prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCSCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCSCSc1nnnn1-c1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S35"
} |
Can you make molecule CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCN1CCSC2=CC=C(C=C1OC)c1nnnn1-c1ccccc12 | CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCN1CCSC2=CC=C(C=C1OC)c1nnnn1-c1ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S35"
} |
Can you make molecule CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCC[S@@+]([O-])C(Cl)(Cl)c1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCC[S@@+]([O-])C(Cl)(Cl)c1nnnn1-c1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S35"
} |
Can you make molecule CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCS/C(Cl)=C(\C#N)Nc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCS/C(Cl)=C(\C#N)Nc1nnnn1-c1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S35"
} |
Can you make molecule CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CCn1c(OC)ccccc2c3ccccc3n3nnnc3n2c1=S | CCS(=O)(=O)CCSc1nnnn1-c1ccccc1OC | CCS(=O)(=O)CCn1c(OC)ccccc2c3ccccc3n3nnnc3n2c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S35"
} |
Can you make molecule CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSn1ccnc(NCC[C@@H](O)C(C)C)c1=O | CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | C=CSn1ccnc(NCC[C@@H](O)C(C)C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNc1nccn(C(C)C)c1=O | CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | CC(C)[C@H](O)CCNc1nccn(C(C)C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC4"
} |
Can you make molecule CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | C=CCCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNc1nccn(CCCCl)c1=O | CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | CC(C)[C@H](O)CCNc1nccn(CCCCl)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNc1nccn(CCCCS)c1=O | CCn1ccnc(NCC[C@@H](O)C(C)C)c1=O | CC(C)[C@H](O)CCNc1nccn(CCCCS)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2Cl)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2Cl)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccc(I)cc2)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccc(I)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)CCNC(=O)C(=O)Nc2cccc(C)c2Cl)cc1I | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl | Cc1ccc(NC(=O)CCNC(=O)C(=O)Nc2cccc(C)c2Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2cccc(Br)c2)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2cccc(Br)c2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=O)CCNC(=O)C(=O)Nc2cccc(C)c2Cl)c1C | Cc1cccc(NC(=O)C(=O)NCCC(=O)Nc2ccccc2)c1Cl | Cc1cccc(NC(=O)CCNC(=O)C(=O)Nc2cccc(C)c2Cl)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(Br)c([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)n1 | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 | CCn1cc(Br)c([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(Br)c&n1",
"old_substring": "n16cc8cn1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccn([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)c1=S | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 | CCn1ccn([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccn&c1=S",
"old_substring": "n16cc8cn1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc2cc([C@H]3OCC[C@@H]3C[NH2+]CC(C)=Cc3ccccc3)ccc2n1 | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 | CCn1cc2cc([C@H]3OCC[C@@H]3C[NH2+]CC(C)=Cc3ccccc3)ccc2n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc2cc&ccc2n1",
"old_substring": "n16cc8cn1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)c2cccnc21 | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)c2cccnc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&c2cccnc21",
"old_substring": "n16cc8cn1"
} |
Can you make molecule CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc([C@H]3OCC[C@@H]3C[NH2+]CC(C)=Cc3ccccc3)ccc21 | CCn1cc([C@H]2OCC[C@@H]2C[NH2+]CC(C)=Cc2ccccc2)cn1 | CCn1ccc2nc([C@H]3OCC[C@@H]3C[NH2+]CC(C)=Cc3ccccc3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2nc&ccc21",
"old_substring": "n16cc8cn1"
} |
Can you make molecule CCN(CC(N)=S)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(N)=S)C(C)(C)CC(=O)OC(C)(C)C | CCN(CC(N)=S)C(=O)OC(C)(C)C | CCN(CC(N)=S)C(C)(C)CC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C12=O"
} |
Can you make molecule CCN(CC(N)=S)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(N)=S)C(C)(C)CCC(=O)OC(C)(C)C | CCN(CC(N)=S)C(=O)OC(C)(C)C | CCN(CC(N)=S)C(C)(C)CCC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C12=O"
} |
Can you make molecule CCN(CC(N)=S)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(N)=S)[C@H](Br)CC(=O)OC(C)(C)C | CCN(CC(N)=S)C(=O)OC(C)(C)C | CCN(CC(N)=S)[C@H](Br)CC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C12=O"
} |
Can you make molecule CCN(CC(N)=S)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCC(=O)C(CC)(CC)OC(C)(C)C)CC(N)=S | CCN(CC(N)=S)C(=O)OC(C)(C)C | CCN(CCC(=O)C(CC)(CC)OC(C)(C)C)CC(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C12=O"
