prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CCC(CO)=Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CCCC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)SNc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CCCCC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC4=O"
} |
Can you make molecule CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CC(=O)Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | CCC(C=O)=Nc1cccc(OC(=O)Cc2ccc(F)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC4=O"
} |
Can you make molecule Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(OC[C@@H](O)C(C)(C)N2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)C(C)(C)N2CC[NH+](C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](O)C&(C)C",
"old_substring": "C3[C@@H](O)C5"
} |
Can you make molecule Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(OC[C@@H](C)C(=O)N2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](C)C(=O)N2CC[NH+](C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C)C&=O",
"old_substring": "C3[C@@H](O)C5"
} |
Can you make molecule Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(OC[C@H](S)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@H](S)CN2CC[NH+](C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C3[C@@H](O)C5"
} |
Can you make molecule Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(OCC[C@H](C)CC(=O)N2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OCC[C@H](C)CC(=O)N2CC[NH+](C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C3[C@@H](O)C5"
} |
Can you make molecule Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(OC(=O)C[C@H](C)C(=O)N2CC[NH+](C)CC2)c1C | Cc1cccc(OC[C@@H](O)CN2CC[NH+](C)CC2)c1C | Cc1cccc(OC(=O)C[C@H](C)C(=O)N2CC[NH+](C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&=O)C&=O",
"old_substring": "C3[C@@H](O)C5"
} |
Can you make molecule CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CC(C)CC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C(=O)N[C@H]1C[C@H]1CCCCBr)c1ccccc1 | CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CC(C)(C(=O)N[C@H]1C[C@H]1CCCCBr)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | C=CCCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C(=O)N[C@H]1C[C@H]1CCCCCl)c1ccccc1 | CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CC(C)(C(=O)N[C@H]1C[C@H]1CCCCCl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC4"
} |
Can you make molecule CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | CCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | C=CCCCC[C@@H]1C[C@@H]1NC(=O)C(C)(C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC4"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3I)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3I)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc%10cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3Br)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3Br)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc%10cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3Cl)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C(=O)c3ccccc3Cl)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc%10cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C(=O)c3cc4ccccc4o3)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C(=O)c3cc4ccccc4o3)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2o1",
"old_substring": "c18ccc%10cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C(=O)c3cc4ccccc4s3)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | Cc1ccc(C)c(N2CCN(C(=O)c3ccc(Cn4c(=O)[nH]c5ccccc5c4=O)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C(=O)c3cc4ccccc4s3)CC2)c1.Cn1c(=O)[nH]c2ccccc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2s1",
"old_substring": "c18ccc%10cc1"
} |
Can you make molecule Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1cc2c(cc1N)OCCCO2)N1CCCCC1 | Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 | CC(C)(CC(=O)Nc1cc2c(cc1N)OCCCO2)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Nc1cc2c(cc1N)OCCCO2)N1CCCCC1 | Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 | CC(C)(CCC(=O)Nc1cc2c(cc1N)OCCCO2)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc2c(cc1NC(=O)C[C@@H](Br)N1CCCCC1)OCCCO2 | Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 | Nc1cc2c(cc1NC(=O)C[C@@H](Br)N1CCCCC1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Nc2cc3c(cc2N)OCCCO3)cc(=O)n1N1CCCCC1 | Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 | Cc1cc(Nc2cc3c(cc2N)OCCCO3)cc(=O)n1N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Nc2cc3c(cc2N)OCCCO3)c(=O)ccn1N1CCCCC1 | Nc1cc2c(cc1NC(=O)N1CCCCC1)OCCCO2 | Cc1c(Nc2cc3c(cc2N)OCCCO3)c(=O)ccn1N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(Cc2sc(C(=O)c3cc(OC)ccc3O)cc2C#N)cc1 | CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 | CNC(=O)c1ccc(Cc2sc(C(=O)c3cc(OC)ccc3O)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N46C"
} |
Can you make molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(Cc2ccc(C(=O)c3cc(OC)ccc3O)cc2C#N)cc1 | CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 | CNC(=O)c1ccc(Cc2ccc(C(=O)c3cc(OC)ccc3O)cc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N46C"
} |
Can you make molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(CN2CCC(=NOC(=O)c3cc(OC)ccc3O)CC2)cc1 | CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 | CNC(=O)c1ccc(CN2CCC(=NOC(=O)c3cc(OC)ccc3O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N46C"
} |
Can you make molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(Cc2cc(C(=O)c3cc(OC)ccc3O)cnc2C#N)cc1 | CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 | CNC(=O)c1ccc(Cc2cc(C(=O)c3cc(OC)ccc3O)cnc2C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N46C"
} |
Can you make molecule CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)c1ccc(CCC2=CCCN(C(=O)c3cc(OC)ccc3O)C2)cc1 | CNC(=O)c1ccc(CN(C)C(=O)c2cc(OC)ccc2O)cc1 | CNC(=O)c1ccc(CCC2=CCCN(C(=O)c3cc(OC)ccc3O)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N46C"
} |
Can you make molecule O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)co2)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)co2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c15nc7no1"
} |
