prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1NC(=O)[C@H](CCCBr)N(Cc2cc(F)cc(Br)c2)C1=O | CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | C[C@@H]1NC(=O)[C@H](CCCBr)N(Cc2cc(F)cc(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | CC(C)CC[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1NC(=O)[C@H](CCCCBr)N(Cc2cc(F)cc(Br)c2)C1=O | CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | C[C@@H]1NC(=O)[C@H](CCCCBr)N(Cc2cc(F)cc(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCC[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | C=CCCC[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1NC(=O)[C@H](CCCCCl)N(Cc2cc(F)cc(Br)c2)C1=O | CC(C)[C@H]1C(=O)N[C@@H](C)C(=O)N1Cc1cc(F)cc(Br)c1 | C[C@@H]1NC(=O)[C@H](CCCCCl)N(Cc2cc(F)cc(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC3C"
} |
Can you make molecule CCOCc1ccccc1NC(=O)CCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccccc1NC(=O)CCN1CCCCCCC1=O | CCOCc1ccccc1NC(=O)CCN1CCCC1=O | CCOCc1ccccc1NC(=O)CCN1CCCCCCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule CCOCc1ccccc1NC(=O)CCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccccc1NC(=O)CCN1CCCCC1 | CCOCc1ccccc1NC(=O)CCN1CCCC1=O | CCOCc1ccccc1NC(=O)CCN1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule CCOCc1ccccc1NC(=O)CCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccccc1NC(=O)CCN1CC=CCC1 | CCOCc1ccccc1NC(=O)CCN1CCCC1=O | CCOCc1ccccc1NC(=O)CCN1CC=CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule CCOCc1ccccc1NC(=O)CCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccccc1NC(=O)CCN1CCCc2sccc2C1=O | CCOCc1ccccc1NC(=O)CCN1CCCC1=O | CCOCc1ccccc1NC(=O)CCN1CCCc2sccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2sccc2C1=O",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule CCOCc1ccccc1NC(=O)CCN1CCCC1=O less soluble in water? The output molecule should be similar to the input molecule. | CCOCc1ccccc1NC(=O)CCN1CCCCCC1 | CCOCc1ccccc1NC(=O)CCN1CCCC1=O | CCOCc1ccccc1NC(=O)CCN1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N16CCCC1=O"
} |
Can you make molecule O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1cc(I)c(=O)c(I)c1)c1ccc2c(c1)CCCC2 | O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 | O=C(Cn1cc(I)c(=O)c(I)c1)c1ccc2c(c1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)c(=O)c(I)c1",
"old_substring": "n14cc(Cl)c(=O)[nH]c1=O"
} |
Can you make molecule O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)cn(CC(=O)c2ccc3c(c2)CCCC3)c1=O | O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 | Cc1cc(I)cn(CC(=O)c2ccc3c(c2)CCCC3)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cc(C)c1=O",
"old_substring": "n14cc(Cl)c(=O)[nH]c1=O"
} |
Can you make molecule O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1ncc(Br)c(Br)c1=O)c1ccc2c(c1)CCCC2 | O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 | O=C(Cn1ncc(Br)c(Br)c1=O)c1ccc2c(c1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ncc(Br)c(Br)c1=O",
"old_substring": "n14cc(Cl)c(=O)[nH]c1=O"
} |
Can you make molecule O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1nnc(Cl)c(I)c1I)c1ccc2c(c1)CCCC2 | O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 | O=C(Cc1nnc(Cl)c(I)c1I)c1ccc2c(c1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc(Cl)c(I)c1I",
"old_substring": "n14cc(Cl)c(=O)[nH]c1=O"
} |
Can you make molecule O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc(Cl)nc(Cl)c1)c1ccc2c(c1)CCCC2 | O=C(Cn1cc(Cl)c(=O)[nH]c1=O)c1ccc2c(c1)CCCC2 | O=C(Cc1cc(Cl)nc(Cl)c1)c1ccc2c(c1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)nc(Cl)c1",
"old_substring": "n14cc(Cl)c(=O)[nH]c1=O"
} |
Can you make molecule CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cc(C)ccn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cc(C)ccn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)ccn1",
"old_substring": "c17cnc(C)cn1"
} |
Can you make molecule CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Br)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Br)cn2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Br)cn1",
"old_substring": "c17cnc(C)cn1"
} |
Can you make molecule CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cc(Cl)cn2C)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cc(Cl)cn2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cn1C",
"old_substring": "c17cnc(C)cn1"
} |
Can you make molecule CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Cl)nc2Cl)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Cl)nc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)nc1Cl",
"old_substring": "c17cnc(C)cn1"
} |
Can you make molecule CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Cl)cc2I)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(C)cn2)cc1 | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2cnc(Cl)cc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c17cnc(C)cn1"
} |
Can you make molecule Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CCCc3cc(NC(=O)Nc4cnn(CC(F)F)c4)ccc3C2)[nH+]c1 | Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(N2CCCc3cc(NC(=O)Nc4cnn(CC(F)F)c4)ccc3C2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N16CCC8CC1"
} |
Can you make molecule Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(C2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N16CCC8CC1"
} |
Can you make molecule Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CCCCCNC(=O)Nc2cnn(CC(F)F)c2)[nH+]c1 | Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(CCCCCNC(=O)Nc2cnn(CC(F)F)c2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N16CCC8CC1"
} |
Can you make molecule Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2(C#N)CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(C2(C#N)CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "N16CCC8CC1"
