prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | O=C(/C=C/Sc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C8"
} |
Can you make molecule O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)NN=C1CCC(c2cn3c(nc2=O)SCC3)CC1 | O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)NN=C1CCC(c2cn3c(nc2=O)SCC3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C8"
} |
Can you make molecule O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONCc1ccc(C(=O)Nc2ccccc2)cc1)C(=O)Sc1cn2c(nc1=O)SCC2 | O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | C/C(=N\ONCc1ccc(C(=O)Nc2ccccc2)cc1)C(=O)Sc1cn2c(nc1=O)SCC2 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C8"
} |
Can you make molecule O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)C1=CC[C@H](c2cn3c(nc2=O)SCC3)S1 | O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)C1=CC[C@H](c2cn3c(nc2=O)SCC3)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C8"
} |
Can you make molecule O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)NN=Cc1ccc(-c2cn3c(nc2=O)SCC3)cc1 | O=C(Cc1cn2c(nc1=O)SCC2)NCc1ccc(C(=O)Nc2ccccc2)cc1 | O=C(NCc1ccc(C(=O)Nc2ccccc2)cc1)NN=Cc1ccc(-c2cn3c(nc2=O)SCC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C8"
} |
Can you make molecule O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ncc(-c2ccccc2Cl)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2ccccc2Cl)o1)N1CCN(CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ncc(-c2ccc(I)cc2)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2ccc(I)cc2)o1)N1CCN(CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2cnc(CCCC(=O)N3CCN(CCO)CC3)o2)cc1I | O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 | Cc1ccc(-c2cnc(CCCC(=O)N3CCN(CCO)CC3)o2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ncc(-c2cccc(Br)c2)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 | O=C(CCCc1ncc(-c2cccc(Br)c2)o1)N1CCN(CCO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2cnc(CCCC(=O)N3CCN(CCO)CC3)o2)c1C | O=C(CCCc1ncc(-c2ccccc2)o1)N1CCN(CCO)CC1 | Cc1cccc(-c2cnc(CCCC(=O)N3CCN(CCO)CC3)o2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1sc2c(c1[C@@H](C[NH3+])c1ccccc1F)CCN(C[C@@H](C)CC)C2 | CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F | CCc1sc2c(c1[C@@H](C[NH3+])c1ccccc1F)CCN(C[C@@H](C)CC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c(sc&c2&)C1",
"old_substring": "N234"
} |
Can you make molecule CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc([C@@H](C[NH3+])c2ccccc2F)cc2c1OCCN(C[C@@H](C)CC)C2 | CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F | CCc1cc([C@@H](C[NH3+])c2ccccc2F)cc2c1OCCN(C[C@@H](C)CC)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N234"
} |
Can you make molecule CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)CN1CCC(CC)([C@@H](C[NH3+])c2ccccc2F)C1 | CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F | CC[C@H](C)CN1CCC(CC)([C@@H](C[NH3+])c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N234"
} |
Can you make molecule CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)CN1CCCC(CC)([C@@H](C[NH3+])c2ccccc2F)C1 | CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F | CC[C@H](C)CN1CCCC(CC)([C@@H](C[NH3+])c2ccccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N234"
} |
Can you make molecule CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(C[C@@H](C)CC)c(C#N)c1[C@@H](C[NH3+])c1ccccc1F | CC[C@H](C)CN(CC)[C@@H](C[NH3+])c1ccccc1F | CCc1oc(C[C@@H](C)CC)c(C#N)c1[C@@H](C[NH3+])c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N234"
} |
Can you make molecule O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CNC[C@@H]1Oc1cnc2cc([N+](=O)[O-])ccc2n1 | O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 | C[C@H]1CNC[C@@H]1Oc1cnc2cc([N+](=O)[O-])ccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]15CCC[NH2+]C1"
} |
Can you make molecule O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc2nc(O[C@H]3C=CCC3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3C=CCC3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]15CCC[NH2+]C1"
} |
Can you make molecule O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc2nc(OC3CCCCC3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 | O=[N+]([O-])c1ccc2nc(OC3CCCCC3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]15CCC[NH2+]C1"
} |
Can you make molecule O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc2nc(O[C@H]3C=CCC3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3C=CCC3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]15CCC[NH2+]C1"
} |
