prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2c(Cl)cccc2Cl)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2c(Cl)cccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cc(C)c(Cl)c(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cc(C)c(Cl)c(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cc3cc(Cl)ccc3o2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cc3cc(Cl)ccc3o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(/C=C/Br)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(/C=C/Br)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2ccc3sc(Cl)nc3c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2cccc(C)c2)c1 | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2ccc3sc(Cl)nc3c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc(Cl)nc2c1",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | COCc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1C1OCc2ccccc2CO1 | COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1C1OCc2ccccc2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1C1(O)Cc2ccccc2C1 | COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1COC(c2ccsc2S(=O)(=O)[N-]c2ncccc2-c2ccccc2)=CC2=NN2C1 | COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | C[C@H]1COC(c2ccsc2S(=O)(=O)[N-]c2ncccc2-c2ccccc2)=CC2=NN2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1N1CCOc2ccccc21 | COc1ccsc1S(=O)(=O)[N-]c1ncccc1-c1ccccc1 | O=S(=O)([N-]c1ncccc1-c1ccccc1)c1sccc1N1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(SC(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(SC(F)(F)F)nnc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CCCC(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CCCC(F)(F)F)nnc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CCCCC(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CCCCC(F)(F)F)nnc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)C(F)(F)F)nnc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CC(F)(F)C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(C(F)(F)F)nnc2c1C | Cc1c(Oc2ccc3cn[nH]c3c2)nn2c(CC(F)(F)C(F)(F)F)nnc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCC1.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 | CCOC(=O)N1CCC1.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N5%10"
} |
Can you make molecule CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nscc1N.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 | CCOC(=O)c1nscc1N.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N5%10"
} |
Can you make molecule CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccn1N.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 | CCOC(=O)c1cccn1N.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N5%10"
} |
Can you make molecule CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1ccc(N)o1.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 | CCOC(=O)c1ccc(N)o1.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N5%10"
} |
Can you make molecule CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)N1CCN=C1S.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | CCOC(=O)N[C@@H]1CCCN(C(=O)NC[C@H]2CC[NH+](C3CC3)C2)C1 | CCOC(=O)N1CCN=C1S.O=C(NC[C@H]1CC[NH+](C2CC2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N5%10"
} |
Can you make molecule Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(Cl)s1)OC(=O)CCn1cc([N+](=O)[O-])nc1C | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 | CC[C@@H](CCc1ccc(Cl)s1)OC(=O)CCn1cc([N+](=O)[O-])nc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@@H](CBr)CCc1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@@H](CBr)CCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@@H](CBr)CCCc1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@@H](CBr)CCCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](CCl)CCCc1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](CCl)CCCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H]1CCC[C@H](c2ccc(Cl)s2)C1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H](C)c1ccc(Cl)s1 | Cc1nc([N+](=O)[O-])cn1CCC(=O)O[C@H]1CCC[C@H](c2ccc(Cl)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]35C"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+](CCCCBr)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCCCBr)[C@@H]1CCC[C@H]([NH2+]C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "C3CC"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | C=CCCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C3CC"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+](CCCCCl)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCCCCl)[C@@H]1CCC[C@H]([NH2+]C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "C3CC"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | C=CCCCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C3CC"
} |
Can you make molecule CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[NH+](CCC(C)C)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC)[C@@H]1CCC[C@H]([NH2+]C)C1 | CCC[NH+](CCC(C)C)[C@@H]1CCC[C@H]([NH2+]C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "C3CC"
} |
