prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1I)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1I)c1ccc(=O)[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cc(N2CCCN(C(=O)C3CC3)CC2)ccc1Br)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 | O=C(Nc1cc(N2CCCN(C(=O)C3CC3)CC2)ccc1Br)c1ccc(=O)[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1Cl)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1Cl)c1ccc(=O)[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(N2CCCN(C(=O)C3CC3)CC2)c1Br)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 | O=C(Nc1cccc(N2CCCN(C(=O)C3CC3)CC2)c1Br)c1ccc(=O)[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(N2CCCN(C(=O)C3CC3)CC2)c1Cl)c1ccc(=O)[nH]c1 | O=C(Nc1ccc(N2CCCN(C(=O)C3CC3)CC2)cc1)c1ccc(=O)[nH]c1 | O=C(Nc1cccc(N2CCCN(C(=O)C3CC3)CC2)c1Cl)c1ccc(=O)[nH]c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccc7cc1"
} |
Can you make molecule CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | C=CSc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | CC(C)c1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | C=CCCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C[C@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(CCCCl)cc1 | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | C[NH+](C)C[C@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(CCCCl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+](C)C[C@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(CCCCS)cc1 | CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C[NH+](C)C)cc1 | C[NH+](C)C[C@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(CCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COCSC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | CC(=O)SC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | CON(C)CCCC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | CC(=O)CCCC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCBr)C(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | COC(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | O=C(CCBr)C(=O)c1ccc(NCc2ccc(Cl)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Can you make molecule C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2I)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2I)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[NH+](CCC(=O)Nc2cc(OCc3ccccc3)ccc2Br)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2cc(OCc3ccccc3)ccc2Br)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2Cl)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2Cl)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[NH+](CCC(=O)Nc2cccc(OCc3ccccc3)c2Br)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2cccc(OCc3ccccc3)c2Br)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[NH+](CCC(=O)Nc2cccc(OCc3ccccc3)c2Cl)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2ccc(OCc3ccccc3)cc2)C[C@@H]1O | C[C@H]1CC[NH+](CCC(=O)Nc2cccc(OCc3ccccc3)c2Cl)C[C@@H]1O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 | C[C@H](CC(C)(C)c1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]47"
} |
Can you make molecule C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH2+]C1CCN(C(=O)c2ccccc2F)CC1)CC(=O)c1cccnc1 | C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 | C[C@@H](CC[NH2+]C1CCN(C(=O)c2ccccc2F)CC1)CC(=O)c1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]47"
} |
Can you make molecule C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(c1ccccc1F)N1CCC([NH2+]CC[C@H](Cl)c2cccnc2)CC1 | C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 | O=C(c1ccccc1F)N1CCC([NH2+]CC[C@H](Cl)c2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]47"
} |
Can you make molecule C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 | CCC[C@H](CC(=O)c1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]47"
} |
Can you make molecule C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | C[C@@H]([NH2+]C1CCN(C(=O)c2ccccc2F)CC1)c1cccnc1 | CC(C)[C@H](CCc1cccnc1)[NH2+]C1CCN(C(=O)c2ccccc2F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]47"
} |
Can you make molecule COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3Cl)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3Cl)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccc(I)cc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccc(I)cc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccc(C)c(I)c3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccc(C)c(I)c3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3cccc(Br)c3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3cccc(Br)c3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3cccc(C)c3C)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3ccccc3)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3cccc(C)c3C)C(=O)C[C@@](C)(O)[C@H]2C(=O)Nc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CC(=O)SNc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(CC(=O)SNc2ccc(F)c([N+](=O)[O-])c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(=O)CCCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)CCCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(C)(C)CC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(C)(C)CC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(C)(C)CCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(C)(C)CCC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@H](C)C(=O)SNc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc(C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cn1 | Cc1cnc([C@H](C)C(=O)SNc2ccc(F)c([N+](=O)[O-])c2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]12CCCC1"
