prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@@H](C)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@@H](C)C(=O)[O-])NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&)C(=O)[O-]",
"old_substring": "C5[C@](C)(O)C(=O)[O-]"
} |
Can you make molecule CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(C)C)NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(C)C)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@](C)(O)C(C)C",
"old_substring": "C5[C@](C)(O)C(=O)[O-]"
} |
Can you make molecule CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](CC(C)(C)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](CC(C)(C)C(=O)[O-])NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C(=O)[O-]",
"old_substring": "C5[C@](C)(O)C(=O)[O-]"
} |
Can you make molecule CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C(=O)C(C)(C)O)NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C(=O)C(C)(C)O)NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(O)C&=O",
"old_substring": "C5[C@](C)(O)C(=O)[O-]"
} |
Can you make molecule CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O less soluble in water? The output molecule should be similar to the input molecule. | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](CC(C)(C)CC(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](C[C@](C)(O)C(=O)[O-])NC1=O | CC=C(C)[C@@H]1C=C[C@@H]2C[C@H](C)C[C@H](C)[C@@H]2[C@@H]1C(=O)C1=C([O-])[C@H](CC(C)(C)CC(=O)[O-])NC1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)CC(=O)[O-]",
"old_substring": "C5[C@](C)(O)C(=O)[O-]"
} |
Can you make molecule CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1CCC[C@H]1CC1CCCCC1 | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 | CC(C)(CC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1CCC[C@H]1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1CCC[C@H]1CC1CCCCC1 | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 | CC(C)(CCC(=O)Nc1ccc(S(C)(=O)=O)cc1)N1CCC[C@H]1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C34=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(NC(=O)C[C@@H](Br)N2CCC[C@H]2CC2CCCCC2)cc1 | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 | CS(=O)(=O)c1ccc(NC(=O)C[C@@H](Br)N2CCC[C@H]2CC2CCCCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C34=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Nc2ccc(S(C)(=O)=O)cc2)cc(=O)n1N1CCC[C@H]1CC1CCCCC1 | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 | Cc1cc(Nc2ccc(S(C)(=O)=O)cc2)cc(=O)n1N1CCC[C@H]1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C34=O"
} |
Can you make molecule CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Nc2ccc(S(C)(=O)=O)cc2)c(=O)ccn1N1CCC[C@H]1CC1CCCCC1 | CS(=O)(=O)c1ccc(NC(=O)N2CCC[C@H]2CC2CCCCC2)cc1 | Cc1c(Nc2ccc(S(C)(=O)=O)cc2)c(=O)ccn1N1CCC[C@H]1CC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C34=O"
} |
Can you make molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | COCc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | COCSc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | CC(=O)Sc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)CS)nc1 | COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)CS)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)CI)nc1 | COc1ccc(C(=O)OCc2nc3ccccc3s2)cn1 | O=C(OCc1nc2ccccc2s1)c1ccc(C(=O)CI)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO6"
} |
Can you make molecule COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)Nc2ccc(-n3nc(C)cc3C)cc2I)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccc(-n3nc(C)cc3C)cc2I)cc1NC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)Nc2cc(-n3nc(C)cc3C)ccc2Br)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2cc(-n3nc(C)cc3C)ccc2Br)cc1NC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)Nc2ccc(-n3nc(C)cc3C)cc2Cl)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccc(-n3nc(C)cc3C)cc2Cl)cc1NC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)Nc2cccc(-n3nc(C)cc3C)c2Br)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2cccc(-n3nc(C)cc3C)c2Br)cc1NC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16ccccc18"
} |
Can you make molecule COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(S(=O)(=O)Nc2cccc(-n3nc(C)cc3C)c2Cl)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2ccccc2-n2nc(C)cc2C)cc1NC(C)=O | COc1ccc(S(=O)(=O)Nc2cccc(-n3nc(C)cc3C)c2Cl)cc1NC(C)=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16ccccc18"
} |
Can you make molecule Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc(C=CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1cc(C=CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1cc(C=&)c2ccccc21",
"old_substring": "Cn1c(=O)n5c2ccccc21"
} |
Can you make molecule Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c(Cl)c2ccccc21 | Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c(Cl)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&c(Cl)c2ccccc21",
"old_substring": "Cn1c(=O)n5c2ccccc21"
} |
Can you make molecule Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c(Br)c2ccccc21 | Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c(Br)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&c(Br)c2ccccc21",
"old_substring": "Cn1c(=O)n5c2ccccc21"
} |
Can you make molecule Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)cc2c(F)cccc21 | Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)cc2c(F)cccc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&cc2c(F)cccc21",