} |
Can you make molecule Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C2CCC(=NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(N2CCC(NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | Cc1ccc(C2CCC(=NC(=O)Nc3cnn(CC(F)F)c3)CC2)[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "N16CCC8CC1"
} |
Can you make molecule CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(Br)cc(C(=O)N[C@@H](CC)CCc2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@@H](CC)CCc2ccncc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]79C"
} |
Can you make molecule CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(Br)cc(C(=O)N[C@@H](CBr)CCc2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@@H](CBr)CCc2ccncc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]79C"
} |
Can you make molecule CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(Br)cc(C(=O)N[C@@H](CBr)CCCc2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@@H](CBr)CCCc2ccncc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]79C"
} |
Can you make molecule CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(Br)cc(C(=O)N[C@H](CCl)CCCc2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](CCl)CCCc2ccncc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]79C"
} |
Can you make molecule CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCOc1c(Br)cc(C(=O)N[C@H]2CCC[C@H](c3ccncc3)C2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H](C)c2ccncc2)cc1OC | CCOc1c(Br)cc(C(=O)N[C@H]2CCC[C@H](c3ccncc3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]79C"
} |
Can you make molecule CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | C=CSOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC5"
} |
Can you make molecule CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | C=CCCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC5"
} |
Can you make molecule CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCCl)c1 | CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC5"
} |
Can you make molecule CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCCS)c1 | CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCCS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC5"
} |
Can you make molecule CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCBr)c1 | CCOc1cccc(NC(=O)C(C#N)=C[C@H]2C=c3ccccc3=[NH+]2)c1 | N#CC(=C[C@H]1C=c2ccccc2=[NH+]1)C(=O)Nc1cccc(OCCCBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC5"
} |
Can you make molecule Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C[NH+]2CC[C@@H](OCCCCCc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCCCCCc3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC8"
} |
Can you make molecule Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C[NH+]2CC[C@@H](OC3CCC(c4ccccc4)CC3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OC3CCC(c4ccccc4)CC3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC8"
} |
Can you make molecule Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C[NH+]2CC[C@@H](OCC(C)(C)Cc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCC(C)(C)Cc3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC8"
} |
Can you make molecule Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccccc1)O[C@@H]1CC[NH+](Cc2nc(C)no2)C1 | Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 | CCC[C@@H](CCc1ccccc1)O[C@@H]1CC[NH+](Cc2nc(C)no2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC8"
} |
Can you make molecule Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C[NH+]2CC[C@@H](OCC[C@H](Cl)c3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCCCc3ccccc3)C2)n1 | Cc1noc(C[NH+]2CC[C@@H](OCC[C@H](Cl)c3ccccc3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C4CC8"
} |
Can you make molecule CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | C=CSc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1C(C)C | CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC7"
} |
Can you make molecule CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | C=CCCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1CCCCl | CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1CCCCl | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C less soluble in water? The output molecule should be similar to the input molecule. | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1CCCCS | CCc1c(OC)nc2nc(C(=O)c3ccccc3)cn2c1C | COc1nc2nc(C(=O)c3ccccc3)cn2c(C)c1CCCCS | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccc(N2CCN(CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2CCN(CCc3ccccc3)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&CC1",
"old_substring": "N17CC[NH+]6CC1"
} |
Can you make molecule C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccc(N2CCO[C@H](CCc3ccccc3)C2)nc1 | C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2CCO[C@H](CCc3ccccc3)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@H]&C1",
"old_substring": "N17CC[NH+]6CC1"
} |
Can you make molecule C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccc(N2C[C@H](CCc3ccccc3)CC2=O)nc1 | C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2C[C@H](CCc3ccccc3)CC2=O)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C[C@H]&CC1=O",
"old_substring": "N17CC[NH+]6CC1"
} |
Can you make molecule C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccc(N2CCO[C@@H](CCc3ccccc3)C2)nc1 | C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2CCO[C@@H](CCc3ccccc3)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCO[C@@H]&C1",
"old_substring": "N17CC[NH+]6CC1"
} |
Can you make molecule C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCNC(=O)c1ccc(N2CCS[C@@H](CCc3ccccc3)C2)nc1 | C#CCNC(=O)c1ccc(N2CC[NH+](CCc3ccccc3)CC2)nc1 | C#CCNC(=O)c1ccc(N2CCS[C@@H](CCc3ccccc3)C2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCS[C@@H]&C1",
