prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)NCSCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NCSCc2ccc3c(c2)OCO3)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N45"
} |
Can you make molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)NC(=N)SCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NC(=N)SCc2ccc3c(c2)OCO3)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)N(C)C(=S)SCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)N(C)C(=S)SCc2ccc3c(c2)OCO3)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)c2cc(Cc3ccc4c(c3)OCO4)c(N)o2)nn1C | Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)c2cc(Cc3ccc4c(c3)OCO4)c(N)o2)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N45"
} |
Can you make molecule Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Cl)c(C(=O)N2CCN=C2SCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)NCc2ccc3c(c2)OCO3)nn1C | Cc1c(Cl)c(C(=O)N2CCN=C2SCc2ccc3c(c2)OCO3)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45"
} |
Can you make molecule [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H]([NH+]2CCC[C@H](c3ccccc3)CC2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CCC[C@H](c3ccccc3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]14CC[C@@H]5C1"
} |
Can you make molecule [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H]([NH+]2CC=C(CCc3ccccc3)CC2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC=C(CCc3ccccc3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]14CC[C@@H]5C1"
} |
Can you make molecule [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H]([C@H]2NC[C@H](c3ccccc3)O2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 | [NH3+][C@H]1CCC[C@@H]([C@H]2NC[C@H](c3ccccc3)O2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&NC[C@H]&O1",
"old_substring": "[NH+]14CC[C@@H]5C1"
} |
Can you make molecule [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CCC[C@@H]([C@H]2C[C@@H](c3ccccc3)CCO2)C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 | [NH3+][C@H]1CCC[C@@H]([C@H]2C[C@@H](c3ccccc3)CCO2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&CCO1",
"old_substring": "[NH+]14CC[C@@H]5C1"
} |
Can you make molecule [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(c2ccccc2)C[C@@H]1[C@@H]1CCC[C@H]([NH3+])C1 | [NH3+][C@H]1CCC[C@@H]([NH+]2CC[C@@H](c3ccccc3)C2)C1 | C[C@H]1CN(c2ccccc2)C[C@@H]1[C@@H]1CCC[C@H]([NH3+])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]14CC[C@@H]5C1"
} |
Can you make molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CNSC(=O)Cc1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNSC(=O)Cc1cc(C)n(Cc2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CNC(=O)CCCC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)CCCC(=O)c1cc(C)n(Cc2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CNC(=O)CC(C)(C)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)CC(C)(C)c1cc(C)n(Cc2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CNC(=O)CCC(C)(C)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)CCC(C)(C)c1cc(C)n(Cc2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C47=O"
} |
Can you make molecule CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CNSC(=O)[C@@H](C)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNC(=O)c1cc(C)n(Cc2ccccc2)c1C | CCOC(=O)CNSC(=O)[C@@H](C)c1cc(C)n(Cc2ccccc2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C47=O"
} |
Can you make molecule C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOC(=S)SC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC(=S)SC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOC(=N)CC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC(=N)CC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(=O)CCC(=O)C[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCC(=O)CCC(=O)C[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC[C@H](O)CCC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CC[C@H](O)CCC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(=O)/C=C/SC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCOC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | C#CCC(=O)/C=C/SC[C@H]1CCCN(S(=O)(=O)c2cc(F)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COCc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COCSc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1SC(C)=O | COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1C(=O)CS | COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1C(=O)CI | COc1ccc(NC(=O)c2n[nH]c3cccc(Cl)c23)cc1OC | COc1cc(NC(=O)c2n[nH]c3cccc(Cl)c23)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=O)C(=Cc2ccc(OSC(=O)Cc3cccc4ccccc34)cc2)C(=O)N1 | O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | O=C1NC(=O)C(=Cc2ccc(OSC(=O)Cc3cccc4ccccc34)cc2)C(=O)N1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C57=O"
} |
Can you make molecule O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1NC(=O)C(=Cc2ccc(OC(=O)CCCC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | O=C1NC(=O)C(=Cc2ccc(OC(=O)CCCC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C57=O"
} |
Can you make molecule O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Oc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | CC(C)(CC(=O)Oc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Oc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | CC(C)(CCC(=O)Oc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C57=O"
} |
Can you make molecule O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SOc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | O=C1NC(=O)C(=Cc2ccc(OC(=O)c3cccc4ccccc34)cc2)C(=O)N1 | C[C@H](C(=O)SOc1ccc(C=C2C(=O)NC(=O)NC2=O)cc1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C57=O"
} |
