prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CSc1nccn1C)=N/ON1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | C/C(CSc1nccn1C)=N/ON1CCC(C(=O)N2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nccn1C)C(=O)CN1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | CCC(CC)(Sc1nccn1C)C(=O)CN1CCC(C(=O)N2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1SSSC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SSSC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nccn1C)C(=O)CCN1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | CCC(CC)(Sc1nccn1C)C(=O)CCN1CCC(C(=O)N2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Sc1nccn1C)C(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | Cn1ccnc1SCC(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | CC[C@H](C(=O)Sc1nccn1C)C(=O)N1CCC(C(=O)N2CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule CCCc1c(CCl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc(CCl)c1C1(C)Cc2ccccc2C1 | CCCc1c(CCl)cnn1C | Cn1ncc(CCl)c1C1(C)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CCC2"
} |
Can you make molecule CCCc1c(CCl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc(CCl)c1C1=CC2=CC=C2OC(C)(C)C1 | CCCc1c(CCl)cnn1C | Cn1ncc(CCl)c1C1=CC2=CC=C2OC(C)(C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CCC2"
} |
Can you make molecule CCCc1c(CCl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc(CCl)c1N1CC(C)(C)Sc2ccccc21 | CCCc1c(CCl)cnn1C | Cn1ncc(CCl)c1N1CC(C)(C)Sc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CN&c2ccccc2S1",
"old_substring": "CCC2"
} |
Can you make molecule CCCc1c(CCl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | CN1CCC(c2c(CCl)cnn2C)=CC2=CC=C21 | CCCc1c(CCl)cnn1C | CN1CCC(c2c(CCl)cnn2C)=CC2=CC=C21 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CCC2"
} |
Can you make molecule CCCc1c(CCl)cnn1C less soluble in water? The output molecule should be similar to the input molecule. | Cn1ncc(CCl)c1CN1CCc2sccc2C1 | CCCc1c(CCl)cnn1C | Cn1ncc(CCl)c1CN1CCc2sccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCc2sccc2C1",
"old_substring": "CCC2"
} |
Can you make molecule CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)CC(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)CC(C)C)O[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CC(C)C",
"old_substring": "C4(=O)C(C)(C)C"
} |
Can you make molecule CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)CCCC(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)CCCC(C)(C)C)O[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC(C)(C)C",
"old_substring": "C4(=O)C(C)(C)C"
} |
Can you make molecule CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)CCC(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)CCC(C)(C)C)O[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(C)(C)C",
"old_substring": "C4(=O)C(C)(C)C"
} |
Can you make molecule CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc2c(cc1NC(=O)[C@@H](C)N=CC(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)N=CC(C)(C)C)O[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C=&",
"old_substring": "C4(=O)C(C)(C)C"
} |
Can you make molecule CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc2c(cc1NC(=O)[C@@H](C)N=CC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)NC(=O)C(C)(C)C)O[C@H](C)C2 | CCOc1cc2c(cc1NC(=O)[C@@H](C)N=CC(=O)C(C)(C)C)O[C@H](C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)C=&",
"old_substring": "C4(=O)C(C)(C)C"
} |
Can you make molecule CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)c1c(Cl)cc(Br)cc1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1c(Cl)cc(Br)cc1Cl)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Br)cc1Cl",
"old_substring": "c13cccc(Cl)c1Cl"
} |
Can you make molecule CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)c1ccc(Cl)c(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1ccc(Cl)c(Cl)c1Cl)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c13cccc(Cl)c1Cl"
} |
Can you make molecule CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)c1c(Cl)ccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1c(Cl)ccc(Cl)c1Cl)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)ccc(Cl)c1Cl",
"old_substring": "c13cccc(Cl)c1Cl"
} |
Can you make molecule CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)c1c(Cl)cc(Cl)cc1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1c(Cl)cc(Cl)cc1Cl)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(Cl)cc(Cl)cc1Cl",
"old_substring": "c13cccc(Cl)c1Cl"
} |
Can you make molecule CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)c1cc(Cl)cc(Cl)c1Br)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cccc(Cl)c1Cl)[NH+]1CCCC1 | CCC(CC)(C(=O)c1cc(Cl)cc(Cl)c1Br)[NH+]1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc(Cl)c1Br",
