prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1Cl | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccc(I)cc1 | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H](C)CC(=O)Nc2c(F)cccc2Br)cc1I | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 | Cc1ccc([C@H](C)CC(=O)Nc2c(F)cccc2Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1cccc(Br)c1 | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](C)CC(=O)Nc2c(F)cccc2Br)c1C | C[C@H](CC(=O)Nc1c(F)cccc1Br)c1ccccc1 | Cc1cccc([C@H](C)CC(=O)Nc2c(F)cccc2Br)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C(=Cc1ccc(Cl)cc1)NSC(=O)Cc1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NSC(=O)Cc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C34=O"
} |
Can you make molecule CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CCCC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CCCC(=O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C34=O"
} |
Can you make molecule CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CC(C)(C)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CC(C)(C)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CCC(C)(C)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)CCC(C)(C)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)C(=Cc1ccc(Cl)cc1)NSC(=O)[C@@H](C)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NC(=O)c1ccco1 | CNC(=O)C(=Cc1ccc(Cl)cc1)NSC(=O)[C@@H](C)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C34=O"
} |
Can you make molecule C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCNCC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCNCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&CC1",
"old_substring": "N13CC[NH2+]CC1"
} |
Can you make molecule C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCOCC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@H]&C1",
"old_substring": "N13CC[NH2+]CC1"
} |
Can you make molecule C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCCC1=O | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC1=O",
"old_substring": "N13CC[NH2+]CC1"
} |
Can you make molecule C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCOCC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@@H]&C1",
"old_substring": "N13CC[NH2+]CC1"
} |
Can you make molecule C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCSCC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CC[NH2+]CC1 | C[C@@H](c1nc([C@H]2CSCCO2)no1)N1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N13CC[NH2+]CC1"
} |
Can you make molecule CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCc1ccsc1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1ccsc1)C(=O)Nc1cncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccsc1",
"old_substring": "c18nccs1"
} |
Can you make molecule CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCc1cnc(Br)s1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1cnc(Br)s1)C(=O)Nc1cncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1ncc&s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCc1ncc(Cl)s1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1ncc(Cl)s1)C(=O)Nc1cncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCc1ncc(Br)s1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1ncc(Br)s1)C(=O)Nc1cncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Br)s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CCc1scnc1Cl)C(=O)Nc1cncc2ccccc12 | CCN(CCc1nccs1)C(=O)Nc1cncc2ccccc12 | CCN(CCc1scnc1Cl)C(=O)Nc1cncc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scnc1Cl",
"old_substring": "c18nccs1"
} |
Can you make molecule C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=C[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | C[NH+]1CCC(=C[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC=&CC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NOC[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | C[NH+]1CCC(=NOC[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | C[N+](C)(C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)N1CCC(C(=O)N2CCCSC[C@@H]2CC[NH+]2CCCSCC2)CC1 | C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | CS(=O)(=O)N1CCC(C(=O)N2CCCSC[C@@H]2CC[NH+]2CCCSCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC(C[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | C[NH+](C)C[C@H]1CSCCCN1C(=O)C1CCN(S(C)(=O)=O)CC1 | C[N+]1(C)CCC(C[C@H]2CSCCCN2C(=O)C2CCN(S(C)(=O)=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]3C"
} |
Can you make molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | S=C(OCc1coc(-c2cccs2)n1)Sc1cccnc1Cl | Clc1ncccc1OCc1coc(-c2cccs2)n1 | S=C(OCc1coc(-c2cccs2)n1)Sc1cccnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1cccnc1Cl)OCc1coc(-c2cccs2)n1 | Clc1ncccc1OCc1coc(-c2cccs2)n1 | N=C(Cc1cccnc1Cl)OCc1coc(-c2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1cccnc1Cl)Cc1coc(-c2cccs2)n1 | Clc1ncccc1OCc1coc(-c2cccs2)n1 | O=C(CCC(=O)c1cccnc1Cl)Cc1coc(-c2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cccnc1Cl)Cc1coc(-c2cccs2)n1 | Clc1ncccc1OCc1coc(-c2cccs2)n1 | O=C(/C=C/Sc1cccnc1Cl)Cc1coc(-c2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule Clc1ncccc1OCc1coc(-c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H](CCCc1cccnc1Cl)Cc1coc(-c2cccs2)n1 | Clc1ncccc1OCc1coc(-c2cccs2)n1 | O[C@H](CCCc1cccnc1Cl)Cc1coc(-c2cccs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O34"
} |
Can you make molecule O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(OCC2CC2)nc1)NCc1noc(-c2ccco2)n1 | O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 | O=C(/C=C/Sc1ccc(OCC2CC2)nc1)NCc1noc(-c2ccco2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2noc(-c3ccco3)n2)nc1-c1ccc(OCC2CC2)nc1 | O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 | O=Cc1sc(NCc2noc(-c3ccco3)n2)nc1-c1ccc(OCC2CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2noc(-c3ccco3)n2)sc1-c1ccc(OCC2CC2)nc1 | O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 | O=Cc1nc(NCc2noc(-c3ccco3)n2)sc1-c1ccc(OCC2CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1noc(-c2ccco2)n1)n1nc(-c2ccc(OCC3CC3)nc2)oc1=S | O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 | O=C(NCc1noc(-c2ccco2)n1)n1nc(-c2ccc(OCC3CC3)nc2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C37"
