prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OC2CCCCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCCCC2)nc1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OC2CCCCCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCCCCC2)nc1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OSC2=CCCCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OSC2=CCCCCC2)nc1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OC2CCC(Cl)CC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCC(Cl)CC2)nc1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)NCc1ccc(OCCC2=CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OC2CCCC2)nc1)N1CCOCC1 | CC(C)(CNC(=O)NCc1ccc(OCCC2=CCCC2)nc1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(SC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(SC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(CCCC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(CCCC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(CCCCC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(CCCCC(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(C(F)(F)C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nc(CC(F)(F)C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | O=C(Cn1nc(CC(F)(F)C(F)(F)F)cc1C1CC1)NC12CC3CC(CC(C3)C1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C7(F)(F)F"
} |
Can you make molecule O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(I)o1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(I)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(Br)o1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(Br)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(Cl)o1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccc(Cl)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1occc1Br | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1occc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1CNC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1O | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1O)NCc1ccco1 | Cc1ccsc1CNC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccccc1Cl)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1ccccc1Cl)C(=O)NCC#CCOc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1ccc(I)cc1)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1ccc(I)cc1)C(=O)NCC#CCOc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(O[C@@H](C)C(=O)NCC#CCOc2cccc(Br)c2)cc1I | C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 | Cc1ccc(O[C@@H](C)C(=O)NCC#CCOc2cccc(Br)c2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Oc1cccc(Br)c1)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 | C[C@H](Oc1cccc(Br)c1)C(=O)NCC#CCOc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(O[C@@H](C)C(=O)NCC#CCOc2cccc(Br)c2)c1C | C[C@H](Oc1ccccc1)C(=O)NCC#CCOc1cccc(Br)c1 | Cc1cccc(O[C@@H](C)C(=O)NCC#CCOc2cccc(Br)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | CC(C)CC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC7"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@@H]1CCCN1C(=O)c1cccs1)N1CCO[C@H](CCCCBr)C1 | CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | O=C([C@@H]1CCCN1C(=O)c1cccs1)N1CCO[C@H](CCCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC7"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | C=CCCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC7"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@@H]1CCCN1C(=O)c1cccs1)N1CCO[C@H](CCCCCl)C1 | CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | O=C([C@@H]1CCCN1C(=O)c1cccs1)N1CCO[C@H](CCCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC7"
} |
Can you make molecule CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | CCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | C=CCCCC[C@@H]1CN(C(=O)[C@@H]2CCCN2C(=O)c2cccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC7"
} |
Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(SC(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(SC(F)(F)F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(CCCC(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(CCCC(F)(F)F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(CCCCC(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(CCCCC(F)(F)F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C)Nc1ccc(CC(F)(F)C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] | CC[C@H](C)Nc1ccc(CC(F)(F)C(F)(F)F)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C4(F)(F)F"
} |
Can you make molecule CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1cccnc1[N+](=O)[O-])C1CCN(Cc2c(F)cccc2Cl)CC1 | CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] | O=C(COc1cccnc1[N+](=O)[O-])C1CCN(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)COc1cccnc1[N+](=O)[O-])C(=S)SCc1c(F)cccc1Cl | CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] | CN(C(=O)COc1cccnc1[N+](=O)[O-])C(=S)SCc1c(F)cccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1cccnc1[N+](=O)[O-])CN1CCC(Cc2c(F)cccc2Cl)CC1 | CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] | O=C(COc1cccnc1[N+](=O)[O-])CN1CCC(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1cccnc1[N+](=O)[O-])N1CSC(=S)N(Cc2c(F)cccc2Cl)C1 | CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] | O=C(COc1cccnc1[N+](=O)[O-])N1CSC(=S)N(Cc2c(F)cccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN25"
} |
Can you make molecule CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#CC1(C(=O)COc2cccnc2[N+](=O)[O-])CCC(Cc2c(F)cccc2Cl)CC1 | CN(Cc1c(F)cccc1Cl)C(=O)COc1cccnc1[N+](=O)[O-] | N#CC1(C(=O)COc2cccnc2[N+](=O)[O-])CCC(Cc2c(F)cccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](Cc1ccc(O)cc1)c1nc2cn-2ccs1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 | [NH3+][C@H](Cc1ccc(O)cc1)c1nc2cn-2ccs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn2ccsc2n1",
"old_substring": "c12ncccn1"
} |
Can you make molecule [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](Cc1ccc(O)cc1)c1ncncc1I | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncncc1I",
"old_substring": "c12ncccn1"
} |
Can you make molecule [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](Cc1ccc(O)cc1)n1ccccc2cnc1-2 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 | [NH3+][C@H](Cc1ccc(O)cc1)n1ccccc2cnc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc2ccccn12",
