prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]CCCCc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]CCCCc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C45"
} |
Can you make molecule C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]CCCCCc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]CCCCCc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C45"
} |
Can you make molecule C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CC(c2cc(Cl)cc(Cl)c2O[C@@H](C)[C@H](C)O)C1 | C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]C1CC(c2cc(Cl)cc(Cl)c2O[C@@H](C)[C@H](C)O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C45"
} |
Can you make molecule C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]OC(=S)Sc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]OC(=S)Sc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C45"
} |
Can you make molecule C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]SC(=S)Nc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]Cc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | C[NH2+]SC(=S)Nc1cc(Cl)cc(Cl)c1O[C@@H](C)[C@H](C)O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C45"
} |
Can you make molecule CC(C)[C@@H](CO)Nc1ccc(N)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CI)Nc1ccc(N)cc1Br | CC(C)[C@@H](CO)Nc1ccc(N)cc1Br | CC(C)[C@H](CI)Nc1ccc(N)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CI",
"old_substring": "CC(C)[C@H]2CO"
} |
Can you make molecule CC(C)[C@@H](CO)Nc1ccc(N)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)C(=O)Nc1ccc(N)cc1Br | CC(C)[C@@H](CO)Nc1ccc(N)cc1Br | CC(C)[C@H](C)C(=O)Nc1ccc(N)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C)C&=O",
"old_substring": "CC(C)[C@H]2CO"
} |
Can you make molecule CC(C)[C@@H](CO)Nc1ccc(N)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1ccc(N)cc1Br | CC(C)[C@@H](CO)Nc1ccc(N)cc1Br | CC(C)[C@@H](C)C(=O)Nc1ccc(N)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H](C)C&=O",
"old_substring": "CC(C)[C@H]2CO"
} |
Can you make molecule CC(C)[C@@H](CO)Nc1ccc(N)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](Br)C(=O)Nc1ccc(N)cc1Br | CC(C)[C@@H](CO)Nc1ccc(N)cc1Br | CC(C)[C@H](Br)C(=O)Nc1ccc(N)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](Br)C&=O",
"old_substring": "CC(C)[C@H]2CO"
} |
Can you make molecule CC(C)[C@@H](CO)Nc1ccc(N)cc1Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](C)CNc1ccc(N)cc1Br | CC(C)[C@@H](CO)Nc1ccc(N)cc1Br | CC(C)[C@H](C)CNc1ccc(N)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C)C&",
"old_substring": "CC(C)[C@H]2CO"
} |
Can you make molecule CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(O)c(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c2onc1-2 | CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C | CCc1ccc(O)c(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c2onc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCOc2ccc(-c3c(Br)cc(Br)cc3C=CC[NH2+]C)cc2C1 | CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C | CCN1CCOc2ccc(-c3c(Br)cc(Br)cc3C=CC[NH2+]C)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2ccc-2ncn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C | CCc1cc2ccc-2ncn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2nc-2ccn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C | CCc1ccc2nc-2ccn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc2nc-2ccn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | CCOc1c(Br)cc(Br)cc1C=CC[NH2+]C | CCc1cnc2nc-2ccn(-c2c(Br)cc(Br)cc2C=CC[NH2+]C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2Cl)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccc(I)cc2)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccc(I)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[NH+]2CCC[C@@H]2C(=O)N2CCN(C(=O)C(C)(C)C)CC2)cc1I | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 | Cc1ccc(C[NH+]2CCC[C@@H]2C(=O)N2CCN(C(=O)C(C)(C)C)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2cccc(Br)c2)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2cccc(Br)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[NH+]2CCC[C@@H]2C(=O)N2CCN(C(=O)C(C)(C)C)CC2)c1C | CC(C)(C)C(=O)N1CCN(C(=O)[C@H]2CCC[NH+]2Cc2ccccc2)CC1 | Cc1cccc(C[NH+]2CCC[C@@H]2C(=O)N2CCN(C(=O)C(C)(C)C)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1C(=O)c2ccccc2C1=O)CC(=O)N1CCC(C(=O)[O-])CC1 | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@@H](CCN1C(=O)c2ccccc2C1=O)CC(=O)N1CCC(C(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]5CC3=O"
} |
Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCN1C(=O)c2ccccc2C1=O)CC(=O)N1CCC(C(=O)[O-])CC1 | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](CCN1C(=O)c2ccccc2C1=O)CC(=O)N1CCC(C(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]5CC3=O"
} |
Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](CC(C)(C)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]5CC3=O"
} |
Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | CCC[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]5CC3=O"
} |
Can you make molecule C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | C[C@H](CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | CC[C@@](C)(CC(=O)N1CCC(C(=O)[O-])CC1)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@]&(C)CC&=O",
"old_substring": "C[C@@H]5CC3=O"
} |
