prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=CC=C3CC3(C)C2)C1 | CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=CC=C3CC3(C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&Cc2ccccc2C1",
"old_substring": "CCC2"
} |
Can you make molecule CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=NC3=C(CCCC2(C)C)S3)C1 | CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=NC3=C(CCCC2(C)C)S3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCCc2sc&nc21",
"old_substring": "CCC2"
} |
Can you make molecule CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=C3C=C3CC(C)(C)O2)C1 | CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=C3C=C3CC(C)(C)O2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)Cc2cc&ccc2O1",
"old_substring": "CCC2"
} |
Can you make molecule CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=C3C=C3CCN2C)C1 | CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]C2=CC=C3C=C3CCN2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CN1CCc2cc&ccc21",
"old_substring": "CCC2"
} |
Can you make molecule CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]CCCCC23CC2C3)C1 | CCC[NH2+][C@H](Cc1ccccc1)[C@@H]1CN(CC)CCO1 | CCN1CCO[C@H]([C@@H](Cc2ccccc2)[NH2+]CCCCC23CC2C3)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC2(CCCC2)C1",
"old_substring": "CCC2"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCCCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCCCCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)n1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCCCC(=O)n1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCC(CC=C)n1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCC(CC=C)n1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&CC=C",
"old_substring": "C=CC4"
} |
Can you make molecule C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(Cl)Cn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=CCn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | C=C(Cl)Cn1c(=O)c2c(nc3n2[C@H](C)C(C)=NN3C)n(C)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=C(Cl)C&",
"old_substring": "C=CC4"
} |
Can you make molecule C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@H]1NSC(=O)Cc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NSC(=O)Cc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@H]1NC(=O)CCCC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)CCCC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@H]1NC(=O)CC(C)(C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)CC(C)(C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCCC[C@H]1NC(=O)CCC(C)(C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)CCC(C)(C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SN[C@@H]1CCCC[C@@H]1C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H]1CCCC[C@H]1NC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | C[C@H](C(=O)SN[C@@H]1CCCC[C@@H]1C)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1ccc2ccc(NC(=O)CC(C)(C)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)CC(C)(C)NCCc3ccccn3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1ccc2ccc(NC(=O)CCC(C)(C)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)CCC(C)(C)NCCc3ccccn3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C45=O"
} |
Can you make molecule COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1ccc2ccc(NC(=O)C[C@@H](Br)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(NC(=O)C[C@@H](Br)NCCc3ccccn3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C45=O"
} |
Can you make molecule COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1ccc2ccc(Nc3cc(C)n(NCCc4ccccn4)c(=O)c3)cc21 | COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(Nc3cc(C)n(NCCc4ccccn4)c(=O)c3)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C45=O"
} |
Can you make molecule COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 less soluble in water? The output molecule should be similar to the input molecule. | COCCn1ccc2ccc(Nc3c(C)n(NCCc4ccccn4)ccc3=O)cc21 | COCCn1ccc2ccc(NC(=O)NCCc3ccccn3)cc21 | COCCn1ccc2ccc(Nc3c(C)n(NCCc4ccccn4)ccc3=O)cc21 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C45=O"
} |
Can you make molecule Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCCCNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CCCCNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCC=NC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CCC=NC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C57"
} |
Can you make molecule Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(CCCCCNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CCCCCNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C57"
} |
Can you make molecule Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CC(NC(=O)C(=O)Nc3cc(Cl)ccc3Cl)C2)no1 | Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(C2CC(NC(=O)C(=O)Nc3cc(Cl)ccc3Cl)C2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C57"
} |
