prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2Cl)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccc(I)cc2)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccc(I)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2nn(C)cc2C(=O)N2C[C@@H]3CC[C@H]2C3)cc1I | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 | Cc1ccc(-c2nn(C)cc2C(=O)N2C[C@@H]3CC[C@H]2C3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2cccc(Br)c2)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2cccc(Br)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(-c2nn(C)cc2C(=O)N2C[C@@H]3CC[C@H]2C3)c1C | Cn1cc(C(=O)N2C[C@@H]3CC[C@H]2C3)c(-c2ccccc2)n1 | Cc1cccc(-c2nn(C)cc2C(=O)N2C[C@@H]3CC[C@H]2C3)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule C=CCc1ccccc1OCCn1c(C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccccc1OCCCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OCCCCn1c(C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C3C5"
} |
Can you make molecule C=CCc1ccccc1OCCn1c(C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccccc1OCCCCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OCCCCCn1c(C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C3C5"
} |
Can you make molecule C=CCc1ccccc1OCCn1c(C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccccc1OC1CC(n2c(C)nc3ccccc32)C1 | C=CCc1ccccc1OCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OC1CC(n2c(C)nc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C3C5"
} |
Can you make molecule C=CCc1ccccc1OCCn1c(C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccccc1O[C@@H](C)CCn1c(C)nc2ccccc21 | C=CCc1ccccc1OCCn1c(C)nc2ccccc21 | C=CCc1ccccc1O[C@@H](C)CCn1c(C)nc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C3C5"
} |
Can you make molecule C=CCc1ccccc1OCCn1c(C)nc2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | C=CCc1ccccc1OC1CCC(n2c(C)nc3ccccc32)CC1 | C=CCc1ccccc1OCCn1c(C)nc2ccccc21 | C=CCc1ccccc1OC1CCC(n2c(C)nc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C3C5"
} |
Can you make molecule O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H]([NH+]2CCC(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCC(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]15CCN4CC1"
} |
Can you make molecule O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H]([NH+]2CC(c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CC(c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC&C1",
"old_substring": "[NH+]15CCN4CC1"
} |
Can you make molecule O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H]([NH+]2CCCN(Cc3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCCN(Cc3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCN(C&)CC1",
"old_substring": "[NH+]15CCN4CC1"
} |
Can you make molecule O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H]([NH+]2CCCN[C@H](c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCCN[C@H](c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCN[C@H]&C1",
"old_substring": "[NH+]15CCN4CC1"
} |
Can you make molecule O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H]([NH+]2CCO[C@H](c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCN(c3ccc(Cl)c(Cl)c3)CC2)C(=O)N1c1ccccc1 | O=C1C[C@H]([NH+]2CCO[C@H](c3ccc(Cl)c(Cl)c3)C2)C(=O)N1c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCO[C@H]&C1",
"old_substring": "[NH+]15CCN4CC1"
} |
Can you make molecule N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1nc(-c2ccc(I)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccc(I)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1nc(-c2ccc(Br)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccc(Br)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1nc(-c2ccc(Cl)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccc(Cl)o2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c17ccco1"
} |
Can you make molecule N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1nc(-c2occc2Br)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | N#Cc1nc(-c2occc2Br)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c17ccco1"
} |
Can you make molecule N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccsc1-c1nc(C#N)c(N2CCN(C(=O)CSc3ccc(F)c(F)c3)CC2)o1 | N#Cc1nc(-c2ccco2)oc1N1CCN(C(=O)CSc2ccc(F)c(F)c2)CC1 | Cc1ccsc1-c1nc(C#N)c(N2CCN(C(=O)CSc3ccc(F)c(F)c3)CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c17ccco1"
} |
Can you make molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Fc1ccccc1F | Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Fc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(F)c1F",
"old_substring": "c1%10cccc(F)c1"
} |
Can you make molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1cccc(F)c1 | Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c(F)c1",
"old_substring": "c1%10cccc(F)c1"
