prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)N(C(=O)C[C@H](c1cccc(F)c1)C(C)C)CCO2 | COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N(C(=O)C[C@H](c1cccc(F)c1)C(C)C)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&C(C)C",
"old_substring": "C3(=O)C[C@@H]5C"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)N(CC[C@H](Cl)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N(CC[C@H](Cl)c1cccc(F)c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C3(=O)C[C@@H]5C"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)N([C@@H](CCc1cccc(F)c1)C(C)C)CCO2 | COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N([C@@H](CCc1cccc(F)c1)C(C)C)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C3(=O)C[C@@H]5C"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2c(c1)N(C(=O)CCC(C)(C)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 | COc1ccc2c(c1)N(C(=O)CCC(C)(C)c1cccc(F)c1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C[C@@H]5C"
} |
Can you make molecule COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1cccc(F)c1)N1CCOc2ccc(OC)cc21 | COc1ccc2c(c1)N(C(=O)C[C@H](C)c1cccc(F)c1)CCO2 | CCC[C@H](CC(=O)c1cccc(F)c1)N1CCOc2ccc(OC)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C3(=O)C[C@@H]5C"
} |
Can you make molecule C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=COC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 | C=COC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C5CO"
} |
Can you make molecule C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)C1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 | CCC(=O)C1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C5CO"
} |
Can you make molecule C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C=COC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 | C=C=COC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C5CO"
} |
Can you make molecule C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 | CCC1(C[NH2+][C@H](C)c2cccnc2)CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C5CO"
} |
Can you make molecule C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]CC1(C2(C)COC2)CCCCC1)c1cccnc1 | C[C@@H]([NH2+]CC1(CCO)CCCCC1)c1cccnc1 | C[C@@H]([NH2+]CC1(C2(C)COC2)CCCCC1)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&COC1",
"old_substring": "C5CO"
} |
Can you make molecule Cn1c(Cl)cnc1CSc1cc(Br)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cl)cnc1C1=CC=C(Sc2cc(Br)ccc2N)N2CCC2=C1 | Cn1c(Cl)cnc1CSc1cc(Br)ccc1N | Cn1c(Cl)cnc1C1=CC=C(Sc2cc(Br)ccc2N)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C23"
} |
Can you make molecule Cn1c(Cl)cnc1CSc1cc(Br)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1c2sc-2ncnc(-c2ncc(Cl)n2C)c1Sc1cc(Br)ccc1N | Cn1c(Cl)cnc1CSc1cc(Br)ccc1N | Cc1c2sc-2ncnc(-c2ncc(Cl)n2C)c1Sc1cc(Br)ccc1N | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2ncnc&c12",
"old_substring": "C23"
} |
Can you make molecule Cn1c(Cl)cnc1CSc1cc(Br)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cl)cnc1C1=CC=C2SCCN2C(Sc2cc(Br)ccc2N)=C1 | Cn1c(Cl)cnc1CSc1cc(Br)ccc1N | Cn1c(Cl)cnc1C1=CC=C2SCCN2C(Sc2cc(Br)ccc2N)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C23"
} |
Can you make molecule Cn1c(Cl)cnc1CSc1cc(Br)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Cl)cnc1C1=C2CCN2CC(Sc2cc(Br)ccc2N)=CC=C1 | Cn1c(Cl)cnc1CSc1cc(Br)ccc1N | Cn1c(Cl)cnc1C1=C2CCN2CC(Sc2cc(Br)ccc2N)=CC=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C23"
} |
Can you make molecule Cn1c(Cl)cnc1CSc1cc(Br)ccc1N less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Sc2cc(Br)ccc2N)ccc(-c2ncc(Cl)n2C)nc2sc1-2 | Cn1c(Cl)cnc1CSc1cc(Br)ccc1N | Cc1c(Sc2cc(Br)ccc2N)ccc(-c2ncc(Cl)n2C)nc2sc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&sc2nc&ccc12",
"old_substring": "C23"
} |
Can you make molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSCc2csc(-c3ccco3)c2)c1 | COc1cccc(CSCc2csc(-c3ccco3)n2)c1 | COc1cccc(CSCc2csc(-c3ccco3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSCc2csc(-c3ccco3)c2C)c1 | COc1cccc(CSCc2csc(-c3ccco3)n2)c1 | COc1cccc(CSCc2csc(-c3ccco3)c2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1C",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSCc2ccc(-c3ccco3)s2)c1 | COc1cccc(CSCc2csc(-c3ccco3)n2)c1 | COc1cccc(CSCc2ccc(-c3ccco3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSCc2cc(-c3ccco3)cnc2Cl)c1 | COc1cccc(CSCc2csc(-c3ccco3)n2)c1 | COc1cccc(CSCc2cc(-c3ccco3)cnc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule COc1cccc(CSCc2csc(-c3ccco3)n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CSCc2cc(-c3ccco3)ncc2Cl)c1 | COc1cccc(CSCc2csc(-c3ccco3)n2)c1 | COc1cccc(CSCc2cc(-c3ccco3)ncc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ncc1Cl",
