prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)CC[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@H](O)CC[C@@]1(C[NH3+])CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](O)CC&",
"old_substring": "CC[C@H]2O"
} |
Can you make molecule CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)C(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@H](C)C(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C)C&=O",
"old_substring": "CC[C@H]2O"
} |
Can you make molecule CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCO)C[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@H](CCO)C[C@@]1(C[NH3+])CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCO",
"old_substring": "CC[C@H]2O"
} |
Can you make molecule CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](Br)C(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@H](Br)C(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](Br)C&=O",
"old_substring": "CC[C@H]2O"
} |
Can you make molecule CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CC(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | CC[C@@H](C)CC(=O)[C@@]1(C[NH3+])CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C)CC&=O",
"old_substring": "CC[C@H]2O"
} |
Can you make molecule COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4Cl)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4Cl)c(O)c32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccc(I)cc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccc(I)cc4)c(O)c32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccc(C)c(I)c4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccc(C)c(I)c4)c(O)c32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4cccc(Br)c4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4cccc(Br)c4)c(O)c32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4cccc(C)c4C)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4ccccc4)c(O)c32)cc1 | COc1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3nn(-c4cccc(C)c4C)c(O)c32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN[C@H](C)c1ccc(N2CCOCC2)cc1)c1ccc(C)o1 | Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | CCC(CC)(C(=O)CN[C@H](C)c1ccc(N2CCOCC2)cc1)c1ccc(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN[C@H](C)c1ccc(N2CCOCC2)cc1)c1ccc(C)o1 | Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | CCC(CC)(C(=O)CCN[C@H](C)c1ccc(N2CCOCC2)cc1)c1ccc(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](c1ccc(C)o1)[S@+]([O-])CN[C@H](C)c1ccc(N2CCOCC2)cc1 | Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | CC[C@H](c1ccc(C)o1)[S@+]([O-])CN[C@H](C)c1ccc(N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&[S@](=O)C&",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C(=O)N[C@H](C)c1ccc(N2CCOCC2)cc1)C(=O)c1ccc(C)o1 | Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | CCCC[C@@H](C(=O)N[C@H](C)c1ccc(N2CCOCC2)cc1)C(=O)c1ccc(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H](C&=O)C&=O",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCC[S@+]([O-])[C@@H](C)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | Cc1ccc(CCC(=O)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | Cc1ccc(CCC[S@+]([O-])[C@@H](C)N[C@H](C)c2ccc(N3CCOCC3)cc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC[S@](=O)[C@H]&C",
"old_substring": "C7CC4=O"
} |
Can you make molecule Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC[C@H]2CC(CCc3ccccc3)=NO2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@H]2CC(CCc3ccccc3)=NO2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC(C&)=NO1",
"old_substring": "[C@@H]18CC(=O)N7C1"
} |
Can you make molecule Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC[C@@H]2CCN(CCc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CCN(CCc3ccccc3)C2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN(C&)C1",
"old_substring": "[C@@H]18CC(=O)N7C1"
} |
Can you make molecule Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC[C@@H]2C=C(CCc3ccccc3)N=N2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2C=C(CCc3ccccc3)N=N2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]18CC(=O)N7C1"
} |
Can you make molecule Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC[C@@H]2CCCCN(Cc3ccccc3)C2=O)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CCCCN(Cc3ccccc3)C2=O)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCN&C1=O",
"old_substring": "[C@@H]18CC(=O)N7C1"
} |
Can you make molecule Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)NC[C@@H]2CN(Cc3ccccc3)CCS2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CC(=O)N(Cc3ccccc3)C2)cc1[N+](=O)[O-] | Cc1ccc(C(=O)NC[C@@H]2CN(Cc3ccccc3)CCS2)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@@H]18CC(=O)N7C1"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | C=CSOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | C=CCCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OCCCCl)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | CC1=C(C(=O)OCCCCl)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OCCCCS)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | CC1=C(C(=O)OCCCCS)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OCCCBr)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | CCOC(=O)C1=C(C)N=C2SCCC(=O)N2[C@@H]1c1ccc(Br)cc1 | CC1=C(C(=O)OCCCBr)[C@@H](c2ccc(Br)cc2)N2C(=O)CCSC2=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc3c(N4CCC[C@@H](CCS(=O)(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](CCS(=O)(=O)[O-])C4)nccn3n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C8(=O)[O-]"
} |
Can you make molecule COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)CO)C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)CO)C4)nccn3n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C8(=O)[O-]"
} |
Can you make molecule COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc3c(N4CCC[C@@H](C(O)O)C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(O)O)C4)nccn3n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C8(=O)[O-]"
} |
Can you make molecule COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2cc3c(N4CCC[C@@H](C(F)(F)C(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC | COc1ccc(-c2cc3c(N4CCC[C@@H](C(F)(F)C(=O)[O-])C4)nccn3n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C8(=O)[O-]"
} |