"old_substring": "Cn1c(=O)n5c2ccccc21"
} |
Can you make molecule Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)cc2cccc(Cl)c21 | Cn1c(=O)n(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)c2ccccc21 | Cn1c(CC(=O)N[C@@H]2CCCc3ccc(F)cc32)cc2cccc(Cl)c21 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1c&cc2cccc(Cl)c21",
"old_substring": "Cn1c(=O)n5c2ccccc21"
} |
Can you make molecule N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)N=C1CCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)N=C1CCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)NC1CCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)NC1CCCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)NSC1=CCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NSC1=CCCCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#CC(C(=O)N=CC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)NC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | N#CC(C(=O)N=CC1CCCC1)=C([O-])Cc1cnn(-c2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCC1",
"old_substring": "C14CCCC1"
} |
Can you make molecule NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | C[C@H](C(=O)SNc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "NC(=O)[C@H]57"
} |
Can you make molecule NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1S[C@H](c2ccc(F)cc2)C(=O)N1Nc1cccc(Oc2ccccc2)c1 | NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | O=C1S[C@H](c2ccc(F)cc2)C(=O)N1Nc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&C(=O)S[C@H]&C1=O",
"old_substring": "NC(=O)[C@H]57"
} |
Can you make molecule NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCc1ccc(F)cc1)C(=O)Nc1cccc(Oc2ccccc2)c1 | NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | C[C@H](CCc1ccc(F)cc1)C(=O)Nc1cccc(Oc2ccccc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC&",
"old_substring": "NC(=O)[C@H]57"
} |
Can you make molecule NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(Oc2ccccc2)c1)[C@H](Cl)Cc1ccc(F)cc1 | NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | O=C(Nc1cccc(Oc2ccccc2)c1)[C@H](Cl)Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](Cl)C&",
"old_substring": "NC(=O)[C@H]57"
} |
Can you make molecule NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc(Oc2ccccc2)c1)[C@@H](F)Cc1ccc(F)cc1 | NC(=O)[C@H](Nc1cccc(Oc2ccccc2)c1)c1ccc(F)cc1 | O=C(Nc1cccc(Oc2ccccc2)c1)[C@@H](F)Cc1ccc(F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@@H](F)C&",
"old_substring": "NC(=O)[C@H]57"
} |
Can you make molecule CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[C@@H]1CCCCO1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCCCO1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCCO1",
"old_substring": "[C@@H]18CCOC1"
} |
Can you make molecule CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[C@@H]1CCSC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCSC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]18CCOC1"
} |
Can you make molecule CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[C@@H]1C=CCC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1C=CCC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=CCC1",
"old_substring": "[C@@H]18CCOC1"
} |
Can you make molecule CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[C@@H]1CCCSC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCCSC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@@H]18CCOC1"
} |
Can you make molecule CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[C@@H]1CCSS1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCOC1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | CCN(C[C@@H]1CCSS1)C(=O)Nc1cc2c(cc1Cl)OCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSS1",
"old_substring": "[C@@H]18CCOC1"
} |
Can you make molecule CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCC(C)(C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC8"
} |
Can you make molecule CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCCCC(=O)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC8"
} |
Can you make molecule CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCC[C@@H](C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&C",
"old_substring": "CCCC8"
} |
Can you make molecule CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCC[C@@H](C)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC[C@H]&C",
"old_substring": "CCCC8"
} |
Can you make molecule CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCCCc1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | CCC(C)(CC)c1nnc(NC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "CCCC8"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NSC(=O)Cc1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NSC(=O)Cc1ccc(Br)o1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CCCC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)CCCC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CC(C)(C)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)CC(C)(C)c1ccc(Br)o1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NC(=O)CCC(C)(C)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)CCC(C)(C)c1ccc(Br)o1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](NSC(=O)[C@@H](C)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NC(=O)c1ccc(Br)o1)C(=O)N1CCOCC1 | CC[C@@H](NSC(=O)[C@@H](C)c1ccc(Br)o1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccccc2)NC(=O)N(CCCCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCCCOc2ccc(Cl)cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C5C3"
