prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CCC(CC2CCC2)([C@@H](C)c2ccccc2)C1 | CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 | CCNC(=O)N1CCC(CC2CCC2)([C@@H](C)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CCCC(CC2CCC2)([C@@H](C)c2ccccc2)C1 | CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 | CCNC(=O)N1CCCC(CC2CCC2)([C@@H](C)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)c1oc(CC2CCC2)c([C@@H](C)c2ccccc2)c1C#N | CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 | CCNC(=O)c1oc(CC2CCC2)c([C@@H](C)c2ccccc2)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N356"
} |
Can you make molecule CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CC(CC2CCC2)([C@@H](C)c2ccccc2)CCC1=O | CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 | CCNC(=O)N1CC(CC2CCC2)([C@@H](C)c2ccccc2)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N356"
} |
Can you make molecule CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)N1CCC[C@@](CC2CCC2)([C@@H](C)c2ccccc2)C1 | CCNC(=O)N(CC1CCC1)[C@@H](C)c1ccccc1 | CCNC(=O)N1CCC[C@@](CC2CCC2)([C@@H](C)c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N356"
} |
Can you make molecule Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc[nH]c1-c1cccc(C(=O)N2C[C@@H]3C[NH+]4CCCC[C@@H]4[C@@H]3C2)c1 | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 | Cc1nc[nH]c1-c1cccc(C(=O)N2C[C@@H]3C[NH+]4CCCC[C@@H]4[C@@H]3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc[nH]c1&",
"old_substring": "Cc1nc7n[nH]1"
} |
Can you make molecule Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c[nH]nc1-c1cccc(C(=O)N2C[C@@H]3C[NH+]4CCCC[C@@H]4[C@@H]3C2)c1 | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 | Cc1c[nH]nc1-c1cccc(C(=O)N2C[C@@H]3C[NH+]4CCCC[C@@H]4[C@@H]3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c[nH]nc1&",
"old_substring": "Cc1nc7n[nH]1"
} |
Can you make molecule Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)c1Br | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 | Cc1n[nH]c(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1n[nH]c&c1Br",
"old_substring": "Cc1nc7n[nH]1"
} |
Can you make molecule Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c2ncc(-c3cccc(C(=O)N4C[C@@H]5C[NH+]6CCCC[C@@H]6[C@@H]5C4)c3)cc12 | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 | Cc1n[nH]c2ncc(-c3cccc(C(=O)N4C[C@@H]5C[NH+]6CCCC[C@@H]6[C@@H]5C4)c3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1n[nH]c2ncc&cc12",
"old_substring": "Cc1nc7n[nH]1"
} |
Can you make molecule Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)c2cc[nH]c2n1 | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)n[nH]1 | Cc1nc(-c2cccc(C(=O)N3C[C@@H]4C[NH+]5CCCC[C@@H]5[C@@H]4C3)c2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&c2cc[nH]c2n1",
"old_substring": "Cc1nc7n[nH]1"
} |
Can you make molecule C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1oc(C(=O)c2cc(C3CC3)[nH]n2)nc1C#N | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1oc(C(=O)c2cc(C3CC3)[nH]n2)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1sc(C(=O)c2cc(C3CC3)[nH]n2)cc1C#N | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1sc(C(=O)c2cc(C3CC3)[nH]n2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1ccc(C(=O)c2cc(C3CC3)[nH]n2)cc1C#N | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1ccc(C(=O)c2cc(C3CC3)[nH]n2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N1CCC(=NOC(=O)c2cc(C3CC3)[nH]n2)CC1 | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N1CCC(=NOC(=O)c2cc(C3CC3)[nH]n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1cc(C(=O)c2cc(C3CC3)[nH]n2)cnc1C#N | C[C@H]([C@@H](C)c1ccc(Cl)cc1)N(C)C(=O)c1cc(C2CC2)[nH]n1 | C[C@@H](c1ccc(Cl)cc1)[C@@H](C)c1cc(C(=O)c2cc(C3CC3)[nH]n2)cnc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N34C"
} |
Can you make molecule Cc1csc(NC2=NC(=O)CS2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(NC2=NC(=O)CS2)c1Cl | Cc1csc(NC2=NC(=O)CS2)n1 | Cc1csc(NC2=NC(=O)CS2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1csc3n1"
} |
Can you make molecule Cc1csc(NC2=NC(=O)CS2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC2=NC(=O)CS2)ncc1Br | Cc1csc(NC2=NC(=O)CS2)n1 | Cc1cc(NC2=NC(=O)CS2)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1csc3n1"
} |
Can you make molecule Cc1csc(NC2=NC(=O)CS2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC2=NC(=O)CS2)cnc1Cl | Cc1csc(NC2=NC(=O)CS2)n1 | Cc1cc(NC2=NC(=O)CS2)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1csc3n1"