} |
Can you make molecule CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCCCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCCC1",
"old_substring": "[NH+]12CCCC1"
} |
Can you make molecule CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1(C)C | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]12CCCC1"
} |
Can you make molecule CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCC2(CCC2)C1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCC2(CCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC2(CCC2)C1",
"old_substring": "[NH+]12CCCC1"
} |
Can you make molecule CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CC2(CCCC2)C1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CCCC1 | CCC(CC)([C@H](Cc1nc(C)cs1)NC)[NH+]1CC2(CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCCC2)C1",
"old_substring": "[NH+]12CCCC1"
} |
Can you make molecule C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)N[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | CC(C)S(=O)(=O)N[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CS(=O)(=O)N[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | CC(C)CS(=O)(=O)N[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CS&(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NCCCCS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NCCCCS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS(C)(=O)=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](NC(=O)N=S(C)(C)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NC(=O)N=S(C)(C)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(C)(=O)=NC&=O",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)S(=O)(=O)CN[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | C[C@@H](NS(C)(=O)=O)C(=O)N1CCN(c2cccc[nH+]2)CC1 | CC(C)S(=O)(=O)CN[C@H](C)C(=O)N1CCN(c2cccc[nH+]2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)S(=O)(=O)C&",
"old_substring": "S5(C)(=O)=O"
} |
Can you make molecule C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](c1ccccc1)C1CC[NH+](CCc2ccc(Br)cc2)CC1 | C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 | NC(=O)[C@@H](c1ccccc1)C1CC[NH+](CCc2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "C[NH+]23"
} |
Can you make molecule C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](c1ccccc1)[NH+]1CCC=C(CCc2ccc(Br)cc2)C1 | C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 | NC(=O)[C@@H](c1ccccc1)[NH+]1CCC=C(CCc2ccc(Br)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C1=CCC[NH+]&C1",
"old_substring": "C[NH+]23"
} |
Can you make molecule C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(Cc2ccc(Br)cc2)CC[NH+]([C@@H](C(N)=O)c2ccccc2)CC1 | C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 | CC1(Cc2ccc(Br)cc2)CC[NH+]([C@@H](C(N)=O)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CC[NH+]&CC1",
"old_substring": "C[NH+]23"
} |
Can you make molecule C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1([C@@H](C(N)=O)c2ccccc2)CC[NH+](CCc2ccc(Br)cc2)CC1 | C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 | CC1([C@@H](C(N)=O)c2ccccc2)CC[NH+](CCc2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&(C)CC1",
"old_substring": "C[NH+]23"
} |
Can you make molecule C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](c1ccccc1)C1CC[NH+](Cc2ccc(Br)cc2)CC1 | C[NH+](Cc1ccc(Br)cc1)[C@@H](C(N)=O)c1ccccc1 | NC(=O)[C@@H](c1ccccc1)C1CC[NH+](Cc2ccc(Br)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "C[NH+]23"
} |
Can you make molecule Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1S(=O)(=O)NC1CCCCCCC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NC1CCCCCCC1)OCCN2C | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C14CCC(C)CC1"
} |
Can you make molecule Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1S(=O)(=O)NSC1=CCCCCC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NSC1=CCCCCC1)OCCN2C | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCC(C)CC1"
} |
Can you make molecule Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1S(=O)(=O)N=C1CCCCC1(C)C)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)N=C1CCCCC1(C)C)OCCN2C | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCCC1=&",
"old_substring": "C14CCC(C)CC1"
} |
Can you make molecule Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C less soluble in water? The output molecule should be similar to the input molecule. | CC(=NS(=O)(=O)c1cc2c(cc1C)N(C)CCO2)C1CCCCC1 | Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C | CC(=NS(=O)(=O)c1cc2c(cc1C)N(C)CCO2)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)C1CCCCC1",