Can you make molecule COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | COCc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | COCSc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | CC(=O)Sc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1nc2c(s1)[C@@H](c1cc(C(=O)CS)ccc1Br)CC2 | COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | Nc1nc2c(s1)[C@@H](c1cc(C(=O)CS)ccc1Br)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1nc2c(s1)[C@@H](c1cc(C(=O)CI)ccc1Br)CC2 | COc1ccc(Br)c([C@H]2CCc3nc(N)sc32)c1 | Nc1nc2c(s1)[C@@H](c1cc(C(=O)CI)ccc1Br)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)OCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 | CC[C@@H](C)C[C@H](CC)OCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "C[C@@H]1CCC[C@@H]6C1"
} |
Can you make molecule C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](Br)COCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 | CC(C)CC[C@H](Br)COCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "C[C@@H]1CCC[C@@H]6C1"
} |
Can you make molecule C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](NC(=O)COC2CCCCCCC2)CC[NH+]1Cc1ccccc1 | C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 | C[C@@H]1C[C@H](NC(=O)COC2CCCCCCC2)CC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C[C@@H]1CCC[C@@H]6C1"
} |
Can you make molecule C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C(C)C[C@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)S1 | C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 | CCC1=C(C)C[C@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC1=C(C)C[C@H]&S1",
"old_substring": "C[C@@H]1CCC[C@@H]6C1"
} |
Can you make molecule C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](Cl)CCCOCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | C[C@@H]1CCC[C@@H](OCC(=O)N[C@@H]2CC[NH+](Cc3ccccc3)[C@H](C)C2)C1 | CCC[C@@H](Cl)CCCOCC(=O)N[C@@H]1CC[NH+](Cc2ccccc2)[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H](Cl)CCC&",
"old_substring": "C[C@@H]1CCC[C@@H]6C1"
} |
Can you make molecule CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)C1CC[NH+](C2CCC(C3(C)CCCC3)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C3(C)CCCC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)C1CC[NH+](C2CCC(C(Cl)(Cl)Cl)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(Cl)(Cl)Cl)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C7(C)C"
} |
Can you make molecule CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)C1CC[NH+](C2CCC(=C(C)C(CC)CC)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(=C(C)C(CC)CC)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C(CC)CC",
"old_substring": "C7(C)C"
} |
Can you make molecule CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCNC(=O)C1CC[NH+](C2CCC(=C(C)C3CCCCC3)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(=C(C)C3CCCCC3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C1CCCCC1",
"old_substring": "C7(C)C"
} |
Can you make molecule CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)C1CCC([NH+]2CCC(C(=O)NCC)CC2)CC1 | CCNC(=O)C1CC[NH+](C2CCC(C(C)C)CC2)CC1 | CCCC(C)(C)C1CCC([NH+]2CCC(C(=O)NCC)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C7(C)C"
} |
Can you make molecule C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=Cc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | C[NH+]1CCC(=Cc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC=&CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NOCc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | C[NH+]1CCC(=NOCc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | C[N+](C)(C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc(CC[NH+]2CCCSCC2)cc1)N[C@@H]1CCC[C@H](C(F)(F)F)C1 | C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | O=C(NCc1ccc(CC[NH+]2CCCSCC2)cc1)N[C@@H]1CCC[C@H](C(F)(F)F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC(Cc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | C[NH+](C)Cc1ccc(CNC(=O)N[C@@H]2CCC[C@H](C(F)(F)F)C2)cc1 | C[N+]1(C)CCC(Cc2ccc(CNC(=O)N[C@@H]3CCC[C@H](C(F)(F)F)C3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C2(C)CCCC2)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C2(C)CCCC2)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C(Cl)(Cl)Cl)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(Cl)(Cl)Cl)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1cc(C(=O)NC[C@H](C)Oc2ccc(C)cc2)n(CC)n1 | CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCCC(C)(C)c1cc(C(=O)NC[C@H](C)Oc2ccc(C)cc2)n(CC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C(C)(CC)CC)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(C)(CC)CC)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C8(C)C"
} |
Can you make molecule CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1nc(C2(C=O)CCCCCC2)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C(C)C)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | CCn1nc(C2(C=O)CCCCCC2)cc1C(=O)NC[C@H](C)Oc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C8(C)C"
} |
Can you make molecule FC(F)(Cl)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(Cl)c1ccccc1 | FC(F)(Cl)Oc1ccccc1 | FC(F)(Cl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "FC&(F)Cl",
"old_substring": "FC(F)(Cl)O2"
} |
Can you make molecule FC(F)(Cl)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)C(F)(F)Cc1ccccc1 | FC(F)(Cl)Oc1ccccc1 | FC(F)C(F)(F)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)F",
"old_substring": "FC(F)(Cl)O2"
} |
Can you make molecule FC(F)(Cl)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)(F)C(F)(F)Cc1ccccc1 | FC(F)(Cl)Oc1ccccc1 | FC(F)(F)C(F)(F)Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "FC(F)(Cl)O2"
} |
