prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CC(=O)SN(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1CC(=O)SN(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(=O)CCCC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)CCCC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(C)(C)CC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(C)(C)CC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(C)(C)CCC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(C)(C)CCC(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H](C)C(=O)SN(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1C(=O)N(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | COc1ccccc1[C@H](C)C(=O)SN(c1ccc(C)cc1)[C@@H]1C=CS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C26=O"
} |
Can you make molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)CCCONC(=O)[C@H]1CCCc2sccc21 | NC(=O)CONC(=O)[C@H]1CCCc2sccc21 | NC(=O)CCCONC(=O)[C@H]1CCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=O)CCC&",
"old_substring": "NC(=O)C3"
} |
Can you make molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | NC(=O)[C@@H](Cl)ONC(=O)[C@H]1CCCc2sccc21 | NC(=O)CONC(=O)[C@H]1CCCc2sccc21 | NC(=O)[C@@H](Cl)ONC(=O)[C@H]1CCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=O)[C@H]&Cl",
"old_substring": "NC(=O)C3"
} |
Can you make molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | NC(=S)C1(ONC(=O)[C@H]2CCCc3sccc32)CCCC1 | NC(=O)CONC(=O)[C@H]1CCCc2sccc21 | NC(=S)C1(ONC(=O)[C@H]2CCCc3sccc32)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "NC(=S)C1&CCCC1",
"old_substring": "NC(=O)C3"
} |
Can you make molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)ONC(=O)[C@H]1CCCc2sccc21 | NC(=O)CONC(=O)[C@H]1CCCc2sccc21 | O=C(CS)ONC(=O)[C@H]1CCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "NC(=O)C3"
} |
Can you make molecule NC(=O)CONC(=O)[C@H]1CCCc2sccc21 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)ONC(=O)[C@H]1CCCc2sccc21 | NC(=O)CONC(=O)[C@H]1CCCc2sccc21 | O=C(CI)ONC(=O)[C@H]1CCCc2sccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "NC(=O)C3"
} |
Can you make molecule COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1I | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)ccc1Br | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 | COc1cc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1Cl | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)c1Br | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)c1Cl | COc1ccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)cc1 | COc1cccc([C@H]2[C@@H](C(=O)Nc3cnn(CC(C)C)c3)CC(=O)N2C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(I)o3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(I)o3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(Br)o3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(Br)o3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(Cl)o3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccc(Cl)o3)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3occc3Br)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3occc3Br)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c19ccco1"
} |
Can you make molecule CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3sccc3C)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3ccco3)nn12 | CC[NH+](CC)CCNc1nc2sc(C)c(C)c2c2nc(-c3sccc3C)nn12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c19ccco1"
} |
Can you make molecule CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CO)NC(=O)CC(C)(C)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)CC(C)(C)Nc1ccc(N2CCc3sccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CO)NC(=O)CCC(C)(C)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)CCC(C)(C)Nc1ccc(N2CCc3sccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CO)NC(=O)C[C@@H](Br)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)NC(=O)C[C@@H](Br)Nc1ccc(N2CCc3sccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CO)Nc1cc(C)n(Nc2ccc(N3CCc4sccc4C3)cc2)c(=O)c1 | CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)Nc1cc(C)n(Nc2ccc(N3CCc4sccc4C3)cc2)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@](C)(CO)Nc1c(C)n(Nc2ccc(N3CCc4sccc4C3)cc2)ccc1=O | CCC[C@@](C)(CO)NC(=O)Nc1ccc(N2CCc3sccc3C2)cc1 | CCC[C@@](C)(CO)Nc1c(C)n(Nc2ccc(N3CCc4sccc4C3)cc2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCCCC1)SN1CCN(c2nc3cccnc3s2)CC1 | O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 | O=C(CCC(=O)N1CCCCC1)SN1CCN(c2nc3cccnc3s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CC(c2nc3cccnc3s2)C1)N1CCCCC1 | O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 | O=C(CCC(=O)N1CC(c2nc3cccnc3s2)C1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCCN(c2nc3cccnc3s2)C1=O)N1CCCCC1 | O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 | O=C(CCC(=O)N1CCCN(c2nc3cccnc3s2)C1=O)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)N1CCN=C1Sc1nc2cccnc2s1)N1CCCCC1 | O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 | O=C(CCC(=O)N1CCN=C1Sc1nc2cccnc2s1)N1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(C(=O)CCC(=O)N2CCCCC2)CCN1c1nc2cccnc2s1 | O=C(CCC(=O)N1CCN(c2nc3cccnc3s2)CC1)N1CCCCC1 | CC1(C)CN(C(=O)CCC(=O)N2CCCCC2)CCN1c1nc2cccnc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N15CCN6CC1"
