prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NSC(=O)C[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NSC(=O)C[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NCC(=C=O)C[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NCC(=C=O)C[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=O)CCCC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)CCCC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC(=O)CC(C)(C)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)CC(C)(C)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(NC[S@+]([O-])CCC[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | Cc1ccc(C)c(NC[S@+]([O-])CCC[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C58=O"
} |
Can you make molecule CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C2(c3ccc(Cl)cc3)CCOCC2)co1 | CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1nc(C2(c3ccc(Cl)cc3)CCOCC2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c14nnc5o1"
} |
Can you make molecule CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C2(c3ccc(Cl)cc3)CCOCC2)c(=S)o1 | CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1nn(C2(c3ccc(Cl)cc3)CCOCC2)c(=S)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)o1",
"old_substring": "c14nnc5o1"
} |
Can you make molecule CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(C2(c3ccc(Cl)cc3)CCOCC2)on1 | CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1cc(C2(c3ccc(Cl)cc3)CCOCC2)on1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&on1",
"old_substring": "c14nnc5o1"
} |
Can you make molecule CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc(C)c(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1nc(C)c(C2(c3ccc(Cl)cc3)CCOCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&o1",
"old_substring": "c14nnc5o1"
} |
Can you make molecule CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C2(c3ccc(Cl)cc3)CCOCC2)c(=S)s1 | CCc1nnc(C2(c3ccc(Cl)cc3)CCOCC2)o1 | CCc1nn(C2(c3ccc(Cl)cc3)CCOCC2)c(=S)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn&c(=S)s1",
"old_substring": "c14nnc5o1"
} |
Can you make molecule C/C=N/NC(=O)COc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/NC(=O)COc1ccc(C)c(Cl)c1 | C/C=N/NC(=O)COc1ccccc1C | C/C=N/NC(=O)COc1ccc(C)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "c13ccccc1C"
} |
Can you make molecule C/C=N/NC(=O)COc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/NC(=O)COc1ccc(Br)cc1C | C/C=N/NC(=O)COc1ccccc1C | C/C=N/NC(=O)COc1ccc(Br)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1C",
"old_substring": "c13ccccc1C"
} |
Can you make molecule C/C=N/NC(=O)COc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/NC(=O)COc1cccc(Br)c1C | C/C=N/NC(=O)COc1ccccc1C | C/C=N/NC(=O)COc1cccc(Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c13ccccc1C"
} |
Can you make molecule C/C=N/NC(=O)COc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/NC(=O)COc1ccc(F)cc1Cl | C/C=N/NC(=O)COc1ccccc1C | C/C=N/NC(=O)COc1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c13ccccc1C"
} |
Can you make molecule C/C=N/NC(=O)COc1ccccc1C less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/NC(=O)COc1cc(F)ccc1Cl | C/C=N/NC(=O)COc1ccccc1C | C/C=N/NC(=O)COc1cc(F)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Cl",
"old_substring": "c13ccccc1C"
} |
Can you make molecule Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cl)c(Cl)cc1C1=C(C[C@@H]2CCCC[C@H]2O)CN2CCC2=NO1 | Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1C1=C(C[C@@H]2CCCC[C@H]2O)CN2CCC2=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cl)c(Cl)cc1C1=NN2CCCN2C(C[C@@H]2CCCC[C@H]2O)=C1 | Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1C1=NN2CCCN2C(C[C@@H]2CCCC[C@H]2O)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cl)c(Cl)cc1C1=CC=C(C[C@@H]2CCCC[C@H]2O)N2CCC2=C1 | Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1C1=CC=C(C[C@@H]2CCCC[C@H]2O)N2CCC2=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cl)c(Cl)cc1-c1snc2sc-2c(N)c1C[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1-c1snc2sc-2c(N)c1C[C@@H]1CCCC[C@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cl)c(Cl)cc1C1=CN=C(C[C@@H]2CCCC[C@H]2O)CN2CCN12 | Nc1cc(Cl)c(Cl)cc1NC[C@@H]1CCCC[C@H]1O | Nc1cc(Cl)c(Cl)cc1C1=CN=C(C[C@@H]2CCCC[C@H]2O)CN2CCN12 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2c&cnc2C1",
"old_substring": "N23"
} |
Can you make molecule N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(CCCCNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CCCCNc2cc[nH+]c3ccsc23)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C46"
} |
Can you make molecule N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(CCC=Nc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CCC=Nc2cc[nH+]c3ccsc23)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C46"
} |
Can you make molecule N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(CCCCCNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CCCCCNc2cc[nH+]c3ccsc23)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C46"
} |
Can you make molecule N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(C2CC(Nc3cc[nH+]c4ccsc34)C2)c(F)c1 | N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(C2CC(Nc3cc[nH+]c4ccsc34)C2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C46"
} |
