prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nonc1C(=O)CC1=CC[C@@H](c2nc(C)c3c(n2)N(C)C(=O)CC3)O1 | Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)CC1=CC[C@@H](c2nc(C)c3c(n2)N(C)C(=O)CC3)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CC[C@@H]&O1",
"old_substring": "N13CCC[C@@H]15"
} |
Can you make molecule Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nonc1C(=O)CC1=CN=N[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)CC1=CN=N[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@@H]&N=N1",
"old_substring": "N13CCC[C@@H]15"
} |
Can you make molecule Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nonc1C(=O)CCC1=CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)CCC1=CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "N13CCC[C@@H]15"
} |
Can you make molecule Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1nc(C)c2c(n1)N(C)C(=O)CC2)C(=O)c1nonc1C | Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | CCC[C@H](CC(=O)c1nc(C)c2c(n1)N(C)C(=O)CC2)C(=O)c1nonc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "N13CCC[C@@H]15"
} |
Can you make molecule Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nonc1C(=O)[C@@H](CCc1nc(C)c2c(n1)N(C)C(=O)CC2)C(C)C | Cc1nonc1C(=O)N1CCC[C@@H]1c1nc(C)c2c(n1)N(C)C(=O)CC2 | Cc1nonc1C(=O)[C@@H](CCc1nc(C)c2c(n1)N(C)C(=O)CC2)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "N13CCC[C@@H]15"
} |
Can you make molecule Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)c1Cl | Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nn(C)c(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn(C)c&c1Cl",
"old_substring": "Cc1nn(C)cc17"
} |
Can you make molecule Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)nc1C | Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nc(C)c(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc(C)c&nc1C",
"old_substring": "Cc1nn(C)cc17"
} |
Can you make molecule Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c(Cl)c1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nn(C)c(Cl)c1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn(C)c(Cl)c1&",
"old_substring": "Cc1nn(C)cc17"
} |
Can you make molecule Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)c(C)c1I | Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nn(CNC(=O)c2ccc(Cn3cc(Cl)c([N+](=O)[O-])n3)cc2)c(C)c1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(C)c1I",
"old_substring": "Cc1nn(C)cc17"
} |
Can you make molecule Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)c2sc(CNC(=O)c3ccc(Cn4cc(Cl)c([N+](=O)[O-])n4)cc3)cc12 | Cc1nn(C)cc1CNC(=O)c1ccc(Cn2cc(Cl)c([N+](=O)[O-])n2)cc1 | Cc1nn(C)c2sc(CNC(=O)c3ccc(Cn4cc(Cl)c([N+](=O)[O-])n4)cc3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn(C)c2sc&cc12",
"old_substring": "Cc1nn(C)cc17"
} |
Can you make molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1COSC(=O)Cc1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COSC(=O)Cc1ccc(C)c(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1COC(=O)CCCC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)CCCC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1COC(=O)CC(C)(C)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)CC(C)(C)c1ccc(C)c(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1COC(=O)CCC(C)(C)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)CCC(C)(C)c1ccc(C)c(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cl)cc1COSC(=O)[C@@H](C)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COC(=O)c1ccc(C)c(NC(=O)c2ccco2)c1 | COc1ccc(Cl)cc1COSC(=O)[C@@H](C)c1ccc(C)c(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C39=O"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2c(Cl)cccc2Cl)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2c(Cl)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c16cccc(Cl)c1"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2I)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2I)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c16cccc(Cl)c1"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2Br)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)cc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c16cccc(Cl)c1"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)c(I)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)c(I)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c16cccc(Cl)c1"
} |
Can you make molecule Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)c(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2cccc(Cl)c2)C1 | Cc1noc(C)c1[C@@H](C)NC(=O)N[C@@H]1CCN(c2ccc(Cl)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c16cccc(Cl)c1"
} |
Can you make molecule Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Nc2ccc(-c3ccccc3)o2)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 | Cc1cc(CNC(=O)Nc2ccc(-c3ccccc3)o2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c17cc9on1"
} |
Can you make molecule Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)oc2C)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)oc2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c17cc9on1"
} |