} |
Can you make molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1ccccc1C | Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c1%10cccc(F)c1"
} |
Can you make molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1cccc(F)c1F | Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Cc1cccc(F)c1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&c(F)c1F",
"old_substring": "c1%10cccc(F)c1"
} |
Can you make molecule Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Fc1ccc(F)cc1 | Cc1cc(NC(=O)N2CCN(Cc3ccc(-c4cccc(F)c4)s3)CC2)no1 | Cc1cc(NC(=O)N2CCN(Cc3cccs3)CC2)no1.Fc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1F",
"old_substring": "c1%10cccc(F)c1"
} |
Can you make molecule Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)c1Cl | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1csc&c1Cl",
"old_substring": "Cc1csc5n1"
} |
Can you make molecule Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)ncc1Br | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)ncc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "Cc1csc5n1"
} |
Can you make molecule Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)cnc1Cl | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)cnc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cnc1Cl",
"old_substring": "Cc1csc5n1"
} |
Can you make molecule Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)sc1C | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 | Cc1cc(Cn2c3c(sc2=O)C[C@@H](C)CC3)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&sc1C",
"old_substring": "Cc1csc5n1"
} |
Can you make molecule Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc2sc(Cn3c4c(sc3=O)C[C@@H](C)CC4)nc12 | Cc1csc(Cn2c3c(sc2=O)C[C@@H](C)CC3)n1 | Cc1cccc2sc(Cn3c4c(sc3=O)C[C@@H](C)CC4)nc12 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc2sc&nc12",
"old_substring": "Cc1csc5n1"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)NC1C[C@@H](c2ccccc2)C[C@@H](N2CCOCC2)C1 | C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 | C[C@@H](c1ccco1)N(C)C(=O)NC1C[C@@H](c2ccccc2)C[C@@H](N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "C5[C@@H]68"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)N[C@H]1CC[C@@](c2ccccc2)(N2CCOCC2)C1 | C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 | C[C@@H](c1ccco1)N(C)C(=O)N[C@H]1CC[C@@](c2ccccc2)(N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "C5[C@@H]68"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)N[C@H]1CC[C@](c2ccccc2)(N2CCOCC2)C1 | C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 | C[C@@H](c1ccco1)N(C)C(=O)N[C@H]1CC[C@](c2ccccc2)(N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "C5[C@@H]68"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)N[C@@H]1CCC[C@@](c2ccccc2)(N2CCOCC2)C1 | C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 | C[C@@H](c1ccco1)N(C)C(=O)N[C@@H]1CCC[C@@](c2ccccc2)(N2CCOCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "C5[C@@H]68"
} |
Can you make molecule C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](c1ccco1)N(C)C(=O)Nc1ccc(N2CCOCC2)c2[nH]c(-c3ccccc3)cc12 | C[C@@H](c1ccco1)N(C)C(=O)NC[C@H](c1ccccc1)N1CCOCC1 | C[C@@H](c1ccco1)N(C)C(=O)Nc1ccc(N2CCOCC2)c2[nH]c(-c3ccccc3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c2[nH]c&cc12",
"old_substring": "C5[C@@H]68"
} |
Can you make molecule Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCCS3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCCS3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CCCCC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CCCCC3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCCCS3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCCCS3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCSCS3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3SCSCS3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CCCCCC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CC3)cccc2c1 | Cc1cnc2c(S(=O)(=O)N(Cc3ccco3)C3CCCCCC3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CC1"
} |
Can you make molecule Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNSC3=NC(=O)C=[SH]3)[nH+]c2c1C | Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNSC3=NC(=O)C=[SH]3)[nH+]c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC(=O)C=&S1",
"old_substring": "C6%10=O"
} |
Can you make molecule Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C1C2CC3CC1CC(C2)C3.Cc1cc(=O)n(NCCNc2[nH+]c3c(C)c(C)ccc3cc2C#N)nc1C | Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C | C1C2CC3CC1CC(C2)C3.Cc1cc(=O)n(NCCNc2[nH+]c3c(C)c(C)ccc3cc2C#N)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(=O)c&c1C",
"old_substring": "C6%10=O"
} |