Can you make molecule Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(SC(=S)ONC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(CNC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | Cc1nc(SC(=S)ONC(=O)C(=O)Nc2cc(Cl)ccc2Cl)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C57"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCCS3)C2)s1 | CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCCS3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCCCS3)C2)s1 | CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCCCS3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3(C)SCCS3)C2)s1 | CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3(C)SCCS3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCSCS3)C2)s1 | CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3SCSCS3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS6"
} |
Can you make molecule CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3CSCCSC3)C2)s1 | CS[C@@H]1CC[C@H](NC(=O)CCC(=O)c2ccc(C)s2)C1 | Cc1ccc(C(=O)CCC(=O)N[C@H]2CC[C@@H](C3CSCCSC3)C2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS6"
} |
Can you make molecule O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnnn1C1SCCS1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1SCCS1)N[C@H](CO)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnnn1C1CCCCC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CCCCC1)N[C@H](CO)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnnn1C1SCCCS1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1SCCCS1)N[C@H](CO)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnnn1C1SCSCS1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1SCSCS1)N[C@H](CO)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1nnnn1C1CCCCCC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CC1)N[C@H](CO)C(=O)[O-] | O=C(CSc1nnnn1C1CCCCCC1)N[C@H](CO)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C15CC1"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COC(=S)Sc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(COC(=S)Sc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Cc1ccc(Br)cc1)OCC(=O)N[C@H]1CCS(=O)(=O)C1 | O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | N=C(Cc1ccc(Br)cc1)OCC(=O)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCC(=O)c1ccc(Br)cc1)CC(=O)N[C@H]1CCS(=O)(=O)C1 | O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(CCC(=O)c1ccc(Br)cc1)CC(=O)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&CCC&=O",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C[C@H](O)CCc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(C[C@H](O)CCc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(Br)cc1)CC(=O)N[C@H]1CCS(=O)(=O)C1 | O=C(COc1ccc(Br)cc1)N[C@H]1CCS(=O)(=O)C1 | O=C(/C=C/Sc1ccc(Br)cc1)CC(=O)N[C@H]1CCS(=O)(=O)C1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccccc2N)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nnc(NC(=O)c2ccccc2N)s1 | CCc1nnc(NC(=O)c2ccccc2N)s1 | C=CSc1nnc(NC(=O)c2ccccc2N)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccccc2N)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nnc(NC(=O)c2ccccc2N)s1 | CCc1nnc(NC(=O)c2ccccc2N)s1 | CC(C)c1nnc(NC(=O)c2ccccc2N)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC6"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccccc2N)s1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nnc(NC(=O)c2ccccc2N)s1 | CCc1nnc(NC(=O)c2ccccc2N)s1 | C=CCCc1nnc(NC(=O)c2ccccc2N)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC6"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccccc2N)s1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccccc1C(=O)Nc1nnc(CCCCl)s1 | CCc1nnc(NC(=O)c2ccccc2N)s1 | Nc1ccccc1C(=O)Nc1nnc(CCCCl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC6"
} |
Can you make molecule CCc1nnc(NC(=O)c2ccccc2N)s1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccccc1C(=O)Nc1nnc(CCCCS)s1 | CCc1nnc(NC(=O)c2ccccc2N)s1 | Nc1ccccc1C(=O)Nc1nnc(CCCCS)s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC6"
} |
Can you make molecule O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3ccc(Br)cc3I)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3ccc(Br)cc3I)C(=O)N=C2[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1I",
"old_substring": "c16cccc(Br)c1"
} |
Can you make molecule O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(/C=C/Br)c3)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(/C=C/Br)c3)C(=O)N=C2[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(/C=C/Br)c1",
"old_substring": "c16cccc(Br)c1"
} |
Can you make molecule O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3ccc(Br)cc3Br)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3ccc(Br)cc3Br)C(=O)N=C2[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)cc1Br",
"old_substring": "c16cccc(Br)c1"
} |
Can you make molecule O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(N2C(=O)N=C([O-])C(=Cc3ccc(-c4ccccc4C(=O)[O-])o3)C2=O)oc2ccc(Br)cc12 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 | Cc1c(N2C(=O)N=C([O-])C(=Cc3ccc(-c4ccccc4C(=O)[O-])o3)C2=O)oc2ccc(Br)cc12 | 102 | {