Can you make molecule N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(SC(=S)ONc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(CNc2cc[nH+]c3ccsc23)c(F)c1 | N#Cc1ccc(SC(=S)ONc2cc[nH+]c3ccsc23)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C46"
} |
Can you make molecule N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccccc1NSC(=O)C[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NSC(=O)C[C@H]1C[C@@H]1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccccc1NCC(=C=O)C[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NCC(=C=O)C[C@H]1C[C@@H]1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccccc1NC(=O)CCCC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)CCCC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccccc1C#N)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | CC(C)(CC(=O)Nc1ccccc1C#N)[C@H]1C[C@@H]1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccccc1NC[S@+]([O-])CCC[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC(=O)[C@H]1C[C@@H]1[N+](=O)[O-] | N#Cc1ccccc1NC[S@+]([O-])CCC[C@H]1C[C@@H]1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C24=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NSC(=O)Cc1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NSC(=O)Cc1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CCCC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)CCCC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CC(C)(C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)CC(C)(C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CCC(C)(C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)CCC(C)(C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NSC(=O)[C@@H](C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NC(=O)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | CC[C@@H](NSC(=O)[C@@H](C)c1ccc([N+](=O)[O-])c(C)c1)c1ccc2c(c1)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCOC(=O)C1(C#N)CC(OC)(OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(O)ccc(C(=O)C2(C#N)CC(OC)(OC)C2)c2noc1-2 | CCOC(=O)C1(C#N)CC(OC)(OC)C1 | CCc1c(O)ccc(C(=O)C2(C#N)CC(OC)(OC)C2)c2noc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1(C#N)CC(OC)(OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2c(c1)CN(C(=O)C1(C#N)CC(OC)(OC)C1)CCO2 | CCOC(=O)C1(C#N)CC(OC)(OC)C1 | CCc1ccc2c(c1)CN(C(=O)C1(C#N)CC(OC)(OC)C1)CCO2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1(C#N)CC(OC)(OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cnc2ccc-2cc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | CCOC(=O)C1(C#N)CC(OC)(OC)C1 | CCn1cnc2ccc-2cc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1(C#N)CC(OC)(OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc-2ccc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | CCOC(=O)C1(C#N)CC(OC)(OC)C1 | CCn1ccc2nc-2ccc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCOC(=O)C1(C#N)CC(OC)(OC)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCn1ccc2nc-2ncc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | CCOC(=O)C1(C#N)CC(OC)(OC)C1 | CCn1ccc2nc-2ncc(C(=O)C2(C#N)CC(OC)(OC)C2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H]1CCC[C@@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 | CC(=O)N[C@@H]1CCC[C@@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "[C@@H]46CC3=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H]1CC[C@@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 | CC(=O)N[C@H]1CC[C@@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "[C@@H]46CC3=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@@H](CCCc1cccs1)C(C)(C)N[C@@H](C)c1ccc(Cl)cc1Cl | CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 | CC(=O)N[C@@H](CCCc1cccs1)C(C)(C)N[C@@H](C)c1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@@H]46CC3=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)N[C@H]1CC[C@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 | CC(=O)N[C@H]1CC[C@](N[C@@H](C)c2ccc(Cl)cc2Cl)(c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "[C@@H]46CC3=O"
} |
Can you make molecule CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1[nH]c(-c2cccs2)c(C)c1N[C@@H](C)c1ccc(Cl)cc1Cl | CC(=O)N[C@@H](CC(=O)N[C@@H](C)c1ccc(Cl)cc1Cl)c1cccs1 | CC(=O)Nc1[nH]c(-c2cccs2)c(C)c1N[C@@H](C)c1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH]c&c(C)c1&",
"old_substring": "[C@@H]46CC3=O"
} |
Can you make molecule COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)Cc1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COSC(=O)Cc1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCCC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)CCCC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CC(C)(C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)CC(C)(C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)CCC(C)(C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)CCC(C)(C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | COSC(=O)[C@@H](C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COC(=O)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | COSC(=O)[C@@H](C)c1cc(-c2ccc(F)cc2)nc2cc(-c3ccccc3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C45=O"
} |
Can you make molecule CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN=C=S)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | O=C(CN=C=S)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1)C1N=N1 | CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | O=C(c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1)C1N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&N=N1",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/OC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | C/C=N/OC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCN=C=S)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | O=C(CCCN=C=S)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCN=C=S",