} |
Can you make molecule CCN(CC(N)=S)C(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCC(C)(C)C(=O)OC(C)(C)C)CC(N)=S | CCN(CC(N)=S)C(=O)OC(C)(C)C | CCN(CCCC(C)(C)C(=O)OC(C)(C)C)CC(N)=S | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C12=O"
} |
Can you make molecule CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@@H](CCl)c1ccc(Br)cc1I | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1ccc(Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c12cccc(Br)c1"
} |
Can you make molecule CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@@H](CCl)c1oc2ccc(Br)cc2c1C | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1oc2ccc(Br)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(Br)cc2c1C",
"old_substring": "c12cccc(Br)c1"
} |
Can you make molecule CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(/C=C/Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(/C=C/Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c12cccc(Br)c1"
} |
Can you make molecule CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@@H](CCl)c1ccc(Br)cc1Br | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1ccc(Br)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c12cccc(Br)c1"
} |
Can you make molecule CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCS(=O)(=O)CC[C@@H](CCl)c1cc(Br)ccc1I | CCS(=O)(=O)CC[C@@H](CCl)c1cccc(Br)c1 | CCS(=O)(=O)CC[C@@H](CCl)c1cc(Br)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c12cccc(Br)c1"
} |
Can you make molecule C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCN(SC(=O)CC2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(SC(=O)CC2(C)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCN(CC(=C=O)CC2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(CC(=C=O)CC2(C)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCN(C(=O)CCCC(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)CCCC(=O)C2(C)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCN(C(=O)CC(C)(C)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)CC(C)(C)C2(C)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCN(C[S@+]([O-])CCCC2(C)CCCC2)CC1 | C[NH2+]C1CCN(C(=O)C2(C)CCCC2)CC1 | C[NH2+]C1CCN(C[S@+]([O-])CCCC2(C)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCCCCCC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N13CCC(C)CC1"
} |
Can you make molecule Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)C1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCC2)C1",
"old_substring": "N13CCC(C)CC1"
} |
Can you make molecule Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCCCCCCC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N13CCC(C)CC1"
} |
Can you make molecule Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCCC2)C1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCCC2)C1",
"old_substring": "N13CCC(C)CC1"
} |
Can you make molecule Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC(C)CC1 | Cc1nn(S(=O)(=O)c2ccc(F)cc2)c(C)c1S(=O)(=O)N1CCC2(CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCCC2)CC1",
"old_substring": "N13CCC(C)CC1"
} |
Can you make molecule CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | C=CSN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | C=CCCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCl)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CCCCl)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCCS)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CCCCS)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCCBr)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CC)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | CCN(CCCBr)c1ccc([C@@H]2C3=C([O-])CCCC3=NC3=NC(SC)=NC(=O)[C@@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccc(I)cc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccc(I)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)[NH2+]Cc1cccc(OCc2cc(I)ccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2cc(I)ccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2Cl)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)[NH2+]Cc1cccc(OC=C(C)c2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OC=C(C)c2ccccc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccccc1F",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)[NH2+]Cc1cccc(OCc2cc(F)ccc2Br)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2ccccc2F)c1 | CCC(C)(C)[NH2+]Cc1cccc(OCc2cc(F)ccc2Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c18ccccc1F"
} |
Can you make molecule CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccccc1NC(=O)CCc1cc(C(=O)C(C)C)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(=O)C(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)c1cc(CCC(=O)Nc2ccccc2CC)oc1C | CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 | C=C(C)C(=O)c1cc(CCC(=O)Nc2ccccc2CC)oc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccccc1NC(=O)CCc1cc(C(=O)CC(C)C)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(=O)CC(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccccc1NC(=O)CCc1cc(C(C)C)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "C4(C)=O"