Can you make molecule Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(s1)[C@H]([NH+](C)Cc1ccoc1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1ccoc1C)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccoc1C",
"old_substring": "c14cccn1C"
} |
Can you make molecule Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(s1)[C@H]([NH+](C)Cc1sccc1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1sccc1C)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c14cccn1C"
} |
Can you make molecule Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cc(Br)cn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cc(Br)cn1C)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)cn1C",
"old_substring": "c14cccn1C"
} |
Can you make molecule Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(s1)[C@H]([NH+](C)Cc1ccncc1Cl)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1ccncc1Cl)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c14cccn1C"
} |
Can you make molecule Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cnccc1Cl)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cccn1C)CCC2 | Cc1nc2c(s1)[C@H]([NH+](C)Cc1cnccc1Cl)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c14cccn1C"
} |
Can you make molecule CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(CN(C)C(=O)CC(C)(C)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)CC(C)(C)NCCc2ncc(C)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(CN(C)C(=O)CCC(C)(C)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)CCC(C)(C)NCCc2ncc(C)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(CN(C)C(=O)C[C@@H](Br)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)C(=O)C[C@@H](Br)NCCc2ncc(C)s2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(CN(C)c2cc(C)n(NCCc3ncc(C)s3)c(=O)c2)s1 | CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)c2cc(C)n(NCCc3ncc(C)s3)c(=O)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc(CN(C)c2c(C)n(NCCc3ncc(C)s3)ccc2=O)s1 | CCc1cnc(CN(C)C(=O)NCCc2ncc(C)s2)s1 | CCc1cnc(CN(C)c2c(C)n(NCCc3ncc(C)s3)ccc2=O)s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 | CCCC[C@H](CC)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "C15C[C@@H](C)C[C@@H](C)C1"
} |
Can you make molecule Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](Cl)CCCCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 | CCC[C@@H](Cl)CCCCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H](Cl)CCC&",
"old_substring": "C15C[C@@H](C)C[C@@H](C)C1"
} |
Can you make molecule Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)(C)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 | CCCCCC(C)(C)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC(C)(C)C&",
"old_substring": "C15C[C@@H](C)C[C@@H](C)C1"
} |
Can you make molecule Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(CC)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 | CCC(CC)(CC)CCCS(=O)(=O)Cc1cc(=O)n2cccc(C)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(C&)(CC)CC",
"old_substring": "C15C[C@@H](C)C[C@@H](C)C1"
} |
Can you make molecule Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC[C@@H](Br)CCC(C)C)nc12 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC3C[C@@H](C)C[C@@H](C)C3)nc12 | Cc1cccn2c(=O)cc(CS(=O)(=O)CCC[C@@H](Br)CCC(C)C)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "C15C[C@@H](C)C[C@@H](C)C1"
} |
Can you make molecule CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1cnn(CCCC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CCCC[NH+]2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1cnn(CCCCC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CCCCC[NH+]2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1cnn(C2CC([NH+]3CCCCC3)C2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(C2CC([NH+]3CCCCC3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1cnn(C2CCN([NH+]3CCCCC3)CC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(C2CCN([NH+]3CCCCC3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C6C4"
} |
Can you make molecule CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](C)C(=O)Nc1cnn([C@@H](C)CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn(CC[NH+]2CCCCC2)c1 | CC(C)[C@@H](C)C(=O)Nc1cnn([C@@H](C)CC[NH+]2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1ccc(Cl)s1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1ccc(Br)s1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1ccc(Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1sccc1Br | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1csc(I)c1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1csc(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c15cccs1"
} |
Can you make molecule O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cc2c(s1)CSC2 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cccs1 | O=C(Cn1c(=O)oc2cc(Cl)ccc21)N1CCC[C@@H]1c1cc2c(s1)CSC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c15cccs1"
} |
Can you make molecule CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1I | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)ccc1Br | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 | CCc1cc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1Cl | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)c1Br | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 | CCc1cccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)c1Cl | CCc1ccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)cc1 | CCc1cccc(NC(=O)c2ccc([C@H]3Nc4cc(C(F)(F)F)ccc4S(=O)(=O)N3)cc2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc6cc1"
} |