Can you make molecule O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(-c2ccc(Cl)cc2)ncnc1N1CCN(C(=O)CC2CCCCC2)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 | Cc1c(-c2ccc(Cl)cc2)ncnc1N1CCN(C(=O)CC2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c15nc7no1"
} |
Can you make molecule O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(-c2ccc(Cl)cc2)nc1N1CCN(C(=O)CC2CCCCC2)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 | Cc1cnc(-c2ccc(Cl)cc2)nc1N1CCN(C(=O)CC2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c15nc7no1"
} |
Can you make molecule O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1CCCCC1)N1CCN(c2ncnc(-c3ccc(Cl)cc3)c2F)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 | O=C(CC1CCCCC1)N1CCN(c2ncnc(-c3ccc(Cl)cc3)c2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c15nc7no1"
} |
Can you make molecule O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)ncc2I)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)no2)CC1 | O=C(CC1CCCCC1)N1CCN(c2nc(-c3ccc(Cl)cc3)ncc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c15nc7no1"
} |
Can you make molecule COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | COCc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | COCSc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | CC(=O)Sc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SCC(=O)Nc2cccc(C(=O)CS)c2)n1 | COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | Nc1cc(N)nc(SCC(=O)Nc2cccc(C(=O)CS)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(N)nc(SCC(=O)Nc2cccc(C(=O)CI)c2)n1 | COc1cccc(NC(=O)CSc2nc(N)cc(N)n2)c1 | Nc1cc(N)nc(SCC(=O)Nc2cccc(C(=O)CI)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)SN[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(CC(=O)SN[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CCCC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)CCCC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)(C)CC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(C)(C)CC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(C)(C)CCC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(C)(C)CCC(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H](C)C(=O)SN[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc(C(=O)N[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | COc1cc([C@H](C)C(=O)SN[C@H](c2ccccc2)c2cccnc2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)c1nn(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 | CC[C@H](CSC)c1nn(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn&nc1&",
"old_substring": "N34C"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)c1oc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)nc1C#N | CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 | CC[C@H](CSC)c1oc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N34C"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)c1sc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 | CC[C@H](CSC)c1sc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N34C"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)c1ccc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 | CC[C@H](CSC)c1ccc(C(=O)[C@@H](C)N(C)c2nccn3cnnc23)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N34C"
} |
Can you make molecule CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CSC)N1CCC(=NOC(=O)[C@@H](C)N(C)c2nccn3cnnc23)CC1 | CC[C@H](CSC)N(C)C(=O)[C@@H](C)N(C)c1nccn2cnnc12 | CC[C@H](CSC)N1CCC(=NOC(=O)[C@@H](C)N(C)c2nccn3cnnc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N34C"
} |
Can you make molecule C[NH2+]Cc1cccc(-c2nccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(Cc2cccc(-c3nccs3)c2)CC1 | C[NH2+]Cc1cccc(-c2nccs2)c1 | C[NH+]1CCC(Cc2cccc(-c3nccs3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]Cc1cccc(-c2nccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=CCC[NH+](Cc2cccc(-c3nccs3)c2)C1 | C[NH2+]Cc1cccc(-c2nccs2)c1 | CC1=CCC[NH+](Cc2cccc(-c3nccs3)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]Cc1cccc(-c2nccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CC[NH+](Cc2cccc(-c3nccs3)c2)CC1 | C[NH2+]Cc1cccc(-c2nccs2)c1 | CC1CC[NH+](Cc2cccc(-c3nccs3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]Cc1cccc(-c2nccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(C)(Cc2cccc(-c3nccs3)c2)CC1 | C[NH2+]Cc1cccc(-c2nccs2)c1 | C[NH+]1CCC(C)(Cc2cccc(-c3nccs3)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule C[NH2+]Cc1cccc(-c2nccs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CC2CC[NH2+]CC2)cc(-c2nccs2)c1 | C[NH2+]Cc1cccc(-c2nccs2)c1 | c1cc(CC2CC[NH2+]CC2)cc(-c2nccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "C[NH2+]3"
} |
Can you make molecule CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NCSC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)NCSC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N46"
} |
Can you make molecule CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CC(C[C@@H]2CCCN(c3nc4ccc(OC)cc4cc3C)C2)C1 | CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)N1CC(C[C@@H]2CCCN(c3nc4ccc(OC)cc4cc3C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N46"
} |
Can you make molecule CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)NC(=N)SC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)NC(=N)SC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N46"
} |
Can you make molecule CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1nsc(C[C@@H]2CCCN(c3nc4ccc(OC)cc4cc3C)C2)c1N | CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)c1nsc(C[C@@H]2CCCN(c3nc4ccc(OC)cc4cc3C)C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N46"
} |
Can you make molecule CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N(C)C(=S)SC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)NC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | CCCC(=O)N(C)C(=S)SC[C@@H]1CCCN(c2nc3ccc(OC)cc3cc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N46"
} |