Can you make molecule COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])[C@@H]1CCCN(c2nccn3nc(-c4ccc(OC)c(OC)c4)cc23)C1 | COc1ccc(-c2cc3c(N4CCC[C@@H](C(=O)[O-])C4)nccn3n2)cc1OC | CCC(CC)(C(=O)[O-])[C@@H]1CCCN(c2nccn3nc(-c4ccc(OC)c(OC)c4)cc23)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C8(=O)[O-]"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)CC(C)(C)c3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CC(C)(C)c3n[nH]c(C)n3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)CC6"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)CCC(C)(C)c3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCC(C)(C)c3n[nH]c(C)n3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)CC6"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)C[C@H](C)c3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)C[C@H](C)c3n[nH]c(C)n3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)CC6"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(C(=O)C[C@@H](Br)c3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)C[C@@H](Br)c3n[nH]c(C)n3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C4(=O)CC6"
} |
Can you make molecule COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(N2CCN(SC(=O)[C@@H](C)c3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(C(=O)CCc3n[nH]c(C)n3)CC2=O)cc1 | COc1ccc(N2CCN(SC(=O)[C@@H](C)c3n[nH]c(C)n3)CC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C4(=O)CC6"
} |
Can you make molecule Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2Cl)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2Cl)=[NH+]/C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=N)n(/C(Nc2cc(Cl)cc(Cl)c2Br)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2cc(Cl)cc(Cl)c2Br)=[NH+]/C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=N)n(/C(Nc2c(Cl)ccc(Cl)c2Cl)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2c(Cl)ccc(Cl)c2Cl)=[NH+]/C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=N)n(/C(Nc2c(Cl)cc(Cl)cc2Cl)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2c(Cl)cc(Cl)cc2Cl)=[NH+]/C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(=N)n(/C(Nc2c(Cl)cc(Br)cc2Cl)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2ccc(Cl)c(Cl)c2)=[NH+]/C(C)C)s1 | Cc1cc(=N)n(/C(Nc2c(Cl)cc(Br)cc2Cl)=[NH+]/C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c13ccc(Cl)c(Cl)c1"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)NSC(=O)C[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NSC(=O)C[C@@H]1CSCN1C(=O)c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)NCC(=C=O)C[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NCC(=C=O)C[C@@H]1CSCN1C(=O)c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)NC(=O)CCCC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)CCCC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)NC(=O)CC(C)(C)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)CC(C)(C)[C@@H]1CSCN1C(=O)c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H](C)NC[S@+]([O-])CCC[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC(=O)[C@@H]1CSCN1C(=O)c1ccoc1 | CC(C)CC[C@@H](C)NC[S@+]([O-])CCC[C@@H]1CSCN1C(=O)c1ccoc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C25=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1CCC(CO)=Nc1cc(C(F)(F)F)ccc1-n1cncn1 | C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | C[C@@H]1Cc2ccccc2N1CCC(CO)=Nc1cc(C(F)(F)F)ccc1-n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CN1c2ccccc2C[C@H]1C)=N/ONc1cc(C(F)(F)F)ccc1-n1cncn1 | C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | C/C(CN1c2ccccc2C[C@H]1C)=N/ONc1cc(C(F)(F)F)ccc1-n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1cc(C(F)(F)F)ccc1-n1cncn1)N1c2ccccc2C[C@H]1C | C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | CCC(CC)(C(=O)CNc1cc(C(F)(F)F)ccc1-n1cncn1)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1Cc2ccccc2N1SSC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | C[C@@H]1Cc2ccccc2N1SSC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1cc(C(F)(F)F)ccc1-n1cncn1)N1c2ccccc2C[C@H]1C | C[C@@H]1Cc2ccccc2N1CC(=O)Nc1cc(C(F)(F)F)ccc1-n1cncn1 | CCC(CC)(C(=O)CCNc1cc(C(F)(F)F)ccc1-n1cncn1)N1c2ccccc2C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 | Cc1cc(Br)ccc1NC(=O)[C@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c14ccc(Br)cn1"
} |
Can you make molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Br)cc1I)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cc1I)[C@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c14ccc(Br)cn1"
} |
Can you make molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Br)s1)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)s1)[C@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c14ccc(Br)cn1"
} |
Can you make molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Br)cc1Br)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cc1Br)[C@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c14ccc(Br)cn1"
} |
Can you make molecule O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Br)c2cccnc12)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)cn1)[C@H]1CCCc2ccccc21 | O=C(Nc1ccc(Br)c2cccnc12)[C@H]1CCCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c2cccnc12",
"old_substring": "c14ccc(Br)cn1"
} |
Can you make molecule CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | CC(C)CC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC5"
} |
Can you make molecule CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)Nc1cccc2c1C[NH+](CCCCBr)C2)c1ccsc1 | CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | C[C@@H](C(=O)Nc1cccc2c1C[NH+](CCCCBr)C2)c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC5"
} |
Can you make molecule CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | C=CCCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC5"
} |
Can you make molecule CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)Nc1cccc2c1C[NH+](CCCCCl)C2)c1ccsc1 | CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | C[C@@H](C(=O)Nc1cccc2c1C[NH+](CCCCCl)C2)c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC5"
} |
Can you make molecule CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | CCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | C=CCCCC[NH+]1Cc2cccc(NC(=O)[C@H](C)c3ccsc3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC5"
} |