Can you make molecule Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Nc2ccc3oc(-c4ccccc4)nc3c2)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 | Cc1cc(CNC(=O)Nc2ccc3oc(-c4ccccc4)nc3c2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2oc&nc2c1",
"old_substring": "c17cc9on1"
} |
Can you make molecule Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Nc2cc3occc3c(-c3ccccc3)n2)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 | Cc1cc(CNC(=O)Nc2cc3occc3c(-c3ccccc3)n2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2c&n1",
"old_substring": "c17cc9on1"
} |
Can you make molecule Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(CNC(=O)Nc2ccc(-c3ccccc3)nc2C)no1 | Cc1cc(CNC(=O)Nc2cc(-c3ccccc3)on2)no1 | Cc1cc(CNC(=O)Nc2ccc(-c3ccccc3)nc2C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c17cc9on1"
} |
Can you make molecule C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C | C[C@H](CC(C)(C)c1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)[C@@H](C)S(=O)(=O)c1nccn1C)CC(=O)c1ccccc1 | C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C | C[C@@H](CCNC(=O)[C@@H](C)S(=O)(=O)c1nccn1C)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)NCC[C@H](Cl)c1ccccc1)S(=O)(=O)c1nccn1C | C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C | C[C@H](C(=O)NCC[C@H](Cl)c1ccccc1)S(=O)(=O)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C | CCC[C@H](CC(=O)c1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]34"
} |
Can you make molecule C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | C[C@H](C(=O)N[C@H](C)c1ccccc1)S(=O)(=O)c1nccn1C | CC(C)[C@H](CCc1ccccc1)NC(=O)[C@@H](C)S(=O)(=O)c1nccn1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]34"
} |
Can you make molecule COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | COCSCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | CC(=O)SCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)CCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | O=C(CI)CCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=c1c2c(nc(SCc3cccc(F)c3)n1CCC1OCCCO1)CCS2 | COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | O=c1c2c(nc(SCc3cccc(F)c3)n1CCC1OCCCO1)CCS2 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCl)CCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | COCCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | O=C(CCl)CCn1c(SCc2cccc(F)c2)nc2c(c1=O)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](C#N)(NSC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NSC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](C#N)(NC(=O)CCCC(=O)N1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NC(=O)CCCC(=O)N1CCN(c2cccc(Cl)c2)CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N[C@](C)(C#N)C1CC1)N1CCN(c2cccc(Cl)c2)CC1 | C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | CC(C)(CC(=O)N[C@](C)(C#N)C1CC1)N1CCN(c2cccc(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@](C#N)(NC[S@+]([O-])CCCN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | C[C@](C#N)(NC[S@+]([O-])CCCN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N[C@](C)(C#N)C1CC1)N1CCN(c2cccc(Cl)c2)CC1 | C[C@](C#N)(NC(=O)CN1CCN(c2cccc(Cl)c2)CC1)C1CC1 | CC(C)(CCC(=O)N[C@](C)(C#N)C1CC1)N1CCN(c2cccc(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)NCCCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NCCCCNc2ncccn2)cc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)N=CCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)N=CCCNc2ncccn2)cc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C5"
} |
Can you make molecule Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)NCCCCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NCCCCCNc2ncccn2)cc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)NC2CC(Nc3ncccn3)C2)cc(Cl)c1Cl | Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl | Cn1c(C(=O)NC2CC(Nc3ncccn3)C2)cc(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(CCNc1ncccn1)=NC(=O)c1cc(Cl)c(Cl)n1C | Cn1c(C(=O)NCCNc2ncccn2)cc(Cl)c1Cl | CC(CCNc1ncccn1)=NC(=O)c1cc(Cl)c(Cl)n1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C5"
} |
Can you make molecule COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | COCSCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | CC(=O)SCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC(=O)CI | COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC1OCCCO1 | COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC1OCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO5"
} |
Can you make molecule COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC(=O)CCl | COCCCn1c(C)cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc12 | Cc1cn2c3c(=O)n(Cc4ccccc4F)c(=O)n(C)c3nc2n1CCCC(=O)CCl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO5"
} |
Can you make molecule CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCO[C@@H](C)C(=O)n1cc(C#N)c(C2CCS(=O)(=O)CC2)n1 | CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 | CCCCO[C@@H](C)C(=O)n1cc(C#N)c(C2CCS(=O)(=O)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn&nc1&",
"old_substring": "N25C"
} |