"old_substring": "C14CCC(C)CC1"
} |
Can you make molecule Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1S(=O)(=O)N=C1CCOC3(CCCCC3)C1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)NC1CCC(C)CC1)OCCN2C | Cc1cc2c(cc1S(=O)(=O)N=C1CCOC3(CCCCC3)C1)OCCN2C | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCOC2(CCCCC2)C1",
"old_substring": "C14CCC(C)CC1"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+]1CCCC1(C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+]1CCCC1(C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]5(C)C"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[N+](C)(C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[N+](C)(C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "[NH+]5(C)C"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+]1CC(C)(C)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+]1CC(C)(C)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]5(C)C"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+]1CC2(CC2)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+]1CC2(CC2)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CC2)C1",
"old_substring": "[NH+]5(C)C"
} |
Can you make molecule CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC[NH+]1CCC(C)(C)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+](C)C)C(=O)c1ccc2c(c1)NC(=O)CS2 | CN(CC[NH+]1CCC(C)(C)C1)C(=O)c1ccc2c(c1)NC(=O)CS2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]5(C)C"
} |
Can you make molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C[C@@H](C)N=O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C[C@@H](C)N=O)C(=O)Nc1cccc(Cl)c1SC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)N=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@@H](C)Cl | CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@@H](C)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](Cl)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C[C@@H](C)CS)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C[C@@H](C)CS)C(=O)Nc1cccc(Cl)c1SC(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)CS",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@@H](C)CCl | CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@@H](C)CCl | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CCl)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@H](C)Br | CC(C)N(C[C@H](C)O)C(=O)Nc1cccc(Cl)c1SC(F)F | CC(C)N(C(=O)Nc1cccc(Cl)c1SC(F)F)C(=O)[C@H](C)Br | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](Br)C&=O",
"old_substring": "C5[C@H](C)O"
} |
Can you make molecule O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccccc1)Nc1cccc(OCc2nnnn2C2CC2)c1 | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 | O=C(/C=C/Sc1ccccc1)Nc1cccc(OCc2nnnn2C2CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(Nc2cccc(OCc3nnnn3C3CC3)c2)nc1-c1ccccc1 | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 | O=Cc1sc(Nc2cccc(OCc3nnnn3C3CC3)c2)nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(Nc2cccc(OCc3nnnn3C3CC3)c2)sc1-c1ccccc1 | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 | O=Cc1nc(Nc2cccc(OCc3nnnn3C3CC3)c2)sc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C37"
} |
Can you make molecule O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)n1nc(-c2ccccc2)oc1=S | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)n1nc(-c2ccccc2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C37"
} |
Can you make molecule O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONc1cccc(OCc2nnnn2C2CC2)c1)\c1ccc(-c2ccccc2)o1 | O=C(Nc1cccc(OCc2nnnn2C2CC2)c1)c1ccccc1 | C(=N/ONc1cccc(OCc2nnnn2C2CC2)c1)\c1ccc(-c2ccccc2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C37"
} |
Can you make molecule Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)cc(C)c1Cl | Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)cc(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(C)c1Cl",
"old_substring": "Cc1cc3cc(F)c1"
} |
Can you make molecule Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1Cl | Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1ccc(F)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(F)c&c1Cl",
"old_substring": "Cc1cc3cc(F)c1"
} |
Can you make molecule Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1ccc(Br)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1cc3cc(F)c1"
} |
Can you make molecule Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c(C)cc1I | Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1cc3cc(F)c1"
} |
Can you make molecule Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c(I)c1 | Cc1cc(F)cc(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c1 | Cc1cc(F)c(N[C@@H]2CCC[C@@H]2S(C)(=O)=O)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(F)c&c(I)c1",
"old_substring": "Cc1cc3cc(F)c1"
} |
Can you make molecule O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC1=CCC[C@@H]1c1ccco1)[C@@H]1CCOc2ccccc21 | O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 | O=C(CCC1=CCC[C@@H]1c1ccco1)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "N13CCCCC[C@@H]14"
} |