Can you make molecule c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CNC[C@@H]1Oc1cccc2cccnc12 | c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 | C[C@H]1CNC[C@@H]1Oc1cccc2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]14CCC[NH2+]C1"
} |
Can you make molecule c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C[C@H](Oc2cccc3cccnc23)CC1 | c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 | C1=C[C@H](Oc2cccc3cccnc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]14CCC[NH2+]C1"
} |
Can you make molecule c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1cnc2c(OC3CCCCC3)cccc2c1 | c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 | c1cnc2c(OC3CCCCC3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]14CCC[NH2+]C1"
} |
Can you make molecule c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C[C@H](Oc2cccc3cccnc23)CC1 | c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 | C1=C[C@H](Oc2cccc3cccnc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]14CCC[NH2+]C1"
} |
Can you make molecule c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1cnc2c(OC3CCCCCC3)cccc2c1 | c1cnc2c(O[C@H]3CCC[NH2+]C3)cccc2c1 | c1cnc2c(OC3CCCCCC3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]14CCC[NH2+]C1"
} |
Can you make molecule C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1C[C@H](CCN2C(=O)NC(C)(C)C2=O)CCO1 | C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 | C[C@@H]1C[C@H](CCN2C(=O)NC(C)(C)C2=O)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1C[C@H]&CCO1",
"old_substring": "C[C@@H]1C[NH+]3C[C@@H](C)S1"
} |
Can you make molecule C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN(CCN2C(=O)NC(C)(C)C2=O)CCCO1 | C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 | C[C@@H]1CN(CCN2C(=O)NC(C)(C)C2=O)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CN&CCCO1",
"old_substring": "C[C@@H]1C[NH+]3C[C@@H](C)S1"
} |
Can you make molecule C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CN=C(NCCN2C(=O)NC(C)(C)C2=O)S1 | C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 | C[C@@H]1CN=C(NCCN2C(=O)NC(C)(C)C2=O)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CN=C(N&)S1",
"old_substring": "C[C@@H]1C[NH+]3C[C@@H](C)S1"
} |
Can you make molecule C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CCCN(CCN2C(=O)NC(C)(C)C2=O)C1 | C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 | C[C@@H]1CCCN(CCN2C(=O)NC(C)(C)C2=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]1CCCN&C1",
"old_substring": "C[C@@H]1C[NH+]3C[C@@H](C)S1"
} |
Can you make molecule C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(CCN2C(=O)NC(C)(C)C2=O)CCCO1 | C[C@@H]1C[NH+](CCN2C(=O)NC(C)(C)C2=O)C[C@@H](C)S1 | C[C@H]1CN(CCN2C(=O)NC(C)(C)C2=O)CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CN&CCCO1",
"old_substring": "C[C@@H]1C[NH+]3C[C@@H](C)S1"
} |
Can you make molecule CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Cl)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(I)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Cl)c1Cl | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Br)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(Cl)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Br)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1c(C)cc(I)cc1C | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1ccc(C)c(C)c1 | CC(=O)N[C@@H](C)c1nc2ccccc2n1CCOc1c(C)cc(I)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)cc(C)c1&",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc2c(c1)OCCO2)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | C[C@H](CC(C)(C)c1ccc2c(c1)OCCO2)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)CC(=O)c1ccc2c(c1)OCCO2 | C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | C[C@H](CC[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)CC(=O)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](Cc1ccc2c(c1)OCCO2)[C@H](C)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | C[C@H](Cc1ccc2c(c1)OCCO2)[C@H](C)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)CC(=O)c1ccc2c(c1)OCCO2 | C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | C[C@@H](CC[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)CC(=O)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H]47"
} |
Can you make molecule C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccc2c(c1)OCCO2)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | C[C@H]([NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F)c1ccc2c(c1)OCCO2 | CCC[C@@H](CCc1ccc2c(c1)OCCO2)[NH2+][C@H](C)C(=O)Nc1cc(F)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C[C@H]47"
} |
Can you make molecule COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(C)cc1)[NH2+]CCc1ccc(OC)c(S(N)(=O)=O)c1 | COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O | CC[C@@H](CCc1ccc(C)cc1)[NH2+]CCc1ccc(OC)c(S(N)(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[NH2+][C@@H](CBr)CCc2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@@H](CBr)CCc2ccc(C)cc2)cc1S(N)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[NH2+][C@@H](CBr)CCCc2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@@H](CBr)CCCc2ccc(C)cc2)cc1S(N)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[NH2+][C@H](CCl)CCCc2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H](CCl)CCCc2ccc(C)cc2)cc1S(N)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]57C"
} |