"old_substring": "c13cccc(Cl)c1Cl"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c(OC)cc1I | COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c(OC)cc1Cl | COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc(I)c1OC | COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1cc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc(I)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(OC)c(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c1 | COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1cc(Br)c(OC)c(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1ccc(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | COc1cc(Br)c(-c2cc(C(=O)NCC(F)(F)F)c3ccccc3n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCSCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCSCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S57"
} |
Can you make molecule CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN1CCSc2ccc(-c3nc(COc4ccc(Cl)cc4)n[nH]3)cc21 | CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCN1CCSc2ccc(-c3nc(COc4ccc(Cl)cc4)n[nH]3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S57"
} |
Can you make molecule CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[S@@+]([O-])C(Cl)(Cl)c1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCC[S@@+]([O-])C(Cl)(Cl)c1nc(COc2ccc(Cl)cc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S57"
} |
Can you make molecule CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCS/C(Cl)=C(\C#N)Nc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCS/C(Cl)=C(\C#N)Nc1nc(COc2ccc(Cl)cc2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S57"
} |
Can you make molecule CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1c(=S)n(-c2nc(COc3ccc(Cl)cc3)n[nH]2)c2ccccc21 | CCCSc1nc(COc2ccc(Cl)cc2)n[nH]1 | CCCn1c(=S)n(-c2nc(COc3ccc(Cl)cc3)n[nH]2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S57"
} |
Can you make molecule COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COCc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COCSc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | CC(=O)Sc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | O=C(CS)c1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | COc1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | O=C(CI)c1cccc(Nc2nc(-c3ccc4c(c3)OCO4)cs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCCS3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCCS3)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CCCCC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CCCCC3)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCCCS3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCCCS3)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCSCS3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3SCSCS3)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CCCCCC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CC3)n2)C1=O | CCCC[C@@H]1NC(=O)N(Cc2noc(C3CCCCCC3)n2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COSC(=O)Cc2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COSC(=O)Cc2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CCCC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CCCC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CC(C)(C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CC(C)(C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COC(=O)CCC(C)(C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)CCC(C)(C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)COSC(=O)[C@@H](C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | Cc1cc(C(=O)COSC(=O)[C@@H](C)c2cc3c(cc2[N+](=O)[O-])OCO3)c(C)n1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1S(=O)(=O)N1CCSC12CCN(C(=O)NCCN1CCOCC1)CC2 | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)N1CCSC12CCN(C(=O)NCCN1CCOCC1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC12CCN&CC2",
"old_substring": "N17CCC8CC1"
} |
Can you make molecule COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1S(=O)(=O)N1CCCc2cc(C(=O)NCCN3CCOCC3)ccc2C1 | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)N1CCCc2cc(C(=O)NCCN3CCOCC3)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N17CCC8CC1"
} |
Can you make molecule COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1S(=O)(=O)C1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)C1CCC(C(=O)NCCN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N17CCC8CC1"
} |
Can you make molecule COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1S(=O)(=O)CCCCCC(=O)NCCN1CCOCC1 | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)CCCCCC(=O)NCCN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N17CCC8CC1"
} |
Can you make molecule COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1S(=O)(=O)C1(C#N)CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)N1CCC(C(=O)NCCN2CCOCC2)CC1 | COc1ccc(F)cc1S(=O)(=O)C1(C#N)CCC(C(=O)NCCN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "N17CCC8CC1"
} |
