prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc(NS(=O)(=O)c2ccc([C@H]3NN=C(S)N3c3nc(C)cc(C)n3)cc2)n1 | Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 | Cc1ccnc(NS(=O)(=O)c2ccc([C@H]3NN=C(S)N3c3nc(C)cc(C)n3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(S&)=NN[C@@H]1&",
"old_substring": "N5C(=[NH2+])N7"
} |
Can you make molecule Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc(NS(=O)(=O)c2ccc([C@@H]3[NH2+]CCCN3c3nc(C)cc(C)n3)cc2)n1 | Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 | Cc1ccnc(NS(=O)(=O)c2ccc([C@@H]3[NH2+]CCCN3c3nc(C)cc(C)n3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[NH+]&[C@H]1&",
"old_substring": "N5C(=[NH2+])N7"
} |
Can you make molecule Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=N[C@H](c2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)C(=O)N1c1nc(C)cc(C)n1 | Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 | CC1=N[C@H](c2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)C(=O)N1c1nc(C)cc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)[C@]&&N=C1C",
"old_substring": "N5C(=[NH2+])N7"
} |
Can you make molecule Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc(NS(=O)(=O)c2ccc(CC(=O)NOc3nc(C)cc(C)n3)cc2)n1 | Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 | Cc1ccnc(NS(=O)(=O)c2ccc(CC(=O)NOc3nc(C)cc(C)n3)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&NC(=O)[C@H]&&",
"old_substring": "N5C(=[NH2+])N7"
} |
Can you make molecule Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccnc(NS(=O)(=O)c2ccc(N3CCCN(c4nc(C)cc(C)n4)CC3=O)cc2)n1 | Cc1cc(C)nc(NC(=[NH2+])Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)n1 | Cc1ccnc(NS(=O)(=O)c2ccc(N3CCCN(c4nc(C)cc(C)n4)CC3=O)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1CN&C[C@H]&CN1&",
"old_substring": "N5C(=[NH2+])N7"
} |
Can you make molecule CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(c2cccc3ccccc23)CCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 | CCCC1(c2cccc3ccccc23)CCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N357"
} |
Can you make molecule CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(c2cccc3ccccc23)CCCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 | CCCC1(c2cccc3ccccc23)CCCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N357"
} |
Can you make molecule CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1oc(C(=O)c2ccc(CNC(C)=O)cc2)c(C#N)c1-c1cccc2ccccc12 | CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 | CCCc1oc(C(=O)c2ccc(CNC(C)=O)cc2)c(C#N)c1-c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N357"
} |
Can you make molecule CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(c2cccc3ccccc23)CCC(=O)N(C(=O)c2ccc(CNC(C)=O)cc2)C1 | CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 | CCCC1(c2cccc3ccccc23)CCC(=O)N(C(=O)c2ccc(CNC(C)=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N357"
} |
Can you make molecule CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@]1(c2cccc3ccccc23)CCCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | CCCN(C(=O)c1ccc(CNC(C)=O)cc1)c1cccc2ccccc12 | CCC[C@@]1(c2cccc3ccccc23)CCCN(C(=O)c2ccc(CNC(C)=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N357"
} |
Can you make molecule CCOCCN(C)C(=O)C1(CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCCCCN(C)C(=O)C1(CC)CCCC1 | CCOCCN(C)C(=O)C1(CC)CCCC1 | CCOCCCCN(C)C(=O)C1(CC)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C5"
} |
Can you make molecule CCOCCN(C)C(=O)C1(CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCCCCCN(C)C(=O)C1(CC)CCCC1 | CCOCCN(C)C(=O)C1(CC)CCCC1 | CCOCCCCCN(C)C(=O)C1(CC)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C5"
} |
Can you make molecule CCOCCN(C)C(=O)C1(CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC1CC(N(C)C(=O)C2(CC)CCCC2)C1 | CCOCCN(C)C(=O)C1(CC)CCCC1 | CCOC1CC(N(C)C(=O)C2(CC)CCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C5"
} |
Can you make molecule CCOCCN(C)C(=O)C1(CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCO[C@@H](C)CCN(C)C(=O)C1(CC)CCCC1 | CCOCCN(C)C(=O)C1(CC)CCCC1 | CCO[C@@H](C)CCN(C)C(=O)C1(CC)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C5"
} |
Can you make molecule CCOCCN(C)C(=O)C1(CC)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC1CCC(N(C)C(=O)C2(CC)CCCC2)CC1 | CCOCCN(C)C(=O)C1(CC)CCCC1 | CCOC1CCC(N(C)C(=O)C2(CC)CCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C5"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)Cc1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNSC(=O)Cc1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCCC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)CCCC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CC(C)(C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)CC(C)(C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNC(=O)CCC(C)(C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)CCC(C)(C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CNSC(=O)[C@@H](C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNC(=O)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | CNSC(=O)[C@@H](C)c1ccc(C=CC(=O)N2CC[C@@H](C)C[C@H]2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(SC2=NCCN2CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(SC2=NCCN2CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CC[C@@H](N)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(CC[C@@H](N)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N[C@@H]&CC&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2oc(CC(=O)Nc3ccccc3[N+](=O)[O-])nc2C#N)c(C)c1 | Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(-c2oc(CC(=O)Nc3ccccc3[N+](=O)[O-])nc2C#N)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S/C(N)=N/CCC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(S/C(N)=N/CCC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N/C(=N\\C&)S&",
