prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC(C)(C#N)[C@](C)(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)[C@](C)(O)c1ccc(Cl)s1 | CC(C)(C#N)[C@](C)(O)c1cccs1 | CC(C)(C#N)[C@](C)(O)c1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C#N)[C@](C)(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)[C@](C)(O)c1ccc(Br)s1 | CC(C)(C#N)[C@](C)(O)c1cccs1 | CC(C)(C#N)[C@](C)(O)c1ccc(Br)s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C#N)[C@](C)(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)[C@](C)(O)c1scc2c1CCCC2 | CC(C)(C#N)[C@](C)(O)c1cccs1 | CC(C)(C#N)[C@](C)(O)c1scc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scc2c1CCCC2",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C#N)[C@](C)(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C#N)[C@](C)(O)c1sccc1Br | CC(C)(C#N)[C@](C)(O)c1cccs1 | CC(C)(C#N)[C@](C)(O)c1sccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c12cccs1"
} |
Can you make molecule CC(C)(C#N)[C@](C)(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c([C@@](C)(O)C(C)(C)C#N)sc2ccccc12 | CC(C)(C#N)[C@](C)(O)c1cccs1 | Cc1c([C@@](C)(O)C(C)(C)C#N)sc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1C",
"old_substring": "c12cccs1"
} |
Can you make molecule COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cccc(NSC(=O)Cc2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NSC(=O)Cc2ccc(NC=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C39=O"
} |
Can you make molecule COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cccc(NC(=O)CCCC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)CCCC(=O)c2ccc(NC=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C39=O"
} |
Can you make molecule COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cccc(NC(=O)CC(C)(C)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)CC(C)(C)c2ccc(NC=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cccc(NC(=O)CCC(C)(C)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)CCC(C)(C)c2ccc(NC=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C39=O"
} |
Can you make molecule COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCCOc1cccc(NSC(=O)[C@@H](C)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NC(=O)c2ccc(NC=O)cc2)c1 | COCCOc1cccc(NSC(=O)[C@@H](C)c2ccc(NC=O)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C39=O"
} |
Can you make molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=C([O-])C(=O)N(Cc2ccccc2Cl)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2ccccc2Cl)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=C([O-])C(=O)N(Cc2ccc(I)cc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2ccc(I)cc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CN2C(=O)C([O-])=C(C(=O)c3ccc(F)cc3)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1I | O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | Cc1ccc(CN2C(=O)C([O-])=C(C(=O)c3ccc(F)cc3)[C@@H]2c2cccc([N+](=O)[O-])c2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C1=C([O-])C(=O)N(Cc2cccc(Br)c2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | O=C(C1=C([O-])C(=O)N(Cc2cccc(Br)c2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c15ccccc1"
} |
Can you make molecule O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CN2C(=O)C([O-])=C(C(=O)c3ccc(F)cc3)[C@@H]2c2cccc([N+](=O)[O-])c2)c1C | O=C(C1=C([O-])C(=O)N(Cc2ccccc2)[C@H]1c1cccc([N+](=O)[O-])c1)c1ccc(F)cc1 | Cc1cccc(CN2C(=O)C([O-])=C(C(=O)c3ccc(F)cc3)[C@@H]2c2cccc([N+](=O)[O-])c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c15ccccc1"
} |
Can you make molecule Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)SNc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(CC(=O)SNc2cc(Cl)ccc2Cl)cc2occc21 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(=O)CCCC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(=O)CCCC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(C)(C)CC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(C)(C)CC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(C(C)(C)CCC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | Cn1c(C(C)(C)CCC(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1cc(Cl)ccc1Cl)c1cc2occc2n1C | Cn1c(C(=O)Nc2cc(Cl)ccc2Cl)cc2occc21 | C[C@H](C(=O)SNc1cc(Cl)ccc1Cl)c1cc2occc2n1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCC[C@H](Cc1ccccc1)C(=O)N1CCCC1)Nc1ccccc1F | O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 | O=C(NCC[C@H](Cc1ccccc1)C(=O)N1CCCC1)Nc1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@H](C&)C&=O",
"old_substring": "[C@H]5(C7)C4=O"
} |
Can you make molecule O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1F)N[C@H]1C=C[C@](c2ccccc2)(N2CCCC2)O1 | O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 | O=C(Nc1ccccc1F)N[C@H]1C=C[C@](c2ccccc2)(N2CCCC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@]&&O1",
"old_substring": "[C@H]5(C7)C4=O"
} |
Can you make molecule O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)([C@H](CCCc1ccccc1)NC(=O)Nc1ccccc1F)N1CCCC1 | O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 | CC(C)([C@H](CCCc1ccccc1)NC(=O)Nc1ccccc1F)N1CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CCC&)C&(C)C",
"old_substring": "[C@H]5(C7)C4=O"
} |
Can you make molecule O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1F)N[C@H]1C=C[C@@](c2ccccc2)(N2CCCC2)O1 | O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 | O=C(Nc1ccccc1F)N[C@H]1C=C[C@@](c2ccccc2)(N2CCCC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@]&&O1",
