prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NSC(=O)Cc1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NSC(=O)Cc1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)CCCC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)CCCC(=O)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)CC(C)(C)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)CC(C)(C)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NC(=O)CCC(C)(C)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)CCC(C)(C)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1[C@@H](C)NSC(=O)[C@@H](C)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NC(=O)c1cnc2c(C)cccn2c1=O | COc1ccccc1[C@@H](C)NSC(=O)[C@@H](C)c1cnc2c(C)cccn2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NCSS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)NCSS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N45"
} |
Can you make molecule CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)NC(=N)SS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)NC(=N)SS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N45"
} |
Can you make molecule CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1nsc(S(=O)(=O)c2cc(N3C(=O)[C@@H](C)CS3(=O)=O)ccc2OC)c1N | CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)c1nsc(S(=O)(=O)c2cc(N3C(=O)[C@@H](C)CS3(=O)=O)ccc2OC)c1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&nsc1&",
"old_substring": "N45"
} |
Can you make molecule CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(C)C(=S)SS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)N(C)C(=S)SS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N45"
} |
Can you make molecule CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)c1ccc(S(=O)(=O)c2cc(N3C(=O)[C@@H](C)CS3(=O)=O)ccc2OC)n1N | CC[C@@H](C)NS(=O)(=O)c1cc(N2C(=O)[C@@H](C)CS2(=O)=O)ccc1OC | CC[C@@H](C)c1ccc(S(=O)(=O)c2cc(N3C(=O)[C@@H](C)CS3(=O)=O)ccc2OC)n1N | 102 | {
"fragment_index": 0,
"new_substring": "Nn1c&ccc1&",
"old_substring": "N45"
} |
Can you make molecule CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COc1ccc(S(=O)(=O)NC(C)(C)C)cc1)=N/ON1CCOCC1 | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 | C/C(COc1ccc(S(=O)(=O)NC(C)(C)C)cc1)=N/ON1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C4C3=O"
} |
Can you make molecule CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)CN1CCOCC1 | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 | CCC(CC)(Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)CN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C4C3=O"
} |
Can you make molecule CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)NS(=O)(=O)c1ccc(OSSC(=O)N2CCOCC2)cc1 | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 | CC(C)(C)NS(=O)(=O)c1ccc(OSSC(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)CCN1CCOCC1 | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 | CCC(CC)(Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)CCN1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C4C3=O"
} |
Can you make molecule CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](C(=O)Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)N1CCOCC1 | CC(C)(C)NS(=O)(=O)c1ccc(OCC(=O)N2CCOCC2)cc1 | CC[C@H](C(=O)Oc1ccc(S(=O)(=O)NC(C)(C)C)cc1)C(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C4C3=O"
} |
Can you make molecule COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCCCNC(=O)[C@H]1CN(C(=O)c2ccc(Cl)s2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2ccc(Cl)s2)CC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCCCNC(=O)[C@H]1CN(C(=O)c2ccc(Br)s2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2ccc(Br)s2)CC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCCCNC(=O)[C@H]1CN(C(=O)c2sccc2Br)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2sccc2Br)CC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17cccs1"
} |
Can you make molecule COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCCCNC(=O)[C@H]1CN(C(=O)c2csc(I)c2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2csc(I)c2)CC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c17cccs1"
} |
Can you make molecule COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 less soluble in water? The output molecule should be similar to the input molecule. | COCCCNC(=O)[C@H]1CN(C(=O)c2cc3c(s2)CSC3)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cccs2)CC12CCCCC2 | COCCCNC(=O)[C@H]1CN(C(=O)c2cc3c(s2)CSC3)CC12CCCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c17cccs1"
} |
Can you make molecule Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2cc3ccccc3c2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cc3ccccc3c2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc2ccccc2c1",
"old_substring": "n17cccc1"
} |
Can you make molecule Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2cc(Cl)ccc2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cc(Cl)ccc2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(Cl)ccc1=O",
"old_substring": "n17cccc1"
} |
Can you make molecule Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2ccc3occc3c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2ccc3occc3c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&ccc2occc2c1=O",
"old_substring": "n17cccc1"
} |
Can you make molecule Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2cc(I)cc(C)c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cc(I)cc(C)c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cc(I)cc(C)c1=O",