"old_substring": "c17csc9n1"
} |
Can you make molecule Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Nc2ccc(Br)c(Cl)c2F)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(Br)c(Cl)c2F)cc(=O)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c14ccc(F)c(Cl)c1"
} |
Can you make molecule Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Nc2ccc(Cl)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(Cl)c(Cl)c2)cc(=O)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c14ccc(F)c(Cl)c1"
} |
Can you make molecule Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Nc2ccc(Cl)c(Br)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(Cl)c(Br)c2)cc(=O)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Br)c1",
"old_substring": "c14ccc(F)c(Cl)c1"
} |
Can you make molecule Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Nc2cc(F)c(Cl)cc2Cl)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2cc(F)c(Cl)cc2Cl)cc(=O)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)c(Cl)cc1Cl",
"old_substring": "c14ccc(F)c(Cl)c1"
} |
Can you make molecule Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(Nc2ccc(Cl)c(Cl)c2Cl)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(F)c(Cl)c2)cc(=O)n(C)c1=O | Cn1c(Nc2ccc(Cl)c(Cl)c2Cl)cc(=O)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c14ccc(F)c(Cl)c1"
} |
Can you make molecule CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)CC(=O)[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](C)CC(=O)[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C)CC&=O",
"old_substring": "CC[C@H](C3)CCO"
} |
Can you make molecule CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCCl)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCCl)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CCCl",
"old_substring": "CC[C@H](C3)CCO"
} |
Can you make molecule CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CS)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CS)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&)CS",
"old_substring": "CC[C@H](C3)CCO"
} |
Can you make molecule CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](CCCl)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@H](CCCl)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](C&)CCCl",
"old_substring": "CC[C@H](C3)CCO"
} |
Can you make molecule CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Cl)CCC[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](CCO)C[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | CC[C@@H](Cl)CCC[NH2+][C@H]1C[C@H](C)c2c(C)ccc(O)c21 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@H](Cl)CCC&",
"old_substring": "CC[C@H](C3)CCO"
} |
Can you make molecule CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS&(=O)=O",
"old_substring": "CS3(=O)=O"
} |
Can you make molecule CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)SN1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)SN1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CS(=O)(=O)S&",
"old_substring": "CS3(=O)=O"
} |
Can you make molecule CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCS&(=O)=O",
"old_substring": "CS3(=O)=O"
} |
Can you make molecule CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCCCCS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCS&(=O)=O",
"old_substring": "CS3(=O)=O"
} |
Can you make molecule CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCCS(=O)(=O)SN1C[C@H](C(N)=O)Oc2ccccc21 | CS(=O)(=O)N1C[C@H](C(N)=O)Oc2ccccc21 | CCCS(=O)(=O)SN1C[C@H](C(N)=O)Oc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCS(=O)(=O)S&",
"old_substring": "CS3(=O)=O"
} |
Can you make molecule Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)c1ccc(NCC(=O)Nc2ccc(C)cc2Br)cc1)[C@@H](O)CC | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 | CC[C@H](C(=O)c1ccc(NCC(=O)Nc2ccc(C)cc2Br)cc1)[C@@H](O)CC | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](O)[C@@H]&CC",
"old_substring": "N15C[C@@H](C)O[C@H](C)C1"
} |
Can you make molecule Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CNc2ccc(C(=O)C[C@@H](CS)C(C)C)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)C[C@@H](CS)C(C)C)cc2)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "N15C[C@@H](C)O[C@H](C)C1"
} |
Can you make molecule Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CNc2ccc(C(=O)C[C@H](CO)C(C)C)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)C[C@H](CO)C(C)C)cc2)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](CO)C(C)C",
"old_substring": "N15C[C@@H](C)O[C@H](C)C1"