Can you make molecule Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNC(=O)n3cc(C#N)cn3)[nH+]c2c1C | Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNC(=O)n3cc(C#N)cn3)[nH+]c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn(C&=O)nc1&",
"old_substring": "C6%10=O"
} |
Can you make molecule Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNCCC=CO)[nH+]c2c1C | Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C | C1C2CC3CC1CC(C2)C3.Cc1ccc2cc(C#N)c(NCCNCCC=CO)[nH+]c2c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C6%10=O"
} |
Can you make molecule Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C less soluble in water? The output molecule should be similar to the input molecule. | C1C2CC3CC1CC(C2)C3.Cc1cc(=O)[nH]cc1NCCNc1[nH+]c2c(C)c(C)ccc2cc1C#N | Cc1ccc2cc(C#N)c(NCCNC(=O)C34CC5CC(CC(C5)C3)C4)[nH+]c2c1C | C1C2CC3CC1CC(C2)C3.Cc1cc(=O)[nH]cc1NCCNc1[nH+]c2c(C)c(C)ccc2cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c[nH]c(=O)c1&",
"old_substring": "C6%10=O"
} |
Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCc1nc2c(s1)CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)C2 | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCc1nc2c(s1)CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCn1ncc2c1CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)C2 | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCn1ncc2c1CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCc1onc2c1CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)CC2 | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCc1onc2c1CN(C(=O)[C@H]1CC[C@H](C[NH3+])O1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCc1cc2n(n1)CCCN2C(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCc1cc2n(n1)CCCN2C(=O)[C@H]1CC[C@H](C[NH3+])O1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCCCc1ccc2c(c1)CCN2C(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCNC(=O)[C@H]1CC[C@H](C[NH3+])O1 | N#CCCCc1ccc2c(c1)CCN2C(=O)[C@H]1CC[C@H](C[NH3+])O1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc2ccc(NC(=O)C=C3CC(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CC(C(=O)OC(C)(C)C)C3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C1=9CN6C1"
} |
Can you make molecule Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc2ccc(NC(=O)C=C3CCN(C(=O)OC(C)(C)C)CC3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CCN(C(=O)OC(C)(C)C)CC3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C1=9CN6C1"
} |
Can you make molecule Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc2ccc(NC(=O)C=CCCC(=O)OC(C)(C)C)cc21 | Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=CCCC(=O)OC(C)(C)C)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C1=9CN6C1"
} |
Can you make molecule Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc2ccc(NC(=O)C=C3CCC(C(=O)OC(C)(C)C)CC3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CCC(C(=O)OC(C)(C)C)CC3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C1=9CN6C1"
} |
Can you make molecule Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc2ccc(NC(=O)C=C3CC(F)(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CN(C(=O)OC(C)(C)C)C3)cc21 | Cn1ccc2ccc(NC(=O)C=C3CC(F)(C(=O)OC(C)(C)C)C3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=9CN6C1"
} |
Can you make molecule CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(SC2=NC(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)C(=O)S2)c1 | CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 | CCOC(=O)c1cccc(SC2=NC(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)C(=O)S2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC=&C(=O)S1",
"old_substring": "N19C(=O)C=8SC1=S"
} |
Can you make molecule CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(SC2=NC(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)S2)c1 | CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 | CCOC(=O)c1cccc(SC2=NC(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)S2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC(=O)C=&S1",
"old_substring": "N19C(=O)C=8SC1=S"
} |
Can you make molecule CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(NC(=S)NN=C2CCC(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)CC2)c1 | CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 | CCOC(=O)c1cccc(NC(=S)NN=C2CCC(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)NN=C1CCC&CC1",
"old_substring": "N19C(=O)C=8SC1=S"
} |
Can you make molecule CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(C(=O)C2=C(N=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)CCS2)c1 | CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 | CCOC(=O)c1cccc(C(=O)C2=C(N=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)CCS2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "N19C(=O)C=8SC1=S"
} |