"old_substring": "[C@H]5(C7)C4=O"
} |
Can you make molecule O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1F)N[C@@H]1C=C[C@](c2ccccc2)(N2CCCC2)O1 | O=C(Nc1ccccc1F)N[C@@H](Cc1ccccc1)C(=O)N1CCCC1 | O=C(Nc1ccccc1F)N[C@@H]1C=C[C@](c2ccccc2)(N2CCCC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=C[C@]&&O1",
"old_substring": "[C@H]5(C7)C4=O"
} |
Can you make molecule Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(CCC(CO)=Nc2ccncc2)c(=O)c2cc3ccsc3n12 | Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | Cc1nn(CCC(CO)=Nc2ccncc2)c(=O)c2cc3ccsc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 less soluble in water? The output molecule should be similar to the input molecule. | C/C(Cn1nc(C)n2c(cc3ccsc32)c1=O)=N/ONc1ccncc1 | Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | C/C(Cn1nc(C)n2c(cc3ccsc32)c1=O)=N/ONc1ccncc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1ccncc1)n1nc(C)n2c(cc3ccsc32)c1=O | Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | CCC(CC)(C(=O)CNc1ccncc1)n1nc(C)n2c(cc3ccsc32)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(SSC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | Cc1nn(SSC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C6C4=O"
} |
Can you make molecule Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1ccncc1)n1nc(C)n2c(cc3ccsc32)c1=O | Cc1nn(CC(=O)Nc2ccncc2)c(=O)c2cc3ccsc3n12 | CCC(CC)(C(=O)CCNc1ccncc1)n1nc(C)n2c(cc3ccsc32)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C6C4=O"
} |
Can you make molecule CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)C1CCN(C(=O)c2cc(Cl)nc(-c3ccccc3)n2)CC1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cc(Cl)nc(-c3ccccc3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)nc&n1",
"old_substring": "c17cn(C)nc18"
} |
Can you make molecule CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)c(C)c(-c2ccccc2)n1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)c(C)c(-c2ccccc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)nc&c1C",
"old_substring": "c17cn(C)nc18"
} |
Can you make molecule CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)nc(Cl)nc1-c1ccccc1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 | Cc1c(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)nc(Cl)nc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(Cl)nc&c1C",
"old_substring": "c17cn(C)nc18"
} |
Can you make molecule CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)sc1-c1ccccc1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)sc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&s1",
"old_substring": "c17cn(C)nc18"
} |
Can you make molecule CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)oc1-c1ccccc1 | CC(C)N(C)C(=O)C1CCN(C(=O)c2cn(C)nc2-c2ccccc2)CC1 | Cc1nc(C(=O)N2CCC(C(=O)N(C)C(C)C)CC2)oc1-c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc(C)c&o1",
"old_substring": "c17cn(C)nc18"
} |
Can you make molecule CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)=NC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CC(C)=NC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&C",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | C=CSNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(I)=NC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CC(I)=NC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC=&I",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | C=CCCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N=CCCl)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | CCNC(=O)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | O=C(N=CCCl)NC[C@H]1CCCC[NH+]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CCl",
"old_substring": "CC4"
} |
Can you make molecule C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.c1ccccc1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Clc1ccccc1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Clc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Fc1ccccc1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Fc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Fc1cccc&c1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Cc1ccccc1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cccc&c1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.c1cc2ccsc2o1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CCc3ccccc3)C2)c1 | C#Cc1cccc(C(=O)N2CCc3c(c(C(=O)NCc4ccccn4)nn3CC)C2)c1.c1cc2ccsc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2ccoc2s1",
"old_substring": "c1%12ccccc1"
} |
Can you make molecule O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cccc(-c2cc[nH]c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2cc[nH]c2)c1)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[nH]c1",
"old_substring": "c15cn[nH]c1"
} |
Can you make molecule O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cccc(-c2nc(I)c(I)[nH]2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2nc(I)c(I)[nH]2)c1)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Ic1nc&[nH]c1I",
"old_substring": "c15cn[nH]c1"
} |
Can you make molecule O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=c1[nH]ncc(-c2cccc([N-]S(=O)(=O)c3c[nH]c4ncccc34)c2)c1Cl | O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 | O=c1[nH]ncc(-c2cccc([N-]S(=O)(=O)c3c[nH]c4ncccc34)c2)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c(=O)c1Cl",
"old_substring": "c15cn[nH]c1"
} |