Can you make molecule O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1ccc2nc(OC3CCCCCC3)cnc2c1 | O=[N+]([O-])c1ccc2nc(O[C@H]3CCC[NH2+]C3)cnc2c1 | O=[N+]([O-])c1ccc2nc(OC3CCCCCC3)cnc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]15CCC[NH2+]C1"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | C=CCC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCl)C2=O)n(C)n1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCl)C2=O)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCS)C2=O)n(C)n1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCS)C2=O)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCBr)C2=O)n(C)n1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCBr)C2=O)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCF)C2=O)n(C)n1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+][C@@H]1CCN(c2cc(C)nn2C)C1=O | Cc1cc(N2CC[C@@H]([NH2+][C@H]3CC[C@@H](C)C[C@@H]3CCCCF)C2=O)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC5"
} |
Can you make molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CC(C)=NC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | C=CSNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=NC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CC(I)=NC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | C=CCCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)N=CCCl)cc1NS(=O)(=O)c1ccc(F)cc1 | CCNC(=O)c1ccc(C)c(NS(=O)(=O)c2ccc(F)cc2)c1 | Cc1ccc(C(=O)N=CCCl)cc1NS(=O)(=O)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC4"
} |
Can you make molecule COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | COCSC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | CC(=O)SC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | CON(C)CCCC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | CC(=O)CCCC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO4"
} |
Can you make molecule COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(Cc2ccc3ccccc3n2)C[C@H](C(=O)C(=O)CCBr)O1 | COC(=O)[C@H]1CN(Cc2ccc3ccccc3n2)C[C@@H](C)O1 | C[C@@H]1CN(Cc2ccc3ccccc3n2)C[C@H](C(=O)C(=O)CCBr)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO4"
} |
Can you make molecule C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CCCC[C@@H]1I | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CCCC[C@@H]1I | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@@H]1I",
"old_substring": "[C@H]14C[C@H]1C"
} |
Can you make molecule C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CC=CS1 | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CC=CS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CS1",
"old_substring": "[C@H]14C[C@H]1C"
} |
Can you make molecule C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CC1(Cl)Cl | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1CC1(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC1(Cl)Cl",
"old_substring": "[C@H]14C[C@H]1C"
} |
Can you make molecule C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C1\NCC(C)(C)c2ccc(cc2)C2(CCCCOC)C[C@@H]2N1 | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C | C/[NH+]=C1\NCC(C)(C)c2ccc(cc2)C2(CCCCOC)C[C@@H]2N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCC2",
"old_substring": "[C@H]14C[C@H]1C"
} |
Can you make molecule C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C/[NH+]=C1\NCC(C)(C)c2ccc(cc2)C2(CCCCCOC)C[C@@H]2N1 | C/[NH+]=C(\NCC(C)(C)c1ccc(OC)cc1)N[C@H]1C[C@H]1C | C/[NH+]=C1\NCC(C)(C)c2ccc(cc2)C2(CCCCCOC)C[C@@H]2N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCCC2",
"old_substring": "[C@H]14C[C@H]1C"
} |
Can you make molecule CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=S)Sc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOC(=S)Sc1ccc(CN2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=N)Cc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOC(=N)Cc1ccc(CN2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)CCC(=O)c1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCC(=O)CCC(=O)c1ccc(CN2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](O)CCc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCC[C@H](O)CCc1ccc(CN2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)/C=C/Sc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCOc1ccc(CN2CCOC(C)(C)C2)cc1OC | CCCC(=O)/C=C/Sc1ccc(CN2CCOC(C)(C)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]c(NC(C)(C)C[C@@H](C)Cl)ccc1I | Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I | Cc1[nH+]c(NC(C)(C)C[C@@H](C)Cl)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)CC&(C)C",
"old_substring": "C2[C@@H](C)C[C@H](C)O"
} |
Can you make molecule Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)[C@@H](C)Nc1ccc(I)c(C)[nH+]1 | Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I | CC[C@@H](Cl)[C@@H](C)Nc1ccc(I)c(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)[C@H]&C",
"old_substring": "C2[C@@H](C)C[C@H](C)O"
} |
Can you make molecule Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]c(NC[C@@H](CS)C(C)C)ccc1I | Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I | Cc1[nH+]c(NC[C@@H](CS)C(C)C)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "C2[C@@H](C)C[C@H](C)O"
} |
Can you make molecule Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH+]c(NC[C@@H](Br)CCC(C)C)ccc1I | Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I | Cc1[nH+]c(NC[C@@H](Br)CCC(C)C)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "C2[C@@H](C)C[C@H](C)O"