} |
Can you make molecule O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONCc1noc(-c2ccco2)n1)\c1ccc(-c2ccc(OCC3CC3)nc2)o1 | O=C(NCc1noc(-c2ccco2)n1)c1ccc(OCC2CC2)nc1 | C(=N/ONCc1noc(-c2ccco2)n1)\c1ccc(-c2ccc(OCC3CC3)nc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C37"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2Cl)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2Cl)C(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccc(I)cc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccc(I)cc2)C(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccc(C)c(I)c2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccc(C)c(I)c2)C(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc(C[NH2+][C@@H](c2cccc(Br)c2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2cccc(Br)c2)C(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)Cc1nc(C[NH2+][C@@H](c2cccc(C)c2C)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2ccccc2)C(C)C)cs1 | CNC(=O)Cc1nc(C[NH2+][C@@H](c2cccc(C)c2C)C(C)C)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2Cl)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccc(I)cc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccc(I)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccc(C)c(I)c2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccc(C)c(I)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2cccc(Br)c2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2cccc(C)c2C)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccccc2)cc1 | COC(=O)c1ccc(NC(=O)C(=Cc2ccccc2)NC(=O)c2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule O=C(c1ccncc1C#CCCO)N1CCCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccncc1C#CCCO)N1CCCCC1 | O=C(c1ccncc1C#CCCO)N1CCCOCC1 | O=C(c1ccncc1C#CCCO)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N12CCCOCC1"
} |
Can you make molecule O=C(c1ccncc1C#CCCO)N1CCCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccncc1C#CCCO)N1CCCCCC1 | O=C(c1ccncc1C#CCCO)N1CCCOCC1 | O=C(c1ccncc1C#CCCO)N1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N12CCCOCC1"
} |
Can you make molecule O=C(c1ccncc1C#CCCO)N1CCCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccncc1C#CCCO)N1CCCSCC1 | O=C(c1ccncc1C#CCCO)N1CCCOCC1 | O=C(c1ccncc1C#CCCO)N1CCCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCSCC1",
"old_substring": "N12CCCOCC1"
} |
Can you make molecule O=C(c1ccncc1C#CCCO)N1CCCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccncc1C#CCCO)N1CC=CCC1 | O=C(c1ccncc1C#CCCO)N1CCCOCC1 | O=C(c1ccncc1C#CCCO)N1CC=CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CCC1",
"old_substring": "N12CCCOCC1"
} |
Can you make molecule O=C(c1ccncc1C#CCCO)N1CCCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccncc1C#CCCO)N1CCCCCCC1 | O=C(c1ccncc1C#CCCO)N1CCCOCC1 | O=C(c1ccncc1C#CCCO)N1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N12CCCOCC1"
} |
Can you make molecule CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCC(C)C)CC(=O)N12 | CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCC(C)C)CC(=O)N12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCCCBr)CC(=O)N12 | CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCCCBr)CC(=O)N12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC6"
} |
Can you make molecule CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | C=CCCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC6"
} |
Can you make molecule CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCCCCl)CC(=O)N12 | CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | COc1ccccc1[C@@H]1[C@H]2[NH+]=c3ccccc3=C2C[C@H]2C(=O)N(CCCCCl)CC(=O)N12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC6"
} |
Can you make molecule CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | CCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | C=CCCCCN1CC(=O)N2[C@H](c3ccccc3OC)[C@H]3[NH+]=c4ccccc4=C3C[C@H]2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC6"
} |
Can you make molecule COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COCc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COCSc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1SC(C)=O)Cc1cc(=O)[nH]nc1-2 | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COc1cc2c(cc1SC(C)=O)Cc1cc(=O)[nH]nc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1C(=O)CS)Cc1cc(=O)[nH]nc1-2 | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COc1cc2c(cc1C(=O)CS)Cc1cc(=O)[nH]nc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc2c(cc1C(=O)CI)Cc1cc(=O)[nH]nc1-2 | COc1cc2c(cc1OC)-c1n[nH]c(=O)cc1C2 | COc1cc2c(cc1C(=O)CI)Cc1cc(=O)[nH]nc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1C(=O)NNC(=O)C[C@H](O)c2cc1cc(F)ccc(-c1ccccc1)s2 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 | CC[C@@H]1C(=O)NNC(=O)C[C@H](O)c2cc1cc(F)ccc(-c1ccccc1)s2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(Br)c1C)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(Br)c1C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H]1C(=O)NNC(=O)C[C@H](O)c2oc1ccc(F)cc(-c1ccccc1)c2C | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 | CC[C@@H]1C(=O)NNC(=O)C[C@H](O)c2oc1ccc(F)cc(-c1ccccc1)c2C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cc(F)ccc1Br)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cc(F)ccc1Br)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1ccc(F)cc1Cl)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1cccc(F)c1)c1ccccc1 | CC[C@H](C(=O)NNC(=O)C[C@H](O)c1ccc(F)cc1Cl)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCCCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCSCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCSCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CC=CC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CC=CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)C1(C(=O)N2CCCC[C@H]2CSSN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CN2CCOCC2)CC1 | COC(=O)C1(C(=O)N2CCCC[C@H]2CSSN2CCOCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccc(N2CCCC2)cc1I | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccc(N2CCCC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccccc17"
} |