} |
Can you make molecule CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccccc1NC(=O)CCc1cc(C(=O)CCC(C)C)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(C)=O)c(C)o1 | CCc1ccccc1NC(=O)CCc1cc(C(=O)CCC(C)C)c(C)o1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "C4(C)=O"
} |
Can you make molecule CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | S=C=NCc1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | S=C=NCc1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN6C"
} |
Can you make molecule CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C=S)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | O=C(N=C=S)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N=C=S",
"old_substring": "CN6C"
} |
Can you make molecule CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCC[C@H](CN3CCOCC3)C2)ccc1CN1CCSCC1 | CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | c1cc(CN2CCC[C@H](CN3CCOCC3)C2)ccc1CN1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN6C"
} |
Can you make molecule CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCc1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | CON(C)CCCc1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CN6C"
} |
Can you make molecule CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | c1cc(CN2CCC[C@H](CN3CCOCC3)C2)ccc1CN1CCCCC1 | CN(C)c1ccc(CN2CCC[C@H](CN3CCOCC3)C2)cc1 | c1cc(CN2CCC[C@H](CN3CCOCC3)C2)ccc1CN1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCCCC1",
"old_substring": "CN6C"
} |
Can you make molecule Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCNCSCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCNCSCc1cn2ccccc2[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCNC(=N)SCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCNC(=N)SCc1cn2ccccc2[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCc1nsc(Cc2cn3ccccc3[nH+]2)c1N | Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCc1nsc(Cc2cn3ccccc3[nH+]2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCN(C)C(=S)SCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCN(C)C(=S)SCc1cn2ccccc2[nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)ccc1CCc1cc(Cc2cn3ccccc3[nH+]2)c(N)o1 | Cc1cc(F)ccc1CCNCc1cn2ccccc2[nH+]1 | Cc1cc(F)ccc1CCc1cc(Cc2cn3ccccc3[nH+]2)c(N)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N34"
} |
Can you make molecule Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCC([NH+]2CCC[C@@H](C[NH3+])C2)=CC2=CC=C21 | Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 | Cc1ccccc1N1CCC([NH+]2CCC[C@@H](C[NH3+])C2)=CC2=CC=C21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "C4C2"
} |
Can you make molecule Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCSC([NH+]2CCC[C@@H](C[NH3+])C2)=CC=C2C=C21 | Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 | Cc1ccccc1N1CCSC([NH+]2CCC[C@@H](C[NH3+])C2)=CC=C2C=C21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "C4C2"
} |
Can you make molecule Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCC([NH+]2CCC[C@@H](C[NH3+])C2)=C2C=CC=C2C1 | Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 | Cc1ccccc1N1CCC([NH+]2CCC[C@@H](C[NH3+])C2)=C2C=CC=C2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&cccc2C1",
"old_substring": "C4C2"
} |
Can you make molecule Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCCC([NH+]2CCC[C@@H](C[NH3+])C2)=C2C=CC=C21 | Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 | Cc1ccccc1N1CCCC([NH+]2CCC[C@@H](C[NH3+])C2)=C2C=CC=C21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2c&cccc21",
"old_substring": "C4C2"
} |
Can you make molecule Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1CCOC([NH+]2CCC[C@@H](C[NH3+])C2)=CC=C2C=C2C1 | Cc1ccccc1CC[NH+]1CCC[C@@H](C[NH3+])C1 | Cc1ccccc1N1CCOC([NH+]2CCC[C@@H](C[NH3+])C2)=CC=C2C=C2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "C4C2"
} |
Can you make molecule Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3Cl)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3Cl)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c14ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3cc(Cl)cc(Cl)c3Br)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3cc(Cl)cc(Cl)c3Br)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c14ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)ccc(Cl)c3Cl)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)ccc(Cl)c3Cl)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c14ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)cc(Cl)cc3Cl)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)cc(Cl)cc3Cl)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c14ccc(Cl)c(Cl)c1"
} |
Can you make molecule Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)cc(Br)cc3Cl)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3ccc(Cl)c(Cl)c3)o2)c1=O | Cc1n[nH]c(=S)n(/N=C\c2ccc(-c3c(Cl)cc(Br)cc3Cl)o2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c14ccc(Cl)c(Cl)c1"