Can you make molecule FC(F)(Cl)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1c(Cl)cc(F)cc1-c1ccccc1 | FC(F)(Cl)Oc1ccccc1 | Oc1c(Cl)cc(F)cc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)cc(Cl)c1O",
"old_substring": "FC(F)(Cl)O2"
} |
Can you make molecule FC(F)(Cl)Oc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N)cc(Cl)c1-c1ccccc1 | FC(F)(Cl)Oc1ccccc1 | Cc1cc(N)cc(Cl)c1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(N)cc(Cl)c1&",
"old_substring": "FC(F)(Cl)O2"
} |
Can you make molecule Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C)N(C)ONC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@H](C)N(C)ONC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "[C@@H]7(O)C5"
} |
Can you make molecule Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](CCl)CCCNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@H](CCl)CCCNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]7(O)C5"
} |
Can you make molecule Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2CCN(CNC(=O)C(=O)Nc3ccc(C)c(F)c3)C2)o1 | Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@@H]2CCN(CNC(=O)C(=O)Nc3ccc(C)c(F)c3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN(C&)C1",
"old_substring": "[C@@H]7(O)C5"
} |
Can you make molecule Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@]2(F)CCN(NC(=O)C(=O)Nc3ccc(C)c(F)c3)C2)o1 | Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@]2(F)CCN(NC(=O)C(=O)Nc3ccc(C)c(F)c3)C2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@]1&(F)CCN&C1",
"old_substring": "[C@@H]7(O)C5"
} |
Can you make molecule Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H]2C=C(CNC(=O)C(=O)Nc3ccc(C)c(F)c3)N=N2)o1 | Cc1ccc([C@H](O)CNC(=O)C(=O)Nc2ccc(C)c(F)c2)o1 | Cc1ccc([C@@H]2C=C(CNC(=O)C(=O)Nc3ccc(C)c(F)c3)N=N2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]7(O)C5"
} |
Can you make molecule C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)[C@@H](C)NC(=O)CCCC(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)CCCC(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)[C@@H](C)NC(=O)CCC(=O)CNc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)CCC(=O)CNc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)[C@@H](C)NC[S@+]([O-])CCC(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC[S@+]([O-])CCC(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)[C@@H](C)NC(=O)CCCS(=O)(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)CCCS(=O)(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CO)[C@@H](C)NC(=O)C(C)(F)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(=O)Nc1cnc(-c2ccccc2)s1 | C[C@@H](CO)[C@@H](C)NC(=O)C(C)(F)C(=O)Nc1cnc(-c2ccccc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C)c1C | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14cccc(C#N)c1"
} |
Can you make molecule Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cc(C#N)ccc1I | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cc(C#N)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C#N)ccc1I",
"old_substring": "c14cccc(C#N)c1"
} |
Can you make molecule Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1ccc(C#N)cc1Cl | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1ccc(C#N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)cc1Cl",
"old_substring": "c14cccc(C#N)c1"
} |
Can you make molecule Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#CCCCCO)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#CCCCCO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C#CCCCCO)c1",
"old_substring": "c14cccc(C#N)c1"
} |
Can you make molecule Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(Cl)c1C=O | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(C#N)c1 | Cc1cnc2c(c1)nc([C@H](C)Cl)n2-c1cccc(Cl)c1C=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Cl)c1C=O",
"old_substring": "c14cccc(C#N)c1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCC2CCC(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCC(c3cc[nH+]cc3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C19CCN8CC1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCC2CC(c3cc[nH+]cc3)C2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CC(c3cc[nH+]cc3)C2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C19CCN8CC1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCC2CCC(C)(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCC(C)(c3cc[nH+]cc3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "C19CCN8CC1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCC2(C#N)CCC(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2(C#N)CCC(c3cc[nH+]cc3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "C19CCN8CC1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCC2(C)CCN(Cc3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2CCN(c3cc[nH+]cc3)CC2)cn1 | Cc1ccc(NC(=O)C(=O)NCC2(C)CCN(Cc3cc[nH+]cc3)CC2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCN(C&)CC1",
"old_substring": "C19CCN8CC1"
} |
Can you make molecule COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1cn2cnnc2s1 | COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1cn2cnnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2scc&n12",
"old_substring": "c1%10nnc2sc8nn12"
} |
Can you make molecule COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.O=c1cnnc2scnn12 | COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.O=c1cnnc2scnn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2sc&nn2c1=O",