} |
Can you make molecule Cc1csc(NC2=NC(=O)CS2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC2=NC(=O)CS2)sc1C | Cc1csc(NC2=NC(=O)CS2)n1 | Cc1cc(NC2=NC(=O)CS2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1csc3n1"
} |
Can you make molecule Cc1csc(NC2=NC(=O)CS2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2sc(NC3=NC(=O)CS3)nc12 | Cc1csc(NC2=NC(=O)CS2)n1 | Cc1cccc2sc(NC3=NC(=O)CS3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc2sc&nc12",
"old_substring": "Cc1csc3n1"
} |
Can you make molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1ccc2cc(S(=O)(=O)NCCCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCCCc3ccc(N4CCCCC4)cc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C8"
} |
Can you make molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1ccc2cc(S(=O)(=O)N=CCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)N=CCCc3ccc(N4CCCCC4)cc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C5C8"
} |
Can you make molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1ccc2cc(S(=O)(=O)NCCCCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCCCCc3ccc(N4CCCCC4)cc3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C8"
} |
Can you make molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1ccc2cc(S(=O)(=O)NC3CC(c4ccc(N5CCCCC5)cc4)C3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 | O=c1ccc2cc(S(=O)(=O)NC3CC(c4ccc(N5CCCCC5)cc4)C3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C8"
} |
Can you make molecule O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1ccc(N2CCCCC2)cc1)=NS(=O)(=O)c1ccc2oc(=O)ccc2c1 | O=c1ccc2cc(S(=O)(=O)NCCc3ccc(N4CCCCC4)cc3)ccc2o1 | CC(CCc1ccc(N2CCCCC2)cc1)=NS(=O)(=O)c1ccc2oc(=O)ccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5C8"
} |
Can you make molecule CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](C2([C@H]3CCOC3)CC2)CC1 | CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 | CC1CC[NH+](C2([C@H]3CCOC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&([C@H]2CCOC2)CC1",
"old_substring": "C14[C@H]2C[NH2+]C[C@@H]12"
} |
Can you make molecule CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+]([C@@H]2C[C@H](C)N(C)C2)CC1 | CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 | CC1CC[NH+]([C@@H]2C[C@H](C)N(C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@@H]&CN1C",
"old_substring": "C14[C@H]2C[NH2+]C[C@@H]12"
} |
Can you make molecule CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](N2CC[C@H](C)[C@H]2C)CC1 | CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 | CC1CC[NH+](N2CC[C@H](C)[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&[C@@H]1C",
"old_substring": "C14[C@H]2C[NH2+]C[C@@H]12"
} |
Can you make molecule CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+]([C@@H]2CCN(C)[C@@H](C)C2)CC1 | CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 | CC1CC[NH+]([C@@H]2CCN(C)[C@@H](C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1C[C@H]&CCN1C",
"old_substring": "C14[C@H]2C[NH2+]C[C@@H]12"
} |
Can you make molecule CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+]([NH+]2CCC[C@H]2C)CC1 | CC1CC[NH+](C2[C@H]3C[NH2+]C[C@@H]23)CC1 | CC1CC[NH+]([NH+]2CCC[C@H]2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCC[NH+]1&",
"old_substring": "C14[C@H]2C[NH2+]C[C@@H]12"
} |
Can you make molecule C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCCCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]15CCSCC1"
} |
Can you make molecule C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCCCCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]15CCSCC1"
} |
Can you make molecule C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCC1(C)C | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]15CCSCC1"
} |
Can you make molecule C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCC[NH+]1[C@@H](C)c1nc(-c2cccnc2Oc2ccccc2)no1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 | C[C@@H]1CCCC[NH+]1[C@@H](C)c1nc(-c2cccnc2Oc2ccccc2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC[C@H]1C",
"old_substring": "[NH+]15CCSCC1"
} |
Can you make molecule C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCC(C)(C)C1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCSCC1 | C[C@@H](c1nc(-c2cccnc2Oc2ccccc2)no1)[NH+]1CCC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]15CCSCC1"