Can you make molecule C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)[O-])[NH+]1CCN(SC(=O)Cc2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(SC(=O)Cc2ccc(C[NH3+])o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CCCC(=O)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CCCC(=O)c2ccc(C[NH3+])o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CC(C)(C)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CC(C)(C)c2ccc(C[NH3+])o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CCC(C)(C)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)CCC(C)(C)c2ccc(C[NH3+])o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN1CC[NH+]([C@@H](C)C(=O)[O-])CC1)c1ccc(C[NH3+])o1 | C[C@@H](C(=O)[O-])[NH+]1CCN(C(=O)c2ccc(C[NH3+])o2)CC1 | C[C@H](C(=O)SN1CC[NH+]([C@@H](C)C(=O)[O-])CC1)c1ccc(C[NH3+])o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)c1ccc(C[NH+](C)Cc2ccsc2)c([N+](=O)[O-])c1 | C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] | CC(=O)c1ccc(C[NH+](C)Cc2ccsc2)c([N+](=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1ccsc1)Cc1ccc(CCCCC(N)=O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(CCCCC(N)=O)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1ccsc1)Cc1ccc(CC/C(N)=N/O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(CC/C(N)=N/O)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1ccsc1)Cc1ccc(CC/C(N)=N\O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(CC/C(N)=N\O)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](Cc1ccsc1)Cc1ccc(CC(N)=S)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(C(N)=O)cc1[N+](=O)[O-] | C[NH+](Cc1ccsc1)Cc1ccc(CC(N)=S)cc1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(N)=S",
"old_substring": "C4(N)=O"
} |
Can you make molecule Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COC(=O)c3ccc(Cl)c(OCC(F)(F)F)c3F)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3ccc(Cl)c(OCC(F)(F)F)c3F)cc(=O)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c&c1F",
"old_substring": "c18cnc7c(Cl)c1"
} |
Can you make molecule Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COC(=O)c3cc(OCC(F)(F)F)c(Cl)cc3Cl)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cc(OCC(F)(F)F)c(Cl)cc3Cl)cc(=O)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c(Cl)cc1Cl",
"old_substring": "c18cnc7c(Cl)c1"
} |
Can you make molecule Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COC(=O)c3ccc(Cl)c(OCC(F)(F)F)c3Cl)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3ccc(Cl)c(OCC(F)(F)F)c3Cl)cc(=O)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c&c1Cl",
"old_substring": "c18cnc7c(Cl)c1"
} |
Can you make molecule Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COC(=O)n3cc(OCC(F)(F)F)cc(Cl)c3=O)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)n3cc(OCC(F)(F)F)cc(Cl)c3=O)cc(=O)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc(Cl)c1=O",
"old_substring": "c18cnc7c(Cl)c1"
} |
Can you make molecule Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2nc(COC(=O)n3cc(OCC(F)(F)F)cc(Cl)c3=S)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)c3cnc(OCC(F)(F)F)c(Cl)c3)cc(=O)n2c1 | Cc1ccc2nc(COC(=O)n3cc(OCC(F)(F)F)cc(Cl)c3=S)cc(=O)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc&cc(Cl)c1=S",
"old_substring": "c18cnc7c(Cl)c1"
} |
Can you make molecule Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CCCCN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CCCCCN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CCCCCN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C2CC(N3CCCN(Cc4cc(C)ccc4C)S3(=O)=O)C2)c1 | Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(C2CC(N3CCCN(Cc4cc(C)ccc4C)S3(=O)=O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(SC(=S)ON2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(SC(=S)ON2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(NC(=S)SN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(CN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | Cc1cccc(NC(=S)SN2CCCN(Cc3cc(C)ccc3C)S2(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C46"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | C=CCC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCl)C1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCS)C1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCS)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCBr)C1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCBr)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCF)C1 | CC[C@H]1C[C@H](C)CC[C@@H]1[NH2+]CCCN1CCCC1=O | C[C@@H]1CC[C@H]([NH2+]CCCN2CCCC2=O)[C@@H](CCCCF)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC5"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(I)o1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(I)o1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(Br)o1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(Br)o1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(Cl)o1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccc(Cl)o1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1occc1Br)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1occc1Br)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c18ccco1"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1sccc1C)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1ccco1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(CC[NH+](C)C)Cc1sccc1C)C2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c18ccco1"
