ccc(O)c(CCCc2cnc(C[NH2+]C)o2)c2onc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCCc1cnc(C[NH2+]C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCOc2ccc(CCCc3cnc(C[NH2+]C)o3)cc2C1 | CCOCCCc1cnc(C[NH2+]C)o1 | CCN1CCOc2ccc(CCCc3cnc(C[NH2+]C)o3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCOCCCc1cnc(C[NH2+]C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2ccc-2ncn(CCCc2cnc(C[NH2+]C)o2)c1=O | CCOCCCc1cnc(C[NH2+]C)o1 | CCc1cc2ccc-2ncn(CCCc2cnc(C[NH2+]C)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCCc1cnc(C[NH2+]C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2nc-2ccn(CCCc2cnc(C[NH2+]C)o2)c1=O | CCOCCCc1cnc(C[NH2+]C)o1 | CCc1ccc2nc-2ccn(CCCc2cnc(C[NH2+]C)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCCc1cnc(C[NH2+]C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc2nc-2ccn(CCCc2cnc(C[NH2+]C)o2)c1=O | CCOCCCc1cnc(C[NH2+]C)o1 | CCc1cnc2nc-2ccn(CCCc2cnc(C[NH2+]C)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1Cc1cc(C#N)c(S(=O)(=O)c2cccc(F)c2)s1 | Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 | Cc1ccsc1Cc1cc(C#N)c(S(=O)(=O)c2cccc(F)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1Cc1ccc(S(=O)(=O)c2cccc(F)c2)c(C#N)c1 | Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 | Cc1ccsc1Cc1ccc(S(=O)(=O)c2cccc(F)c2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1CON=C1CCN(S(=O)(=O)c2cccc(F)c2)CC1 | Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 | Cc1ccsc1CON=C1CCN(S(=O)(=O)c2cccc(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N23C"
} |
Can you make molecule Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1Cc1cnc(C#N)c(S(=O)(=O)c2cccc(F)c2)c1 | Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 | Cc1ccsc1Cc1cnc(C#N)c(S(=O)(=O)c2cccc(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N23C"
} |
Can you make molecule Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1CN1CCC=C(CS(=O)(=O)c2cccc(F)c2)C1 | Cc1ccsc1CN(C)S(=O)(=O)c1cccc(F)c1 | Cc1ccsc1CN1CCC=C(CS(=O)(=O)c2cccc(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N23C"
} |
Can you make molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCN(SC(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(SC(=O)Cc2ccc(-n3cccn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCN(C(=O)CCCC(=O)c2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)CCCC(=O)c2ccc(-n3cccn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCN(C(=O)CC(C)(C)c2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)CC(C)(C)c2ccc(-n3cccn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCN(C[S@+]([O-])CCCc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C[S@+]([O-])CCCc2ccc(-n3cccn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1CCCN(C(=O)CCC(C)(C)c2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)Cc2ccc(-n3cccn3)cc2)C1 | CC[C@@H]1CCCN(C(=O)CCC(C)(C)c2ccc(-n3cccn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C6"
} |
Can you make molecule CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@H](C(=O)C(C)C)C(=O)N(CCC1CC1)N=O | CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C | CCC(CC)[C@H](C(=O)C(C)C)C(=O)N(CCC1CC1)N=O | 102 | {
"fragment_index": 0,
"new_substring": "O=NN1CCC&CC1",
"old_substring": "O1C"
} |
Can you make molecule CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@H](C(=O)C(C)C)C(=O)S(=O)(=O)CCC1CC1 | CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C | CCC(CC)[C@H](C(=O)C(C)C)C(=O)S(=O)(=O)CCC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=S1(=O)CCC&CC1",
"old_substring": "O1C"
} |
Can you make molecule CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@@H](C(=O)OP1OCCN1C(C)(C)C)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)OP1OCCN1C(C)(C)C)C(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "O&P1OCCN1C(C)(C)C",
"old_substring": "O1C"
} |
Can you make molecule CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@@H](C(=O)SCOC)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)SCOC)C(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "O1C"
} |
Can you make molecule CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[C@@H](C(=O)OCCl)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)OC)C(=O)C(C)C | CCC(CC)[C@@H](C(=O)OCCl)C(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "O1C"
} |
Can you make molecule CCc1nsc(N2CCC(CC(N)=O)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(N2CCC(CCCCC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CCCCC(N)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C5C(N)=O"
} |
Can you make molecule CCc1nsc(N2CCC(CC(N)=O)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(N2CCC(CC(N)=S)CC2)n1 | CCc1nsc(N2CCC(CC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CC(N)=S)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C5C(N)=O"
} |
Can you make molecule CCc1nsc(N2CCC(CC(N)=O)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(N2CCC(CC(C)=O)CC2)n1 | CCc1nsc(N2CCC(CC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CC(C)=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C5C(N)=O"
} |
Can you make molecule CCc1nsc(N2CCC(CC(N)=O)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(N2CCC(CC/C(N)=N/O)CC2)n1 | CCc1nsc(N2CCC(CC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CC/C(N)=N/O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C5C(N)=O"
} |
Can you make molecule CCc1nsc(N2CCC(CC(N)=O)CC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nsc(N2CCC(CC/C(N)=N\O)CC2)n1 | CCc1nsc(N2CCC(CC(N)=O)CC2)n1 | CCc1nsc(N2CCC(CC/C(N)=N\O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C5C(N)=O"
} |
Can you make molecule CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)[C@H]2CCCC[C@@H]2I)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)[C@H]2CCCC[C@@H]2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "C18[C@H]2CCCC[C@@H]12"
} |
Can you make molecule CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2CCCCCCC2)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2CCCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C18[C@H]2CCCC[C@@H]12"
} |
Can you make molecule CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2CCCCCC2)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C18[C@H]2CCCC[C@@H]12"
} |
Can you make molecule CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2C3=CC=CC=C2CCCC3)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2C3=CC=CC=C2CCCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C18[C@H]2CCCC[C@@H]12"
} |
Can you make molecule CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)[C@@H](C)C2=CCCCC2)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)C2[C@H]3CCCC[C@@H]23)c1 | CC(C)N(C)C(=O)c1ccc(Cl)c(NC(=O)[C@@H](C)C2=CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "C18[C@H]2CCCC[C@@H]12"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.