"old_substring": "n17cccc1"
} |
Can you make molecule Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(-n2cnc(C)c(Br)c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cccc2)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | Cc1nc(-n2cnc(C)c(Br)c2=O)sc1C(=O)Nc1cccc(-c2cn3ccsc3n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&cnc(C)c(Br)c1=O",
"old_substring": "n17cccc1"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)CC(C)(C)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)CC(C)(C)NC[C@H](O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)CCC(C)(C)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)CCC(C)(C)NC[C@H](O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])[C@H]1CCCC[C@@H]1Nc1c(C)n(C)n(NC[C@H](O)c2ccco2)c1=O | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1Nc1c(C)n(C)n(NC[C@H](O)c2ccco2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])[C@H]1CCCC[C@@H]1Nc1nn(NC[C@H](O)c2ccco2)c(C)cc1=O | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1Nc1nn(NC[C@H](O)c2ccco2)c(C)cc1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)C[C@@H](Br)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)NC[C@H](O)c1ccco1 | CC[S@+]([O-])[C@H]1CCCC[C@@H]1NC(=O)C[C@@H](Br)NC[C@H](O)c1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(C[C@H]3CCCC3(C)C)c2cc1C | Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C | Cc1cc2ncn(C[C@H]3CCCC3(C)C)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC1(C)C",
"old_substring": "[C@H]15CC1(Cl)Cl"
} |
Can you make molecule Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(C[C@H]3CC=CC=C3Cl)c2cc1C | Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C | Cc1cc2ncn(C[C@H]3CC=CC=C3Cl)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC=CC=C1Cl",
"old_substring": "[C@H]15CC1(Cl)Cl"
} |
Can you make molecule Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(C[C@H]3CC34CCCCC4)c2cc1C | Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C | Cc1cc2ncn(C[C@H]3CC34CCCCC4)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC12CCCCC2",
"old_substring": "[C@H]15CC1(Cl)Cl"
} |
Can you make molecule Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(C[C@H]3CCC=CCCC3)c2cc1C | Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C | Cc1cc2ncn(C[C@H]3CCC=CCCC3)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC=CCCC1",
"old_substring": "[C@H]15CC1(Cl)Cl"
} |
Can you make molecule Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc2ncn(C[C@@H](C)CCC(C)(C)C)c2cc1C | Cc1cc2ncn(C[C@H]3CC3(Cl)Cl)c2cc1C | Cc1cc2ncn(C[C@@H](C)CCC(C)(C)C)c2cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)CCC(C)(C)C",
"old_substring": "[C@H]15CC1(Cl)Cl"
} |
Can you make molecule Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1OCC(=O)O[C@H](CCl)CCCc1nccs1 | Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 | Cc1ccccc1OCC(=O)O[C@H](CCl)CCCc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1OCC(=O)O[C@@H]1N=NC=C1CCc1nccs1 | Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 | Cc1ccccc1OCC(=O)O[C@@H]1N=NC=C1CCc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1OCC(=O)O[C@@H]1CC[C@@H](c2nccs2)C1 | Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 | Cc1ccccc1OCC(=O)O[C@@H]1CC[C@@H](c2nccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1OCC(=O)O[C@H](C)C(C)(C)Cc1nccs1 | Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 | Cc1ccccc1OCC(=O)O[C@H](C)C(C)(C)Cc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1nccs1)OC(=O)COc1ccccc1C | Cc1ccccc1OCC(=O)O[C@@H](C)c1nccs1 | CC[C@@H](CCc1nccs1)OC(=O)COc1ccccc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]46C"
} |
Can you make molecule C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CC[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1)CC(=O)N1CCOCC1 | C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@@H](CC[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1)CC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]5C4=O"
} |
Can you make molecule C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1)CC(=O)N1CCOCC1 | C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@H](CC[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1)CC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]5C4=O"
} |
Can you make molecule C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@@H](CCN1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]5C4=O"
} |
Can you make molecule C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@H](CC(C)(C)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]5C4=O"
} |
Can you make molecule C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1([NH+]2CCN(Cc3ccc4c(c3)OCO4)CC2)O[C@@H](N2CCOCC2)CS1 | C[C@H](C(=O)N1CCOCC1)[NH+]1CCN(Cc2ccc3c(c2)OCO3)CC1 | C[C@@]1([NH+]2CCN(Cc3ccc4c(c3)OCO4)CC2)O[C@@H](N2CCOCC2)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&O[C@@H]&CS1",
"old_substring": "C[C@@H]5C4=O"
} |