"old_substring": "CN3"
} |
Can you make molecule CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1CCSCC1)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | CNC(=O)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | O=C(CN1CCSCC1)c1cccc(S(=O)(=O)NC[C@@H]2CCCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCSCC1",
"old_substring": "CN3"
} |
Can you make molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCC1CCCC1)CC(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@H](CCC1CCCC1)CC(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@H](C8)C3=O"
} |
Can you make molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCC1CCCC1)CC(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@@H](CCC1CCCC1)CC(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@H](C8)C3=O"
} |
Can you make molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)Nc1ccc(C(=O)NC2CCOCC2)cc1)C1CCCC1 | C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@H](CC(C)(C)Nc1ccc(C(=O)NC2CCOCC2)cc1)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@H](C8)C3=O"
} |
Can you make molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCOCC1)c1ccc(NCC[C@H](Cl)CC2CCCC2)cc1 | C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | O=C(NC1CCOCC1)c1ccc(NCC[C@H](Cl)CC2CCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C[C@H](C8)C3=O"
} |
Can you make molecule C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CNc1ccc(C(=O)NC2CCOCC2)cc1)[C@H](C)C1CCCC1 | C[C@H](CC1CCCC1)C(=O)Nc1ccc(C(=O)NC2CCOCC2)cc1 | C[C@H](CNc1ccc(C(=O)NC2CCOCC2)cc1)[C@H](C)C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C[C@H](C8)C3=O"
} |
Can you make molecule O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NCCCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C6"
} |
Can you make molecule O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(N=CCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C4C6"
} |
Can you make molecule O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NCCCCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C6"
} |
Can you make molecule O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CC(c2nc3ccccc3s2)C1)c1cc(C2CC2)[nH]n1 | O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | O=C(NC1CC(c2nc3ccccc3s2)C1)c1cc(C2CC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C6"
} |
Can you make molecule O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCc1nc2ccccc2s1)=NC(=O)c1cc(C2CC2)[nH]n1 | O=C(NCCc1nc2ccccc2s1)c1cc(C2CC2)[nH]n1 | CC(CCc1nc2ccccc2s1)=NC(=O)c1cc(C2CC2)[nH]n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4C6"
} |
Can you make molecule O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccsc1)Nc1cc(N2CCOCC2)ncn1 | O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 | O=C(/C=C/Sc1ccsc1)Nc1cc(N2CCOCC2)ncn1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2cc(N3CCOCC3)ncn2)nc1-c1ccsc1 | O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 | O=Cc1sc(Nc2cc(N3CCOCC3)ncn2)nc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2cc(N3CCOCC3)ncn2)sc1-c1ccsc1 | O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 | O=Cc1nc(Nc2cc(N3CCOCC3)ncn2)sc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(N2CCOCC2)ncn1)n1nc(-c2ccsc2)oc1=S | O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 | O=C(Nc1cc(N2CCOCC2)ncn1)n1nc(-c2ccsc2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONc1cc(N2CCOCC2)ncn1)\c1ccc(-c2ccsc2)o1 | O=C(Nc1cc(N2CCOCC2)ncn1)c1ccsc1 | C(=N/ONc1cc(N2CCOCC2)ncn1)\c1ccc(-c2ccsc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C[NH+]2CCN(CCCCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCCCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CN1CC[NH+](Cc2cn(C)nc2-c2cccc(Cl)c2)CC1 | Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | CC(=O)CN1CC[NH+](Cc2cn(C)nc2-c2cccc(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)=O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)=NON1CC[NH+](Cc2cn(C)nc2-c2cccc(Cl)c2)CC1 | Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | CCC(CC)=NON1CC[NH+](Cc2cn(C)nc2-c2cccc(Cl)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)=NO&",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C[NH+]2CCN(CCCC(N)=S)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCCC(N)=S)CC2)c(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(N)=S",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C[NH+]2CCN(CCCC/C(N)=N/O)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCC(N)=O)CC2)c(-c2cccc(Cl)c2)n1 | Cn1cc(C[NH+]2CCN(CCCC/C(N)=N/O)CC2)c(-c2cccc(Cl)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC/C(N)=N/O",
"old_substring": "C4CC(N)=O"
} |
Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1ccccc1Cl)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=S(=O)(c1ccccc1Cl)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=S&(=O)c1ccccc1Cl",
"old_substring": "O=S4(=O)c1ccccc1"
} |
Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(c1sccc1Br)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=S(=O)(c1sccc1Br)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=S&(=O)c1sccc1Br",