"fragment_index": 0,
"new_substring": "c1&oc2ccc(Br)cc2c1C",
"old_substring": "c16cccc(Br)c1"
} |
Can you make molecule O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cc(Br)ccc3I)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cccc(Br)c3)C(=O)N=C2[O-])o1 | O=C([O-])c1ccccc1-c1ccc(C=C2C(=O)N(c3cc(Br)ccc3I)C(=O)N=C2[O-])o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1I",
"old_substring": "c16cccc(Br)c1"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c(OC)cc1I | COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c(OC)cc1Cl | COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc(I)c1OC | COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1cc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc(I)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(OC)c(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c1 | COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1cc(Br)c(OC)c(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1ccc(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | COc1cc(Br)c(-c2csc(NC(=O)c3ccc(S(C)(=O)=O)cc3)n2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c15ccc9cc16"
} |
Can you make molecule COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5Cl)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5Cl)CC4)ncc3c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cn2ccc3nc(N4CCN(c5ccc(I)cc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccc(I)cc5)CC4)ncc3c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cn2ccc3nc(N4CCN(c5ccc(C)c(I)c5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccc(C)c(I)c5)CC4)ncc3c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cn2ccc3nc(N4CCN(c5cccc(Br)c5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5cccc(Br)c5)CC4)ncc3c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c18ccccc1"
} |
Can you make molecule COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Cn2ccc3nc(N4CCN(c5cccc(C)c5C)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5ccccc5)CC4)ncc3c2=O)cc1 | COc1ccc(Cn2ccc3nc(N4CCN(c5cccc(C)c5C)CC4)ncc3c2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c18ccccc1"
} |
Can you make molecule Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1Cl | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccncc1Cl",
"old_substring": "c12ccncc1"
} |
Can you make molecule Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1/C=N/NC(=O)c1ccccc1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1",
"old_substring": "c12ccncc1"
} |
Can you make molecule Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1/C=N/NC(=O)c1cnc2ccsc2c1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 | Cc1nn(C)cc1/C=N/NC(=O)c1cnc2ccsc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cnc2ccsc2c1",
"old_substring": "c12ccncc1"
} |
Can you make molecule Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1/C=N/NC(=O)c1ccc2sncc2c1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccc2sncc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2sncc2c1",
"old_substring": "c12ccncc1"
} |
Can you make molecule Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(C)cc1/C=N/NC(=O)c1nc2ccccc2s1 | Cc1nn(C)cc1/C=N/NC(=O)c1ccncc1 | Cc1nn(C)cc1/C=N/NC(=O)c1nc2ccccc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc2ccccc2s1",
"old_substring": "c12ccncc1"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC2CCC(NSC(=O)Cc3ccc[nH]3)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 | N#Cc1ccc(OC2CCC(NSC(=O)Cc3ccc[nH]3)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccc(OC2CCC(NC(=O)CCCC(=O)c3ccc[nH]3)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 | N#Cc1ccc(OC2CCC(NC(=O)CCCC(=O)c3ccc[nH]3)CC2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)NC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 | CC(C)(CC(=O)NC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)NC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 | CC(C)(CCC(=O)NC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C(=O)SNC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | N#Cc1ccc(OC2CCC(NC(=O)c3ccc[nH]3)CC2)nc1 | C[C@H](C(=O)SNC1CCC(Oc2ccc(C#N)cn2)CC1)c1ccc[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccc(-c2nc3cc(CCCCBr)ccc3o2)cc1 | CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | [NH3+]Cc1ccc(-c2nc3cc(CCCCBr)ccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | C=CCCCCc1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccc(-c2nc3cc(CCCCCBr)ccc3o2)cc1 | CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | [NH3+]Cc1ccc(-c2nc3cc(CCCCCBr)ccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccc(-c2nc3cc(CCCCCS)ccc3o2)cc1 | CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | [NH3+]Cc1ccc(-c2nc3cc(CCCCCS)ccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 less soluble in water? The output molecule should be similar to the input molecule. | [NH3+]Cc1ccc(-c2nc3cc(CCCCCCS)ccc3o2)cc1 | CC(C)c1ccc2oc(-c3ccc(C[NH3+])cc3)nc2c1 | [NH3+]Cc1ccc(-c2nc3cc(CCCCCCS)ccc3o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c(OC)cc1I | COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c(OC)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1I",