"old_substring": "N17CC[NH+]6CC1"
} |
Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1ccc(Br)cc1I | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1ccc(Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c17cccc(Br)c1"
} |
Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(/C=C/Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(/C=C/Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c17cccc(Br)c1"
} |
Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1ccc(Br)cc1Br | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1ccc(Br)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c17cccc(Br)c1"
} |
Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1oc2ccc(Br)cc2c1C | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1oc2ccc(Br)cc2c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(Br)cc2c1C",
"old_substring": "c17cccc(Br)c1"
} |
Can you make molecule CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cc(Br)ccc1I | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cccc(Br)c1 | CCc1nn(C)cc1NC(=O)N[C@@H](C)c1cc(Br)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c17cccc(Br)c1"
} |
Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCN1CCC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N567"
} |
Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCCC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCN1CCCC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N567"
} |
Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCc1oc(CC(=O)N2CCc3ccccc3C2)c(S(=O)(=O)c2cc(F)ccc2OC)c1C#N | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCc1oc(CC(=O)N2CCc3ccccc3C2)c(S(=O)(=O)c2cc(F)ccc2OC)c1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N567"
} |
Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCN1CC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)CCC1=O | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCN1CC(CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)CCC1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N567"
} |
Can you make molecule CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCC[C@@](CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | CCN(CC(=O)N1CCc2ccccc2C1)S(=O)(=O)c1cc(F)ccc1OC | CCN1CCC[C@@](CC(=O)N2CCc3ccccc3C2)(S(=O)(=O)c2cc(F)ccc2OC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N567"
} |
Can you make molecule C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)[C@@H](CC)[C@@H](O)CC)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)[C@@H](CC)[C@@H](O)CC)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](O)[C@@H]&CC",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)C[C@@H](CS)C(C)C)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)C[C@@H](CS)C(C)C)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](CS)C(C)C",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCC(C)(C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCCC(C)(C)C3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC(C)(C)C1",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCC(C)(C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCC(C)(C)C3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)(C)C1",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCC[C@@H](C)CC3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3C[C@@H](C)O[C@@H](C)C3)cc2)CC1 | C#CCOCC1CCN(C(=O)c2ccc(S(=O)(=O)N3CCC[C@@H](C)CC3)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@H](C)CC1",
"old_substring": "N17C[C@@H](C)O[C@@H](C)C1"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)NCSCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCSCc1nc3ccccc3s1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)NC(=N)SCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NC(=N)SCc1nc3ccccc3s1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)c1nsc(Cc3nc4ccccc4s3)c1N)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)c1nsc(Cc3nc4ccccc4s3)c1N)C2 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)N(C)C(=S)SCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)N(C)C(=S)SCc1nc3ccccc3s1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2c(cc1C)O[C@@H](C(=O)c1ccc(Cc3nc4ccccc4s3)n1N)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)NCc1nc3ccccc3s1)C2 | Cc1cc2c(cc1C)O[C@@H](C(=O)c1ccc(Cc3nc4ccccc4s3)n1N)C2 | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N45"
} |
Can you make molecule COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COCc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COCSc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)Oc2ccc(F)cc2)cc(SC(C)=O)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(SC(C)=O)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)Oc2ccc(F)cc2)cc(C(=O)CS)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(C(=O)CS)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)Oc2ccc(F)cc2)cc(C(=O)CI)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(OC)c1Br | COc1cc(C(=O)Oc2ccc(F)cc2)cc(C(=O)CI)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1c1nc2c(s1)CN(C(=O)COCC(=O)[O-])C2 | CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1c1nc2c(s1)CN(C(=O)COCC(=O)[O-])C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N25"
} |
Can you make molecule CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1n1ncc2c1CN(C(=O)COCC(=O)[O-])C2 | CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1n1ncc2c1CN(C(=O)COCC(=O)[O-])C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N25"
} |
Can you make molecule CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1c1onc2c1CN(C(=O)COCC(=O)[O-])CC2 | CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1c1onc2c1CN(C(=O)COCC(=O)[O-])CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N25"
} |
