prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](c1ccccc1Cl)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1Cl)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c12ccccc1"
} |
Can you make molecule CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](c1cc2sccc2s1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1cc2sccc2s1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](c1ccc(I)cc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccc(I)cc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c12ccccc1"
} |
Can you make molecule CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](c1csc2ccccc12)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1csc2ccccc12)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c12ccccc1"
} |
Can you make molecule CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](c1ccc(C)c(I)c1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccccc1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | CC[C@@H](c1ccc(C)c(I)c1)[S@@+]([O-])Cc1ccc(C(F)(F)F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c12ccccc1"
} |
Can you make molecule CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)Nc1ccc(NC(=O)CC(C)(C)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)CC(C)(C)Nc2cc(C)on2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)Nc1ccc(NC(=O)CCC(C)(C)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)CCC(C)(C)Nc2cc(C)on2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)Nc1ccc(NC(=O)C[C@@H](Br)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(NC(=O)C[C@@H](Br)Nc2cc(C)on2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C56=O"
} |
Can you make molecule CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)Nc1ccc(Nc2cc(C)n(Nc3cc(C)on3)c(=O)c2)cc1 | CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(Nc2cc(C)n(Nc3cc(C)on3)c(=O)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C56=O"
} |
Can you make molecule CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)Nc1ccc(Nc2c(C)n(Nc3cc(C)on3)ccc2=O)cc1 | CCOC(=O)Nc1ccc(NC(=O)Nc2cc(C)on2)cc1 | CCOC(=O)Nc1ccc(Nc2c(C)n(Nc3cc(C)on3)ccc2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C56=O"
} |
Can you make molecule O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(-c2ccccc2Cl)nc2ccccn12 | O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 | O=[N+]([O-])c1c(-c2ccccc2Cl)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(-c2ccc(I)cc2)nc2ccccn12 | O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 | O=[N+]([O-])c1c(-c2ccc(I)cc2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nc3ccccn3c2[N+](=O)[O-])cc1I | O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 | Cc1ccc(-c2nc3ccccn3c2[N+](=O)[O-])cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(-c2cccc(Br)c2)nc2ccccn12 | O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 | O=[N+]([O-])c1c(-c2cccc(Br)c2)nc2ccccn12 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nc3ccccn3c2[N+](=O)[O-])c1C | O=[N+]([O-])c1c(-c2ccccc2)nc2ccccn12 | Cc1cccc(-c2nc3ccccn3c2[N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c13ccccc1"
} |
Can you make molecule O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | O=C(NCCCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5CC7"
} |
Can you make molecule O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCN1C(=O)NC2(CCCC2)C1=O)=NC(=O)Nc1cccc(CN2CCOC2=O)c1 | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | CC(CCN1C(=O)NC2(CCCC2)C1=O)=NC(=O)Nc1cccc(CN2CCOC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C5CC7"
} |
Can you make molecule O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(CN2CCOC2=O)c1)NC1CCC(N2C(=O)NC3(CCCC3)C2=O)CC1 | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | O=C(Nc1cccc(CN2CCOC2=O)c1)NC1CCC(N2C(=O)NC3(CCCC3)C2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5CC7"
} |
Can you make molecule O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CNC(=O)Nc1cccc(CN2CCOC2=O)c1)CN1C(=O)NC2(CCCC2)C1=O | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | CC(C)(CNC(=O)Nc1cccc(CN2CCOC2=O)c1)CN1C(=O)NC2(CCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C5CC7"
} |
Can you make molecule O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCN1C(=O)NC2(CCCC2)C1=O)NC(=O)Nc1cccc(CN2CCOC2=O)c1 | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)Nc1cccc(CN2CCOC2=O)c1 | CCC[C@@H](CCN1C(=O)NC2(CCCC2)C1=O)NC(=O)Nc1cccc(CN2CCOC2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C5CC7"
} |
Can you make molecule Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc(-c3ccc(F)cc3Cl)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3Cl)cc2C(=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc(-c3ccc(F)cc3Br)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3Br)cc2C(=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc(-c3ccc(F)c(Cl)c3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)c(Cl)c3)cc2C(=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc(-c3ccc(I)cc3F)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(I)cc3F)cc2C(=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-n2nc(-c3cc4c(F)cccc4s3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3ccc(F)cc3)cc2C(=O)[O-])c(C)c1 | Cc1ccc(-n2nc(-c3cc4c(F)cccc4s3)cc2C(=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCC(C)(C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCCCC(=O)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCC[C@@H](C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCC[C@@H](C)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC5"
