prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)C[NH+]([C@@H]2CCCC[C@H]2SC[C@@H](C)CO)C1 | CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO | CCC1(CC)C[NH+]([C@@H]2CCCC[C@H]2SC[C@@H](C)CO)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH2+]24"
} |
Can you make molecule CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO less soluble in water? The output molecule should be similar to the input molecule. | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[NH+](C)C | CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]&(C)C",
"old_substring": "[NH2+]24"
} |
Can you make molecule CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(CC)C[NH+]([C@@H]2CCCC[C@H]2SC[C@@H](C)CO)C1 | CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO | CCCC1(CC)C[NH+]([C@@H]2CCCC[C@H]2SC[C@@H](C)CO)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH2+]24"
} |
Can you make molecule CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO less soluble in water? The output molecule should be similar to the input molecule. | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[N+]#N | CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[N+]#N | 102 | {
"fragment_index": 0,
"new_substring": "[N+]&#N",
"old_substring": "[NH2+]24"
} |
Can you make molecule CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO less soluble in water? The output molecule should be similar to the input molecule. | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[NH+]1CCCC1 | CC[NH2+][C@@H]1CCCC[C@H]1SC[C@@H](C)CO | CC.C[C@@H](CO)CS[C@@H]1CCCC[C@H]1[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH2+]24"
} |
Can you make molecule COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)[C@H](C)C1(CC2CCCCC2)CC[NH2+]C1 | COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)C1(CC2CCCCC2)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)[C@H](C)[C@]1(CC2CCCCC2)CCC[NH2+]C1 | COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)[C@]1(CC2CCCCC2)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)[C@H](C)n1c[nH+]cc1CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)n1c[nH+]cc1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)[C@H](C)c1cc(CC2CCCCC2)[nH][nH+]1 | COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)c1cc(CC2CCCCC2)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](C)[C@H](C)c1c(CC2CCCCC2)c[nH+]n1C | COC(=O)[C@@H](C)[C@H](C)[NH2+]CC1CCCCC1 | COC(=O)[C@@H](C)[C@H](C)c1c(CC2CCCCC2)c[nH+]n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC(CC)[NH+](C)CCC(=O)NC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[NH+](C)CCC(=O)NCCCCC(N)=O | CCC(CC)[NH+](C)CCC(=O)NC(N)=O | CCC(CC)[NH+](C)CCC(=O)NCCCCC(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C2(N)=O"
} |
Can you make molecule CCC(CC)[NH+](C)CCC(=O)NC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[NH+](C)CCC(=O)NCC(C)=O | CCC(CC)[NH+](C)CCC(=O)NC(N)=O | CCC(CC)[NH+](C)CCC(=O)NCC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C2(N)=O"
} |
Can you make molecule CCC(CC)[NH+](C)CCC(=O)NC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[NH+](C)CCC(=O)NC(=O)N(C)OC | CCC(CC)[NH+](C)CCC(=O)NC(N)=O | CCC(CC)[NH+](C)CCC(=O)NC(=O)N(C)OC | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)C&=O",
"old_substring": "C2(N)=O"
} |
Can you make molecule CCC(CC)[NH+](C)CCC(=O)NC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[NH+](C)CCC(=O)NC(=O)C(C)C | CCC(CC)[NH+](C)CCC(=O)NC(N)=O | CCC(CC)[NH+](C)CCC(=O)NC(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C2(N)=O"
} |
Can you make molecule CCC(CC)[NH+](C)CCC(=O)NC(N)=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)[NH+](C)CCC(=O)NC(=O)S | CCC(CC)[NH+](C)CCC(=O)NC(N)=O | CCC(CC)[NH+](C)CCC(=O)NC(=O)S | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)S",
"old_substring": "C2(N)=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)CC(C)(C)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)CC(C)(C)NCc2nnc(SCc3ccccc3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)CCC(C)(C)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)CCC(C)(C)NCc2nnc(SCc3ccccc3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(NC(=O)C[C@@H](Br)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(NC(=O)C[C@@H](Br)NCc2nnc(SCc3ccccc3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(Nc2cc(C)n(NCc3nnc(SCc4ccccc4)n3C)c(=O)c2)c1 | Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(Nc2cc(C)n(NCc3nnc(SCc4ccccc4)n3C)c(=O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)cc(Nc2c(C)n(NCc3nnc(SCc4ccccc4)n3C)ccc2=O)c1 | Cc1cc(C)cc(NC(=O)NCc2nnc(SCc3ccccc3)n2C)c1 | Cc1cc(C)cc(Nc2c(C)n(NCc3nnc(SCc4ccccc4)n3C)ccc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)NCCNc2ccn(-n3cccn3)c2)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 | Cc1nc(C)c(C(=O)NCCNc2ccn(-n3cccn3)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c17cc9ncn1"
} |
Can you make molecule Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)NCCNc2nc(-n3cccn3)ncc2I)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 | Cc1nc(C)c(C(=O)NCCNc2nc(-n3cccn3)ncc2I)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c17cc9ncn1"
} |
Can you make molecule Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)NCCNc2ccnc(-n3cccn3)c2)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 | Cc1nc(C)c(C(=O)NCCNc2ccnc(-n3cccn3)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccnc&c1",
"old_substring": "c17cc9ncn1"
} |
Can you make molecule Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)NCCNc2csc3nc(-n4cccn4)cn23)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 | Cc1nc(C)c(C(=O)NCCNc2csc3nc(-n4cccn4)cn23)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&cn12",
"old_substring": "c17cc9ncn1"
} |
Can you make molecule Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)nc(Cl)n2)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)ncn2)s1 | Cc1nc(C)c(C(=O)NCCNc2cc(-n3cccn3)nc(Cl)n2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&nc(Cl)n1",
"old_substring": "c17cc9ncn1"
} |
