prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NSC(=O)Cc1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NSC(=O)Cc1ccc(C)s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CCCC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)CCCC(=O)c1ccc(C)s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CC(C)(C)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)CC(C)(C)c1ccc(C)s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NC(=O)CCC(C)(C)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)CCC(C)(C)c1ccc(C)s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(NSC(=O)[C@@H](C)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NC(=O)c1ccc(C)s1)C(=O)[O-] | CCC(CC)(NSC(=O)[C@@H](C)c1ccc(C)s1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(CC(=O)SN[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(CC(=O)SN[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(C(=O)CCCC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)CCCC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(C(C)(C)CC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(C)(C)CC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(C(C)(C)CCC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(C)(C)CCC(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc([C@H](C)C(=O)SN[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc(C(=O)N[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | CC(C)c1cc([C@H](C)C(=O)SN[C@H](C)c2ccc3c(c2)CCC3)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C46=O"
} |
Can you make molecule CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)c1ccc(SC(=S)N(C)C(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(SC(=S)N(C)C(=O)NCc2ccnn2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N49"
} |
Can you make molecule CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)c1ccc(SC2=NCCN2C(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(SC2=NCCN2C(=O)NCc2ccnn2C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N49"
} |
Can you make molecule CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)c1ccc(C2CCN(CC(=O)NCc3ccnn3C)CC2)cc1Cl | CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(C2CCN(CC(=O)NCc3ccnn3C)CC2)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N49"
} |
Can you make molecule CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)c1ccc(-c2sc(C(=O)NCc3ccnn3C)cc2C#N)cc1Cl | CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(-c2sc(C(=O)NCc3ccnn3C)cc2C#N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N49"
} |
Can you make molecule CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)C(=O)c1ccc(-c2ccc(C(=O)NCc3ccnn3C)cc2C#N)cc1Cl | CCN(CC)C(=O)c1ccc(NC(=O)NCc2ccnn2C)cc1Cl | CCN(CC)C(=O)c1ccc(-c2ccc(C(=O)NCc3ccnn3C)cc2C#N)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N49"
} |
Can you make molecule CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1C(=O)N(Cc1cccs1)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 | CCOc1ccccc1C(=O)N(Cc1cccs1)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&s1",
"old_substring": "c19ccc%10o1"
} |
Can you make molecule CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1C(=O)N(Cc1ccsc1)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 | CCOc1ccccc1C(=O)N(Cc1ccsc1)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc&c1",
"old_substring": "c19ccc%10o1"
} |
Can you make molecule CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1C(=O)N(Cc1ccoc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 | CCOc1ccccc1C(=O)N(Cc1ccoc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c19ccc%10o1"
} |
Can you make molecule CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1C(=O)N(Cc1occc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 | CCOc1ccccc1C(=O)N(Cc1occc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc&cc1C",
"old_substring": "c19ccc%10o1"
} |
Can you make molecule CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccccc1C(=O)N(Cc1cocc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | CCOc1ccccc1C(=O)N(Cc1ccc(-c2cccc(Cl)c2)o1)[C@H]1CCS(=O)(=O)C1 | CCOc1ccccc1C(=O)N(Cc1cocc1C)[C@H]1CCS(=O)(=O)C1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&coc&c1C",
"old_substring": "c19ccc%10o1"
} |
Can you make molecule O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc2nc(C3CCCCC3)oc2c1)NC[C@@H]1CCCCO1 | O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 | O=C(/C=C/Sc1ccc2nc(C3CCCCC3)oc2c1)NC[C@@H]1CCCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NC[C@@H]2CCCCO2)nc1-c1ccc2nc(C3CCCCC3)oc2c1 | O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 | O=Cc1sc(NC[C@@H]2CCCCO2)nc1-c1ccc2nc(C3CCCCC3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NC[C@@H]2CCCCO2)sc1-c1ccc2nc(C3CCCCC3)oc2c1 | O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 | O=Cc1nc(NC[C@@H]2CCCCO2)sc1-c1ccc2nc(C3CCCCC3)oc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C46"
} |
Can you make molecule O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC[C@@H]1CCCCO1)n1nc(-c2ccc3nc(C4CCCCC4)oc3c2)oc1=S | O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 | O=C(NC[C@@H]1CCCCO1)n1nc(-c2ccc3nc(C4CCCCC4)oc3c2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C46"
} |
Can you make molecule O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C(=N/ONC[C@@H]1CCCCO1)\c1ccc(-c2ccc3nc(C4CCCCC4)oc3c2)o1 | O=C(NC[C@@H]1CCCCO1)c1ccc2nc(C3CCCCC3)oc2c1 | C(=N/ONC[C@@H]1CCCCO1)\c1ccc(-c2ccc3nc(C4CCCCC4)oc3c2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C46"