} |
Can you make molecule COc1ccccc1/N=N\c1c(O)n[nH]c1C less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1/N=N\c1c(O)n[nH]c1C | COc1ccccc1/N=N\c1c(O)n[nH]c1C | COCc1ccccc1/N=N\c1c(O)n[nH]c1C | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1/N=N\c1c(O)n[nH]c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1OCc2ccccc2CO1 | COc1ccccc1/N=N\c1c(O)n[nH]c1C | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1OCc2ccccc2CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1/N=N\c1c(O)n[nH]c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1(O)Cc2ccccc2C1 | COc1ccccc1/N=N\c1c(O)n[nH]c1C | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1(O)Cc2ccccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1/N=N\c1c(O)n[nH]c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1=CC2=NN2C[C@@H](C)CO1 | COc1ccccc1/N=N\c1c(O)n[nH]c1C | Cc1[nH]nc(O)c1/N=N\c1ccccc1C1=CC2=NN2C[C@@H](C)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1/N=N\c1c(O)n[nH]c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1[nH]nc(O)c1/N=N\c1ccccc1N1CCOc2ccccc21 | COc1ccccc1/N=N\c1c(O)n[nH]c1C | Cc1[nH]nc(O)c1/N=N\c1ccccc1N1CCOc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | COCc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2OCc3ccccc3CO2)cc1 | COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2OCc3ccccc3CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2(O)Cc3ccccc3C2)cc1 | COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2(O)Cc3ccccc3C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2=CC3=NN3C[C@@H](C)CO2)cc1 | COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | Cc1ccc(C[C@H](C#N)Sc2ccccc2C2=CC3=NN3C[C@@H](C)CO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](C#N)Sc2ccccc2N2CCOc3ccccc32)cc1 | COc1ccccc1S[C@@H](C#N)Cc1ccc(C)cc1 | Cc1ccc(C[C@H](C#N)Sc2ccccc2N2CCOc3ccccc32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Cc1cccnc1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Cc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1C",
"old_substring": "c1%10ccncc1"
} |
Can you make molecule CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Clc1cccnc1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Clc1cccnc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c1%10ccncc1"
} |
Can you make molecule CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.c1ccccc1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c1%10ccncc1"
} |
Can you make molecule CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Clc1ccncc1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Clc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c1%10ccncc1"
} |
Can you make molecule CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Fc1ccc(Br)nc1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)nc(-c2ccncc2)n1 | CNc1cc([C@H]2CCCN(Cc3cccc(OC)c3OC)C2)ncn1.Fc1ccc(Br)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c1%10ccncc1"
} |
Can you make molecule C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCCCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCC&",
"old_substring": "C#CC6"
} |
Can you make molecule C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCCCCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCCCCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCCCC&",
"old_substring": "C#CC6"
} |
Can you make molecule C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(C)(C)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CC(C)(C)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(C)C",
"old_substring": "C#CC6"
} |
Can you make molecule C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(C)(C)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCC(C)(C)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CCC&(C)C",
"old_substring": "C#CC6"
} |
Can you make molecule C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC(CC)(CC)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CCN1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | C#CC(CC)(CC)N1CCN(C(=O)NC[C@@H](C)N2CCc3ccccc32)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C#CC&(CC)CC",
"old_substring": "C#CC6"
} |
Can you make molecule O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1cn2ccccc2n1)c1ccc(Cc2nc3cccnc3s2)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cc2nc3cccnc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2cccnc2s1",
"old_substring": "n17nnc2ccccc21"
} |