} |
Can you make molecule CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccccc2)NC(=O)N(CCCCCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCCCCOc2ccc(Cl)cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C5C3"
} |
Can you make molecule CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccccc2)NC(=O)N(C2CC(Oc3ccc(Cl)cc3Cl)C2)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(C2CC(Oc3ccc(Cl)cc3Cl)C2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C5C3"
} |
Can you make molecule CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccccc2)NC(=O)N([C@@H](C)CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N([C@@H](C)CCOc2ccc(Cl)cc2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C5C3"
} |
Can you make molecule CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@]1(c2ccccc2)NC(=O)N(C2CCC(Oc3ccc(Cl)cc3Cl)CC2)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(CCOc2ccc(Cl)cc2Cl)C1=O | CC[C@]1(c2ccccc2)NC(=O)N(C2CCC(Oc3ccc(Cl)cc3Cl)CC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C5C3"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)cc1I | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 | COc1cc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c15ccc6c7c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)cc1Cl | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 | COc1cc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c15ccc6c7c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(I)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)c1 | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 | COc1cc(I)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c15ccc6c7c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)c1 | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 | COc1cc(Br)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c15ccc6c7c1"
} |
Can you make molecule COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)cc1Br | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c1 | COc1cc(NC(=O)c2ccc3c(c2)C(=O)N(c2cc(C)on2)C3=O)c(OC)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c15ccc6c7c1"
} |
Can you make molecule Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OCCC(CO)=NC(=S)NC[C@H]2CCCO2)cc1 | Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | Cc1ccc(OCCC(CO)=NC(=S)NC[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COc1ccc(C)cc1)=N/ONC(=S)NC[C@H]1CCCO1 | Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | C/C(COc1ccc(C)cc1)=N/ONC(=S)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(C)cc1)C(=O)CNC(=S)NC[C@H]1CCCO1 | Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | CCC(CC)(Oc1ccc(C)cc1)C(=O)CNC(=S)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OSSC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | Cc1ccc(OSSC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)n1nc(Oc2ccc(C)cc2)nc1NC(=S)NC[C@H]1CCCO1 | Cc1ccc(OCC(=O)NC(=S)NC[C@H]2CCCO2)cc1 | CCC(=O)n1nc(Oc2ccc(C)cc2)nc1NC(=S)NC[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(=O)n1nc&nc1&",
"old_substring": "C4C3=O"
} |
Can you make molecule CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC[C@H](N2CCC(C(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 | C[NH+]1CCC[C@H](N2CCC(C(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=O)CCOc1cccc(C(N)=O)c1)C(=S)S[C@H]1CCC[NH+](C)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)C(=S)S[C@H]1CCC[NH+](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC[C@H](C2CCN(CC(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 | C[NH+]1CCC[C@H](C2CCN(CC(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC[C@H](N2CN(C(=O)CCOc3cccc(C(N)=O)c3)CSC2=S)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 | C[NH+]1CCC[C@H](N2CN(C(=O)CCOc3cccc(C(N)=O)c3)CSC2=S)C1 | 102 | {
"fragment_index": 0,
"new_substring": "S=C1SCN&CN1&",
"old_substring": "CN25"
} |
Can you make molecule CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC[C@H](C2CCC(C#N)(C(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | CN(C(=O)CCOc1cccc(C(N)=O)c1)[C@H]1CCC[NH+](C)C1 | C[NH+]1CCC[C@H](C2CCC(C#N)(C(=O)CCOc3cccc(C(N)=O)c3)CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCC&CC1",
"old_substring": "CN25"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1I | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)ccc1Br | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 | COC(=O)c1cc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1Cl | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)c1Br | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 | COC(=O)c1cccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)c1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)c1Cl | COC(=O)c1ccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)cc1 | COC(=O)c1cccc(NC(=O)c2c(C)sc3ncnc(N4CCC[C@H](C)C4)c23)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c19ccc8cc1"
} |
Can you make molecule Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccs/c1=N\C(=O)C=Cc1ccc(-n2cncn2)c(F)c1 | Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O | Cn1ccs/c1=N\C(=O)C=Cc1ccc(-n2cncn2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1ccs/c1=N\\C(=O)C&",