} |
Can you make molecule CCSCCn1cnc2sc(C)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSSCCn1cnc2sc(C)cc2c1=O | CCSCCn1cnc2sc(C)cc2c1=O | C=CSSCCn1cnc2sc(C)cc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCSCCn1cnc2sc(C)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCSCCn1cnc2sc(C)cc2c1=O | CCSCCn1cnc2sc(C)cc2c1=O | C=CCCSCCn1cnc2sc(C)cc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCSCCn1cnc2sc(C)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(=O)n(CCSCCCCl)cnc2s1 | CCSCCn1cnc2sc(C)cc2c1=O | Cc1cc2c(=O)n(CCSCCCCl)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCSCCn1cnc2sc(C)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(=O)n(CCSCCCCS)cnc2s1 | CCSCCn1cnc2sc(C)cc2c1=O | Cc1cc2c(=O)n(CCSCCCCS)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCSCCn1cnc2sc(C)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(=O)n(CCSCCCBr)cnc2s1 | CCSCCn1cnc2sc(C)cc2c1=O | Cc1cc2c(=O)n(CCSCCCBr)cnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)ccn(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)c1=O | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 | Cn1c(=O)ccn(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(=O)n(C)c1=O",
"old_substring": "n15cc([N+](=O)[O-])cn1"
} |
Can you make molecule O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=O)nc(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)[nH]1 | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 | Cc1cc(=O)nc(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(=O)cc(C)[nH]1",
"old_substring": "n15cc([N+](=O)[O-])cn1"
} |
Can you make molecule O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c[nH]c(=O)n1C12C[C@@H]3C[C@@H](CC(C(=O)[O-])(C3)C1)C2 | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 | Cc1c[nH]c(=O)n1C12C[C@@H]3C[C@@H](CC(C(=O)[O-])(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c[nH]c(=O)n1&",
"old_substring": "n15cc([N+](=O)[O-])cn1"
} |
Can you make molecule O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)n1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)n1 | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 | CC(=O)n1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)[O-])(C4)C2)C3)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn(C(C)=O)n1",
"old_substring": "n15cc([N+](=O)[O-])cn1"
} |
Can you make molecule O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(O)c(=O)ccn1C12C[C@@H]3C[C@@H](CC(C(=O)[O-])(C3)C1)C2 | O=C([O-])C12C[C@H]3C[C@@H](C1)CC(n1cc([N+](=O)[O-])cn1)(C3)C2 | Cc1c(O)c(=O)ccn1C12C[C@@H]3C[C@@H](CC(C(=O)[O-])(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(O)c(=O)ccn1&",
"old_substring": "n15cc([N+](=O)[O-])cn1"
} |
Can you make molecule COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cc1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COSC(=O)Cc1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)CCCC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)CC(C)(C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)CCC(C)(C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)[C@@H](C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COC(=O)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | COSC(=O)[C@@H](C)c1ccc([C@H]2C3=C(C[C@H](c4ccccc4O)CC3=O)Nc3ncnn32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C56=O"
} |
Can you make molecule COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CCCC(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CCCCC(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CCCCC(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CC(F)(F)C(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CC(F)(F)C(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CC(F)(F)C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2C(F)(F)F)cc1 | COc1ccc(O[C@H](C)CNC(=O)[C@@H]2CCCC[C@@H]2CC(F)(F)C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C9(F)(F)F"
} |
Can you make molecule Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2cccc2C(=O)CCCC(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)CCCC(=O)Nc2cc(C)cc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C3=O"
} |
Can you make molecule Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2cccc2C(=O)CCC(=O)CNc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)CCC(=O)CNc2cc(C)cc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C5(=O)C3=O"