"old_substring": "c1%10nnc2sc8nn12"
} |
Can you make molecule COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1ccn2cnnc2c1 | COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1ccn2cnnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2ccc&cn12",
"old_substring": "c1%10nnc2sc8nn12"
} |
Can you make molecule COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1nc2sccn2n1 | COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.c1nc2sccn2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2nc&nn12",
"old_substring": "c1%10nnc2sc8nn12"
} |
Can you make molecule COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.Cn1ncc2cncnc21 | COc1cc(-c2nnc3sc(Cc4ccc(Cl)cc4)nn23)cc(OC)c1OC | COc1cccc(OC)c1OC.Cc1ccc(Cl)cc1.Cn1ncc2cncnc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&nc2c1cnn2C",
"old_substring": "c1%10nnc2sc8nn12"
} |
Can you make molecule COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CCNc2ccn(-n3ccnc3C)c2)c1 | COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 | COC(=O)c1cccc(CCNc2ccn(-n3ccnc3C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccn&c1",
"old_substring": "c16cncc9n1"
} |
Can you make molecule COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CCNc2sc3nc(-n4ccnc4C)cn3c2C)c1 | COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 | COC(=O)c1cccc(CCNc2sc3nc(-n4ccnc4C)cn3c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2nc&cn2c1C",
"old_substring": "c16cncc9n1"
} |
Can you make molecule COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CCNc2cncc3ccc(-n4ccnc4C)nc23)c1 | COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 | COC(=O)c1cccc(CCNc2cncc3ccc(-n4ccnc4C)nc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cncc2ccc&nc12",
"old_substring": "c16cncc9n1"
} |
Can you make molecule COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CCNc2nc(-n3ccnc3C)ncc2I)c1 | COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 | COC(=O)c1cccc(CCNc2nc(-n3ccnc3C)ncc2I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c16cncc9n1"
} |
Can you make molecule COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(CCNc2cnc3scc(-n4ccnc4C)n3c2=O)c1 | COC(=O)c1cccc(CCNc2cncc(-n3ccnc3C)n2)c1 | COC(=O)c1cccc(CCNc2cnc3scc(-n4ccnc4C)n3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc2scc&n2c1=O",
"old_substring": "c16cncc9n1"
} |
Can you make molecule Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(F)(F)F)nc1SCC(=O)N1CCN(Cc2c(F)cccc2Cl)CC1 | Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F | Cn1cc(C(F)(F)F)nc1SCC(=O)N1CCN(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1cc&nc1&",
"old_substring": "Cn1c7nnc19"
} |
Can you make molecule Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(F)(F)F)nc(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)cc1=O | Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F | Cn1c(C(F)(F)F)nc(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&nc&cc1=O",
"old_substring": "Cn1c7nnc19"
} |
Can you make molecule Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(F)(F)F)cn2cc(SCC(=O)N3CCN(Cc4c(F)cccc4Cl)CC3)nc12 | Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F | Cn1c(C(F)(F)F)cn2cc(SCC(=O)N3CCN(Cc4c(F)cccc4Cl)CC3)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&cn2cc&nc12",
"old_substring": "Cn1c7nnc19"
} |
Can you make molecule Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSn1ncn(C(F)(F)F)c1=S)N1CCN(Cc2c(F)cccc2Cl)CC1 | Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F | O=C(CSn1ncn(C(F)(F)F)c1=S)N1CCN(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnn&c1=S",
"old_substring": "Cn1c7nnc19"
} |
Can you make molecule Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1cn(C(F)(F)F)cn1)N1CCN(Cc2c(F)cccc2Cl)CC1 | Cn1c(SCC(=O)N2CCN(Cc3c(F)cccc3Cl)CC2)nnc1C(F)(F)F | O=C(CSc1cn(C(F)(F)F)cn1)N1CCN(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc&c1",
"old_substring": "Cn1c7nnc19"
} |
Can you make molecule CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1csc3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1csc3ccccc13)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c19c[nH]c2ccccc12"
} |
Can you make molecule CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1[nH]c3ccccc3c1Br)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1[nH]c3ccccc3c1Br)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]c2ccccc2c1Br",
"old_substring": "c19c[nH]c2ccccc12"
} |
Can you make molecule CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1[nH]c3ccccc3c1Cl)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1[nH]c3ccccc3c1Cl)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]c2ccccc2c1Cl",
"old_substring": "c19c[nH]c2ccccc12"
} |
Can you make molecule CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1cnc3ccccc3c1Br)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1cnc3ccccc3c1Br)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc2ccccc2c1Br",
"old_substring": "c19c[nH]c2ccccc12"
} |
Can you make molecule CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1coc3cc(C)ccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1c[nH]c3ccccc13)CC2 | CCOC(=O)c1nn(CC(C)C)c2c1CN(Cc1coc3cc(C)ccc13)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc2cc(C)ccc12",
"old_substring": "c19c[nH]c2ccccc12"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.