Can you make molecule CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1c1cc2n(n1)CCCN2C(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1c1cc2n(n1)CCCN2C(=O)COCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N25"
} |
Can you make molecule CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC[C@@H]1c1ccc2c(c1)CCN2C(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1NC(=O)COCC(=O)[O-] | CC1(C)CCC[C@@H]1c1ccc2c(c1)CCN2C(=O)COCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N25"
} |
Can you make molecule O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | N=C(NC(=O)c1cccc2ccccc12)Sc1ccc2c3c(cccc13)CC2 | O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | N=C(NC(=O)c1cccc2ccccc12)Sc1ccc2c3c(cccc13)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(SC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | O=C(SC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)N1CCC(c2ccc3c4c(cccc24)CC3)CC1)c1cccc2ccccc12 | O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | O=C(NC(=S)N1CCC(c2ccc3c4c(cccc24)CC3)CC1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)N1CC[C@H](c2ccc3c4c(cccc24)CC3)C1)c1cccc2ccccc12 | O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | O=C(NC(=S)N1CC[C@H](c2ccc3c4c(cccc24)CC3)C1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CC[C@H]&C1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC(=S)NN=C1CCC(c2ccc3c4c(cccc24)CC3)CC1)c1cccc2ccccc12 | O=C(NC(=S)Nc1ccc2c3c(cccc13)CC2)c1cccc2ccccc12 | O=C(NC(=S)NN=C1CCC(c2ccc3c4c(cccc24)CC3)CC1)c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)NN=C1CCC&CC1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)c3nc(C#N)c(C4CC[NH+](C(C)C)CC4)o3)n2c1 | Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 | Cc1ccc2ncc(C(=O)c3nc(C#N)c(C4CC[NH+](C(C)C)CC4)o3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N46C"
} |
Can you make molecule Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)c3cc(C#N)c(C4CC[NH+](C(C)C)CC4)s3)n2c1 | Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 | Cc1ccc2ncc(C(=O)c3cc(C#N)c(C4CC[NH+](C(C)C)CC4)s3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N46C"
} |
Can you make molecule Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)c3ccc(C4CC[NH+](C(C)C)CC4)c(C#N)c3)n2c1 | Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 | Cc1ccc2ncc(C(=O)c3ccc(C4CC[NH+](C(C)C)CC4)c(C#N)c3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N46C"
} |
Can you make molecule Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)ON=C3CCN(C4CC[NH+](C(C)C)CC4)CC3)n2c1 | Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 | Cc1ccc2ncc(C(=O)ON=C3CCN(C4CC[NH+](C(C)C)CC4)CC3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N46C"
} |
Can you make molecule Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)c3cnc(C#N)c(C4CC[NH+](C(C)C)CC4)c3)n2c1 | Cc1ccc2ncc(C(=O)N(C)C3CC[NH+](C(C)C)CC3)n2c1 | Cc1ccc2ncc(C(=O)c3cnc(C#N)c(C4CC[NH+](C(C)C)CC4)c3)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1ncc&cc1&",
"old_substring": "N46C"
} |
Can you make molecule C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC[C@H](Br)CC(=O)N/N=C/c1cccs1 | C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br | CC(C)CC[C@H](Br)CC(=O)N/N=C/c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](Br)CCC(C)C",
"old_substring": "C[C@@]13CC1(Br)Br"
} |
Can you make molecule C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)C(=O)N/N=C/c1cccs1 | C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br | CC[C@@H](C)C[C@H](CC)C(=O)N/N=C/c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "C[C@@]13CC1(Br)Br"
} |
Can you make molecule C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](CC)CC(=O)N/N=C/c1cccs1 | C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br | CCCC[C@H](CC)CC(=O)N/N=C/c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](C&)CC",
"old_substring": "C[C@@]13CC1(Br)Br"
} |
Can you make molecule C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](Cl)CCCC(=O)N/N=C/c1cccs1 | C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br | CCC[C@@H](Cl)CCCC(=O)N/N=C/c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H](Cl)CCC&",
"old_substring": "C[C@@]13CC1(Br)Br"
} |
Can you make molecule C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CBr)(CCC)CC(=O)N/N=C/c1cccs1 | C[C@@]1(C(=O)N/N=C/c2cccs2)CC1(Br)Br | CCCC(CBr)(CCC)CC(=O)N/N=C/c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(C&)(CBr)CCC",
"old_substring": "C[C@@]13CC1(Br)Br"
} |
Can you make molecule CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](Cl)CCCNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](Cl)CCCNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H](Cl)CCC&",
"old_substring": "CCC[C@@H](C)C3=O"
} |
Can you make molecule CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CBr)CNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](CBr)CNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H](C&)CBr",
"old_substring": "CCC[C@@H](C)C3=O"
} |
Can you make molecule CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](Br)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCCC[C@@H](Br)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](Br)C&=O",
"old_substring": "CCC[C@@H](C)C3=O"
} |
Can you make molecule CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](Br)CCNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@H](Br)CCNc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H](Br)CC&",
"old_substring": "CCC[C@@H](C)C3=O"
} |
Can you make molecule CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCC[C@@H](C)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | CCCC[C@@H](CC)C(=O)Nc1cc(C(=O)N[C@H](C)c2ccccc2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@@H](CC)C&=O",
"old_substring": "CCC[C@@H](C)C3=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.