prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNSC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNSC(=O)CN1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CCCC(=O)N1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CCCC(=O)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CC(C)(C)N1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CC(C)(C)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC[S@+]([O-])CCCN1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNC[S@+]([O-])CCCN1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C5"
} |
Can you make molecule CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCNC(=O)CCC(C)(C)N1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CN1C(=O)c2ccccc2C1=O | CC(C)CCNC(=O)CCC(C)(C)N1C(=O)c2ccccc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C5"
} |
Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(Cc2cc3cc(F)ccc3s2)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(Cc2cc3cc(F)ccc3s2)c2ccccc2[C@]1(O)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(F)ccc2s1",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(C=Cc2cccc(F)c2F)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(C=Cc2cccc(F)c2F)c2ccccc2[C@]1(O)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(F)c1F",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)cccc1CN1C(=O)[C@@](O)(c2cccc(F)c2)c2ccccc21 | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | Cc1c(Br)cccc1CN1C(=O)[C@@](O)(c2cccc(F)c2)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(Br)c1C",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(CN2C(=O)[C@@](O)(c3cccc(F)c3)c3ccccc32)oc2ccc(F)cc12 | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | Cc1c(CN2C(=O)[C@@](O)(c3cccc(F)c3)c3ccccc32)oc2ccc(F)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(F)cc2c1C",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(Cc2cc(F)ccc2Br)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(Cc2cccc(F)c2)c2ccccc2[C@]1(O)c1cccc(F)c1 | O=C1N(Cc2cc(F)ccc2Br)c2ccccc2[C@]1(O)c1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c13cccc(F)c1"
} |
Can you make molecule Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCC[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1CCCC[NH2+][C@@H](C)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1CCCCC[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1CCCCC[NH2+][C@@H](C)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1C1CC([NH2+][C@@H](C)c2nc3ccccc3s2)C1 | Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1C1CC([NH2+][C@@H](C)c2nc3ccccc3s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1SC(=S)O[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1SC(=S)O[NH2+][C@@H](C)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(C)c1NC(=S)S[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1C[NH2+][C@@H](C)c1nc2ccccc2s1 | Cc1noc(C)c1NC(=S)S[NH2+][C@@H](C)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C36"
} |
Can you make molecule CCOC(=O)c1cnn(C(=O)OCC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)n1ncc(C(=O)N2CCOc3ccc(CC)cc3C2)c1N | CCOC(=O)c1cnn(C(=O)OCC)c1N | CCOC(=O)n1ncc(C(=O)N2CCOc3ccc(CC)cc3C2)c1N | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O24"
} |
Can you make molecule CCOC(=O)c1cnn(C(=O)OCC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)n1ncc(C(=O)c2cc3ccc-3ncn(CC)c2=O)c1N | CCOC(=O)c1cnn(C(=O)OCC)c1N | CCOC(=O)n1ncc(C(=O)c2cc3ccc-3ncn(CC)c2=O)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O24"
} |
Can you make molecule CCOC(=O)c1cnn(C(=O)OCC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)n1ncc(C(=O)c2ccc3nc-3ccn(CC)c2=O)c1N | CCOC(=O)c1cnn(C(=O)OCC)c1N | CCOC(=O)n1ncc(C(=O)c2ccc3nc-3ccn(CC)c2=O)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O24"
} |
Can you make molecule CCOC(=O)c1cnn(C(=O)OCC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)n1ncc(C(=O)c2cnc3nc-3ccn(CC)c2=O)c1N | CCOC(=O)c1cnn(C(=O)OCC)c1N | CCOC(=O)n1ncc(C(=O)c2cnc3nc-3ccn(CC)c2=O)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O24"
} |
Can you make molecule CCOC(=O)c1cnn(C(=O)OCC)c1N less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)n1ncc(C(=O)c2oc3ccc(CC)cc3c2C=O)c1N | CCOC(=O)c1cnn(C(=O)OCC)c1N | CCOC(=O)n1ncc(C(=O)c2oc3ccc(CC)cc3c2C=O)c1N | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1c&oc2ccc&cc12",
"old_substring": "O24"
} |
Can you make molecule O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/S[C@H]1CCC(=O)N(C2CCCCCC2)C1)NCCc1ccc(Cl)cc1 | O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C(/C=C/S[C@H]1CCC(=O)N(C2CCCCCC2)C1)NCCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCc2ccc(Cl)cc2)nc1[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=Cc1sc(NCCc2ccc(Cl)cc2)nc1[C@H]1CCC(=O)N(C2CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCc2ccc(Cl)cc2)sc1[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=Cc1nc(NCCc2ccc(Cl)cc2)sc1[C@H]1CCC(=O)N(C2CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1ccc(Cl)cc1)N/N=C/C[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C(NCCc1ccc(Cl)cc1)N/N=C/C[C@H]1CCC(=O)N(C2CCCCCC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1CC[C@H](N2CCC(=NONCCc3ccc(Cl)cc3)CC2)CN1C1CCCCCC1 | O=C(NCCc1ccc(Cl)cc1)[C@H]1CCC(=O)N(C2CCCCCC2)C1 | O=C1CC[C@H](N2CCC(=NONCCc3ccc(Cl)cc3)CC2)CN1C1CCCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "O=C35"