Can you make molecule CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cccc(N2CCCS/C2=N\C=Cc2cc(OC)c([O-])c([N+](=O)[O-])c2)c1 | CCOC(=O)c1cccc(N2C(=O)C(=Cc3cc(OC)c([O-])c([N+](=O)[O-])c3)SC2=S)c1 | CCOC(=O)c1cccc(N2CCCS/C2=N\C=Cc2cc(OC)c([O-])c([N+](=O)[O-])c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCS/C1=N\\C&",
"old_substring": "N19C(=O)C=8SC1=S"
} |
Can you make molecule CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2CCN2CC(C(=O)c2ccc(NN)nn2)=NC(C2CCCC2)=N1 | CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 | CC(C)CC1=C2CCN2CC(C(=O)c2ccc(NN)nn2)=NC(C2CCCC2)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2c&nc&nc2C1",
"old_substring": "N234"
} |
Can you make molecule CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1=C2OCCN2CC(C(=O)c2ccc(NN)nn2)=CC(C2CCCC2)=C1 | CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 | CC(C)CC1=C2OCCN2CC(C(=O)c2ccc(NN)nn2)=CC(C2CCCC2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2c&cc&cc2C1",
"old_substring": "N234"
} |
Can you make molecule CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(C2CCCC2)CCN(C(=O)c2ccc(NN)nn2)C1 | CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 | CC(C)CC1(C2CCCC2)CCN(C(=O)c2ccc(NN)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N234"
} |
Can you make molecule CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1(C2CCCC2)CCCN(C(=O)c2ccc(NN)nn2)C1 | CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 | CC(C)CC1(C2CCCC2)CCCN(C(=O)c2ccc(NN)nn2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N234"
} |
Can you make molecule CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)Cc1oc(C(=O)c2ccc(NN)nn2)c(C#N)c1C1CCCC1 | CC(C)CN(C(=O)c1ccc(NN)nn1)C1CCCC1 | CC(C)Cc1oc(C(=O)c2ccc(NN)nn2)c(C#N)c1C1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N234"
} |
Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CSCCCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCCCN2CCOCC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CSCCCCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCCCCN2CCOCC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CSC2CC(N3CCOCC3)C2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSC2CC(N3CCOCC3)C2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CS[C@@H](C)CCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CS[C@@H](C)CCN2CCOCC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c(NC(=O)CSC2CCC(N3CCOCC3)CC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSCCN2CCOCC2)c(C)c1 | Cc1cc(C)c(NC(=O)CSC2CCC(N3CCOCC3)CC2)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6C4"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1Cc2ncsc2C1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1Cc2ncsc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N5%12"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCc2nocc2C1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCc2nocc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N5%12"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCCn2nccc21 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCCn2nccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N5%12"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCc2ccccc21 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N5%12"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCn2nccc2C1 | COc1ccc(OC)c(NC(=O)Nc2cc(N3CCN(Cc4ccccc4)CC3)ncn2)c1 | COc1ccc(OC)cc1.O=C(Nc1cc(N2CCN(Cc3ccccc3)CC2)ncn1)N1CCn2nccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2nc&cc2C1",
"old_substring": "N5%12"
} |
Can you make molecule O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(-n2cnnn2)cc1I | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(-n2cnnn2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15cccc7c1"
} |
Can you make molecule O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cc(-n2cnnn2)ccc1Br | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cc(-n2cnnn2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15cccc7c1"
} |
Can you make molecule O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(-n2cnnn2)cc1Cl | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1ccc(-n2cnnn2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15cccc7c1"
} |
Can you make molecule O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1Br | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15cccc7c1"
} |
Can you make molecule O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1Cl | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1 | O=C(OCc1nnc(-c2ccc(Cl)cc2)o1)c1cccc(-n2cnnn2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15cccc7c1"
} |
Can you make molecule CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)N1CCC2(CCC(=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)CC2)CC1 | CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CC[NH+](CC)N1CCC2(CCC(=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC2(CCC&CC2)CC1",