Can you make molecule O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1cn2ccccc2n1)c1ccc(Cc2nc3cnccc3s2)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cc2nc3cnccc3s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2cnccc2s1",
"old_substring": "n17nnc2ccccc21"
} |
Can you make molecule O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2cc3ccccc3c2)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2cc3ccccc3c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc2ccccc2c1",
"old_substring": "n17nnc2ccccc21"
} |
Can you make molecule O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1nc(Cc2ccc(C(=O)OCc3cn4ccccc4n3)cc2)c2ccccc21 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 | Cn1nc(Cc2ccc(C(=O)OCc3cn4ccccc4n3)cc2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1nc&c2ccccc21",
"old_substring": "n17nnc2ccccc21"
} |
Can you make molecule O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn2ccccc2c1Cc1ccc(C(=O)OCc2cn3ccccc3n2)cc1 | O=C(OCc1cn2ccccc2n1)c1ccc(Cn2nnc3ccccc32)cc1 | Cc1nn2ccccc2c1Cc1ccc(C(=O)OCc2cn3ccccc3n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn2ccccc2c1&",
"old_substring": "n17nnc2ccccc21"
} |
Can you make molecule COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1I | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)ccc1Br | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 | COc1cc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1Cl | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)c1Br | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 | COc1cccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)c1Cl | COc1ccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)cc1 | COc1cccc(SCC(=O)Nc2ccc(N3CC[NH+](C)CC3)c(F)c2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccc9cc1"
} |
Can you make molecule CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COCO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O | COCO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "COCO&",
"old_substring": "C4CO"
} |
Can you make molecule CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O | C=CO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C4CO"
} |
Can you make molecule CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O | CCC(=O)[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C4CO"
} |
Can you make molecule CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C=CO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O | C=C=CO[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C4CO"
} |
Can you make molecule CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | CC1(C)CCC[C@@H](C[NH+](CCO)C2CCCCC2)C1=O | CC[NH+](C[C@@H]1CCCC(C)(C)C1=O)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C4CO"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnc3C)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnc3C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccnc1C",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cnc(I)n3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cnc(I)n3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1ncn&n1",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccn(-c2ccc(C(=O)N3C[C@H](c4ccccc4C)C[C@@H]3C)cc2)n1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 | Cc1ccn(-c2ccc(C(=O)N3C[C@H](c4ccccc4C)C[C@@H]3C)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc(C)n1",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cccnc3=O)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cccnc3=O)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cccnc1=O",
"old_substring": "n16ccnn1"
} |
Can you make molecule Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cc(I)cn3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3ccnn3)cc2)C1 | Cc1ccccc1[C@@H]1C[C@H](C)N(C(=O)c2ccc(-n3cc(I)cn3)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cn1",
"old_substring": "n16ccnn1"
} |
Can you make molecule COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CN(SC(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(SC(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CN(C(=O)CCCC(=O)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)CCCC(=O)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CN(C(=O)CC(C)(C)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)CC(C)(C)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CN(C[S@+]([O-])CCCn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C[S@+]([O-])CCCn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C8"
} |
Can you make molecule COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CN(C(=O)CCC(C)(C)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)Cn3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | COc1ccc([C@@H]2CN(C(=O)CCC(C)(C)n3nc4ccccc4n3)C[C@H]2[NH+](C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C8"
} |