Can you make molecule O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCCS1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CCCCC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCCCS1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCSCS1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CCCCCC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CC1 | O=C(Cc1c[nH]c2ccc([N+](=O)[O-])cc12)OCc1nncn1C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2I)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)C(=O)Nc2cc(OC3CCCC3)ccc2Br)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2cc(OC3CCCC3)ccc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2Cl)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)C(=O)Nc2cccc(OC3CCCC3)c2Br)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2cccc(OC3CCCC3)c2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(NC(=O)C(=O)Nc2cccc(OC3CCCC3)c2Cl)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2ccc(OC3CCCC3)cc2)CC1 | C[NH+]1CCC(NC(=O)C(=O)Nc2cccc(OC3CCCC3)c2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18ccc7cc1"
} |
Can you make molecule O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@@H]1CN(c2nccs2)CCO1)NCc1c(F)cccc1F | O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 | O=C(/C=C/S[C@@H]1CN(c2nccs2)CCO1)NCc1c(F)cccc1F | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCc2c(F)cccc2F)nc1[C@@H]1CN(c2nccs2)CCO1 | O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 | O=Cc1sc(NCc2c(F)cccc2F)nc1[C@@H]1CN(c2nccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCc2c(F)cccc2F)sc1[C@@H]1CN(c2nccs2)CCO1 | O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 | O=Cc1nc(NCc2c(F)cccc2F)sc1[C@@H]1CN(c2nccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1c(F)cccc1F)N/N=C/C[C@@H]1CN(c2nccs2)CCO1 | O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 | O=C(NCc1c(F)cccc1F)N/N=C/C[C@@H]1CN(c2nccs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | Fc1cccc(F)c1CNON=C1CCN([C@@H]2CN(c3nccs3)CCO2)CC1 | O=C(NCc1c(F)cccc1F)[C@@H]1CN(c2nccs2)CCO1 | Fc1cccc(F)c1CNON=C1CCN([C@@H]2CN(c3nccs3)CCO2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C36"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | COCc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | COCSc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | CC(=O)Sc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CS)c(NC(=O)CN2C[C@H](C)OCC2(C)C)c1 | COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | Cc1ccc(C(=O)CS)c(NC(=O)CN2C[C@H](C)OCC2(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CI)c(NC(=O)CN2C[C@H](C)OCC2(C)C)c1 | COc1ccc(C)cc1NC(=O)CN1C[C@H](C)OCC1(C)C | Cc1ccc(C(=O)CI)c(NC(=O)CN2C[C@H](C)OCC2(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccccc3Cl)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccccc3Cl)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccc(I)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccc(I)cc3)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccc(C)c(I)c3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3ccc(C)c(I)c3)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3cccc(Br)c3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3cccc(Br)c3)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3cccc(C)c3C)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@H](c3ccccc3)c3ccc(F)cc3)CC2)n(C)n1 | Cc1cc(C(=O)N2CCN([C@@H](c3ccc(F)cc3)c3cccc(C)c3C)CC2)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1Cl | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1Br | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-]c1[nH]c(=S)nnc1C=Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1C=Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(F)cc1",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)c(Cl)c1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | [O-]c1[nH]c(=S)nnc1Cc1ccc(I)cc1F | [O-]c1[nH]c(=S)nnc1Cc1ccc(F)cc1 | [O-]c1[nH]c(=S)nnc1Cc1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c13ccc(F)cc1"
} |
Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccsc1)NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-] | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | O=C(/C=C/Sc1ccsc1)NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCC(=O)N2CCc3c2cccc3[N+](=O)[O-])nc1-c1ccsc1 | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | O=Cc1sc(NCCC(=O)N2CCc3c2cccc3[N+](=O)[O-])nc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCC(=O)N2CCc3c2cccc3[N+](=O)[O-])sc1-c1ccsc1 | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | O=Cc1nc(NCCC(=O)N2CCc3c2cccc3[N+](=O)[O-])sc1-c1ccsc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNC(=O)n1nc(-c2ccsc2)oc1=S)N1CCc2c1cccc2[N+](=O)[O-] | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | O=C(CCNC(=O)n1nc(-c2ccsc2)oc1=S)N1CCc2c1cccc2[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C36"
} |
Can you make molecule O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCNO/N=C/c1ccc(-c2ccsc2)o1)N1CCc2c1cccc2[N+](=O)[O-] | O=C(NCCC(=O)N1CCc2c1cccc2[N+](=O)[O-])c1ccsc1 | O=C(CCNO/N=C/c1ccc(-c2ccsc2)o1)N1CCc2c1cccc2[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C36"
} |
Can you make molecule CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CCCCC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2SCCCS2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2SCCCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2SCSCS2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2SCSCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CCCCCC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C17CC1"
} |
Can you make molecule CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CSCCSC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CC2)c1 | CC(=O)Nc1cccc(CN2CCOC[C@@H]2C2CSCCSC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C17CC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.