"old_substring": "c18ccc(C=9)cc1"
} |
Can you make molecule CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CC=C1Oc2c(ccc(OCC(N)=O)c2C)C1=O)[NH+](CC)CC | CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CCCC[C@@H](CC=C1Oc2c(ccc(OCC(N)=O)c2C)C1=O)[NH+](CC)CC | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "c18ccc(C=9)cc1"
} |
Can you make molecule CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC(CC)(c2ccc(C=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)cc2)C1 | CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CC[NH+]1CCC(CC)(c2ccc(C=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]678"
} |
Can you make molecule CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@](CC)(c2ccc(C=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)cc2)C1 | CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CC[NH+]1CCC[C@](CC)(c2ccc(C=C3Oc4c(ccc(OCC(N)=O)c4C)C3=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]678"
} |
Can you make molecule CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1[nH+]cn(CC)c1-c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CC[NH+](CC)c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | CCc1[nH+]cn(CC)c1-c1ccc(C=C2Oc3c(ccc(OCC(N)=O)c3C)C2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]678"
} |
Can you make molecule [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCC4)c(F)cc31)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCC1",
"old_substring": "N15CCCC1"
} |
Can you make molecule [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCCC4)c(F)cc31)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1",
"old_substring": "N15CCCC1"
} |
Can you make molecule [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2cc3c(cc2F)[n+]([O-])c2c([n+]3[O-])CCC2)CC1 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 | CC1CCN(c2cc3c(cc2F)[n+]([O-])c2c([n+]3[O-])CCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N15CCCC1"
} |
Can you make molecule [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCCCCCC4)c(F)cc31)CCC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCCC1",
"old_substring": "N15CCCC1"
} |
Can you make molecule [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CCCCCCN1c1cc2c(cc1F)[n+]([O-])c1c([n+]2[O-])CCC1 | [O-][n+]1c2c([n+]([O-])c3cc(N4CCCC4)c(F)cc31)CCC2 | O=C1CCCCCCN1c1cc2c(cc1F)[n+]([O-])c1c([n+]2[O-])CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCCCC1=O",
"old_substring": "N15CCCC1"
} |
Can you make molecule COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](C/C(C)=N\ON2CCCC2)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](C/C(C)=N\ON2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CN1CCCC1)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 | CCC(CC)(C(=O)CN1CCCC1)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](SSC(=O)N2CCCC2)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](SSC(=O)N2CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCN1CCCC1)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 | CCC(CC)(C(=O)CCN1CCCC1)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)N1CCCC1)C(=O)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | COc1ccc([N+](=O)[O-])cc1CN1CCC[NH+](CC(=O)N2CCCC2)CC1 | CC[C@@H](C(=O)N1CCCC1)C(=O)[NH+]1CCCN(Cc2cc([N+](=O)[O-])ccc2OC)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C6C3=O"
} |
Can you make molecule COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(CCCCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(CCCCNC(=S)Nc3ccccc3C)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C7C5"
} |
Can you make molecule COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(CCCCCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(CCCCCNC(=S)Nc3ccccc3C)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C7C5"
} |
Can you make molecule COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(C3CC(NC(=S)Nc4ccccc4C)C3)c2c1 | COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(C3CC(NC(=S)Nc4ccccc4C)C3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C7C5"
} |
Can you make molecule COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc(C3CCN(NC(=S)Nc4ccccc4C)CC3)c2c1 | COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(C3CCN(NC(=S)Nc4ccccc4C)CC3)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "C7C5"
} |
Can you make molecule COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc2[nH]cc([C@@H](C)CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc(CCNC(=S)Nc3ccccc3C)c2c1 | COc1ccc2[nH]cc([C@@H](C)CCNC(=S)Nc3ccccc3C)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C7C5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.