} |
Can you make molecule C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1sc2ccccc2c1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1sc2ccccc2c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Br",
"old_substring": "c12ccccc1Br"
} |
Can you make molecule C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccc(Cl)cc1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c12ccccc1Br"
} |
Can you make molecule C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccc2ccccc2c1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccc2ccccc2c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1Br",
"old_substring": "c12ccccc1Br"
} |
Can you make molecule C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c([C@@H](C(=O)[O-])[C@@H](C)[C@H](C)O)c(Br)c1 | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br | Cc1cc(C)c([C@@H](C(=O)[O-])[C@@H](C)[C@H](C)O)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)cc(C)cc1Br",
"old_substring": "c12ccccc1Br"
} |
Can you make molecule C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)c([C@@H](C(=O)[O-])[C@@H](C)[C@H](C)O)cc1C | C[C@@H]([C@H](C)O)[C@H](C(=O)[O-])c1ccccc1Br | Cc1cc(Br)c([C@@H](C(=O)[O-])[C@@H](C)[C@H](C)O)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c(C)cc1Br",
"old_substring": "c12ccccc1Br"
} |
Can you make molecule CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCc2c(sc(NC(=O)Nc3c(Cl)cccc3Cl)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3c(Cl)cccc3Cl)c2C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3I)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3I)c2C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3Br)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3Br)c2C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCc2c(sc(NC(=O)N=Cc3cccc(Cl)c3Cl)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)N=Cc3cccc(Cl)c3Cl)c2C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Cl)c1Cl",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CCc2c(sc(NC(=O)N=Cc3c(Cl)cccc3Cl)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)Nc3cccc(Cl)c3)c2C(N)=O)C1 | CC[C@H]1CCc2c(sc(NC(=O)N=Cc3c(Cl)cccc3Cl)c2C(N)=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1C=&",
"old_substring": "c17cccc(Cl)c1"
} |
Can you make molecule CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2cc(NSC(=O)C[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NSC(=O)C[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2cc(NCC(=C=O)C[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NCC(=C=O)C[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2cc(NC(=O)CCCC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)CCCC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2cc(NC(=O)CC(C)(C)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)CC(C)(C)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)c1nc2cc(NC[S@+]([O-])CCC[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC(=O)[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | CC(C)(C)c1nc2cc(NC[S@+]([O-])CCC[C@@H]3Cc4ccccc4C(=O)O3)ccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C57=O"
} |
Can you make molecule Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)cnc1Cl | Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1cc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1cccnc14"
} |
Can you make molecule Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)c1 | Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1cccc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "Cc1cccnc14"
} |
Can you make molecule Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1cc(Cl)cnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Cl)cnc1&",
"old_substring": "Cc1cccnc14"
} |
Can you make molecule Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)ccc1I | Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1nc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc&ccc1I",
"old_substring": "Cc1cccnc14"
} |
Can you make molecule Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)ncc1Br | Cc1cccnc1C[C@@H](N[C@H]1CCSc2ccccc21)C(F)(F)F | Cc1cc(C[C@@H](N[C@H]2CCSc3ccccc32)C(F)(F)F)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1cccnc14"
} |
Can you make molecule CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | C=CSc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@H](c1ccc(C(C)C)cc1)[C@H]1CN2CCC[C@@H]2CO1 | CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | C[NH2+][C@H](c1ccc(C(C)C)cc1)[C@H]1CN2CCC[C@@H]2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | C=CCCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@H](c1ccc(CCCCl)cc1)[C@H]1CN2CCC[C@@H]2CO1 | CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | C[NH2+][C@H](c1ccc(CCCCl)cc1)[C@H]1CN2CCC[C@@H]2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+][C@H](c1ccc(CCCCS)cc1)[C@H]1CN2CCC[C@@H]2CO1 | CCc1ccc([C@@H]([NH2+]C)[C@H]2CN3CCC[C@@H]3CO2)cc1 | C[NH2+][C@H](c1ccc(CCCCS)cc1)[C@H]1CN2CCC[C@@H]2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.