Can you make molecule CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(CC(=O)SN[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(CC(=O)SN[C@@H](C)COc2ccccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(=O)CCCC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)CCCC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(C)(C)CC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(C)(C)CC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(C(C)(C)CCC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(C)(C)CCC(=O)N[C@@H](C)COc2ccccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H](C)C(=O)SN[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc(C(=O)N[C@@H](C)COc2ccccc2OC)cn1 | CCn1cc([C@H](C)C(=O)SN[C@@H](C)COc2ccccc2OC)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(Br)cc1Cl)N1CCC(Cc2nc3ccccc3[nH]2)CC1 | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl | O=S(=O)(c1ccc(Br)cc1Cl)N1CCC(Cc2nc3ccccc3[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1nc2ccccc2[nH]1)C(=S)SS(=O)(=O)c1ccc(Br)cc1Cl | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl | CN(Cc1nc2ccccc2[nH]1)C(=S)SS(=O)(=O)c1ccc(Br)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(Br)cc1Cl)C1CCN(CCc2nc3ccccc3[nH]2)CC1 | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl | O=S(=O)(c1ccc(Br)cc1Cl)C1CCN(CCc2nc3ccccc3[nH]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccc(Br)cc1Cl)N1CN(Cc2nc3ccccc3[nH]2)CSC1=S | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl | O=S(=O)(c1ccc(Br)cc1Cl)N1CN(Cc2nc3ccccc3[nH]2)CSC1=S | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN34"
} |
Can you make molecule CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(Cc2nc3ccccc3[nH]2)CCC(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 | CN(Cc1nc2ccccc2[nH]1)S(=O)(=O)c1ccc(Br)cc1Cl | N#CC1(Cc2nc3ccccc3[nH]2)CCC(S(=O)(=O)c2ccc(Br)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN34"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | C=CSc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C(C)C)c1NC(=O)c1cc2cccc(F)c2o1 | CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | Cc1noc(C(C)C)c1NC(=O)c1cc2cccc(F)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | C=CCCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(CCCCl)c1NC(=O)c1cc2cccc(F)c2o1 | CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | Cc1noc(CCCCl)c1NC(=O)c1cc2cccc(F)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(CCCCS)c1NC(=O)c1cc2cccc(F)c2o1 | CCc1onc(C)c1NC(=O)c1cc2cccc(F)c2o1 | Cc1noc(CCCCS)c1NC(=O)c1cc2cccc(F)c2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1cc(NSC(=O)Cc2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NSC(=O)Cc2ccc(N3CCC(C)=N3)cc2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1cc(NC(=O)CCCC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)CCCC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1cc(NC(=O)CC(C)(C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)CC(C)(C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1cc(NC(=O)CCC(C)(C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)CCC(C)(C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1cc(NSC(=O)[C@@H](C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NC(=O)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | CCCCc1cc(NSC(=O)[C@@H](C)c2ccc(N3CCC(C)=N3)cc2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | CC(C)CC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1CCCCBr | CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | [NH3+][C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1CCCCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | C=CCCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1CCCCCl | CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | [NH3+][C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1CCCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | CCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | C=CCCCC[C@H]1CN(C(=O)C2(c3ccc(Cl)cc3)CC2)C[C@@H]1[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | BrCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | C=CCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | BrCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | BrCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | SCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 less soluble in water? The output molecule should be similar to the input molecule. | SCCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | CC(C)c1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | SCCCCCCc1nc(C[NH+]2CCC[C@H]2c2cccc3c2OCCO3)no1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCC4)c(F)c3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N17CCCC1"
} |
Can you make molecule Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCC4)c(F)c3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N17CCCC1"
} |
Can you make molecule Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCC(C)CC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCC(C)CC4)c(F)c3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N17CCCC1"
} |
Can you make molecule Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCCC4)c(F)c3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N17CCCC1"
} |
Can you make molecule Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCC4=O)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCC4)c(F)c3)o2)cc1 | Cc1ccc(-c2nnc([C@@H](C)Nc3ccc(N4CCCCCCC4=O)c(F)c3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N17CCCC1"
} |
Can you make molecule C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)c1ccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)cc1I | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 | C=CCNC(=O)c1ccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccccc16"
} |
Can you make molecule C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)c1cc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)ccc1Br | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 | C=CCNC(=O)c1cc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccccc16"
} |
Can you make molecule C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)c1ccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)cc1Cl | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 | C=CCNC(=O)c1ccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccccc16"
} |
Can you make molecule C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)c1cccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)c1Br | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 | C=CCNC(=O)c1cccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccccc16"
} |
Can you make molecule C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCNC(=O)c1cccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)c1Cl | C=CCNC(=O)c1ccccc1NC(=O)[C@H]1CC(c2cccc(F)c2)=NO1 | C=CCNC(=O)c1cccc(NC(=O)[C@H]2CC(c3cccc(F)c3)=NO2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccccc16"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.