} |
Can you make molecule Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3CCCC(C)(C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3CCCC(C)(C)C3)cc2)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N15C[C@@H](C)O[C@H](C)C1"
} |
Can you make molecule Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3CCC(C)(C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3C[C@@H](C)O[C@H](C)C3)cc2)c(Br)c1 | Cc1ccc(NC(=O)CNc2ccc(C(=O)N3CCC(C)(C)C3)cc2)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)(C)C1",
"old_substring": "N15C[C@@H](C)O[C@H](C)C1"
} |
Can you make molecule CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c(=S)n1CCNSC(=O)Cc1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNSC(=O)Cc1ccncc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c(=S)n1CCNC(=O)CCCC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)CCCC(=O)c1ccncc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c(=S)n1CCNC(=O)CC(C)(C)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)CC(C)(C)c1ccncc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c(=S)n1CCNC(=O)CCC(C)(C)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)CCC(C)(C)c1ccncc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1n[nH]c(=S)n1CCNSC(=O)[C@@H](C)c1ccncc1F | CCc1n[nH]c(=S)n1CCNC(=O)c1ccncc1F | CCc1n[nH]c(=S)n1CCNSC(=O)[C@@H](C)c1ccncc1F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)nnc(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1C | Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1c(Cl)nnc(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Cl)nnc&c1C",
"old_substring": "Cc1cnn6c1"
} |
Can you make molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)cnn1CCCCC[NH+]1CCN(c2ccc(O)cc2)CC1 | Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1c(Cl)cnn1CCCCC[NH+]1CCN(c2ccc(O)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Cl)cnn1&",
"old_substring": "Cc1cnn6c1"
} |
Can you make molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c[nH]c(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1c[nH]c(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c[nH]c&c1",
"old_substring": "Cc1cnn6c1"
} |
Can you make molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(Cl)nc1CCCCC[NH+]1CCN(c2ccc(O)cc2)CC1 | Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1cnc(Cl)nc1CCCCC[NH+]1CCN(c2ccc(O)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cnc(Cl)nc1&",
"old_substring": "Cc1cnn6c1"
} |
Can you make molecule Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)nn1C | Cc1cnn(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)c1 | Cc1c(Cl)c(CCCCC[NH+]2CCN(c3ccc(O)cc3)CC2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Cl)c&nn1C",
"old_substring": "Cc1cnn6c1"
} |
Can you make molecule CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(-c2noc3ncc(-c4nnn(-c5cccc(Cl)c5)c4N)cc23)cc1 | CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 | CCOc1ccc(-c2noc3ncc(-c4nnn(-c5cccc(Cl)c5)c4N)cc23)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&noc2ncc&cc12",
"old_substring": "c19noc8n1"
} |
Can you make molecule CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(-c2ncnc(-c3nnn(-c4cccc(Cl)c4)c3N)c2C)cc1 | CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 | CCOc1ccc(-c2ncnc(-c3nnn(-c4cccc(Cl)c4)c3N)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c19noc8n1"
} |
Can you make molecule CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(-c2nc(-c3nnn(-c4cccc(Cl)c4)c3N)ncc2C)cc1 | CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 | CCOc1ccc(-c2nc(-c3nnn(-c4cccc(Cl)c4)c3N)ncc2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c19noc8n1"
} |
Can you make molecule CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(-c2ncnc(-c3nnn(-c4cccc(Cl)c4)c3N)c2F)cc1 | CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 | CCOc1ccc(-c2ncnc(-c3nnn(-c4cccc(Cl)c4)c3N)c2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c19noc8n1"
} |
Can you make molecule CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc(-c2nc(-c3nnn(-c4cccc(Cl)c4)c3N)ncc2I)cc1 | CCOc1ccc(-c2noc(-c3nnn(-c4cccc(Cl)c4)c3N)n2)cc1 | CCOc1ccc(-c2nc(-c3nnn(-c4cccc(Cl)c4)c3N)ncc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c19noc8n1"
} |
Can you make molecule C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 | C[C@H](CC(C)(C)c1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]36"
} |
Can you make molecule C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)CC(=O)c1ccsc1 | C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 | C[C@@H](CCNC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)CC(=O)c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]36"