} |
Can you make molecule O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1I | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c12ccc(Br)cc1"
} |
Can you make molecule O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1Br | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c12ccc(Br)cc1"
} |
Can you make molecule O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C1NCCCCCN1)c1cc(Br)ccc1I | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 | O=C(N=C1NCCCCCN1)c1cc(Br)ccc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c12ccc(Br)cc1"
} |
Can you make molecule O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C1NCCCCCN1)c1ccc(Br)c(Cl)c1F | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 | O=C(N=C1NCCCCCN1)c1ccc(Br)c(Cl)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(Cl)c1F",
"old_substring": "c12ccc(Br)cc1"
} |
Can you make molecule O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=C1NCCCCCN1)c1cc(Br)ccc1Cl | O=C(N=C1NCCCCCN1)c1ccc(Br)cc1 | O=C(N=C1NCCCCCN1)c1cc(Br)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c12ccc(Br)cc1"
} |
Can you make molecule O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@]1(O)CCOC1)Nc1ccc(-c2ccc3c(c2)CCO3)cc1I | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 | O=C(NC[C@]1(O)CCOC1)Nc1ccc(-c2ccc3c(c2)CCO3)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17cccc9c1"
} |
Can you make molecule O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@]1(O)CCOC1)Nc1cc(-c2ccc3c(c2)CCO3)ccc1Br | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 | O=C(NC[C@]1(O)CCOC1)Nc1cc(-c2ccc3c(c2)CCO3)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17cccc9c1"
} |
Can you make molecule O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@]1(O)CCOC1)Nc1ccc(-c2ccc3c(c2)CCO3)cc1Cl | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 | O=C(NC[C@]1(O)CCOC1)Nc1ccc(-c2ccc3c(c2)CCO3)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17cccc9c1"
} |
Can you make molecule O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1Br | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17cccc9c1"
} |
Can you make molecule O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1Cl | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1 | O=C(NC[C@]1(O)CCOC1)Nc1cccc(-c2ccc3c(c2)CCO3)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17cccc9c1"
} |
Can you make molecule CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCCC4)cc(c23)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCCCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCCCC4)cc(c23)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCSCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCSCC4)cc(c23)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CC=CC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CC=CC4)cc(c23)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC=CC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1C(=O)c2cccc3cc(S(=O)(=O)SSN4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)N4CCOCC4)cc(c23)C1=O | CN1C(=O)c2cccc3cc(S(=O)(=O)SSN4CCOCC4)cc(c23)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&SN1CCOCC1",
"old_substring": "N15CCOCC1"
} |
Can you make molecule CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1C(=O)/C(=C\Nc2ccc(CC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(CC(F)(F)F)cc2)C(=O)NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)F",
"old_substring": "O3C(F)(F)F"
} |
Can you make molecule CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1C(=O)/C(=C\Nc2ccc(SC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(SC(F)(F)F)cc2)C(=O)NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "O3C(F)(F)F"
} |
Can you make molecule CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1C(=O)/C(=C\Nc2ccc([C@@H](O)CCC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc([C@@H](O)CCC(F)(F)F)cc2)C(=O)NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CCC(F)(F)F",
"old_substring": "O3C(F)(F)F"
} |
Can you make molecule CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1C(=O)/C(=C\Nc2ccc(CCCC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(CCCC(F)(F)F)cc2)C(=O)NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "O3C(F)(F)F"
} |
Can you make molecule CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CN1C(=O)/C(=C\Nc2ccc(C(=O)C(F)(F)C(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(OC(F)(F)F)cc2)C(=O)NC1=S | CC(C)CN1C(=O)/C(=C\Nc2ccc(C(=O)C(F)(F)C(F)(F)F)cc2)C(=O)NC1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C(F)(F)C(F)(F)F",
"old_substring": "O3C(F)(F)F"
} |
Can you make molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1SC(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1SC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "S&C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CCCC(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CCCCC(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CCCCC(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CC(F)(F)C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1C(F)(F)F | O=C(N[C@@H]1CCCc2ccccc21)[C@@H]1CCCN1S(=O)(=O)c1ccccc1CC(F)(F)C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "C&C(F)(F)C(F)(F)F",