Can you make molecule Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2Cl)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccccc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccccc2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cnccc2Cl)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cnccc2Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cc(Br)ncc2F)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cc(Br)ncc2F)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ncc1F",
"old_substring": "c18ccncc1"
} |
Can you make molecule Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cc(C)c(Br)cn2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2ccncc2)ccc1Cl | Cc1cc(N(CCC#N)C(=O)CN(C)[C@H](C)c2cc(C)c(Br)cn2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&ncc1Br",
"old_substring": "c18ccncc1"
} |
Can you make molecule CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CCCC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CCCCC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)CCCc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCCc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CCC(=O)CCCc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)CCC&",
"old_substring": "CC7=O"
} |
Can you make molecule CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Cc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CC(=O)c1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | CCCCC(=O)Cc1ccc(NC(=O)[C@@H](C)Nc2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC(=O)C&",
"old_substring": "CC7=O"
} |
Can you make molecule Cc1cc2noc(-c3ccccc3)c2cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2noc(-c3ccccc3Cl)c2cc1Cl | Cc1cc2noc(-c3ccccc3)c2cc1Cl | Cc1cc2noc(-c3ccccc3Cl)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1cc2noc(-c3ccccc3)c2cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2noc(-c3ccc(I)cc3)c2cc1Cl | Cc1cc2noc(-c3ccccc3)c2cc1Cl | Cc1cc2noc(-c3ccc(I)cc3)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1cc2noc(-c3ccccc3)c2cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2noc(-c3ccc(C)c(I)c3)c2cc1Cl | Cc1cc2noc(-c3ccccc3)c2cc1Cl | Cc1cc2noc(-c3ccc(C)c(I)c3)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1cc2noc(-c3ccccc3)c2cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2noc(-c3cccc(Br)c3)c2cc1Cl | Cc1cc2noc(-c3ccccc3)c2cc1Cl | Cc1cc2noc(-c3cccc(Br)c3)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule Cc1cc2noc(-c3ccccc3)c2cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2noc(-c3cccc(C)c3C)c2cc1Cl | Cc1cc2noc(-c3ccccc3)c2cc1Cl | Cc1cc2noc(-c3cccc(C)c3C)c2cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1NC(=O)NC1C[C@@H](c2cccs2)C[C@@H](N2CC[NH+](C)CC2)C1 | CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 | CCOc1ncccc1NC(=O)NC1C[C@@H](c2cccs2)C[C@@H](N2CC[NH+](C)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C[C@H]&C[C@H]&C1",
"old_substring": "C6[C@@H]79"
} |
Can you make molecule CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1NC(=O)N[C@H]1CC[C@@](c2cccs2)(N2CC[NH+](C)CC2)C1 | CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 | CCOc1ncccc1NC(=O)N[C@H]1CC[C@@](c2cccs2)(N2CC[NH+](C)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@]&&C1",
"old_substring": "C6[C@@H]79"
} |
Can you make molecule CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1NC(=O)N[C@H]1CC[C@](c2cccs2)(N2CC[NH+](C)CC2)C1 | CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 | CCOc1ncccc1NC(=O)N[C@H]1CC[C@](c2cccs2)(N2CC[NH+](C)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@@]&&C1",
"old_substring": "C6[C@@H]79"
} |
Can you make molecule CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1NC(=O)N[C@@H]1CCC[C@@](c2cccs2)(N2CC[NH+](C)CC2)C1 | CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 | CCOc1ncccc1NC(=O)N[C@@H]1CCC[C@@](c2cccs2)(N2CC[NH+](C)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCC[C@]&&C1",
"old_substring": "C6[C@@H]79"
} |
Can you make molecule CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ncccc1NC(=O)Nc1ccc(N2CC[NH+](C)CC2)c2[nH]c(-c3cccs3)cc12 | CCOc1ncccc1NC(=O)NC[C@H](c1cccs1)N1CC[NH+](C)CC1 | CCOc1ncccc1NC(=O)Nc1ccc(N2CC[NH+](C)CC2)c2[nH]c(-c3cccs3)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&c2[nH]c&cc12",
"old_substring": "C6[C@@H]79"
} |
Can you make molecule N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CCCCC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1SCCCS1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1SCCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1SCSCS1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1SCSCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CCCCCC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CSCCSC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CC1 | N#C[C@@H](NC(=O)c1ccc(F)c(F)c1F)C1CSCCSC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C15CC1"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.