} |
Can you make molecule Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C=Nc1ccc(I)c(C)[nH+]1 | Cc1[nH+]c(NC[C@@H](C)C[C@H](C)O)ccc1I | CC[C@H](C)C=Nc1ccc(I)c(C)[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&[C@@H](C)CC",
"old_substring": "C2[C@@H](C)C[C@H](C)O"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)C(=O)CC(C)(C)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)CC(C)(C)NCc1cc(OC)c(OC)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)C(=O)CCC(C)(C)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)CCC(C)(C)NCc1cc(OC)c(OC)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)C(=O)C[C@@H](Br)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)C(=O)C[C@@H](Br)NCc1cc(OC)c(OC)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)c1cc(C)n(NCc2cc(OC)c(OC)cc2Br)c(=O)c1 | CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)c1cc(C)n(NCc2cc(OC)c(OC)cc2Br)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)c1c(C)n(NCc2cc(OC)c(OC)cc2Br)ccc1=O | CC[C@@H](C)N(C)C(=O)NCc1cc(OC)c(OC)cc1Br | CC[C@@H](C)N(C)c1c(C)n(NCc2cc(OC)c(OC)cc2Br)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)CC(=O)N[C@H](C)CC(C)(C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)N[C@H](C)CC(C)(C)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C4[C@@H]6C"
} |
Can you make molecule COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)CC(=O)NCC[C@H](Cl)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NCC[C@H](Cl)c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C4[C@@H]6C"
} |
Can you make molecule COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)CC(=O)N[C@@H](CCc1cccc(C)c1)C(C)C | COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)N[C@@H](CCc1cccc(C)c1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C4[C@@H]6C"
} |
Can you make molecule COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)CC(=O)N=CCC[C@@H](C)Cc1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)N=CCC[C@@H](C)Cc1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC[C@@H](C)C&",
"old_substring": "C4[C@@H]6C"
} |
Can you make molecule COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)CC(=O)NCCC1=CCC[C@@H]1c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NC[C@H](C)c1cccc(C)c1 | COc1ccccc1[C@@H](C)CC(=O)NCCC1=CCC[C@@H]1c1cccc(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "C4[C@@H]6C"
} |
Can you make molecule CNC(=O)CN(C)c1cc(C[NH3+])ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC2=CC=C21 | CNC(=O)CN(C)c1cc(C[NH3+])ccn1 | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC2=CC=C21 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CN(C)c1cc(C[NH3+])ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=NC2=C(C1)S2 | CNC(=O)CN(C)c1cc(C[NH3+])ccn1 | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=NC2=C(C1)S2 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2nc&sc2C1",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CN(C)c1cc(C[NH3+])ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC2=C1S2 | CNC(=O)CN(C)c1cc(C[NH3+])ccn1 | CN1CCCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC2=C1S2 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCCc2cc&sc21",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CN(C)c1cc(C[NH3+])ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC=C2C=C2C1=O | CNC(=O)CN(C)c1cc(C[NH3+])ccn1 | CN1CCC(C(=O)CN(C)c2cc(C[NH3+])ccn2)=CC=C2C=C2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2ccc&cc2C1=O",
"old_substring": "CN2"
} |
Can you make molecule CNC(=O)CN(C)c1cc(C[NH3+])ccn1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC(=O)C1=CC=CC=C2C(N1C)N2C)c1cc(C[NH3+])ccn1 | CNC(=O)CN(C)c1cc(C[NH3+])ccn1 | CN(CC(=O)C1=CC=CC=C2C(N1C)N2C)c1cc(C[NH3+])ccn1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1c2ccccc2N(C)C1&",
"old_substring": "CN2"
} |
Can you make molecule COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | COCc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | COCSc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | CC(=O)Sc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(C(=O)CS)c(F)c1)NCC1(O)CCSCC1 | COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | O=C(CCc1ccc(C(=O)CS)c(F)c1)NCC1(O)CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCc1ccc(C(=O)CI)c(F)c1)NCC1(O)CCSCC1 | COc1ccc(CCC(=O)NCC2(O)CCSCC2)cc1F | O=C(CCc1ccc(C(=O)CI)c(F)c1)NCC1(O)CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COCc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COCSc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(SC(C)=O)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(SC(C)=O)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(C(=O)CS)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(C(=O)CS)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(C(=O)CI)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(OC)c1OC | COc1cc(-c2nnc(SCc3cc(C)on3)o2)cc(C(=O)CI)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@@H](CBr)CCNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](CBr)CCNC(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]7(C)C8"