Can you make molecule CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCN(SC(=O)C[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(SC(=O)C[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(=C=O)C[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(CC(=C=O)C[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CCCC(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)CCCC(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)CC(C)(C)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)CC(C)(C)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] less soluble in water? The output molecule should be similar to the input molecule. | CCN(C[S@+]([O-])CCC[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C(=O)[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | CCN(C[S@+]([O-])CCC[C@@H]1Cc2ccccc2S1)[C@H]1CCC[C@@H]1C[NH3+] | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CCC(Cc2cccs2)CC1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CCC(Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@@H](C)C[NH+]1CCC(Cc2cccs2)CC1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)C[NH+]1CCC(Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCC&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CC=C(CCc2cccs2)CC1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CC=C(CCc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(C&)CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CCC[C@H](Cc2cccs2)CC1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CCC[C@H](Cc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@H]&CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CC=C(CCCc2cccs2)CC1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+](C)Cc1cccs1 | Cc1cc(Br)ccc1NC(=O)[C@@H](C)[NH+]1CC=C(CCCc2cccs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=C(CC&)CC1",
"old_substring": "[NH+]34C"
} |
Can you make molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCC[C@H](NC(=O)Nc2ccc(C)cc2C)CC1 | COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C | COC(=O)[C@H]1CCC[C@H](NC(=O)Nc2ccc(C)cc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[C@H]17CCC[C@H]16"
} |
Can you make molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCCC[C@H](NC(=O)Nc2ccc(C)cc2C)C1 | COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C | COC(=O)[C@H]1CCCC[C@H](NC(=O)Nc2ccc(C)cc2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCC[C@H]&C1",
"old_substring": "[C@H]17CCC[C@H]16"
} |
Can you make molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@@H](CBr)CCCNC(=O)Nc1ccc(C)cc1C | COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C | COC(=O)[C@@H](CBr)CCCNC(=O)Nc1ccc(C)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]17CCC[C@H]16"
} |
Can you make molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCc2sc(NC(=O)Nc3ccc(C)cc3C)cc2C1 | COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C | COC(=O)[C@H]1CCc2sc(NC(=O)Nc3ccc(C)cc3C)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2sc&cc2C1",
"old_substring": "[C@H]17CCC[C@H]16"
} |
Can you make molecule COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C less soluble in water? The output molecule should be similar to the input molecule. | COC(=O)[C@H]1CCc2c(NC(=O)Nc3ccc(C)cc3C)csc2C1 | COC(=O)[C@H]1CCC[C@H]1NC(=O)Nc1ccc(C)cc1C | COC(=O)[C@H]1CCc2c(NC(=O)Nc3ccc(C)cc3C)csc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCc2c&csc2C1",
"old_substring": "[C@H]17CCC[C@H]16"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccc(Cl)cc2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccc(Cl)cc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c18ccccc1Br"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2sc3ccccc3c2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2sc3ccccc3c2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Br",
"old_substring": "c18ccccc1Br"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C)c([C@@H](C)NC(=O)c2ccc(S(=O)(=O)NC(C)C)cc2)c(Br)c1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 | Cc1cc(C)c([C@@H](C)NC(=O)c2ccc(S(=O)(=O)NC(C)C)cc2)c(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)cc(C)cc1Br",
"old_substring": "c18ccccc1Br"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Br)c([C@@H](C)NC(=O)c2ccc(S(=O)(=O)NC(C)C)cc2)cc1C | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 | Cc1cc(Br)c([C@@H](C)NC(=O)c2ccc(S(=O)(=O)NC(C)C)cc2)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(C)c(C)cc1Br",
"old_substring": "c18ccccc1Br"
} |
Can you make molecule CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccc3ccccc3c2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccccc2Br)cc1 | CC(C)NS(=O)(=O)c1ccc(C(=O)N[C@H](C)c2ccc3ccccc3c2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2ccccc2c1Br",
"old_substring": "c18ccccc1Br"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | CC(C)CCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1C(F)(F)F)N1CCN(CCOCCCCBr)CC1 | CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | O=C(Nc1ccccc1C(F)(F)F)N1CCN(CCOCCCCBr)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | C=CCCCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1C(F)(F)F)N1CCN(CCOCCCCCl)CC1 | CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | O=C(Nc1ccccc1C(F)(F)F)N1CCN(CCOCCCCCl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CC5C"
} |
Can you make molecule CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | CC(C)OCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | C=CCCCCOCCN1CCN(C(=O)Nc2ccccc2C(F)(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC5C"
} |
Can you make molecule CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2nc(-c3cccc(Cl)c3)co2)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)co2)c(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c15nc6no1"
} |
Can you make molecule CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2ncnc(-c3cccc(Cl)c3)c2C)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 | CCn1cc(-c2ncnc(-c3cccc(Cl)c3)c2C)c(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c15nc6no1"
} |