"old_substring": "C6(F)(F)F"
} |
Can you make molecule CCCC[C@H](C(=O)[O-])c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)[O-])c1cc2sccn2c1 | CCCC[C@H](C(=O)[O-])c1ccccn1 | CCCC[C@H](C(=O)[O-])c1cc2sccn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2sccn2c1",
"old_substring": "c12ccccn1"
} |
Can you make molecule CCCC[C@H](C(=O)[O-])c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)[O-])c1ccccc1 | CCCC[C@H](C(=O)[O-])c1ccccn1 | CCCC[C@H](C(=O)[O-])c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c12ccccn1"
} |
Can you make molecule CCCC[C@H](C(=O)[O-])c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)[O-])c1ccc(I)cn1 | CCCC[C@H](C(=O)[O-])c1ccccn1 | CCCC[C@H](C(=O)[O-])c1ccc(I)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cn1",
"old_substring": "c12ccccn1"
} |
Can you make molecule CCCC[C@H](C(=O)[O-])c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)[O-])c1nc2ccccc2s1 | CCCC[C@H](C(=O)[O-])c1ccccn1 | CCCC[C@H](C(=O)[O-])c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2s1",
"old_substring": "c12ccccn1"
} |
Can you make molecule CCCC[C@H](C(=O)[O-])c1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)[O-])c1cc2ccccn2c1 | CCCC[C@H](C(=O)[O-])c1ccccn1 | CCCC[C@H](C(=O)[O-])c1cc2ccccn2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccn2c1",
"old_substring": "c12ccccn1"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)c3cnccc3Cl)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cnccc3Cl)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnccc1Cl",
"old_substring": "c18cncnc1C"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)c3ccoc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3ccoc3C)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccoc1C",
"old_substring": "c18cncnc1C"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)c3sccc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3sccc3C)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c18cncnc1C"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)c3ccncc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3ccncc3C)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1C",
"old_substring": "c18cncnc1C"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(-c2csc(NC(=O)c3ccncc3Cl)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3cncnc3C)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3ccncc3Cl)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c18cncnc1C"
} |
Can you make molecule Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1CC(=O)SNCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1CC(=O)SNCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)CCCC(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)CCCC(=O)NCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(C)(C)CC(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(C)(C)CC(=O)NCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(C)(C)CCC(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(C)(C)CCC(=O)NCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1[C@H](C)C(=O)SNCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1C(=O)NCc1cccc(Cl)c1 | Cc1nn([C@H]2CCS(=O)(=O)C2)c(C)c1[C@H](C)C(=O)SNCc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3I)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3I)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3Br)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3Br)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)c(I)c3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)c(I)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C[C@H](O)c3cc(Cl)ccc3Cl)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3cc(Cl)ccc3Cl)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)c(Cl)c3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)cc3)CC2)c1 | Cc1ccc(C)c(N2CCN(C[C@H](O)c3ccc(Cl)c(Cl)c3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3Cl)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3Cl)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c19ccc(F)cc1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3Br)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3Br)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c19ccc(F)cc1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)c(Cl)c3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)c(Cl)c3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c19ccc(F)cc1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(I)cc3F)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(I)cc3F)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c19ccc(F)cc1"
} |
Can you make molecule Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3cc4c(F)cccc4s3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3ccc(F)cc3)n2)cc1 | Cc1ccc(NC(=O)C(=O)NCCc2csc(-c3cc4c(F)cccc4s3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c19ccc(F)cc1"
} |