} |
Can you make molecule C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCC[C@@H]1[NH+]1CCC(NCC[C@H](Cl)c2ccsc2)CC1 | C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 | O[C@H]1CCCC[C@@H]1[NH+]1CCC(NCC[C@H](Cl)c2ccsc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]36"
} |
Can you make molecule C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 | CCC[C@H](CC(=O)c1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]36"
} |
Can you make molecule C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | C[C@@H](NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1)c1ccsc1 | CC(C)[C@H](CCc1ccsc1)NC1CC[NH+]([C@H]2CCCC[C@@H]2O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]36"
} |
Can you make molecule CCc1ccc(CC(=O)C(C)(C)OC)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(CC(=O)C(C)(C)OC)s1 | CCc1ccc(CC(=O)C(C)(C)OC)s1 | C=CSc1ccc(CC(=O)C(C)(C)OC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccc(CC(=O)C(C)(C)OC)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(C)(C)C(=O)Cc1ccc(C(C)C)s1 | CCc1ccc(CC(=O)C(C)(C)OC)s1 | COC(C)(C)C(=O)Cc1ccc(C(C)C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccc(CC(=O)C(C)(C)OC)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(CC(=O)C(C)(C)OC)s1 | CCc1ccc(CC(=O)C(C)(C)OC)s1 | C=CCCc1ccc(CC(=O)C(C)(C)OC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccc(CC(=O)C(C)(C)OC)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(C)(C)C(=O)Cc1ccc(CCCCl)s1 | CCc1ccc(CC(=O)C(C)(C)OC)s1 | COC(C)(C)C(=O)Cc1ccc(CCCCl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCc1ccc(CC(=O)C(C)(C)OC)s1 less soluble in water? The output molecule should be similar to the input molecule. | COC(C)(C)C(=O)Cc1ccc(CCCCS)s1 | CCc1ccc(CC(=O)C(C)(C)OC)s1 | COC(C)(C)C(=O)Cc1ccc(CCCCS)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2OCc3ccccc3CO2)c(C)c1 | COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2OCc3ccccc3CO2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2(O)Cc3ccccc3C2)c(C)c1 | COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2(O)Cc3ccccc3C2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2=CC3=NN3C[C@@H](C)CO2)c(C)c1 | COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C | Cc1ccc(NC(=O)NC[C@H](C)C(=O)C2=CC3=NN3C[C@@H](C)CO2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[C@H](C)C(=O)N2CCOC23CCCCC3)c(C)c1 | COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C | Cc1ccc(NC(=O)NC[C@H](C)C(=O)N2CCOC23CCCCC3)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC12CCCCC2",
"old_substring": "CO2"
} |
Can you make molecule COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)NC[C@H](C)C(=O)N2CCOC3(CCC3)C2)c(C)c1 | COC(=O)[C@@H](C)CNC(=O)Nc1ccc(C)cc1C | Cc1ccc(NC(=O)NC[C@H](C)C(=O)N2CCOC3(CCC3)C2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOC2(CCC2)C1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | COCc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | COCSc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | CC(=O)Sc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2ccn(-c3ccccc3)n2)c(C(=O)CS)c1 | COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | Cc1ccc(NCc2ccn(-c3ccccc3)n2)c(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NCc2ccn(-c3ccccc3)n2)c(C(=O)CI)c1 | COc1cc(C)ccc1NCc1ccn(-c2ccccc2)n1 | Cc1ccc(NCc2ccn(-c3ccccc3)n2)c(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cncc(Cl)n2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cncc(Cl)n2)[C@H]3C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cncc&n1",
"old_substring": "c19cnccn1"
} |
Can you make molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cn4ccsc4n2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cn4ccsc4n2)[C@H]3C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn2ccsc2n1",
"old_substring": "c19cnccn1"
} |
Can you make molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnc(Br)cn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnc(Br)cn2)[C@H]3C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Br)cn1",
"old_substring": "c19cnccn1"
} |
Can you make molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cn4ccccc4n2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cn4ccccc4n2)[C@H]3C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn2ccccc2n1",
"old_substring": "c19cnccn1"
} |
Can you make molecule COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)C=C(C)c2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)Cc2cnccn2)[C@H]3C1=O | COCCN1C[C@@]23C=C[C@@H](O2)[C@H](C(=O)N(C)C=C(C)c2cnccn2)[C@H]3C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1cnccn1",