"old_substring": "N45C"
} |
Can you make molecule Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(-c2sc(CC(=O)Nc3ccccc3[N+](=O)[O-])cc2C#N)c(C)c1 | Cc1ccc(N(C)CC(=O)Nc2ccccc2[N+](=O)[O-])c(C)c1 | Cc1ccc(-c2sc(CC(=O)Nc3ccccc3[N+](=O)[O-])cc2C#N)c(C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N45C"
} |
Can you make molecule O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 | O=C(CCC(=O)N1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CC[S@+]([O-])CN1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 | O=C(CC[S@+]([O-])CN1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CC[S@](=O)C&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc2cnccc12)C1=NO[C@H](N2CCN(C(=O)C3CCCCC3)CC2)C1 | O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 | O=C(Nc1cccc2cnccc12)C1=NO[C@H](N2CCN(C(=O)C3CCCCC3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=NO[C@H]&C1",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONc1cccc2cnccc12)C(=O)SN1CCN(C(=O)C2CCCCC2)CC1 | O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 | C/C(=N\ONc1cccc2cnccc12)C(=O)SN1CCN(C(=O)C2CCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCS(=O)(=O)CN1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | O=C(Nc1cccc2cnccc12)C(=O)N1CCN(C(=O)C2CCCCC2)CC1 | O=C(CCCS(=O)(=O)CN1CCN(C(=O)C2CCCCC2)CC1)Nc1cccc2cnccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCCS(=O)(=O)C&",
"old_substring": "O=C3C4=O"
} |
Can you make molecule CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)c(C(=O)[C@H]2CN(CCC(C)C)CCO2)c1 | CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | Cc1ccc(F)c(C(=O)[C@H]2CN(CCC(C)C)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)c(C(=O)[C@H]2CN(CCCCBr)CCO2)c1 | CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | Cc1ccc(F)c(C(=O)[C@H]2CN(CCCCBr)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC3"
} |
Can you make molecule CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | C=CCCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)c(C(=O)[C@H]2CN(CCCCCl)CCO2)c1 | CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | Cc1ccc(F)c(C(=O)[C@H]2CN(CCCCCl)CCO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC3"
} |
Can you make molecule CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | CCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | C=CCCCCN1CCO[C@@H](C(=O)c2cc(C)ccc2F)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CCC3"
} |
Can you make molecule CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@]1(C(C)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(C)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@]1(CCCCC(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(CCCCC(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@]1(C/C(N)=N\O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C/C(N)=N\O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(N)=N\\O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@]1(CC/C(N)=N/O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(CC/C(N)=N/O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN[C@@]1(CC/C(N)=N\O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(C(N)=O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | CN[C@@]1(CC/C(N)=N\O)CC[C@@H](N2CC[C@H]([NH+]3CCCCC3)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C7(N)=O"
} |
Can you make molecule CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2[nH+]cc(C(=O)[O-])cc2Cl)CC1 | CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 | CC1CCN(c2[nH+]cc(C(=O)[O-])cc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cc&cc1Cl",
"old_substring": "c13[nH+]cccc14"
} |
Can you make molecule CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2n[nH]c3ccc(C(=O)[O-])cc23)CC1 | CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 | CC1CCN(c2n[nH]c3ccc(C(=O)[O-])cc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&n[nH]c2ccc&cc12",
"old_substring": "c13[nH+]cccc14"
} |
Can you make molecule CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2n[nH]c3cccc(C(=O)[O-])c23)CC1 | CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 | CC1CCN(c2n[nH]c3cccc(C(=O)[O-])c23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&n[nH]c2cccc&c12",
"old_substring": "c13[nH+]cccc14"
} |
Can you make molecule CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2n[nH]c3cc(C(=O)[O-])ccc23)CC1 | CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 | CC1CCN(c2n[nH]c3cc(C(=O)[O-])ccc23)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&n[nH]c2cc&ccc12",
"old_substring": "c13[nH+]cccc14"
} |
Can you make molecule CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1CCN(c2nccc(C(=O)[O-])c2I)CC1 | CC1CCN(c2[nH+]cccc2C(=O)[O-])CC1 | CC1CCN(c2nccc(C(=O)[O-])c2I)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c13[nH+]cccc14"
} |