Can you make molecule CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCO[C@@H](C)C(=O)c1nc(C#N)c(C2CCS(=O)(=O)CC2)o1 | CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 | CCCCO[C@@H](C)C(=O)c1nc(C#N)c(C2CCS(=O)(=O)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N25C"
} |
Can you make molecule CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCO[C@@H](C)C(=O)c1cc(C#N)c(C2CCS(=O)(=O)CC2)s1 | CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 | CCCCO[C@@H](C)C(=O)c1cc(C#N)c(C2CCS(=O)(=O)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N25C"
} |
Can you make molecule CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCO[C@@H](C)C(=O)c1ccc(C2CCS(=O)(=O)CC2)c(C#N)c1 | CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 | CCCCO[C@@H](C)C(=O)c1ccc(C2CCS(=O)(=O)CC2)c(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N25C"
} |
Can you make molecule CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCO[C@@H](C)C(=O)ON=C1CCN(C2CCS(=O)(=O)CC2)CC1 | CCCCO[C@@H](C)C(=O)N(C)C1CCS(=O)(=O)CC1 | CCCCO[C@@H](C)C(=O)ON=C1CCN(C2CCS(=O)(=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N25C"
} |
Can you make molecule CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1cccnc1)[NH2+][C@@H](C)CS(C)(=O)=O | CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 | CCCC[C@@H](CCc1cccnc1)[NH2+][C@@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "CC(C)[C@@H]24"
} |
Can you make molecule CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@](C)(C[NH2+][C@@H](C)CS(C)(=O)=O)Cc1cccnc1 | CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 | CCC[C@](C)(C[NH2+][C@@H](C)CS(C)(=O)=O)Cc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@](C)(C&)C&",
"old_substring": "CC(C)[C@@H]24"
} |
Can you make molecule CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)[NH2+][C@@H](CCc1cccnc1)C(C)(C)C | CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 | C[C@@H](CS(C)(=O)=O)[NH2+][C@@H](CCc1cccnc1)C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC&)C(C)(C)C",
"old_substring": "CC(C)[C@@H]24"
} |
Can you make molecule CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC(C)(C)Cc1cccnc1)[NH2+][C@@H](C)CS(C)(=O)=O | CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 | C[C@@H](CC(C)(C)Cc1cccnc1)[NH2+][C@@H](C)CS(C)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CC(C)(C)C&",
"old_substring": "CC(C)[C@@H]24"
} |
Can you make molecule CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CS(C)(=O)=O)[NH2+]C1CCC(C)(c2cccnc2)CC1 | CC(C)[C@@H]([NH2+][C@@H](C)CS(C)(=O)=O)c1cccnc1 | C[C@@H](CS(C)(=O)=O)[NH2+]C1CCC(C)(c2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "CC(C)[C@@H]24"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NSC(=O)C[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NSC(=O)C[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCC(=C=O)C[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NCC(=C=O)C[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCCC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)CCCC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CC(C)(C)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)CC(C)(C)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC[S@+]([O-])CCC[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC(=O)[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | Cc1ccc(NC[S@+]([O-])CCC[C@@H]2CCN(S(C)(=O)=O)c3ccccc3O2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C47=O"
} |
Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NSC(=O)Cc4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NSC(=O)Cc4ccccc4Cl)cc3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NC(=O)CCCC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)CCCC(=O)c4ccccc4Cl)cc3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NC(=O)CC(C)(C)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)CC(C)(C)c4ccccc4Cl)cc3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NC(=O)CCC(C)(C)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)CCC(C)(C)c4ccccc4Cl)cc3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-n2nc3ccc(NSC(=O)[C@@H](C)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NC(=O)c4ccccc4Cl)cc3n2)cc1Cl | COc1ccc(-n2nc3ccc(NSC(=O)[C@@H](C)c4ccccc4Cl)cc3n2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)SC[C@H](c2nc(C(F)F)nc3ccccc23)NC1=O | CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] | CC1(C)SC[C@H](c2nc(C(F)F)nc3ccccc23)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)SC[C@H]&NC1=O",
"old_substring": "CC1(C)CN4CC[S@@]1=O"
} |
Can you make molecule CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCSC[C@@]1(O)c1nc(C(F)F)nc2ccccc12 | CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] | CC1(C)CCSC[C@@]1(O)c1nc(C(F)F)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCSC[C@]1&O",
"old_substring": "CC1(C)CN4CC[S@@]1=O"
} |
Can you make molecule CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCSC[C@@H]1c1nc(C(F)F)nc2ccccc12 | CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] | CC1(C)CCSC[C@@H]1c1nc(C(F)F)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCSC[C@@H]1&",