Can you make molecule CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)n1nccc1CC(=O)SO[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1CC(=O)SO[C@@H](C)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)n1nccc1C(=O)CCCC(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)CCCC(=O)O[C@@H](C)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)n1nccc1C(C)(C)CC(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(C)(C)CC(=O)O[C@@H](C)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)n1nccc1C(C)(C)CCC(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(C)(C)CCC(=O)O[C@@H](C)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)n1nccc1[C@H](C)C(=O)SO[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1C(=O)O[C@@H](C)[C@H]1CCCO1 | CCC(CC)n1nccc1[C@H](C)C(=O)SO[C@@H](C)[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 | COCON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C4CO"
} |
Can you make molecule COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 | C=CON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C4CO"
} |
Can you make molecule COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 | CCC(=O)N1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C4CO"
} |
Can you make molecule COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C=CON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 | C=C=CON1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C4CO"
} |
Can you make molecule COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | COc1ccc([C@H]2C(C(C)=O)=C(O)C(=O)N2CCO)cc1 | CCN1C(=O)C(O)=C(C(C)=O)[C@@H]1c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C4CO"
} |
Can you make molecule CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccc(I)cc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccc(I)cc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2cc(I)ccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2cc(I)ccc2F)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2Cl)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2cc(F)ccc2Br)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2cc(F)ccc2Br)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccc(F)cc2Cl)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccccc2F)C1=O | CN(C(=O)N[C@H]1CC[C@@H]([NH+](C)C)C1)[C@@H]1CCN(c2ccc(F)cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)cc1I | Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1ccc(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)cc1Cl | Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1ccc(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1cc(I)ccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)c1 | Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1ccc(I)c(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)c1 | Cc1ccccc1O[C@H](C)CNC(=O)c1cc(N2CCCC2=O)ccc1F | Cc1ccc(Br)c(O[C@H](C)CNC(=O)c2cc(N3CCCC3=O)ccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccccc15"
} |
Can you make molecule O=C(Oc1ccccc1)c1ccccc1I less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(Oc2ccccc2)CCN1c1ccccc1I | O=C(Oc1ccccc1)c1ccccc1I | O=C1C2=CC=CC2=C(Oc2ccccc2)CCN1c1ccccc1I | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(Oc1ccccc1)c1ccccc1I less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(Oc2ccccc2)cc(-c2ccccc2I)ccc2oc1-2 | O=C(Oc1ccccc1)c1ccccc1I | O=Cc1c(Oc2ccccc2)cc(-c2ccccc2I)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C24"
} |
Can you make molecule O=C(Oc1ccccc1)c1ccccc1I less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccccc1I)Oc1ccccc1 | O=C(Oc1ccccc1)c1ccccc1I | O=C(/C=C/Sc1ccccc1I)Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(Oc1ccccc1)c1ccccc1I less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Oc2ccccc2)nc1-c1ccccc1I | O=C(Oc1ccccc1)c1ccccc1I | O=Cc1sc(Oc2ccccc2)nc1-c1ccccc1I | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C24"
} |
Can you make molecule O=C(Oc1ccccc1)c1ccccc1I less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Oc2ccccc2)sc1-c1ccccc1I | O=C(Oc1ccccc1)c1ccccc1I | O=Cc1nc(Oc2ccccc2)sc1-c1ccccc1I | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C24"
} |
Can you make molecule Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CCC(=O)N[C@@H]2CC[C@@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2CC[C@@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CCC(=O)N[C@H]2C=C[C@@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@H]2C=C[C@@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CCC(=O)N[C@@H]2N=N[C@H](c3cccc(Cl)c3)S2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2N=N[C@H](c3cccc(Cl)c3)S2)c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=N[C@H]&S1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CCC(=O)N[C@H]2C=C[C@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@H]2C=C[C@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C)c(CCC(=O)N[C@H]2CCC[C@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@@H]2C[C@@H]2c2cccc(Cl)c2)c(=O)[nH]1 | Cc1nc(C)c(CCC(=O)N[C@H]2CCC[C@H](c3cccc(Cl)c3)C2)c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@@H]14C[C@@H]16"
} |
Can you make molecule Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1ccc(Cl)s1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1ccc(Br)s1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1ccc(Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1sccc1Br | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c13cccs1"
} |
Can you make molecule Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1csc(I)c1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1csc(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c13cccs1"
} |
Can you make molecule Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cc2c(s1)CSC2 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cccs1 | Cc1cc(C)c2c(c1)NC(=O)[C@@]2(O)CC(=O)c1cc2c(s1)CSC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c13cccs1"
} |
Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2ccc(F)cc2Cl)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2Cl)n1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2ccc(F)cc2Br)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2Br)n1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2ccc(F)c(Cl)c2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)c(Cl)c2)n1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2ccc(I)cc2F)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(I)cc2F)n1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | [O-][S@@+](Cc1csc(-c2cc3c(F)cccc3s2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2ccc(F)cc2)n1)c1cccc(F)c1 | [O-][S@@+](Cc1csc(-c2cc3c(F)cccc3s2)n1)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c14ccc(F)cc1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.