"old_substring": "Cn1ncc2c1CCC=4C2=O"
} |
Can you make molecule Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(C=Cc2nc3c(s2)CCC3)ccc1-n1cncn1 | Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O | Fc1cc(C=Cc2nc3c(s2)CCC3)ccc1-n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1nc2c(s1)CCC2",
"old_substring": "Cn1ncc2c1CCC=4C2=O"
} |
Can you make molecule Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | Fc1cc(C=C2C=CC=C2)ccc1-n1cncn1 | Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O | Fc1cc(C=C2C=CC=C2)ccc1-n1cncn1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&C=CC=C1",
"old_substring": "Cn1ncc2c1CCC=4C2=O"
} |
Can you make molecule Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ncsc1C=Cc1ccc(-n2cncn2)c(F)c1 | Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O | Cc1ncsc1C=Cc1ccc(-n2cncn2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ncsc1C=&",
"old_substring": "Cn1ncc2c1CCC=4C2=O"
} |
Can you make molecule Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=Cc1ccc(-n2cncn2)c(F)c1 | Cn1ncc2c1CCC(=Cc1ccc(-n3cncn3)c(F)c1)C2=O | CCCC(C)=Cc1ccc(-n2cncn2)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "Cn1ncc2c1CCC=4C2=O"
} |
Can you make molecule O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc([N+](=O)[O-])cc1)N1Cc2nc(CC3(O)CCOCC3)sc2C1 | O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 | O=C(Cc1ccc([N+](=O)[O-])cc1)N1Cc2nc(CC3(O)CCOCC3)sc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc([N+](=O)[O-])cc1)N1Cc2cnn(CC3(O)CCOCC3)c2C1 | O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 | O=C(Cc1ccc([N+](=O)[O-])cc1)N1Cc2cnn(CC3(O)CCOCC3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCc2noc(CC3(O)CCOCC3)c2C1 | O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCc2noc(CC3(O)CCOCC3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCCn2nc(CC3(O)CCOCC3)cc21 | O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCCn2nc(CC3(O)CCOCC3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCc2cc(CC3(O)CCOCC3)ccc21 | O=C(Cc1ccc([N+](=O)[O-])cc1)NCC1(O)CCOCC1 | O=C(Cc1ccc([N+](=O)[O-])cc1)N1CCc2cc(CC3(O)CCOCC3)ccc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(CNc2ccc(OC)cc2I)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(CNc2cc(OC)ccc2Br)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 | C=CCOc1ccc(CNc2cc(OC)ccc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(CNc2ccc(OC)cc2Cl)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(CNc2cccc(OC)c2Br)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 | C=CCOc1ccc(CNc2cccc(OC)c2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCOc1ccc(CNc2cccc(OC)c2Cl)cc1 | C=CCOc1ccc(CNc2ccc(OC)cc2)cc1 | C=CCOc1ccc(CNc2cccc(OC)c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c17ccc5cc1"
} |
Can you make molecule C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCCC1=NC(=O)CCC1=c2ccccc2=[NH+]C1 | C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 | C[C@H]1CCCCC1=NC(=O)CCC1=c2ccccc2=[NH+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCCCC1=&",
"old_substring": "C[C@H]1N=C(CC5)CS1"
} |
Can you make molecule C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](NC(=O)CCC1=c2ccccc2=[NH+]C1)C1=CCCCC1 | C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 | C[C@H](NC(=O)CCC1=c2ccccc2=[NH+]C1)C1=CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&C1=CCCCC1",
"old_substring": "C[C@H]1N=C(CC5)CS1"
} |
Can you make molecule C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCBr)CCNC(=O)CCC1=c2ccccc2=[NH+]C1 | C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 | C[C@@H](CCBr)CCNC(=O)CCC1=c2ccccc2=[NH+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CCBr",
"old_substring": "C[C@H]1N=C(CC5)CS1"
} |
Can you make molecule C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCBr)CCNC(=O)CCC1=c2ccccc2=[NH+]C1 | C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 | C[C@H](CCBr)CCNC(=O)CCC1=c2ccccc2=[NH+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CCBr",
"old_substring": "C[C@H]1N=C(CC5)CS1"
} |
Can you make molecule C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCc2sc(NC(=O)CCC3=c4ccccc4=[NH+]C3)cc2C1 | C[C@H]1N=C(CCNC(=O)CCC2=c3ccccc3=[NH+]C2)CS1 | C[C@H]1CCc2sc(NC(=O)CCC3=c4ccccc4=[NH+]C3)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCc2sc&cc2C1",
"old_substring": "C[C@H]1N=C(CC5)CS1"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NSC(=O)C[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NSC(=O)C[C@@H]2CCO[C@H]2C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NCC(=C=O)C[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NCC(=C=O)C[C@@H]2CCO[C@H]2C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)CCCC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)CCCC(=O)[C@@H]2CCO[C@H]2C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC(=O)CC(C)(C)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)CC(C)(C)[C@@H]2CCO[C@H]2C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C46=O"
} |
Can you make molecule COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)c1cc(NC[S@+]([O-])CCC[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC(=O)[C@@H]2CCO[C@H]2C)ccc1C | COC(=O)c1cc(NC[S@+]([O-])CCC[C@@H]2CCO[C@H]2C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C46=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.