"old_substring": "c19cnccn1"
} |
Can you make molecule Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2)sc1CC(=O)SNC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1CC(=O)SNC1(C(N)=O)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2)sc1C(=O)CCCC(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)CCCC(=O)NC1(C(N)=O)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2)sc1C(C)(C)CC(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(C)(C)CC(=O)NC1(C(N)=O)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2)sc1C(C)(C)CCC(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(C)(C)CCC(=O)NC1(C(N)=O)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-c2ccc(F)cc2)sc1[C@H](C)C(=O)SNC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NC1(C(N)=O)CCCC1 | Cc1nc(-c2ccc(F)cc2)sc1[C@H](C)C(=O)SNC1(C(N)=O)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cccc(S(=O)(=O)N2CCCCCC2)c1)OCc1ccccn1 | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 | O=C(/C=C/Sc1cccc(S(=O)(=O)N2CCCCCC2)c1)OCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1ccccn1)n1nc(-c2cccc(S(=O)(=O)N3CCCCCC3)c2)oc1=S | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 | O=C(OCc1ccccn1)n1nc(-c2cccc(S(=O)(=O)N3CCCCCC3)c2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1cccc(-c2ccc(/C=N/OOCc3ccccn3)o2)c1)N1CCCCCC1 | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 | O=S(=O)(c1cccc(-c2ccc(/C=N/OOCc3ccccn3)o2)c1)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2cccc(S(=O)(=O)N3CCCCCC3)c2)CC1)OCc1ccccn1 | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 | O=C(NN=C1CCC(c2cccc(S(=O)(=O)N3CCCCCC3)c2)CC1)OCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C36"
} |
Can you make molecule O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\OOCc1ccccn1)C(=O)Sc1cccc(S(=O)(=O)N2CCCCCC2)c1 | O=C(OCc1ccccn1)c1cccc(S(=O)(=O)N2CCCCCC2)c1 | C/C(=N\OOCc1ccccn1)C(=O)Sc1cccc(S(=O)(=O)N2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | O=C(/C=C/Sc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C5"
} |
Can you make molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)NN=C1CCC(c2cccc(F)c2)CC1 | O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)NN=C1CCC(c2cccc(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C5"
} |
Can you make molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONCC(=O)N1CCCCC[C@@H]1c1ccncc1)C(=O)Sc1cccc(F)c1 | O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | C/C(=N\ONCC(=O)N1CCCCC[C@@H]1c1ccncc1)C(=O)Sc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C2C5"
} |
Can you make molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)C1=CC[C@H](c2cccc(F)c2)S1 | O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)C1=CC[C@H](c2cccc(F)c2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C2C5"
} |
Can you make molecule O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)NN=Cc1ccc(-c2cccc(F)c2)cc1 | O=C(Cc1cccc(F)c1)NCC(=O)N1CCCCC[C@@H]1c1ccncc1 | O=C(NCC(=O)N1CCCCC[C@@H]1c1ccncc1)NN=Cc1ccc(-c2cccc(F)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C2C5"
} |
Can you make molecule O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 | O=C(N[C@H]1CCc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&[C@H]1CCc2ccccc21",
"old_substring": "[C@@H]17C=C(c2ccccc2O)N=N1"
} |
Can you make molecule O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1CC=C(Cl)S1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1CC=C(Cl)S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC=C(Cl)S1",
"old_substring": "[C@@H]17C=C(c2ccccc2O)N=N1"
} |
Can you make molecule O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@@H]1Cc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 | O=C(C[C@@H]1Cc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H]1Cc2ccccc21",
"old_substring": "[C@@H]17C=C(c2ccccc2O)N=N1"
} |
Can you make molecule O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H]1Cc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 | O=C(C[C@H]1Cc2ccccc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H]1Cc2ccccc21",
"old_substring": "[C@@H]17C=C(c2ccccc2O)N=N1"
} |
Can you make molecule O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CCCc2occc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | O=C(NCc1ccccc1)C1=C2CCCC[C@@H]2S[C@@H]1NC(=O)[C@@H]1C=C(c2ccccc2O)N=N1 | O=C(N[C@H]1CCCc2occc21)N[C@H]1S[C@H]2CCCCC2=C1C(=O)NCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&[C@H]1CCCc2occc21",
"old_substring": "[C@@H]17C=C(c2ccccc2O)N=N1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.