} |
Can you make molecule Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2cccc2C(=O)CCCS(=O)(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)CCCS(=O)(=O)Nc2cc(C)cc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C5(=O)C3=O"
} |
Can you make molecule Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2cccc2C(=O)C(C)(F)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(C)(F)C(=O)Nc2cc(C)cc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C5(=O)C3=O"
} |
Can you make molecule Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cn2cccc2C[S@+]([O-])CCCC(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C(=O)C(=O)Nc2cc(C)cc(C)c2)cc1 | Cc1ccc(Cn2cccc2C[S@+]([O-])CCCC(=O)Nc2cc(C)cc(C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C5(=O)C3=O"
} |
Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNSC(=O)Cc1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNSC(=O)Cc1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C37=O"
} |
Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)CCCC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)CCCC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C37=O"
} |
Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)CC(C)(C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)CC(C)(C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)CCC(C)(C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)CCC(C)(C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C37=O"
} |
Can you make molecule C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNSC(=O)[C@@H](C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNC(=O)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | C#CCNSC(=O)[C@@H](C)c1ccccc1NC(=O)[C@H]1SCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C37=O"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2Cl)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2Cl)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccc(I)cc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccc(I)cc2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccc(C)c(I)c2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccc(C)c(I)c2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2cccc(Br)c2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2cccc(Br)c2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2cccc(C)c2C)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2ccccc2)c([N+](=O)[O-])c1 | COC(=O)[C@H](C)NC(=O)c1ccc(Nc2cccc(C)c2C)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(=S)n(-c2ccc(F)cc2Cl)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2Cl)c(O)c1/C=N/CCC[NH+]1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(=S)n(-c2ccc(F)cc2Br)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2Br)c(O)c1/C=N/CCC[NH+]1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(=S)n(-c2ccc(F)c(Cl)c2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)c(Cl)c2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(=S)n(-c2ccc(I)cc2F)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(I)cc2F)c(O)c1/C=N/CCC[NH+]1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]c(=S)n(-c2cc3c(F)cccc3s2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2ccc(F)cc2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | O=c1[nH]c(=S)n(-c2cc3c(F)cccc3s2)c(O)c1/C=N/CCC[NH+]1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)COc2cccc3c2CCC3=O)cc1I | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 | CNC(=O)c1ccc(NC(=O)COc2cccc3c2CCC3=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19cccc8c1"
} |
Can you make molecule CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1cc(NC(=O)COc2cccc3c2CCC3=O)ccc1Br | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 | CNC(=O)c1cc(NC(=O)COc2cccc3c2CCC3=O)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19cccc8c1"
} |
Can you make molecule CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(NC(=O)COc2cccc3c2CCC3=O)cc1Cl | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 | CNC(=O)c1ccc(NC(=O)COc2cccc3c2CCC3=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19cccc8c1"
} |
Can you make molecule CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1Br | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19cccc8c1"
} |
Can you make molecule CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1Cl | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1 | CNC(=O)c1cccc(NC(=O)COc2cccc3c2CCC3=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19cccc8c1"