"old_substring": "O=S4(=O)c1ccccc1"
} |
Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N/ON1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1)c1ccccc1 | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | C/C(=N/ON1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(/C)c1ccccc1",
"old_substring": "O=S4(=O)c1ccccc1"
} |
Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(N2C[C@H]3c4ccccc4CC[NH+]3[C@H]2c2ccccc2)c(Cl)c1 | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=Cc1ccc(N2C[C@H]3c4ccccc4CC[NH+]3[C@H]2c2ccccc2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1ccc&c(Cl)c1",
"old_substring": "O=S4(=O)c1ccccc1"
} |
Can you make molecule O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1ccc(Br)cc1N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=S(=O)(c1ccccc1)N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | O=Cc1ccc(Br)cc1N1C[C@H]2c3ccccc3CC[NH+]2[C@H]1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1ccc(Br)cc1&",
"old_substring": "O=S4(=O)c1ccccc1"
} |
Can you make molecule O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C2=CC=CC2=C(Nc2cccc(Cl)c2)CCN1N(Cc1cccnc1)Cc1cccc(F)c1 | O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 | O=C1C2=CC=CC2=C(Nc2cccc(Cl)c2)CCN1N(Cc1cccnc1)Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1c(Nc2cccc(Cl)c2)cc(N(Cc2cccnc2)Cc2cccc(F)c2)ccc2oc1-2 | O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 | O=Cc1c(Nc2cccc(Cl)c2)cc(N(Cc2cccnc2)Cc2cccc(F)c2)ccc2oc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SN(Cc1cccnc1)Cc1cccc(F)c1)Nc1cccc(Cl)c1 | O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 | O=C(/C=C/SN(Cc1cccnc1)Cc1cccc(F)c1)Nc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(CN(Cc2cccnc2)c2ccc(/C=N/ONc3cccc(Cl)c3)o2)c1 | O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 | Fc1cccc(CN(Cc2cccnc2)c2ccc(/C=N/ONc3cccc(Cl)c3)o2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C23"
} |
Can you make molecule O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(N(Cc2cccnc2)Cc2cccc(F)c2)CC1)Nc1cccc(Cl)c1 | O=C(Nc1cccc(Cl)c1)N(Cc1cccnc1)Cc1cccc(F)c1 | O=C(NN=C1CCC(N(Cc2cccnc2)Cc2cccc(F)c2)CC1)Nc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C23"
} |
Can you make molecule Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(C)(C)CC(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(C)(C)CC(=O)OC(C)(C)C)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(C)(C)CCC(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(C)(C)CCC(=O)OC(C)(C)C)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([S@+]([O-])[C@H]2CCCN([C@H](Br)CC(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN([C@H](Br)CC(=O)OC(C)(C)C)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(OOC(C)(C)C)c1ccc(N2CCC[C@H]([S@@+]([O-])c3ccc(C)cn3)C2)cc1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 | C=C(OOC(C)(C)C)c1ccc(N2CCC[C@H]([S@@+]([O-])c3ccc(C)cn3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(O&)c1ccc&cc1",
"old_substring": "C34=O"
} |
Can you make molecule Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(OC(C)(C)C)C(=O)CCN1CCC[C@H]([S@@+]([O-])c2ccc(C)cn2)C1 | Cc1ccc([S@+]([O-])[C@H]2CCCN(C(=O)OC(C)(C)C)C2)nc1 | CCC(CC)(OC(C)(C)C)C(=O)CCN1CCC[C@H]([S@@+]([O-])c2ccc(C)cn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCCCC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCCCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCCCCC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCSC2=CCCCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCSC2=CCCCCC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCC(Cl)CC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCC(Cl)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "ClC1CCC&CC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCCCC2=CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCC2CCCC2)n(C)n1 | Cc1cc(NC(=O)C(=O)N[C@@H](C)CCCCC2=CCCC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCCC1",
"old_substring": "C17CCCC1"
} |
Can you make molecule COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)c(Br)s2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)c(Br)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c(Br)s1",
"old_substring": "c14nc(C)cs1"
} |
Can you make molecule COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[C@H](C[NH3+])Cc2sc(Cl)nc2C)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2sc(Cl)nc2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nc(Cl)sc1&",
"old_substring": "c14nc(C)cs1"
} |
Can you make molecule COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[C@H](C[NH3+])Cc2nc(Cl)c3ccsc3n2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(Cl)c3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(Cl)c2ccsc2n1",
"old_substring": "c14nc(C)cs1"
} |
Can you make molecule COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[C@H](C[NH3+])Cc2nc(Cl)nc3ccsc23)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(Cl)nc3ccsc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(Cl)nc2ccsc12",
"old_substring": "c14nc(C)cs1"
} |
Can you make molecule COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C[C@H](C[NH3+])Cc2ncc(Br)s2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2nc(C)cs2)c1 | COc1cccc(C[C@H](C[NH3+])Cc2ncc(Br)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Br)s1",
"old_substring": "c14nc(C)cs1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.