Can you make molecule COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC[NH2+][C@H]2CCC[C@H](c3ccc(C)cc3)C2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H](C)c2ccc(C)cc2)cc1S(N)(=O)=O | COc1ccc(CC[NH2+][C@H]2CCC[C@H](c3ccc(C)cc3)C2)cc1S(N)(=O)=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]57C"
} |
Can you make molecule C=C(Cl)Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC(C)(C)c1ccc(C#N)cc1 | C=C(Cl)Cc1ccc(C#N)cc1 | C=C(C)CC(C)(C)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC&(C)C",
"old_substring": "C=C(Cl)C2"
} |
Can you make molecule C=C(Cl)Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)CC[C@@H](C)c1ccc(C#N)cc1 | C=C(Cl)Cc1ccc(C#N)cc1 | C=C(C)CC[C@@H](C)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)CC[C@H]&C",
"old_substring": "C=C(Cl)C2"
} |
Can you make molecule C=C(Cl)Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C[C@@H](CC(C)C)c1ccc(C#N)cc1 | C=C(Cl)Cc1ccc(C#N)cc1 | C=C(C)C[C@@H](CC(C)C)c1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C[C@H]&CC(C)C",
"old_substring": "C=C(Cl)C2"
} |
Can you make molecule C=C(Cl)Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc(C#N)cc1 | C=C(Cl)Cc1ccc(C#N)cc1 | C=CCCCCc1ccc(C#N)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=C(Cl)C2"
} |
Can you make molecule C=C(Cl)Cc1ccc(C#N)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C/C(Cl)=C/Cl)cc1 | C=C(Cl)Cc1ccc(C#N)cc1 | N#Cc1ccc(C/C(Cl)=C/Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(Cl)=C/Cl",
"old_substring": "C=C(Cl)C2"
} |
Can you make molecule CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1ccc(CCC[C@@H](CCl)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc(CCC[C@@H](CCl)NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]47C"
} |
Can you make molecule CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1ccc(CCC2=CN=N[C@H]2NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc(CCC2=CN=N[C@H]2NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]47C"
} |
Can you make molecule CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1ccc([C@@H]2CC[C@@H](NC(=O)c3ccccc3)C2)cc1 | CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc([C@@H]2CC[C@@H](NC(=O)c3ccccc3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]47C"
} |
Can you make molecule CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1ccc(CC(C)(C)[C@@H](C)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 | CC(C)Cc1ccc(CC(C)(C)[C@@H](C)NC(=O)c2ccccc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]47C"
} |
Can you make molecule CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(CC(C)C)cc1)NC(=O)c1ccccc1 | CC(C)Cc1ccc([C@H](C)NC(=O)c2ccccc2)cc1 | CC[C@@H](CCc1ccc(CC(C)C)cc1)NC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]47C"
} |
Can you make molecule Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nncc1C[NH+](CC1CCCCC1)C1SCCS1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nncc1C[NH+](CC1CCCCC1)C1CCCCC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nncc1C[NH+](CC1CCCCC1)C1SCCCS1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nncc1C[NH+](CC1CCCCC1)C1SCSCS1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C14CC1"
} |
Can you make molecule Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nncc1C[NH+](CC1CCCCC1)C1CCCCCC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CC1 | Cn1nncc1C[NH+](CC1CCCCC1)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CC1"
} |
Can you make molecule CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)C1CN(C(N)=O)C1 | CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)C1CN(C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N13"
} |
Can you make molecule CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](SC1=NCCN1C(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@H](SC1=NCCN1C(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13"
} |
Can you make molecule CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)C1CCN(CC(N)=O)CC1 | CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)C1CCN(CC(N)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N13"
} |
Can you make molecule CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)N1CCN(SC(N)=O)CC1 | CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@@H](C(=O)N[C@@H](C(=O)[O-])C(C)C)N1CCN(SC(N)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13"
} |
Can you make molecule CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](CC1=NCCN1C(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@H](NC(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | CC(C)C[C@H](CC1=NCCN1C(N)=O)C(=O)N[C@@H](C(=O)[O-])C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N13"
} |
Can you make molecule O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(SC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(SC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(CCCC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(CCCC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(CCCCC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(CCCCC(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(C(F)(F)C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(CC(F)(F)C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | O=C(Nc1ccc(CC(F)(F)C(F)(F)F)cc1)c1ccc(NCc2ccccc2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C8(F)(F)F"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NO[C@@H]2CC[C@@H](NC(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)C2)CC1 | C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | C[NH+]1CCC(=NO[C@@H]2CC[C@@H](NC(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]6C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCc2onc([C@@H]3CC[C@@H](NC(=O)c4ccc5c(c4)CCCN5S(C)(=O)=O)C3)c2C1 | C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | C[NH+]1CCc2onc([C@@H]3CC[C@@H](NC(=O)c4ccc5c(c4)CCCN5S(C)(=O)=O)C3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCc2onc&c2C1",