Can you make molecule O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1CCCC[C@H](c2ccco2)C1)[C@@H]1CCOc2ccccc21 | O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 | O=C([C@H]1CCCC[C@H](c2ccco2)C1)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "N13CCCCC[C@@H]14"
} |
Can you make molecule O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@H]1CCC[C@H](c2ccco2)CC1)[C@@H]1CCOc2ccccc21 | O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 | O=C([C@H]1CCC[C@H](c2ccco2)CC1)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "N13CCCCC[C@@H]14"
} |
Can you make molecule O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1ccco1)C(=O)[C@@H]1CCOc2ccccc21 | O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 | CCCC[C@@H](CCc1ccco1)C(=O)[C@@H]1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "N13CCCCC[C@@H]14"
} |
Can you make molecule O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([C@@H]1CCOc2ccccc21)N1CCC2(CCC(c3ccco3)CC2)CC1 | O=C([C@@H]1CCOc2ccccc21)N1CCCCC[C@@H]1c1ccco1 | O=C([C@@H]1CCOc2ccccc21)N1CCC2(CCC(c3ccco3)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "N13CCCCC[C@@H]14"
} |
Can you make molecule N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H](c1nc2c(N3CCOCC3)cccc2s1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1nc2c(N3CCOCC3)cccc2s1)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2c&cccc2s1",
"old_substring": "c14nc2ccccc2nc13"
} |
Can you make molecule N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H](c1ccc2cc(N3CCOCC3)cn2c1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1ccc2cc(N3CCOCC3)cn2c1)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2cc&cn2c1",
"old_substring": "c14nc2ccccc2nc13"
} |
Can you make molecule N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H](c1cccc2ccc(N3CCOCC3)nc12)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1cccc2ccc(N3CCOCC3)nc12)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc2ccc&nc12",
"old_substring": "c14nc2ccccc2nc13"
} |
Can you make molecule N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@H](c1ccc2cc(N3CCOCC3)ccc2n1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 | N#C[C@H](c1ccc2cc(N3CCOCC3)ccc2n1)S(=O)(=O)c1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2cc&ccc2n1",
"old_substring": "c14nc2ccccc2nc13"
} |
Can you make molecule N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c([C@@H](C#N)S(=O)(=O)c2ccc(Cl)cc2)cc2cc(N3CCOCC3)ccc21 | N#C[C@H](c1nc2ccccc2nc1N1CCOCC1)S(=O)(=O)c1ccc(Cl)cc1 | Cn1c([C@@H](C#N)S(=O)(=O)c2ccc(Cl)cc2)cc2cc(N3CCOCC3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc&ccc2n1C",
"old_substring": "c14nc2ccccc2nc13"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1Cl | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccc(I)cc1 | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccc(I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C)C(=O)Nc2cccc(F)c2C)cc1I | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 | Cc1ccc(C[C@H](C)C(=O)Nc2cccc(F)c2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1cccc(Br)c1 | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C[C@H](C)C(=O)Nc2cccc(F)c2C)c1C | Cc1c(F)cccc1NC(=O)[C@@H](C)Cc1ccccc1 | Cc1cccc(C[C@H](C)C(=O)Nc2cccc(F)c2C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CCC(CO)=N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CCCC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SN[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)SN[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CCCCC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC2=O"
} |
Can you make molecule CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CC(=O)N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | CCC(C=O)=N[C@@H]1CCO[C@H]1c1ccc(Cl)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC2=O"
} |
Can you make molecule CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)CCC[C@@H](N)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)CCC[C@@H](N)C(=O)c1cc(C(C)C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N36C"
} |
Can you make molecule CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)CCC1=NCCN1C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)CCC1=NCCN1C(=O)c1cc(C(C)C)no1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1C&",
"old_substring": "N36C"
} |
Can you make molecule CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)Cc1sc(C(=O)c2cc(C(C)C)no2)cc1C#N | CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)Cc1sc(C(=O)c2cc(C(C)C)no2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N36C"
} |
Can you make molecule CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)Cc1ccc(C(=O)c2cc(C(C)C)no2)cc1C#N | CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)Cc1ccc(C(=O)c2cc(C(C)C)no2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N36C"
} |
Can you make molecule CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)CN1CCC(=NOC(=O)c2cc(C(C)C)no2)CC1 | CCN(CC)C(=O)CN(C)C(=O)c1cc(C(C)C)no1 | CCN(CC)C(=O)CN1CCC(=NOC(=O)c2cc(C(C)C)no2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N36C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.