Can you make molecule O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cccc(-c2ccc3[nH]ncc3c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2ccc3[nH]ncc3c2)c1)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]ncc2c1",
"old_substring": "c15cn[nH]c1"
} |
Can you make molecule O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)([N-]c1cccc(-c2nc3ccccc3[nH]2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2cn[nH]c2)c1)c1c[nH]c2ncccc12 | O=S(=O)([N-]c1cccc(-c2nc3ccccc3[nH]2)c1)c1c[nH]c2ncccc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1ccc2[nH]c&nc2c1",
"old_substring": "c15cn[nH]c1"
} |
Can you make molecule CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@H](C)CNC(=O)CC(C)(C)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)CC(C)(C)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@H](C)CNC(=O)CCC(C)(C)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)CCC(C)(C)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@H](C)CNC(=O)C[C@@H](Br)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNC(=O)C[C@@H](Br)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@H](C)CNc1cc(C)n(Nc2ccc3c(c2)NC(=O)[C@H](C)O3)c(=O)c1 | CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNc1cc(C)n(Nc2ccc3c(c2)NC(=O)[C@H](C)O3)c(=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+](CC)[C@H](C)CNc1c(C)n(Nc2ccc3c(c2)NC(=O)[C@H](C)O3)ccc1=O | CC[NH+](CC)[C@H](C)CNC(=O)Nc1ccc2c(c1)NC(=O)[C@H](C)O2 | CC[NH+](CC)[C@H](C)CNc1c(C)n(Nc2ccc3c(c2)NC(=O)[C@H](C)O3)ccc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COCc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COCSc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(SC(C)=O)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(SC(C)=O)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CS)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(C(=O)CS)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO4"
} |
Can you make molecule COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C(=O)CI)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(OC)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | COc1cc(C(=O)CI)cc([C@H]2Nc3nonc3NC3=C2C(=O)CCC3)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO4"
} |
Can you make molecule O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 | COCC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "C6O"
} |
Can you make molecule O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 | COCSC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "C6O"
} |
Can you make molecule O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | C=COC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 | C=COC1CC[NH+](CC(=O)NCc2cc(Br)cs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C6O"
} |
Can you make molecule O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[NH+]1CCC(C2COC2)CC1)NCc1cc(Br)cs1 | O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 | O=C(C[NH+]1CCC(C2COC2)CC1)NCc1cc(Br)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&COC1",
"old_substring": "C6O"
} |
Can you make molecule O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C2CC[NH+](CC(=O)NCc3cc(Br)cs3)CC2)COC1 | O=C(C[NH+]1CCC(CO)CC1)NCc1cc(Br)cs1 | CC1(C2CC[NH+](CC(=O)NCc3cc(Br)cs3)CC2)COC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&COC1",
"old_substring": "C6O"
} |
Can you make molecule COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COCc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COCSc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1SC(C)=O | COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1SC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1C(=O)CS | COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1C(=O)CS | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1C(=O)CI | COc1ccc(CC(=O)NNC(=O)c2ccoc2C)cc1OC | COc1cc(CC(=O)NNC(=O)c2ccoc2C)ccc1C(=O)CI | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1cnc(Cl)cc1I)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1cnc(Cl)cc1I)NC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)cc1I",
"old_substring": "c17ccc(Cl)nc1"
} |
Can you make molecule CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(Cl)cc1I)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)cc1I)NC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c17ccc(Cl)nc1"
} |
Can you make molecule CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(Cl)s1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)s1)NC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17ccc(Cl)nc1"
} |
Can you make molecule CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(Cl)cc1Br)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)cc1Br)NC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c17ccc(Cl)nc1"
} |
Can you make molecule CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1cnc(Cl)c(Cl)c1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1ccc(Cl)nc1)NC(=O)OC(C)(C)C | CC(C)(CC(=O)Nc1cnc(Cl)c(Cl)c1)NC(=O)OC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc(Cl)c(Cl)c1",
"old_substring": "c17ccc(Cl)nc1"
} |
Can you make molecule O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccccc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1ccccc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccc(I)nc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1ccc(I)nc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c15cccnc1"
} |