} |
Can you make molecule CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CO)=Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CCC(CO)=Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&CO",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CCCC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SNc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)SNc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CCCCC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C=O)=Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CC(=O)Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | CCC(C=O)=Nc1ccc(C=C(C#N)C(=O)Nc2c(Cl)cccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&C=O",
"old_substring": "CC3=O"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)Nc2cc(-n3cncn3)cnc2Cl)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2cc(-n3cncn3)cnc2Cl)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cnc1Cl",
"old_substring": "c17ccc9nc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2Cl)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2Cl)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1Cl",
"old_substring": "c17ccc9nc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2Br)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2Br)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1Br",
"old_substring": "c17ccc9nc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)Nc2nccc(-n3cncn3)c2I)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2nccc(-n3cncn3)c2I)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17ccc9nc1"
} |
Can you make molecule CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1cc(C(=O)Nc2cc3cn(-n4cncn4)cc3s2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2ccc(-n3cncn3)nc2)ccc1C | CC(=O)Nc1cc(C(=O)Nc2cc3cn(-n4cncn4)cc3s2)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn&cc2s1",
"old_substring": "c17ccc9nc1"
} |
Can you make molecule Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(C)cc1I | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(C)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "Cc1ccc(C)c2c1"
} |
Can you make molecule Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(C)cc1Br | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1ccc(C)c2c1"
} |
Can you make molecule Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(Cl)cc1F | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 | Cc1cc([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c(Cl)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Cl)cc1F",
"old_substring": "Cc1ccc(C)c2c1"
} |
Can you make molecule Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1Cl | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(C)c&c1Cl",
"old_substring": "Cc1ccc(C)c2c1"
} |
Can you make molecule Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Cl)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])sc2nc1-2 | Cc1ccc(C)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])c1 | Cc1ccc(Cl)c([C@@H](O)[C@@H](C)[C@@H](C)C(=O)[O-])sc2nc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Cl)c2sc&nc12",
"old_substring": "Cc1ccc(C)c2c1"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H]1CCCC[C@H](C(=O)[O-])C1 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H]1CCCC[C@H](C(=O)[O-])C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@@H]15[C@@H]6[C@@H]2C=C[C@H]1C2"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H]1CCC[C@H](C(=O)[O-])CC1 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H]1CCC[C@H](C(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@@H]15[C@@H]6[C@@H]2C=C[C@H]1C2"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H](CCl)CCCC(=O)[O-] | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H](CCl)CCCC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]15[C@@H]6[C@@H]2C=C[C@H]1C2"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H](CCC(=O)[O-])C(C)(C)C | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H](CCC(=O)[O-])C(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC&)C(C)(C)C",
"old_substring": "[C@@H]15[C@@H]6[C@@H]2C=C[C@H]1C2"
} |
Can you make molecule Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H](C)C(C)(C)CC(=O)[O-] | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@@H]1[C@@H](C(=O)[O-])[C@@H]2C=C[C@H]1C2 | Cc1nn(-c2ccccc2)c(C)c1CNC(=O)[C@H](C)C(C)(C)CC(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]15[C@@H]6[C@@H]2C=C[C@H]1C2"
} |
Can you make molecule Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1CCCCOC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1CCCCOC(=O)CCc1cc(Cl)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C34"
} |
Can you make molecule Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1CCCCCOC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1CCCCCOC(=O)CCc1cc(Cl)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C34"
} |
Can you make molecule Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1C1CC(OC(=O)CCc2cc(Cl)ccc2Br)C1 | Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1C1CC(OC(=O)CCc2cc(Cl)ccc2Br)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C34"
} |
Can you make molecule Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1SC(=S)OOC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1SC(=S)OOC(=O)CCc1cc(Cl)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C34"
} |