} |
Can you make molecule CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCCCN(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | CCC(C)(CC)N(C)C(=O)c1cccc(-c2ccc(S(=O)(=O)N3CCOCC3)s2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC5"
} |
Can you make molecule Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCC(CO)=N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | Cc1nc(CCC(CO)=N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cc1csc(C)n1)=N/ON[C@H](c1ccccc1)c1nnc(N)s1 | Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | C/C(Cc1csc(C)n1)=N/ON[C@H](c1ccccc1)c1nnc(N)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN[C@H](c1ccccc1)c1nnc(N)s1)c1csc(C)n1 | Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | CCC(CC)(C(=O)CN[C@H](c1ccccc1)c1nnc(N)s1)c1csc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(SSC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | Cc1nc(SSC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN[C@H](c1ccccc1)c1nnc(N)s1)c1csc(C)n1 | Cc1nc(CC(=O)N[C@H](c2ccccc2)c2nnc(N)s2)cs1 | CCC(CC)(C(=O)CCN[C@H](c1ccccc1)c1nnc(N)s1)c1csc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(N3C[C@@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)OC3=O)c2c1 | COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc(N3C[C@@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)OC3=O)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C(=O)O1",
"old_substring": "[C@@H]79C(=O)[O-]"
} |
Can you make molecule COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(CC3=NO[C@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)N3)c2c1 | COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc(CC3=NO[C@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)N3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NC(C&)=NO1",
"old_substring": "[C@@H]79C(=O)[O-]"
} |
Can you make molecule COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(N3C[C@@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)CCC3=O)c2c1 | COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc(N3C[C@@H]([NH+]4CCN(Cc5cccc6ccccc56)CC4)CCC3=O)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC(=O)N&C1",
"old_substring": "[C@@H]79C(=O)[O-]"
} |
Can you make molecule COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(NC3=NC(=O)S[C@@H]3[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc(NC3=NC(=O)S[C@@H]3[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&SC(=O)N=C1N&",
"old_substring": "[C@@H]79C(=O)[O-]"
} |
Can you make molecule COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(ONC(=O)[C@@H](C)[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc([C@H](C(=O)[O-])[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | COc1ccc2[nH]cc(ONC(=O)[C@@H](C)[NH+]3CCN(Cc4cccc5ccccc45)CC3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&C(=O)NO&",
"old_substring": "[C@@H]79C(=O)[O-]"
} |
Can you make molecule O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=C(/C=C/Sc1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCCCC2)nc1-c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=Cc1sc(N2CCCCC2)nc1-c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCCCC2)sc1-c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=Cc1nc(N2CCCCC2)sc1-c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1nccnc1-c1nn(C(=O)N2CCCCC2)c(=S)o1)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=C(c1nccnc1-c1nn(C(=O)N2CCCCC2)c(=S)o1)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C46"
} |
Can you make molecule O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1nccnc1-c1ccc(/C=N/ON2CCCCC2)o1)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | O=C(c1nccnc1C(=O)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1)N1CCCCC1 | O=C(c1nccnc1-c1ccc(/C=N/ON2CCCCC2)o1)N1C[C@@H]2[C@H]3CC[C@H](C3)[C@@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C46"
} |
Can you make molecule CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(C(C)C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)C(C(C)C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)CC4"
} |
Can you make molecule CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)(CCBr)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC(C)CC4"
} |
Can you make molecule CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CCCC(C)(C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CC(C)CC4"
} |
Can you make molecule CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[C@H](C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC[C@@H]&C",
"old_substring": "CC(C)CC4"
} |
Can you make molecule CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC[C@H](C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CC[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | CC(C)CCC[C@H](C)[NH+]1CCN(Cc2ccc3c(c2)CCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC[C@@H]&C",