Can you make molecule O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cc(N2CCCC2)ccc1Br | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cc(N2CCCC2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccccc17"
} |
Can you make molecule O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccc(N2CCCC2)cc1Cl | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccc(N2CCCC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccccc17"
} |
Can you make molecule O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc(N2CCCC2)c1Br | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc(N2CCCC2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccccc17"
} |
Can you make molecule O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc(N2CCCC2)c1Cl | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1ccccc1N1CCCC1 | O=C(CNC(=O)c1ccc2c(c1)OCO2)Nc1cccc(N2CCCC2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccccc17"
} |
Can you make molecule COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | COCSC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | CC(=O)SC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | CON(C)CCCC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | CC(=O)CCCC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc(NCc2ccc(C(=O)C(=O)CCBr)[nH]2)n1 | COC(=O)c1ccc(CNc2ccn(C)n2)[nH]1 | Cn1ccc(NCc2ccc(C(=O)C(=O)CCBr)[nH]2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Can you make molecule CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C1=C(N=Cc2cccc(OC(=O)c3ccco3)c2)CCS1 | CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)C1=C(N=Cc2cccc(OC(=O)c3ccco3)c2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C3(=O)C=8C#N"
} |
Can you make molecule CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)C(N=Cc1cccc(OC(=O)c2ccco2)c1)=C(Cl)Cl | CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)C(N=Cc1cccc(OC(=O)c2ccco2)c1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "C3(=O)C=8C#N"
} |
Can you make molecule CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)C=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 | CCOSC(=O)C=Cc1cccc(OC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C=8C#N"
} |
Can you make molecule CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCC=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC[S@+]([O-])CCC=Cc1cccc(OC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C=8C#N"
} |
Can you make molecule CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)[C@H](C)CC=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)C(C#N)=Cc1cccc(OC(=O)c2ccco2)c1 | CCOC(=O)[C@H](C)CC=Cc1cccc(OC(=O)c2ccco2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "C3(=O)C=8C#N"
} |
Can you make molecule Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N(C)SC(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)SC(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N(C)C(=O)CCCC(=O)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)CCCC(=O)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N(C)C(=O)CC(C)(C)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)CC(C)(C)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N(C)C[S@+]([O-])CCCn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C[S@+]([O-])CCCn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N(C)C(=O)CCC(C)(C)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)Cn2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | Cc1ccc(C)c(N(C)C(=O)CCC(C)(C)n2cnc3onc(-c4ccc(F)cc4)c3c2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(Cl)c(C)c3)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(Cl)c(C)c3)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "Cc1ccc7c(C)c1"
} |
Can you make molecule Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(I)cc3C)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(I)cc3C)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc7c(C)c1"
} |
Can you make molecule Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C(=O)Nc3c(Cl)cccc3Cl)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 | Cc1ccc(-c2c(C(=O)Nc3c(Cl)cccc3Cl)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1cccc(Cl)c1&",
"old_substring": "Cc1ccc7c(C)c1"
} |
Can you make molecule Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(Br)cc3C)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(Br)cc3C)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1ccc7c(C)c1"
} |
Can you make molecule Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(F)cc3Cl)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | Cc1ccc(NC(=O)c2c(C)nc3sc(C(=O)N4CCCC4)c(N)c3c2-c2ccc(C)o2)c(C)c1 | Cc1ccc(-c2c(C(=O)Nc3cc(C)c(F)cc3Cl)c(C)nc3sc(C(=O)N4CCCC4)c(N)c23)o1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1F",
"old_substring": "Cc1ccc7c(C)c1"
} |
Can you make molecule Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N)ccc1N[C@@H](C)CCC(C)(C)C | Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 | Cc1cc(N)ccc1N[C@@H](C)CCC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@@H]13CCC[C@H](C)C1"
} |
Can you make molecule Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)Nc1ccc(N)cc1C | Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 | CC[C@@H](C)C[C@H](CC)Nc1ccc(N)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "[C@@H]13CCC[C@H](C)C1"
} |
Can you make molecule Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CNc1ccc(N)cc1C | Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 | CCCC[C@H](CC)CNc1ccc(N)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "[C@@H]13CCC[C@H](C)C1"
} |
Can you make molecule Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C=Nc1ccc(N)cc1C)CC | Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 | CCCC[C@@H](C=Nc1ccc(N)cc1C)CC | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C=&)CC",
"old_substring": "[C@@H]13CCC[C@H](C)C1"
} |
Can you make molecule Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)C(=O)Nc1ccc(N)cc1C | Cc1cc(N)ccc1N[C@@H]1CCC[C@H](C)C1 | CCCCCC[C@@H](C)C(=O)Nc1ccc(N)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@@H](C)C&=O",
"old_substring": "[C@@H]13CCC[C@H](C)C1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.