Can you make molecule O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1cc2cnsc2s1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1cc2cnsc2s1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2cnsc2s1",
"old_substring": "c15cccnc1"
} |
Can you make molecule O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(CNC(=O)[C@H]2C[C@@H]2c2ccccc2C(F)(F)F)c(C)n1 | O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | Cc1ccc(CNC(=O)[C@H]2C[C@@H]2c2ccccc2C(F)(F)F)c(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)nc1C",
"old_substring": "c15cccnc1"
} |
Can you make molecule O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCc1ccncc1Cl)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1cccnc1)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | O=C(NCc1ccncc1Cl)[C@H]1C[C@@H]1c1ccccc1C(F)(F)F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c15cccnc1"
} |
Can you make molecule C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@H]1CC[C@@H](C)N(C(=O)c2nnn[n-]2)C1 | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 | CC(=O)[C@@H]1CC[C@@H](C)N(C(=O)c2nnn[n-]2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H](CCCCC(N)=O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](CCCCC(N)=O)CN1C(=O)c1nnn[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC(N)=O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H](C/C(N)=N\O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](C/C(N)=N\O)CN1C(=O)c1nnn[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H](CC/C(N)=N/O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](CC/C(N)=N/O)CN1C(=O)c1nnn[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N/O",
"old_substring": "C4(N)=O"
} |
Can you make molecule C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC[C@@H](CC/C(N)=N\O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)c1nnn[n-]1 | C[C@@H]1CC[C@@H](CC/C(N)=N\O)CN1C(=O)c1nnn[n-]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C/C(N)=N\\O",
"old_substring": "C4(N)=O"
} |
Can you make molecule COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1C=C[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C | COC(=O)[C@H]1C=C[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@H]&C1",
"old_substring": "[C@H]16C[C@H]17"
} |
Can you make molecule COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCC[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C | COC(=O)[C@H]1CCC[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]16C[C@H]17"
} |
Can you make molecule COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1C=C[C@@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C | COC(=O)[C@H]1C=C[C@@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C=C[C@@H]&C1",
"old_substring": "[C@H]16C[C@H]17"
} |
Can you make molecule COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CN(C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C[C@@H]1C | COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C | COC(=O)[C@H]1CN(C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[C@H]16C[C@H]17"
} |
Can you make molecule COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCCC[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | COC(=O)[C@H]1C[C@H]1C(=O)N[C@@H]1C[C@@](C)(OC)C1(C)C | COC(=O)[C@H]1CCCC[C@H](C(=O)N[C@@H]2C[C@@](C)(OC)C2(C)C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]16C[C@H]17"
} |
Can you make molecule COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CC(=O)SNC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1CC(=O)SNC(=S)NNC(=O)c1ccc(C)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(=O)CCCC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)CCCC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(C)(C)CC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(C)(C)CC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C(C)(C)CCC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(C)(C)CCC(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@H](C)C(=O)SNC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1C(=O)NC(=S)NNC(=O)c1ccc(C)c(Br)c1 | COc1ccccc1[C@H](C)C(=O)SNC(=S)NNC(=O)c1ccc(C)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])Cc1cccc(Br)c1-c1ccc2on(c(Cc3cccc(O)c3)c1)N=N2 | C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 | C[C@@H]([NH3+])Cc1cccc(Br)c1-c1ccc2on(c(Cc3cccc(O)c3)c1)N=N2 | 102 | {
"fragment_index": 0,
"new_substring": "O&n1nnc2ccc&cc21",
"old_substring": "O23"
} |
Can you make molecule C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])Cc1cccc(Br)c1C1=CC=C2OCCN2CC(Cc2cccc(O)c2)=C1 | C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 | C[C@@H]([NH3+])Cc1cccc(Br)c1C1=CC=C2OCCN2CC(Cc2cccc(O)c2)=C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])Cc1cccc(Br)c1-n1cnc(Cc2cccc(O)c2)ccc2cc-2c1=O | C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 | C[C@@H]([NH3+])Cc1cccc(Br)c1-n1cnc(Cc2cccc(O)c2)ccc2cc-2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])Cc1cccc(Br)c1N1CCC(Cc2cccc(O)c2)=C2C=CC=C2C1=O | C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 | C[C@@H]([NH3+])Cc1cccc(Br)c1N1CCC(Cc2cccc(O)c2)=C2C=CC=C2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=C1c2cccc&c2CCN1&",
"old_substring": "O23"
} |
Can you make molecule C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]([NH3+])Cc1cccc(Br)c1-n1ccc(Cc2cccc(O)c2)nc2ccc-2c1=O | C[C@@H]([NH3+])Cc1cccc(Br)c1OCc1cccc(O)c1 | C[C@@H]([NH3+])Cc1cccc(Br)c1-n1ccc(Cc2cccc(O)c2)nc2ccc-2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.