"old_substring": "CC(C)CC4"
} |
Can you make molecule C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccc(I)cc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccc(I)cc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccccc1F"
} |
Can you make molecule C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@](C#N)([C@](C)(O)c2cc(I)ccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2cc(I)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c14ccccc1F"
} |
Can you make molecule C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2Cl)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1F"
} |
Can you make molecule C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@](C#N)([C@](C)(O)c2cc(F)ccc2Br)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2cc(F)ccc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c14ccccc1F"
} |
Can you make molecule C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccc(F)cc2Cl)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccccc2F)C1 | C[C@H]1CC[C@](C#N)([C@](C)(O)c2ccc(F)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ccccc1F"
} |
Can you make molecule CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CC(C)(C)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)CC(C)(C)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCC(C)(C)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)CCC(C)(C)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)C[C@@H](Br)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | CN(C(=O)C[C@@H](Br)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(C)c2ccc(F)cc2)cc(=O)n1N[C@@](C)(C(=O)[O-])C(F)(F)F | CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | Cc1cc(N(C)c2ccc(F)cc2)cc(=O)n1N[C@@](C)(C(=O)[O-])C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N(C)c2ccc(F)cc2)c(=O)ccn1N[C@@](C)(C(=O)[O-])C(F)(F)F | CN(C(=O)N[C@@](C)(C(=O)[O-])C(F)(F)F)c1ccc(F)cc1 | Cc1c(N(C)c2ccc(F)cc2)c(=O)ccn1N[C@@](C)(C(=O)[O-])C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1I | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cc(NC(=O)C2CC2)ccc1Br | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cc(NC(=O)C2CC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1Cl | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cccc(NC(=O)C2CC2)c1Br | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cccc(NC(=O)C2CC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cccc(NC(=O)C2CC2)c1Cl | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1ccc(NC(=O)C2CC2)cc1 | CC[S@@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)c1cccc(NC(=O)C2CC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc5cc1"
} |
Can you make molecule Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OSC(=O)Cc2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OSC(=O)Cc2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CCCC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)CCCC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CC(C)(C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)CC(C)(C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OC(=O)CCC(C)(C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)CCC(C)(C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(OSC(=O)[C@@H](C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OC(=O)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | Cc1cc(OSC(=O)[C@@H](C)c2oc3c(c2C)/C(=N/NC(N)=[NH2+])CCC3)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | COCc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | COCSc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(SC(C)=O)c1O | COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(SC(C)=O)c1O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(C(=O)CS)c1O | COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(C(=O)CS)c1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O less soluble in water? The output molecule should be similar to the input molecule. | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(C(=O)CI)c1O | COc1cc(C)cc(C(=O)N2CCC[C@H]2CSC)c1O | CSC[C@@H]1CCCN1C(=O)c1cc(C)cc(C(=O)CI)c1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C1CC1)[NH+](CCC(CO)=Nc1nccs1)C1CC1 | C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 | C[C@@H](C1CC1)[NH+](CCC(CO)=Nc1nccs1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4C2=O"
} |
Can you make molecule C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(C[NH+](C1CC1)[C@@H](C)C1CC1)=N/ONc1nccs1 | C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 | C/C(C[NH+](C1CC1)[C@@H](C)C1CC1)=N/ONc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C2=O"
} |
Can you make molecule C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1nccs1)[NH+](C1CC1)[C@@H](C)C1CC1 | C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 | CCC(CC)(C(=O)CNc1nccs1)[NH+](C1CC1)[C@@H](C)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C2=O"
} |
Can you make molecule C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C1CC1)[NH+](SSC(=O)Nc1nccs1)C1CC1 | C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 | C[C@@H](C1CC1)[NH+](SSC(=O)Nc1nccs1)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C2=O"