Can you make molecule CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2nc(-c3cccc(Cl)c3)ncc2C)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)ncc2C)c(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c15nc6no1"
} |
Can you make molecule CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2ncnc(-c3cccc(Cl)c3)c2F)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 | CCn1cc(-c2ncnc(-c3cccc(Cl)c3)c2F)c(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c15nc6no1"
} |
Can you make molecule CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 less soluble in water? The output molecule should be similar to the input molecule. | CCn1cc(-c2nc(-c3cccc(Cl)c3)ncc2I)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)no2)c(=O)c2ccccc21 | CCn1cc(-c2nc(-c3cccc(Cl)c3)ncc2I)c(=O)c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c15nc6no1"
} |
Can you make molecule COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COC[C@@H](Cl)CCNC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](Cl)CCNC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "Cl[C@H](C&)CC&",
"old_substring": "C5[C@H]6C"
} |
Can you make molecule COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@H](C)CC(C)(C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | CO[C@H](C)CC(C)(C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C5[C@H]6C"
} |
Can you make molecule COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@@H](C)CC(=O)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COCC[C@@H](C)CC(=O)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C5[C@H]6C"
} |
Can you make molecule COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CO[C@@H](C)[C@H](C)CNC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | CO[C@@H](C)[C@H](C)CNC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&[C@H](C)C&",
"old_substring": "C5[C@H]6C"
} |
Can you make molecule COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C less soluble in water? The output molecule should be similar to the input molecule. | COCC[C@H](C)CC(=O)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COC[C@@H](C)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | COCC[C@H](C)CC(=O)NC(=O)C(=O)Nc1cc(-c2ccccc2)nn1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C5[C@H]6C"
} |
Can you make molecule C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOC(=S)Sc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOC(=S)Sc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCOC(=N)Cc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOC(=N)Cc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(=O)CCC(=O)c1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCC(=O)CCC(=O)c1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CC[C@H](O)CCc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CC[C@H](O)CCc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C#CCC(=O)/C=C/Sc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCOc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | C#CCC(=O)/C=C/Sc1ccccc1CN1CCN(C2=[NH+]C[C@@H](C)S2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNSC(=O)C[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNSC(=O)C[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNCC(=C=O)C[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNCC(=C=O)C[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C26=O"
} |
Can you make molecule COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CCCC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)CCCC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C26=O"
} |
Can you make molecule COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC(=O)CC(C)(C)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)CC(C)(C)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C26=O"
} |
Can you make molecule COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCCNC[S@+]([O-])CCC[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC(=O)[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | COCCNC[S@+]([O-])CCC[C@H]1CCCN1S(=O)(=O)c1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C26=O"
} |
Can you make molecule Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1I | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1Cl | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1Cl",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(I)ccc1C[C@H](O)c1c(F)cc(Br)cc1F | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 | Cc1cc(I)ccc1C[C@H](O)c1c(F)cc(Br)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)ccc1&",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(I)c(C[C@H](O)c2c(F)cc(Br)cc2F)c1 | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 | Cc1ccc(I)c(C[C@H](O)c2c(F)cc(Br)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(I)c&c1",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(Br)c(C[C@H](O)c2c(F)cc(Br)cc2F)c1 | Cc1ccc(C[C@H](O)c2c(F)cc(Br)cc2F)cc1 | Cc1ccc(Br)c(C[C@H](O)c2c(F)cc(Br)cc2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc(Br)c&c1",
"old_substring": "Cc1ccc3cc1"
} |
Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COCSC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | CC(=O)SC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | CON(C)CCCC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | CC(=O)CCCC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1SCCC[C@]1(NC1CCCC1)C(=O)C(=O)CCBr | COC(=O)[C@@]1(NC2CCCC2)CCCS[C@H]1C | C[C@@H]1SCCC[C@]1(NC1CCCC1)C(=O)C(=O)CCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.