"old_substring": "c12ncccn1"
} |
Can you make molecule [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](Cc1ccc(O)cc1)c1ccccn2cc-2n1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ccccn2cc-2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn2ccccc2n1",
"old_substring": "c12ncccn1"
} |
Can you make molecule [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccc2nc-2s1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccn1 | [NH3+][C@H](Cc1ccc(O)cc1)c1ncccc2nc-2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2cccnc2s1",
"old_substring": "c12ncccn1"
} |
Can you make molecule C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCCCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(SC2=CCCCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(SC2=CCCCCC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCC(Cl)CC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCC(Cl)CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2C(C)(C)SC2(C)C)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2CCCC2)n1 | C[C@H](CCn1cncn1)[NH2+]Cc1ccn(C2C(C)(C)SC2(C)C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C(C)(C)SC1(C)C",
"old_substring": "C17CCCC1"
} |
Can you make molecule C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2CC=C(CCN3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CC=C(CCN3CCNC3=O)CC2)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]14CCC5CC1"
} |
Can you make molecule C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2CCc3sc(N4CCNC4=O)cc3C2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCc3sc(N4CCNC4=O)cc3C2)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2sc&cc2C1",
"old_substring": "[NH+]14CCC5CC1"
} |
Can you make molecule C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2Cc3cc(N4CCNC4=O)sc3C2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2Cc3cc(N4CCNC4=O)sc3C2)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&Cc2cc&sc2C1",
"old_substring": "[NH+]14CCC5CC1"
} |
Can you make molecule C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([C@H]2CN(N3CCNC3=O)C(C)(C)C2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([C@H]2CN(N3CCNC3=O)C(C)(C)C2)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C(C)(C)C1",
"old_substring": "[NH+]14CCC5CC1"
} |
Can you make molecule C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(N2CCCN(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC([NH+]2CCC(N3CCNC3=O)CC2)C[C@@H](C)C1 | C[C@@H]1CC(N2CCCN(N3CCNC3=O)CC2)C[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&CC1",
"old_substring": "[NH+]14CCC5CC1"
} |
Can you make molecule CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@H]1C[C@@H](NC(=O)CC(C)(C)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)CC(C)(C)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@H]1C[C@@H](NC(=O)CCC(C)(C)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)CCC(C)(C)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@H]1C[C@@H](Nc2c(C)n(C)n(N[C@@H](CS(C)(=O)=O)c3ccccc3)c2=O)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](Nc2c(C)n(C)n(N[C@@H](CS(C)(=O)=O)c3ccccc3)c2=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C34=O"
} |
Can you make molecule CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@H]1C[C@@H](Nc2nn(N[C@@H](CS(C)(=O)=O)c3ccccc3)c(C)cc2=O)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](Nc2nn(N[C@@H](CS(C)(=O)=O)c3ccccc3)c(C)cc2=O)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C34=O"
} |
Can you make molecule CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@H]1C[C@@H](NC(=O)C[C@@H](Br)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | CCO[C@H]1C[C@@H](NC(=O)C[C@@H](Br)N[C@@H](CS(C)(=O)=O)c2ccccc2)C1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)CSN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CSN1CCN(c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)CN1CC(c2ccccc2)C1 | CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CN1CC(c2ccccc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)CN1CCCN(c2ccccc2)C1=O | CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CN1CCCN(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)CN1CCN=C1Sc1ccccc1 | CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CN1CCN=C1Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC([NH3+])(CC)CN1CCN(c2ccccc2)C(C)(C)C1 | CCC([NH3+])(CC)CN1CCN(c2ccccc2)CC1 | CCC([NH3+])(CC)CN1CCN(c2ccccc2)C(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cc4cc(F)ccc4s3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cc4cc(F)ccc4s3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c19cccc(F)c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(Br)c3C)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(Br)c3C)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c19cccc(F)c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Cc2csc(-c3oc4ccc(F)cc4c3C)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3oc4ccc(F)cc4c3C)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c19cccc(F)c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cc(F)ccc3Br)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cc(F)ccc3Br)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c19cccc(F)c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)c(NC(=O)Cc2csc(-c3ccc(F)cc3Cl)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3cccc(F)c3)n2)c1 | COc1ccc(OC)c(NC(=O)Cc2csc(-c3ccc(F)cc3Cl)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c19cccc(F)c1"
} |
Can you make molecule CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+](C)CCNCc1cnc(-c2ccc(Cl)s2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2ccc(Cl)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+](C)CCNCc1cnc(-c2ccc(Br)s2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2ccc(Br)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+](C)CCNCc1cnc(-c2sccc2Br)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2sccc2Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c18cccs1"
} |