Can you make molecule COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | COCc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | COCSc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | CC(=O)Sc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CC[C@@H](Oc2cccc(C(=O)CS)n2)C1 | COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | [NH3+][C@H]1CC[C@@H](Oc2cccc(C(=O)CS)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+][C@H]1CC[C@@H](Oc2cccc(C(=O)CI)n2)C1 | COc1cccc(O[C@@H]2CC[C@H]([NH3+])C2)n1 | [NH3+][C@H]1CC[C@@H](Oc2cccc(C(=O)CI)n2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1NC(CC[C@@H]2CSc3ccccc32)=NO1 | CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O | CCC[C@@H]1NC(CC[C@@H]2CSc3ccccc32)=NO1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NC(C&)=NO1",
"old_substring": "[C@@H]15NC(=O)N4C1=O"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1C=C(CC[C@@H]2CSc3ccccc32)N=N1 | CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O | CCC[C@@H]1C=C(CC[C@@H]2CSc3ccccc32)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(C&)N=N1",
"old_substring": "[C@@H]15NC(=O)N4C1=O"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1CN(C[C@@H]2CSc3ccccc32)C(=O)O1 | CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O | CCC[C@@H]1CN(C[C@@H]2CSc3ccccc32)C(=O)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C(=O)O1",
"old_substring": "[C@@H]15NC(=O)N4C1=O"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1N=NC(CC[C@@H]2CSc3ccccc32)=N1 | CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O | CCC[C@@H]1N=NC(CC[C@@H]2CSc3ccccc32)=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC(C&)=N1",
"old_substring": "[C@@H]15NC(=O)N4C1=O"
} |
Can you make molecule CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H]1C=C(NC[C@@H]2CSc3ccccc32)N=N1 | CCC[C@@H]1NC(=O)N(C[C@@H]2CSc3ccccc32)C1=O | CCC[C@@H]1C=C(NC[C@@H]2CSc3ccccc32)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C(N&)N=N1",
"old_substring": "[C@@H]15NC(=O)N4C1=O"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OCCN1CCN(C(=O)N[C@@H](C)CCC(C)(C)C)CC1 | CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 | CC(C)OCCN1CCN(C(=O)N[C@@H](C)CCC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@@H]18CCCC[C@@H]1C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C[C@H](CC)NC(=O)N1CCN(CCOC(C)C)CC1 | CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 | CC[C@@H](C)C[C@H](CC)NC(=O)N1CCN(CCOC(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&C[C@H](C)CC",
"old_substring": "[C@@H]18CCCC[C@@H]1C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)OCCN1CCN(C(=O)NC2CCCCCCC2)CC1 | CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 | CC(C)OCCN1CCN(C(=O)NC2CCCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "[C@@H]18CCCC[C@@H]1C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C(C)C[C@H](NC(=O)N2CCN(CCOC(C)C)CC2)S1 | CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 | CCC1=C(C)C[C@H](NC(=O)N2CCN(CCOC(C)C)CC2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC1=C(C)C[C@H]&S1",
"old_substring": "[C@@H]18CCCC[C@@H]1C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)NC(=O)N1CCN(CCOC(C)C)CC1 | CC(C)OCCN1CCN(C(=O)N[C@@H]2CCCC[C@@H]2C)CC1 | CCCCCC[C@@H](C)NC(=O)N1CCN(CCOC(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@H]&C",
"old_substring": "[C@@H]18CCCC[C@@H]1C"
} |
Can you make molecule COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COCc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COCSc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(SC(C)=O)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COc1c(SC(C)=O)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)CS)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COc1c(C(=O)CS)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1c(C(=O)CI)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | COc1ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c2c1OC | COc1c(C(=O)CI)ccc2cnn(CC(=O)Nc3cccnc3)c(=O)c12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccc(I)cc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1cc(I)ccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1cc(I)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1Cl | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1cc(F)ccc1Br | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccc(F)cc1Cl | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccccc1F | CCOC(=O)c1cc2c(=O)n3ccccc3nc2n(C[C@H]2CCCO2)c1=NC(=O)c1ccc(F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccccc1F"
} |
Can you make molecule O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)COSC(=O)Cc2ccccc2O)c2ccccc2N1 | O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 | O=C1CN(C(=O)COSC(=O)Cc2ccccc2O)c2ccccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CN(C(=O)COC(=O)CCCC(=O)c2ccccc2O)c2ccccc2N1 | O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 | O=C1CN(C(=O)COC(=O)CCCC(=O)c2ccccc2O)c2ccccc2N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)OCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 | CC(C)(CC(=O)OCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)OCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 | CC(C)(CCC(=O)OCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SOCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | O=C1CN(C(=O)COC(=O)c2ccccc2O)c2ccccc2N1 | C[C@H](C(=O)SOCC(=O)N1CC(=O)Nc2ccccc21)c1ccccc1O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(=O)c2cc(CC(=O)SNc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(CC(=O)SNc3ccccc3Cl)c(=O)[nH]c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(=O)c2cc(C(=O)CCCC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)CCCC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(=O)c2cc(C(C)(C)CC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(C)(C)CC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(=O)c2cc(C(C)(C)CCC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(C)(C)CCC(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC(=O)c2cc([C@H](C)C(=O)SNc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc(C(=O)Nc3ccccc3Cl)c(=O)[nH]c2C1 | C[C@@H]1CC(=O)c2cc([C@H](C)C(=O)SNc3ccccc3Cl)c(=O)[nH]c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]Cc1ccc(OC2CCCC2)cc1I)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1ccc(OC2CCCC2)cc1I)c1ccc2c(c1)NC(=O)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c18cccc4c1"
} |
Can you make molecule C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]Cc1cc(OC2CCCC2)ccc1Br)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cc(OC2CCCC2)ccc1Br)c1ccc2c(c1)NC(=O)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c18cccc4c1"
} |
Can you make molecule C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]Cc1ccc(OC2CCCC2)cc1Cl)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1ccc(OC2CCCC2)cc1Cl)c1ccc2c(c1)NC(=O)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c18cccc4c1"
} |
Can you make molecule C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1Br)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1Br)c1ccc2c(c1)NC(=O)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c18cccc4c1"
} |
Can you make molecule C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1Cl)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1)c1ccc2c(c1)NC(=O)CO2 | C[C@@H]([NH2+]Cc1cccc(OC2CCCC2)c1Cl)c1ccc2c(c1)NC(=O)CO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c18cccc4c1"
} |
Can you make molecule COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)NCC[NH+](C)C2CCCCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)NCC[NH+](C)SC2=CCCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)SC2=CCCCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)NCC[NH+](C)C2CCCCCCCCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCCCCCCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)NCC[NH+](C)C2(C#N)CCCCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2(C#N)CCCCCCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C17CCCCC1"
} |
Can you make molecule COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C(=O)NCC[NH+](C)C2C3=CC=CC=C2CCCC3)c1F | COc1cccc(C(=O)NCC[NH+](C)C2CCCCC2)c1F | COc1cccc(C(=O)NCC[NH+](C)C2C3=CC=CC=C2CCCC3)c1F | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C17CCCCC1"
} |
Can you make molecule COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Cc2sc(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)cc2C#N)c1 | COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 | COc1cccc(Cc2sc(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)cc2C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N47C"
} |
Can you make molecule COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Cc2ccc(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)cc2C#N)c1 | COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 | COc1cccc(Cc2ccc(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)cc2C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N47C"
} |
Can you make molecule COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CN2CCC(=NOC(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)CC2)c1 | COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 | COc1cccc(CN2CCC(=NOC(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N47C"
} |
Can you make molecule COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCC2=CCCN(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)C2)c1 | COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 | COc1cccc(CCC2=CCCN(C(=O)N[C@H]3CCC[NH+](Cc4ccccc4)C3)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC=C(C&)C1",
"old_substring": "N47C"
} |
Can you make molecule COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(Cc2nc3c(s2)CN(C(=O)N[C@H]2CCC[NH+](Cc4ccccc4)C2)C3)c1 | COc1cccc(CN(C)C(=O)N[C@H]2CCC[NH+](Cc3ccccc3)C2)c1 | COc1cccc(Cc2nc3c(s2)CN(C(=O)N[C@H]2CCC[NH+](Cc4ccccc4)C2)C3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N47C"
} |
Can you make molecule O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | O=C(/C=C/SOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(Oc2ccccc2)CC1)N1CCC(c2ccc(F)cc2)CC1 | O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | O=C(NN=C1CCC(Oc2ccccc2)CC1)N1CCC(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCC(c2ccc(F)cc2)CC1)C(=O)SOc1ccccc1 | O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | C/C(=N\ON1CCC(c2ccc(F)cc2)CC1)C(=O)SOc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=CC[C@H](Oc2ccccc2)S1)N1CCC(c2ccc(F)cc2)CC1 | O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | O=C(C1=CC[C@H](Oc2ccccc2)S1)N1CCC(c2ccc(F)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3CC4"
} |
Can you make molecule O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON1CCC(c2ccc(F)cc2)CC1)[C@H](C)Oc1ccccc1 | O=C(CCOc1ccccc1)N1CCC(c2ccc(F)cc2)CC1 | C/C(=N\ON1CCC(c2ccc(F)cc2)CC1)[C@H](C)Oc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)[C@@H]&C",
"old_substring": "O=C3CC4"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.