"old_substring": "C[NH+]6C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | C[N+](C)(C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]6C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCCc2cc(C(=O)N[C@@H]3CC[C@@H](C[NH+]4CCCSCC4)C3)ccc21 | C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | CS(=O)(=O)N1CCCc2cc(C(=O)N[C@@H]3CC[C@@H](C[NH+]4CCCSCC4)C3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]6C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC([C@@H]2CC[C@@H](NC(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)C2)CC1 | C[NH+](C)[C@@H]1CC[C@@H](NC(=O)c2ccc3c(c2)CCCN3S(C)(=O)=O)C1 | C[N+]1(C)CCC([C@@H]2CC[C@@H](NC(=O)c3ccc4c(c3)CCCN4S(C)(=O)=O)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]6C"
} |
Can you make molecule CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(O)(CCCNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CCCNC(=O)N2CCC[C@@H](C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC&",
"old_substring": "C56"
} |
Can you make molecule CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(O)(CCCCNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CCCCNC(=O)N2CCC[C@@H](C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C56"
} |
Can you make molecule CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(O)(CCC=NC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CCC=NC(=O)N2CCC[C@@H](C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C56"
} |
Can you make molecule CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(O)(CCCCCNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(CCCCCNC(=O)N2CCC[C@@H](C)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C56"
} |
Can you make molecule CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCC(O)(C2CC(NC(=O)N3CCC[C@@H](C)C3)C2)CC1 | CC1CCC(O)(CNC(=O)N2CCC[C@@H](C)C2)CC1 | CC1CCC(O)(C2CC(NC(=O)N3CCC[C@@H](C)C3)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C56"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(CC(=O)SN(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(CC(=O)SN(C)[C@H](c3ccccc3)C(C)C)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(=O)CCCC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)CCCC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(C)(C)CC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(C)(C)CC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c(C(C)(C)CCC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(C)(C)CCC(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)c([C@H](C)C(=O)SN(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c(C(=O)N(C)[C@H](c3ccccc3)C(C)C)cnc12 | Cc1cccn2c(=O)c([C@H](C)C(=O)SN(C)[C@H](c3ccccc3)C(C)C)cnc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(C[NH+](C)[C@@H]1CCC[C@H](C)C1)=N/ON1CCC(C(=O)N2CCCC2)CC1 | C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | C/C(C[NH+](C)[C@@H]1CCC[C@H](C)C1)=N/ON1CCC(C(=O)N2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C4=O"
} |
Can you make molecule C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCC(C(=O)N2CCCC2)CC1)[NH+](C)[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | CCC(CC)(C(=O)CN1CCC(C(=O)N2CCCC2)CC1)[NH+](C)[C@@H]1CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C4=O"
} |
Can you make molecule C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H]([NH+](C)SSC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | C[C@H]1CCC[C@@H]([NH+](C)SSC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCC(C(=O)N2CCCC2)CC1)[NH+](C)[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | CCC(CC)(C(=O)CCN1CCC(C(=O)N2CCCC2)CC1)[NH+](C)[C@@H]1CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C4=O"
} |
Can you make molecule C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1CCC(C(=O)N2CCCC2)CC1)C(=O)[NH+](C)[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H]([NH+](C)CC(=O)N2CCC(C(=O)N3CCCC3)CC2)C1 | CC[C@@H](C(=O)N1CCC(C(=O)N2CCCC2)CC1)C(=O)[NH+](C)[C@@H]1CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)Nc2cccc(N=C(C)O)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(N=C(C)O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)O",
"old_substring": "C4(C)=O"
} |
Can you make molecule COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)Nc2cccc(NC(=O)C(C)C)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(=O)C(C)C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)Nc2cccc(N=C(C)OC)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(N=C(C)OC)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)OC",
"old_substring": "C4(C)=O"
} |
Can you make molecule COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)Nc1cccc(NC(=O)c2ccc(COC)cc2)c1 | COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 | C=C(C)C(=O)Nc1cccc(NC(=O)c2ccc(COC)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)Nc2cccc(NC(=O)CC(C)C)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(C)=O)c2)cc1 | COCc1ccc(C(=O)Nc2cccc(NC(=O)CC(C)C)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C4(C)=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.