"old_substring": "CC1(C)CN4CC[S@@]1=O"
} |
Can you make molecule CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@]1(C#N)c1nc(C(F)F)nc2ccccc12 | CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] | CC1(C)CCC[C@]1(C#N)c1nc(C(F)F)nc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC[C@@]1&C#N",
"old_substring": "CC1(C)CN4CC[S@@]1=O"
} |
Can you make molecule CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)OC[C@@H](c2nc(C(F)F)nc3ccccc23)O1 | CC1(C)CN(c2nc(C(F)F)nc3ccccc23)CC[S@+]1[O-] | CC1(C)OC[C@@H](c2nc(C(F)F)nc3ccccc23)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)OC[C@@H]&O1",
"old_substring": "CC1(C)CN4CC[S@@]1=O"
} |
Can you make molecule CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CC[C@@H](NSC(=O)C[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NSC(=O)C[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CC[C@@H](NCC(=C=O)C[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NCC(=C=O)C[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CC[C@@H](NC(=O)CCCC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)CCCC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CC[C@@H](NC(=O)CC(C)(C)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)CC(C)(C)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H]1CC[C@@H](NC[S@+]([O-])CCC[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC(=O)[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | CS[C@H]1CC[C@@H](NC[S@+]([O-])CCC[C@@H]2CSCN2C(=O)CC(C)(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C36=O"
} |
Can you make molecule O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1C[NH+]2CCC[C@@](Cc3cccc(Br)c3)(C1)C2.Oc1ccccc1 | O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 | O[C@@H]1C[NH+]2CCC[C@@](Cc3cccc(Br)c3)(C1)C2.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]45"
} |
Can you make molecule O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@@H]1Cc2[nH+]cn(c2Cc2cccc(Br)c2)C1.Oc1ccccc1 | O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 | O[C@@H]1Cc2[nH+]cn(c2Cc2cccc(Br)c2)C1.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1Cc2cc(Cc3cccc(Br)c3)n([nH+]2)C1.Oc1ccccc1 | O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 | O[C@H]1Cc2cc(Cc3cccc(Br)c3)n([nH+]2)C1.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]c2c(Cc3cccc(Br)c3)c1C[C@H](O)C2.Oc1ccccc1 | O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 | Cn1[nH+]c2c(Cc3cccc(Br)c3)c1C[C@H](O)C2.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]45"
} |
Can you make molecule O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1Cc2nc(Cc3cccc(Br)c3)c(Br)c([nH+]2)C1.Oc1ccccc1 | O[C@@H](C[NH2+]Cc1cccc(Br)c1)COc1ccccc1 | O[C@H]1Cc2nc(Cc3cccc(Br)c3)c(Br)c([nH+]2)C1.Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]c&nc&c1Br",
"old_substring": "[NH2+]45"
} |
Can you make molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CCCCNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CCCCNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CCC=NC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CCC=NC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C45"
} |
Can you make molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CCCCCNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CCCCCNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C1CC(NC(=O)CS(=O)(=O)c2cccc[n+]2[O-])C1 | COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1C1CC(NC(=O)CS(=O)(=O)c2cccc[n+]2[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1SC(=S)ONC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1CNC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | COc1ccccc1SC(=S)ONC(=O)CS(=O)(=O)c1cccc[n+]1[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | COCc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | COCSc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | CC(=O)Sc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)Nc2cc(C(=O)CS)ccc2F)c(=O)oc2ccccc12 | COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | Cc1c(C(=O)Nc2cc(C(=O)CS)ccc2F)c(=O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)Nc2cc(C(=O)CI)ccc2F)c(=O)oc2ccccc12 | COc1ccc(F)c(NC(=O)c2c(C)c3ccccc3oc2=O)c1 | Cc1c(C(=O)Nc2cc(C(=O)CI)ccc2F)c(=O)oc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC2=NCCN2C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(SC2=NCCN2C[C@@H]2N=NC3=C2CCCC3)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC[C@@H](N)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(CC[C@@H](N)C[C@@H]2N=NC3=C2CCCC3)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2oc(C[C@@H]3N=NC4=C3CCCC4)nc2C#N)nn1 | Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(-c2oc(C[C@@H]3N=NC4=C3CCCC4)nc2C#N)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S/C(N)=N/CC[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(S/C(N)=N/CC[C@@H]2N=NC3=C2CCCC3)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2sc(C[C@@H]3N=NC4=C3CCCC4)cc2C#N)nn1 | Cc1ccc(N(C)C[C@@H]2N=NC3=C2CCCC3)nn1 | Cc1ccc(-c2sc(C[C@@H]3N=NC4=C3CCCC4)cc2C#N)nn1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.