Can you make molecule CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(SC(=O)C[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(SC(=O)C[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(CC(=C=O)C[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(CC(=C=O)C[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(C(=O)CCCC(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)CCCC(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(C(=O)CC(C)(C)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)CC(C)(C)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(C[S@+]([O-])CCC[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C(=O)[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | CC[C@H]1CN(C[S@+]([O-])CCC[C@@H]2CC[C@@H]3CCCC[C@@H]3[NH2+]2)CCN1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C45=O"
} |
Can you make molecule O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc2ccccc2nc1Cl)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1cc2ccccc2nc1Cl)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2nc1Cl",
"old_substring": "c13cc2ccccc2[nH]1"
} |
Can you make molecule O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1csc2ccccc12)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1csc2ccccc12)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc2ccccc12",
"old_substring": "c13cc2ccccc2[nH]1"
} |
Can you make molecule O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1cc2ccccc2c(Cl)n1)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 | O=C(Cc1cc2ccccc2c(Cl)n1)N/N=C/c1c[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccccc2c(Cl)n1",
"old_substring": "c13cc2ccccc2[nH]1"
} |
Can you make molecule O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N/N=C/c2c[nH]c3ccccc23)cc2cc(Cl)ccc21 | O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 | Cn1c(CC(=O)N/N=C/c2c[nH]c3ccccc23)cc2cc(Cl)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cc(Cl)ccc2n1C",
"old_substring": "c13cc2ccccc2[nH]1"
} |
Can you make molecule O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N/N=C/c2c[nH]c3ccccc23)cc2c(Cl)cccc21 | O=C(Cc1cc2ccccc2[nH]1)N/N=C/c1c[nH]c2ccccc12 | Cn1c(CC(=O)N/N=C/c2c[nH]c3ccccc23)cc2c(Cl)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(Cl)cccc2n1C",
"old_substring": "c13cc2ccccc2[nH]1"
} |
Can you make molecule COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)N1CCC(CNSC2=NC(=O)C=[SH]2)CC1.COc1cccc2ccc(=O)oc12 | COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 | CC(C)(C)NC(=O)N1CCC(CNSC2=NC(=O)C=[SH]2)CC1.COc1cccc2ccc(=O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "S&C1=NC(=O)C=&S1",
"old_substring": "C4%10=O"
} |
Can you make molecule COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2ccc(=O)oc12.Cc1cc(=O)n(NCC2CCN(C(=O)NC(C)(C)C)CC2)nc1C | COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 | COc1cccc2ccc(=O)oc12.Cc1cc(=O)n(NCC2CCN(C(=O)NC(C)(C)C)CC2)nc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nn&c(=O)c&c1C",
"old_substring": "C4%10=O"
} |
Can you make molecule COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)N1CCC(CNC(=O)n2cc(C#N)cn2)CC1.COc1cccc2ccc(=O)oc12 | COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 | CC(C)(C)NC(=O)N1CCC(CNC(=O)n2cc(C#N)cn2)CC1.COc1cccc2ccc(=O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cn(C&=O)nc1&",
"old_substring": "C4%10=O"
} |
Can you make molecule COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NC(=O)N1CCC(CNCCC=CO)CC1.COc1cccc2ccc(=O)oc12 | COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 | CC(C)(C)NC(=O)N1CCC(CNCCC=CO)CC1.COc1cccc2ccc(=O)oc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4%10=O"
} |
Can you make molecule COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc2ccc(=O)oc12.Cc1cc(=O)[nH]cc1NCC1CCN(C(=O)NC(C)(C)C)CC1 | COc1cccc2cc(C(=O)NCC3CCN(C(=O)NC(C)(C)C)CC3)c(=O)oc12 | COc1cccc2ccc(=O)oc12.Cc1cc(=O)[nH]cc1NCC1CCN(C(=O)NC(C)(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c[nH]c(=O)c1&",
"old_substring": "C4%10=O"
} |
Can you make molecule O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2Cl)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccc(I)cc2)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccc(I)cc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[C@H](NC(=O)NNC(=O)CCCc3ccccc3)C2=O)cc1I | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O | Cc1ccc(N2CC[C@H](NC(=O)NNC(=O)CCCc3ccccc3)C2=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2cccc(Br)c2)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2cccc(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CC[C@H](NC(=O)NNC(=O)CCCc3ccccc3)C2=O)c1C | O=C(CCCc1ccccc1)NNC(=O)N[C@H]1CCN(c2ccccc2)C1=O | Cc1cccc(N2CC[C@H](NC(=O)NNC(=O)CCCc3ccccc3)C2=O)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | C=CCC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCl)C2)CCc2ccccc21 | CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCl)C2)CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCS)C2)CCc2ccccc21 | CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCS)C2)CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@]1([C@@]2(O)CC[C@H](CCCBr)C2)CCc2ccccc21 | CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | N#C[C@@]1([C@@]2(O)CC[C@H](CCCBr)C2)CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCF)C2)CCc2ccccc21 | CC[C@H]1CC[C@](O)([C@]2(C#N)CCc3ccccc32)C1 | N#C[C@@]1([C@@]2(O)CC[C@H](CCCCF)C2)CCc2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC4"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.