} |
Can you make molecule CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)NC(=O)[C@@H](C)[C@@H](C)C[C@@H](O)Cc1ccc(O)cn1 | CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 | CCC(C)(C)NC(=O)[C@@H](C)[C@@H](C)C[C@@H](O)Cc1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](O)C[C@@H]&C",
"old_substring": "C6[C@H](C)[NH3+]"
} |
Can you make molecule CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)NC(=O)[C@@H](C)[C@H](O)C[C@H](C)c1ccc(O)cn1 | CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 | CCC(C)(C)NC(=O)[C@@H](C)[C@H](O)C[C@H](C)c1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C[C@H]&O",
"old_substring": "C6[C@H](C)[NH3+]"
} |
Can you make molecule CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)NC(=O)[C@@H](C)C[C@@H](C)[C@H](C)c1ccc(O)cn1 | CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 | CCC(C)(C)NC(=O)[C@@H](C)C[C@@H](C)[C@H](C)c1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C6[C@H](C)[NH3+]"
} |
Can you make molecule CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)NC(=O)[C@@H](C)CC[C@H](Cl)Cc1ccc(O)cn1 | CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 | CCC(C)(C)NC(=O)[C@@H](C)CC[C@H](Cl)Cc1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C6[C@H](C)[NH3+]"
} |
Can you make molecule CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(C)NC(=O)[C@@H](C)C[C@@H](CO)Cc1ccc(O)cn1 | CCC(C)(C)NC(=O)[C@@H](C)Oc1ccc(C[C@H](C)[NH3+])nc1 | CCC(C)(C)NC(=O)[C@@H](C)C[C@@H](CO)Cc1ccc(O)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](C&)CO",
"old_substring": "C6[C@H](C)[NH3+]"
} |
Can you make molecule COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)ccc1NC(=O)N[C@H]1CCCC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CCCC[C@H]([NH+](C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]16CC[C@H]7C1"
} |
Can you make molecule COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)ccc1NC(=O)N[C@H]1CCC[C@H]([NH+](C)C)CC1 | COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CCC[C@H]([NH+](C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]16CC[C@H]7C1"
} |
Can you make molecule COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)ccc1NC(=O)N[C@@H](CBr)CCC[NH+](C)C | COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@@H](CBr)CCC[NH+](C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]16CC[C@H]7C1"
} |
Can you make molecule COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)ccc1NC(=O)N[C@H]1CCc2sc([NH+](C)C)cc2C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CCc2sc([NH+](C)C)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2sc&cc2C1",
"old_substring": "[C@H]16CC[C@H]7C1"
} |
Can you make molecule COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C)ccc1NC(=O)N[C@H]1CCc2c([NH+](C)C)csc2C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CC[C@H]([NH+](C)C)C1 | COc1cc(C)ccc1NC(=O)N[C@H]1CCc2c([NH+](C)C)csc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2c&csc2C1",
"old_substring": "[C@H]16CC[C@H]7C1"
} |
Can you make molecule CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CS[NH2+]CCc1c[nH]c2c(Cl)cccc12 | CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | C=CS[NH2+]CCc1c[nH]c2c(Cl)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | C=CCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | ClCCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | ClCCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | SCCCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | SCCCC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 less soluble in water? The output molecule should be similar to the input molecule. | Clc1cccc2c(CC[NH2+]CCCBr)c[nH]c12 | CC[NH2+]CCc1c[nH]c2c(Cl)cccc12 | Clc1cccc2c(CC[NH2+]CCCBr)c[nH]c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)c(Br)s1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)c(Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(Br)s1",
"old_substring": "c17cc(Br)cs1"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1I | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c17cc(Br)cs1"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C(=O)NCc1scc(Br)c1Br | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1scc(Br)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc(Br)c1Br",
"old_substring": "c17cc(Br)cs1"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1Cl | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c17cc(Br)cs1"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1Br | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)cs1 | COc1ccc(F)cc1NC(=O)C(=O)NCc1cc(Br)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Br",
"old_substring": "c17cc(Br)cs1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.