Can you make molecule Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccnc1NC(=S)SOC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1COC(=O)CCc1cc(Cl)ccc1Br | Cn1ccnc1NC(=S)SOC(=O)CCc1cc(Cl)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C34"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(CC(=O)SNCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(CC(=O)SNCc4cccs4)cc3N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C59=O"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)CCCC(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)CCCC(=O)NCc4cccs4)cc3N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C59=O"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(C)(C)CC(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(C)(C)CC(=O)NCc4cccs4)cc3N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(C)(C)CCC(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(C)(C)CCC(=O)NCc4cccs4)cc3N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C59=O"
} |
Can you make molecule COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc([C@H](C)C(=O)SNCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc(C(=O)NCc4cccs4)cc3N2)cc1OC | COc1ccc([C@H]2C[C@@H](C(F)(F)F)n3nc([C@H](C)C(=O)SNCc4cccs4)cc3N2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C59=O"
} |
Can you make molecule CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=S)Sc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOC(=S)Sc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O45"
} |
Can you make molecule CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=N)Cc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOC(=N)Cc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O45"
} |
Can you make molecule CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)CCC(=O)c1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCC(=O)CCC(=O)c1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O45"
} |
Can you make molecule CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](O)CCc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CC[C@H](O)CCc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O45"
} |
Can you make molecule CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)/C=C/Sc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCOc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | CCC(=O)/C=C/Sc1ccc2nc(SCc3cc(N)cc[nH+]3)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O45"
} |
Can you make molecule CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | C=CSc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(C(C)C)cc3)ccc12 | CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(C(C)C)cc3)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | C=CCCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(CCCCl)cc3)ccc12 | CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(CCCCl)cc3)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(CCCCS)cc3)ccc12 | CCc1ccc(-n2ccc3c(nnc4c(C(=O)OC)cnn43)c2=O)cc1 | COC(=O)c1cnn2c1nnc1c(=O)n(-c3ccc(CCCCS)cc3)ccc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(C(C)C)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)C(C(C)C)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)C3"
} |
Can you make molecule CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)CCCC(=O)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)C3"
} |
Can you make molecule CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC#N)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)(CCC#N)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)CCC#N",
"old_substring": "CC(C)C3"
} |
Can you make molecule CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CI)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)[C@H](CI)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CI",
"old_substring": "CC(C)C3"
} |
Can you make molecule CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)Cn1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | CC(C)(CCBr)n1cnnc1[C@@H]1CCCN1Cc1cccc(F)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC(C)C3"
} |
Can you make molecule CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccccc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccccc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c16cccnc1"
} |
Can you make molecule CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccc(I)nc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccc(I)nc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c16cccnc1"
} |
Can you make molecule CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cc3cnsc3s2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cc3cnsc3s2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c16cccnc1"
} |
Can you make molecule CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)[C@@H]2[C@@H](C(=O)C(C)(C)C)N3c4ccccc4C=C[C@@H]3[C@@]23C(=O)Nc2ccccc23)c(C)n1 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | Cc1ccc(C(=O)[C@@H]2[C@@H](C(=O)C(C)(C)C)N3c4ccccc4C=C[C@@H]3[C@@]23C(=O)Nc2ccccc23)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c16cccnc1"
} |
Can you make molecule CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccncc2Cl)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2cccnc2)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | CC(C)(C)C(=O)[C@@H]1[C@@H](C(=O)c2ccncc2Cl)[C@]2(C(=O)Nc3ccccc32)[C@H]2C=Cc3ccccc3N12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c16cccnc1"
} |