Can you make molecule CCCNC(=O)NC(C)(C)c1ncc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CC(C)(C)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)CC(C)(C)NC(C)(C)c1ncc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCCNC(=O)NC(C)(C)c1ncc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)CCC(C)(C)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)CCC(C)(C)NC(C)(C)c1ncc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCCNC(=O)NC(C)(C)c1ncc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNc1c(C)n(C)n(NC(C)(C)c2ncc(C)s2)c1=O | CCCNC(=O)NC(C)(C)c1ncc(C)s1 | CCCNc1c(C)n(C)n(NC(C)(C)c2ncc(C)s2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CCCNC(=O)NC(C)(C)c1ncc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNc1nn(NC(C)(C)c2ncc(C)s2)c(C)cc1=O | CCCNC(=O)NC(C)(C)c1ncc(C)s1 | CCCNc1nn(NC(C)(C)c2ncc(C)s2)c(C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CCCNC(=O)NC(C)(C)c1ncc(C)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)C[C@@H](Br)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)NC(C)(C)c1ncc(C)s1 | CCCNC(=O)C[C@@H](Br)NC(C)(C)c1ncc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COCc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COCSc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(SC(C)=O)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(SC(C)=O)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(C(=O)CS)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(C(=O)CS)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(C(=O)CI)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | COc1ccc(NC(=O)[C@H]2c3cc(OC)c(OC)cc3C(=O)N(C)[C@@H]2c2cccs2)cc1OC | COc1cc2c(cc1OC)[C@H](C(=O)Nc1ccc(C(=O)CI)c(OC)c1)[C@@H](c1cccs1)N(C)C2=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C2(C)CCCC2)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C2(C)CCCC2)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C(Cl)(Cl)Cl)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(Cl)(Cl)Cl)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1cc(C(=O)N2CCC[C@H](OCc3ccccn3)C2)n(CC)n1 | CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCCC(C)(C)c1cc(C(=O)N2CCC[C@H](OCc3ccccn3)C2)n(CC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C(C)(CC)CC)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(C)(CC)CC)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C2(C=O)CCCCCC2)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C(C)C)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | CCn1nc(C2(C=O)CCCCCC2)cc1C(=O)N1CCC[C@H](OCc2ccccn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C8(C)C"
} |
Can you make molecule CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(OSC(=O)Cc2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OSC(=O)Cc2nc3ncc(Br)cn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(OC(=O)CCCC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)CCCC(=O)c2nc3ncc(Br)cn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(OC(=O)CC(C)(C)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)CC(C)(C)c2nc3ncc(Br)cn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(OC(=O)CCC(C)(C)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)CCC(C)(C)c2nc3ncc(Br)cn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(OSC(=O)[C@@H](C)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OC(=O)c2nc3ncc(Br)cn3n2)cc1 | CCCc1ccc(OSC(=O)[C@@H](C)c2nc3ncc(Br)cn3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C=CC(=O)OCC(C)(C)C[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC(=O)[NH+]1CCCC(C)(C)OCC(C)(C)C1 | C=CC(=O)OCC(C)(C)C[NH+](C)C | C=CC(=O)[NH+]1CCCC(C)(C)OCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule C=CC(=O)OCC(C)(C)C[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC(=O)OCC(C)(C)C[N+](C)(C)C | C=CC(=O)OCC(C)(C)C[NH+](C)C | C=CC(=O)OCC(C)(C)C[N+](C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule C=CC(=O)OCC(C)(C)C[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC(=O)[NH+]1CC(C)(C)COCC(C)(C)C1 | C=CC(=O)OCC(C)(C)C[NH+](C)C | C=CC(=O)[NH+]1CC(C)(C)COCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule C=CC(=O)OCC(C)(C)C[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC(=O)[NH+]1CC(C)(C)CC2(CCOC2)C1 | C=CC(=O)OCC(C)(C)C[NH+](C)C | C=CC(=O)[NH+]1CC(C)(C)CC2(CCOC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule C=CC(=O)OCC(C)(C)C[NH+](C)C less soluble in water? The output molecule should be similar to the input molecule. | C=CC(=O)[NH+]1CCC(C)(C)COCC(C)(C)C1 | C=CC(=O)OCC(C)(C)C[NH+](C)C | C=CC(=O)[NH+]1CCC(C)(C)COCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)CC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NSC(=O)CC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCC(=C=O)CC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NCC(=C=O)CC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)CCCC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)CC(C)(C)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCCC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC(=O)C2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | Cc1ccc(NC[S@+]([O-])CCCC2(c3ccc(F)cc3)CC2)cc1S(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Can you make molecule COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | COCc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | COCSc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | CC(=O)Sc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1cc(C[NH+]2CCNC(=O)CC2)ccc1C(=O)CS | COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | CC(C)COc1cc(C[NH+]2CCNC(=O)CC2)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)COc1cc(C[NH+]2CCNC(=O)CC2)ccc1C(=O)CI | COc1ccc(C[NH+]2CCNC(=O)CC2)cc1OCC(C)C | CC(C)COc1cc(C[NH+]2CCNC(=O)CC2)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COCc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COCSc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | CC(=O)Sc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | O=C(CS)c1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | COc1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | O=C(CI)c1cccc(Nc2nnc(S[C@H]3Cc4ccccc4[C@H]3O)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CC[C@H](CC)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc(CC[C@H](CC)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CC[C@H](CBr)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc(CC[C@H](CBr)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CCC[C@H](CBr)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc(CCC[C@H](CBr)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(CCC[C@@H](CCl)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc(CCC[C@@H](CCl)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]58C"