} |
Can you make molecule C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1nccs1)[NH+](C1CC1)[C@@H](C)C1CC1 | C[C@@H](C1CC1)[NH+](CC(=O)Nc1nccs1)C1CC1 | CCC(CC)(C(=O)CCNc1nccs1)[NH+](C1CC1)[C@@H](C)C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C2=O"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)c1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc&c1",
"old_substring": "c17coc5n1"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)Nc2ccc(Cl)cc2)coc1NC(=O)c1ccco1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 | Cc1c(C(=O)Nc2ccc(Cl)cc2)coc1NC(=O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc&c1C",
"old_substring": "c17coc5n1"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(NC(=O)c2ccco2)ccc1C(=O)Nc1ccc(Cl)cc1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 | Cc1nc(NC(=O)c2ccco2)ccc1C(=O)Nc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c17coc5n1"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nn1cccc(C(=O)Nc2ccc(Cl)cc2)c1=O)c1ccco1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 | O=C(Nn1cccc(C(=O)Nc2ccc(Cl)cc2)c1=O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccn&c1=O",
"old_substring": "c17coc5n1"
} |
Can you make molecule O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(C(=O)Nc2ccc(Cl)cc2)o1)c1ccco1 | O=C(Nc1ccc(Cl)cc1)c1coc(NC(=O)c2ccco2)n1 | O=C(Nc1ccc(C(=O)Nc2ccc(Cl)cc2)o1)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c17coc5n1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccsc2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2ccc(C(=O)[O-])c(O)c2)sc1C | O=C([O-])c1ccc(-c2ccsc2)cc1O | Cc1cc(-c2ccc(C(=O)[O-])c(O)c2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "c14ccsc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccsc2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2ccc(C(=O)[O-])c(O)c2)c(C)s1 | O=C([O-])c1ccc(-c2ccsc2)cc1O | Cc1cc(-c2ccc(C(=O)[O-])c(O)c2)c(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)sc1C",
"old_substring": "c14ccsc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccsc2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2sccc2Br)cc1O | O=C([O-])c1ccc(-c2ccsc2)cc1O | O=C([O-])c1ccc(-c2sccc2Br)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c14ccsc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccsc2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2cc3sccc3s2)cc1O | O=C([O-])c1ccc(-c2ccsc2)cc1O | O=C([O-])c1ccc(-c2cc3sccc3s2)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccc2s1",
"old_substring": "c14ccsc1"
} |
Can you make molecule O=C([O-])c1ccc(-c2ccsc2)cc1O less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccc(-c2cc(Cl)sc2Cl)cc1O | O=C([O-])c1ccc(-c2ccsc2)cc1O | O=C([O-])c1ccc(-c2cc(Cl)sc2Cl)cc1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)sc1Cl",
"old_substring": "c14ccsc1"
} |
Can you make molecule OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(F)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | O=C(F)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&F",
"old_substring": "OC5"
} |
Can you make molecule OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | ClCOc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | ClCOc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&CCl",
"old_substring": "OC5"
} |
Can you make molecule OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cl)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | O=C(Cl)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&Cl",
"old_substring": "OC5"
} |
Can you make molecule OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CF)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | O=C(CF)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CF",
"old_substring": "OC5"
} |
Can you make molecule OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCl)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | OCc1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | O=C(CCCl)c1ccc(C[NH+]2CCC[C@H]2CC2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCl",
"old_substring": "OC5"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NC(=O)c2ccc(Oc3c(Cl)cccc3Cl)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3c(Cl)cccc3Cl)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NC(=O)c2ccc(Oc3cc(C)c(Cl)c(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cc(C)c(Cl)c(C)c3)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NC(=O)c2ccc(Oc3cc4cc(Cl)ccc4o3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cc4cc(Cl)ccc4o3)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2o1",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NC(=O)c2ccc(Oc3cccc(/C=C/Br)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(/C=C/Br)c3)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c16cccc(C)c1"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nnc(NC(=O)c2ccc(Oc3ccc4sc(Cl)nc4c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3cccc(C)c3)cc2)s1 | CCc1nnc(NC(=O)c2ccc(Oc3ccc4sc(Cl)nc4c3)cc2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sc(Cl)nc2c1",
"old_substring": "c16cccc(C)c1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.