} |
Can you make molecule Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cc1ccc(C)s1)=N/ON1CCC[C@H](C(=O)NCC(F)(F)F)C1 | Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | C/C(Cc1ccc(C)s1)=N/ON1CCC[C@H](C(=O)NCC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C7C3=O"
} |
Can you make molecule Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCC[C@H](C(=O)NCC(F)(F)F)C1)c1ccc(C)s1 | Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | CCC(CC)(C(=O)CN1CCC[C@H](C(=O)NCC(F)(F)F)C1)c1ccc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7C3=O"
} |
Can you make molecule Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SSC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | Cc1ccc(SSC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C7C3=O"
} |
Can you make molecule Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCC[C@H](C(=O)NCC(F)(F)F)C1)c1ccc(C)s1 | Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | CCC(CC)(C(=O)CCN1CCC[C@H](C(=O)NCC(F)(F)F)C1)c1ccc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7C3=O"
} |
Can you make molecule Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)c1ccc(C)s1)C(=O)N1CCC[C@H](C(=O)NCC(F)(F)F)C1 | Cc1ccc(CC(=O)N2CCC[C@H](C(=O)NCC(F)(F)F)C2)s1 | CC[C@H](C(=O)c1ccc(C)s1)C(=O)N1CCC[C@H](C(=O)NCC(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C7C3=O"
} |
Can you make molecule CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(CN(C)[C@@H](CC)CCc2ccco2)o1 | CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 | CCc1nnc(CN(C)[C@@H](CC)CCc2ccco2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(CN(C)[C@@H](CBr)CCc2ccco2)o1 | CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 | CCc1nnc(CN(C)[C@@H](CBr)CCc2ccco2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(CN(C)[C@@H](CBr)CCCc2ccco2)o1 | CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 | CCc1nnc(CN(C)[C@@H](CBr)CCCc2ccco2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(CN(C)[C@H](CCl)CCCc2ccco2)o1 | CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 | CCc1nnc(CN(C)[C@H](CCl)CCCc2ccco2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]47C"
} |
Can you make molecule CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(CN(C)[C@H]2CCC[C@H](c3ccco3)C2)o1 | CCc1nnc(CN(C)[C@H](C)c2ccco2)o1 | CCc1nnc(CN(C)[C@H]2CCC[C@H](c3ccco3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]47C"
} |
Can you make molecule CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1I | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c12ccc(Cl)cc1"
} |
Can you make molecule CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1Br | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c12ccc(Cl)cc1"
} |
Can you make molecule CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@](C)(Cl)Cc1cc2sc(Cl)cc2s1 | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 | CC(=O)[C@@](C)(Cl)Cc1cc2sc(Cl)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sc(Cl)cc2s1",
"old_substring": "c12ccc(Cl)cc1"
} |
Can you make molecule CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)c(I)c1 | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c12ccc(Cl)cc1"
} |
Can you make molecule CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@](C)(Cl)Cc1cc(Cl)ccc1Cl | CC(=O)[C@@](C)(Cl)Cc1ccc(Cl)cc1 | CC(=O)[C@@](C)(Cl)Cc1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c12ccc(Cl)cc1"
} |
Can you make molecule COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN(C)C(=O)CC(C)(C)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)CC(C)(C)NCc2ccc(C)s2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN(C)C(=O)CCC(C)(C)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)CCC(C)(C)NCc2ccc(C)s2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN(C)C(=O)C[C@@H](Br)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)C(=O)C[C@@H](Br)NCc2ccc(C)s2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN(C)c2cc(C)n(NCc3ccc(C)s3)c(=O)c2)cc1O | COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)c2cc(C)n(NCc3ccc(C)s3)c(=O)c2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CN(C)c2c(C)n(NCc3ccc(C)s3)ccc2=O)cc1O | COc1ccc(CN(C)C(=O)NCc2ccc(C)s2)cc1O | COc1ccc(CN(C)c2c(C)n(NCc3ccc(C)s3)ccc2=O)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.