} |
Can you make molecule CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc([C@H]2CCC[C@H](NC(=O)[C@H](C)[NH+]3CCc4n[nH]cc4C3)C2)cc1 | CCc1ccc([C@@H](C)NC(=O)[C@H](C)[NH+]2CCc3n[nH]cc3C2)cc1 | CCc1ccc([C@H]2CCC[C@H](NC(=O)[C@H](C)[NH+]3CCc4n[nH]cc4C3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]58C"
} |
Can you make molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | C=CCC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H](CCCCl)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | O=C1[C@@H](CCCCl)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H](CCCCS)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | O=C1[C@@H](CCCCS)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H](CCCBr)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | O=C1[C@@H](CCCBr)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1[C@@H](CCCCF)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | CC[C@@H]1C(=O)N2CCCC[C@@H]2C(=O)N1C[C@H]1CC=CCC1 | O=C1[C@@H](CCCCF)N(C[C@H]2CC=CCC2)C(=O)[C@H]2CCCCN12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC4"
} |
Can you make molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCCCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC5"
} |
Can you make molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1[C@@H](C)CCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1[C@@H](C)CCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4CC5"
} |
Can you make molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C1CCC(c2ccccc2)CC1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C1CCC(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC5"
} |
Can you make molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(C)(C)Cc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CC(C)(C)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC5"
} |
Can you make molecule CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C1CC(F)(c2ccccc2)C1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1CCCc1ccccc1 | CC[C@@H](C)Sc1nc2c(c(=O)[nH]c(=O)n2C)n1C1CC(F)(c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C4CC5"
} |
Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cc4cc(F)ccc4s3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cc4cc(F)ccc4s3)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c18cccc(F)c1"
} |
Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(Br)c3C)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(Br)c3C)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c18cccc(F)c1"
} |
Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3oc4ccc(F)cc4c3C)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3oc4ccc(F)cc4c3C)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c18cccc(F)c1"
} |
Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cc(F)ccc3Br)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cc(F)ccc3Br)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18cccc(F)c1"
} |
Can you make molecule CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(F)cc3Cl)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(F)c3)cc2)s1 | CCc1nnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(F)cc3Cl)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18cccc(F)c1"
} |
Can you make molecule Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(=O)n(CC(=O)NCSCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)NCSCc2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(=O)n(CC(=O)NC(=N)SCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)NC(=N)SCc2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(=O)n(CC(=O)c2nsc(Cc3cccs3)c2N)n1 | Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)c2nsc(Cc3cccs3)c2N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(=O)n(CC(=O)N(C)C(=S)SCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)N(C)C(=S)SCc2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(=O)n(CC(=O)c2ccc(Cc3cccs3)n2N)n1 | Cc1ccc(=O)n(CC(=O)NCc2cccs2)n1 | Cc1ccc(=O)n(CC(=O)c2ccc(Cc3cccs3)n2N)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N34"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccccc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccccc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c19cccnc1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccc(I)nc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccc(I)nc3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c19cccnc1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cc4cnsc4s3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cc4cnsc4s3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c19cccnc1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccc(C)nc3C)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccc(C)nc3C)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c19cccnc1"
} |
Can you make molecule COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccncc3Cl)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3cccnc3)CC2)cc1 | COc1ccc(C(=O)N2CCC([C@H](Cc3ccc(F)cc3F)N(C)C(=O)c3ccncc3Cl)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c19cccnc1"
} |
Can you make molecule CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](NC(C)(C)CC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(C)(C)CC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](NC(C)(C)CCC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(C)(C)CCC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](N[C@H](Br)CC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](N[C@H](Br)CC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(C)(C)C)cc(=O)n1N[C@@H](CC(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | Cc1cc(OC(C)(C)C)cc(=O)n1N[C@@H](CC(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(OC(C)(C)C)c(=O)ccn1N[C@@H](CC(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | Cc1c(OC(C)(C)C)c(=O)ccn1N[C@@H](CC(C)C)C(=O)N1CC[C@@H](C)[C@@H](O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.