Can you make molecule COc1cc(C[C@H](C)CO)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C[C@H](C)CO)cc(OC)c1 | COc1cc(C[C@H](C)CO)cc(OC)c1 | COCc1cc(C[C@H](C)CO)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(C[C@H](C)CO)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[C@H](C)CO)cc(C2OCc3ccccc3CO2)c1 | COc1cc(C[C@H](C)CO)cc(OC)c1 | COc1cc(C[C@H](C)CO)cc(C2OCc3ccccc3CO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCc2ccccc2CO1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(C[C@H](C)CO)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[C@H](C)CO)cc(C2(O)Cc3ccccc3C2)c1 | COc1cc(C[C@H](C)CO)cc(OC)c1 | COc1cc(C[C@H](C)CO)cc(C2(O)Cc3ccccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(O)Cc2ccccc2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(C[C@H](C)CO)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[C@H](C)CO)cc(C2=CC3=NN3C[C@@H](C)CO2)c1 | COc1cc(C[C@H](C)CO)cc(OC)c1 | COc1cc(C[C@H](C)CO)cc(C2=CC3=NN3C[C@@H](C)CO2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1COc2cc&nn2C1",
"old_substring": "CO2"
} |
Can you make molecule COc1cc(C[C@H](C)CO)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[C@H](C)CO)cc(N2CCOc3ccccc32)c1 | COc1cc(C[C@H](C)CO)cc(OC)c1 | COc1cc(C[C@H](C)CO)cc(N2CCOc3ccccc32)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccccc21",
"old_substring": "CO2"
} |
Can you make molecule O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCSCc1ccccc1 | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCSCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N34"
} |
Can you make molecule O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)SCc1ccccc1 | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 | N=C(NC(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)SCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N34"
} |
Can you make molecule O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(C(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)nsc1Cc1ccccc1 | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 | Nc1c(C(=O)CN2C(=O)c3cc(Cl)c(Cl)cc3C2=O)nsc1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N34"
} |
Can you make molecule O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C(=S)SCc1ccccc1 | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 | CN(C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)C(=S)SCc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N34"
} |
Can you make molecule O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | Nn1c(Cc2ccccc2)ccc1C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NCc1ccccc1 | Nn1c(Cc2ccccc2)ccc1C(=O)CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N34"
} |
Can you make molecule CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1c([S-])nnc1-c1nn(-c2ccccc2Cl)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2Cl)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1c([S-])nnc1-c1nn(-c2ccc(I)cc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccc(I)cc2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1c([S-])nnc1-c1nn(-c2ccc(C)c(I)c2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccc(C)c(I)c2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1c([S-])nnc1-c1nn(-c2cccc(Br)c2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2cccc(Br)c2)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O less soluble in water? The output molecule should be similar to the input molecule. | CCn1c([S-])nnc1-c1nn(-c2cccc(C)c2C)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2ccccc2)ccc1=O | CCn1c([S-])nnc1-c1nn(-c2cccc(C)c2C)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CCSc1nnc(NC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCSc2ccc(-c3nnc(NC)s3)cc21 | CCSc1nnc(NC)s1 | CCN1CCSc2ccc(-c3nnc(NC)s3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S24"
} |
Can you make molecule CCSc1nnc(NC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCSCSc1nnc(NC)s1 | CCSc1nnc(NC)s1 | CCSCSc1nnc(NC)s1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S24"
} |
Can you make molecule CCSc1nnc(NC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc(-c2nnc(NC)s2)n2c1CSC2 | CCSc1nnc(NC)s1 | CCc1cc(-c2nnc(NC)s2)n2c1CSC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&n2c1CSC2",
"old_substring": "S24"
} |
Can you make molecule CCSc1nnc(NC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2sc(-c3nnc(NC)s3)cc2s1 | CCSc1nnc(NC)s1 | CCc1nc2sc(-c3nnc(NC)s3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2sc&cc2s1",
"old_substring": "S24"
} |
Can you make molecule CCSc1nnc(NC)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2cn(-c3nnc(NC)s3)cc2s1 | CCSc1nnc(NC)s1 | CCc1cc2cn(-c3nnc(NC)s3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cn&cc2s1",
"old_substring": "S24"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | C=CSc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(CNC(=O)c2cc(SC)ccc2C)c(C(C)C)nn1C | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | COc1c(CNC(=O)c2cc(SC)ccc2C)c(C(C)C)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | C=CCCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(CNC(=O)c2cc(SC)ccc2C)c(CCCCl)nn1C | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | COc1c(CNC(=O)c2cc(SC)ccc2C)c(CCCCl)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COc1c(CNC(=O)c2cc(SC)ccc2C)c(CCCCS)nn1C | CCc1nn(C)c(OC)c1CNC(=O)c1cc(SC)ccc1C | COc1c(CNC(=O)c2cc(SC)ccc2C)c(CCCCS)nn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.