Can you make molecule CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+](C)CCNCc1cnc(-c2csc(I)c2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2csc(I)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c18cccs1"
} |
Can you make molecule CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[NH+](C)CCNCc1cnc(-c2cc3c(s2)CSC3)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cccs2)s1 | CC(C)[NH+](C)CCNCc1cnc(-c2cc3c(s2)CSC3)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c18cccs1"
} |
Can you make molecule CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCOC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCOC)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C36"
} |
Can you make molecule CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCCOC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCCOC)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCCCOC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](CCCCCOC)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(Cl)c(C)c(N2CC[C@H](C3CC(OC)C3)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](C3CC(OC)C3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(Cl)c(C)c(N2CC[C@H](SC(=S)OOC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](COC)C2)n1 | CCc1nc(Cl)c(C)c(N2CC[C@H](SC(=S)OOC)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCC[C@@H](CCl)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1CCC[C@@H](CCl)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]58C"
} |
Can you make molecule Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CCC1=CN=N[C@H]1NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1CCC1=CN=N[C@H]1NC(=O)NCc1cccc(Cn2ccnc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]58C"
} |
Can you make molecule Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1CC[C@@H](NC(=O)NCc2cccc(Cn3ccnc3C)c2)C1 | Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1[C@@H]1CC[C@@H](NC(=O)NCc2cccc(Cn3ccnc3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]58C"
} |
Can you make molecule Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1CC(C)(C)[C@@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1CC(C)(C)[C@@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]58C"
} |
Can you make molecule Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccccc1C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | Cc1ccccc1[C@H](C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | CC[C@@H](CCc1ccccc1C)NC(=O)NCc1cccc(Cn2ccnc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]58C"
} |
Can you make molecule CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@H](Cc2ccccc2Cl)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2ccccc2Cl)Sc2ccc(N)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@H](Cc2ccc(I)cc2)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2ccc(I)cc2)Sc2ccc(N)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@@H]2Sc3ccc(N)cc3N(C)C2=O)cc1I | CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 | Cc1ccc(C[C@@H]2Sc3ccc(N)cc3N(C)C2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)[C@H](Cc2cccc(Br)c2)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 | CN1C(=O)[C@H](Cc2cccc(Br)c2)Sc2ccc(N)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[C@@H]2Sc3ccc(N)cc3N(C)C2=O)c1C | CN1C(=O)[C@H](Cc2ccccc2)Sc2ccc(N)cc21 | Cc1cccc(C[C@@H]2Sc3ccc(N)cc3N(C)C2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | C[C@H](CC(C)(C)c1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]45"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CC(=O)c1ccccc1 | C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | C[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)CC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]45"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cl[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | Cl[C@@H](CCSc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]45"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | CCC[C@H](CC(=O)c1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]45"
} |
Can you make molecule C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | C[C@@H](Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1)c1ccccc1 | CC(C)[C@H](CCc1ccccc1)Sc1nnc(-c2c[nH]c3ccccc23)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]45"
} |
Can you make molecule COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCSC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | COCSC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | CC(=O)SC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)C(=O)NC[C@](C)(O)CC(=O)CI | COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | CC(C)CNC(=O)C(=O)NC[C@](C)(O)CC(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)C(=O)C1C[C@@](C)(O)CNOCCCO1 | COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | CC(C)CNC(=O)C(=O)C1C[C@@](C)(O)CNOCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CNC(=O)C(=O)NC[C@](C)(O)CC(=O)CCl | COC[C@@](C)(O)CNC(=O)C(=O)NCC(C)C | CC(C)CNC(=O)C(=O)NC[C@](C)(O)CC(=O)CCl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN1CCC[C@H]([NH+]2CCCC2)C1)NC[C@H]1CCS(=O)(=O)C1 | O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 | O=C(/C=C/SN1CCC[C@H]([NH+]2CCCC2)C1)NC[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=S1(=O)CC[C@H](CNO/N=C/c2ccc(N3CCC[C@H]([NH+]4CCCC4)C3)o2)C1 | O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 | O=S1(=O)CC[C@H](CNO/N=C/c2ccc(N3CCC[C@H]([NH+]4CCCC4)C3)o2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCS(=O)(=O)C1)NN=C1CCC(N2CCC[C@H]([NH+]3CCCC3)C2)CC1 | O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 | O=C(NC[C@H]1CCS(=O)(=O)C1)NN=C1CCC(N2CCC[C@H]([NH+]3CCCC3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@H]1CCS(=O)(=O)C1)C1=CC[C@H](N2CCC[C@H]([NH+]3CCCC3)C2)S1 | O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 | O=C(NC[C@H]1CCS(=O)(=O)C1)C1=CC[C@H](N2CCC[C@H]([NH+]3CCCC3)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/N=c1\ccccn1N1CCC[C@H]([NH+]2CCCC2)C1)NC[C@H]1CCS(=O)(=O)C1 | O=C(NC[C@H]1CCS(=O)(=O)C1)N1CCC[C@H]([NH+]2CCCC2)C1 | O=C(/N=c1\ccccn1N1CCC[C@H]([NH+]2CCCC2)C1)NC[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/N=c1\\ccccn1&",
"old_substring": "O=C34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.