} |
Can you make molecule CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@@H](CBr)CCCNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](CBr)CCCNC(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]7(C)C8"
} |
Can you make molecule CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCNC(=O)N1C[C@@H](C)c2ccccc21)[NH+](CC)CC | CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[C@@H](CCNC(=O)N1C[C@@H](C)c2ccccc21)[NH+](CC)CC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]7(C)C8"
} |
Can you make molecule CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@@H](CCl)CCNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](CCl)CCNC(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCl)CC&",
"old_substring": "[C@H]7(C)C8"
} |
Can you make molecule CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@@H](C)CC(C)(C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](C)CNC(=O)N1C[C@@H](C)c2ccccc21 | CC[NH+](CC)[C@@H](C)CC(C)(C)CNC(=O)N1C[C@@H](C)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CC(C)(C)C&",
"old_substring": "[C@H]7(C)C8"
} |
Can you make molecule O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(I)o2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(I)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(Br)o2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(Br)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(Cl)o2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccc(Cl)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2occc2Br)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2occc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1CN1C[C@H](C(=O)NCCc2cnn(-c3ccccc3)c2)CC1=O | O=C(NCCc1cnn(-c2ccccc2)c1)[C@@H]1CC(=O)N(Cc2ccco2)C1 | Cc1ccsc1CN1C[C@H](C(=O)NCCc2cnn(-c3ccccc3)c2)CC1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\NC(=O)CNSC(=O)Cc1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNSC(=O)Cc1cccs1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\NC(=O)CNC(=O)CCCC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)CCCC(=O)c1cccs1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\NC(=O)CNC(=O)CC(C)(C)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)CC(C)(C)c1cccs1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\NC(=O)CNC(=O)CCC(C)(C)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)CCC(C)(C)c1cccs1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\NC(=O)CNSC(=O)[C@@H](C)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNC(=O)c1cccs1)c1ccco1 | C/C(=N\NC(=O)CNSC(=O)[C@@H](C)c1cccs1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCCCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCCCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C2CC(F)(F)F"
} |
Can you make molecule Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(S/C=C/C(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(S/C=C/C(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&/C=C/C(F)(F)F",
"old_substring": "C2CC(F)(F)F"
} |
Can you make molecule Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CCC(F)(F)CC2)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(C2CCC(F)(F)CC2)[nH]c(=O)c1CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC(F)(F)CC1",
"old_substring": "C2CC(F)(F)F"
} |
Can you make molecule Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCCC(C)(C)C)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | Cc1nc(CCCC(C)(C)C)[nH]c(=O)c1CCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(C)(C)C",
"old_substring": "C2CC(F)(F)F"
} |
Can you make molecule Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CS)Cc1nc(C)c(CCC(=O)[O-])c(=O)[nH]1 | Cc1nc(CCC(F)(F)F)[nH]c(=O)c1CCC(=O)[O-] | CCC(CC)(CS)Cc1nc(C)c(CCC(=O)[O-])c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(C&)(CC)CS",
"old_substring": "C2CC(F)(F)F"
} |
Can you make molecule C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](SN2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](SN2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](N2CCCN(S(=O)(=O)c3ccc(F)c(F)c3)C2=O)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCCN(S(=O)(=O)c3ccc(F)c(F)c3)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](N2CCN=C2SS(=O)(=O)c2ccc(F)c(F)c2)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCN=C2SS(=O)(=O)c2ccc(F)c(F)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)C(C)(C)C2)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)C(C)(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN4CC1"
} |
Can you make molecule C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@H](N2CCC(C#N)(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | C[C@H]1CC[C@@H](N2CCC(C#N)(S(=O)(=O)c3ccc(F)c(F)c3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&(C#N)CC1",
"old_substring": "N15CCN4CC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.