"old_substring": "c13ccc8cc14"
} |
Can you make molecule COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c(OC)cc1Cl | COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c(OC)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&cc1Cl",
"old_substring": "c13ccc8cc14"
} |
Can you make molecule COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc(I)c1OC | COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1cc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc(I)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(I)c1&",
"old_substring": "c13ccc8cc14"
} |
Can you make molecule COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c(OC)c([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c1 | COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1cc(Br)c(OC)c([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c&c(Br)c1",
"old_substring": "c13ccc8cc14"
} |
Can you make molecule COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(Br)c([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1ccc([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | COc1cc(Br)c([C@@H]2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2ccc(F)cc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c&cc1&",
"old_substring": "c13ccc8cc14"
} |
Can you make molecule Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NSC(=O)Cc2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NSC(=O)Cc2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CCCC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)CCCC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CC(C)(C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)CC(C)(C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)CCC(C)(C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)CCC(C)(C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NSC(=O)[C@@H](C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NC(=O)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | Cc1cc(NSC(=O)[C@@H](C)c2cccc([N+](=O)[O-])c2C)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C35=O"
} |
Can you make molecule CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCC[C@@H]1CC(=O)SNCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1CC(=O)SNCCc1ccc(F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCC[C@@H]1CC(=C=O)CNCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1CC(=C=O)CNCCc1ccc(F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C35=O"
} |
Can you make molecule CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCC[C@@H]1C(=O)CCCC(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)CCCC(=O)NCCc1ccc(F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C35=O"
} |
Can you make molecule CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCC[C@@H]1C(C)(C)CC(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(C)(C)CC(=O)NCCc1ccc(F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C35=O"
} |
Can you make molecule CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)N1CCCC[C@@H]1CCC[S@@+]([O-])CNCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1C(=O)NCCc1ccc(F)cc1C | CCC(=O)N1CCCC[C@@H]1CCC[S@@+]([O-])CNCCc1ccc(F)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C35=O"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2Cl)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccc(I)cc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccc(I)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccc(C)c(I)c2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccc(C)c(I)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2cccc(Br)c2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2cccc(C)c2C)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2ccccc2)cc1 | Cc1ccc(S(=O)(=O)N2C(N)=C(C#N)[C@H](c3ccc(Cl)cc3)[C@H]2C(=O)c2cccc(C)c2C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCC(=NO[C@@H]2CC[C@H](NC(=O)[C@@H]3CCCc4[nH]ncc43)C2)CC1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | C[NH+]1CCC(=NO[C@@H]2CC[C@H](NC(=O)[C@@H]3CCCc4[nH]ncc43)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCC(=NO&)CC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH+]1CCc2onc([C@@H]3CC[C@H](NC(=O)[C@@H]4CCCc5[nH]ncc54)C3)c2C1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | C[NH+]1CCc2onc([C@@H]3CC[C@H](NC(=O)[C@@H]4CCCc5[nH]ncc54)C3)c2C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[NH+]1CCc2onc&c2C1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+](C)(C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | C[N+](C)(C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1CC[C@@H](C[NH+]2CCCSCC2)C1)[C@@H]1CCCc2[nH]ncc21 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | O=C(N[C@H]1CC[C@@H](C[NH+]2CCCSCC2)C1)[C@@H]1CCCc2[nH]ncc21 | 102 | {
"fragment_index": 0,
"new_substring": "C&[NH+]1CCCSCC1",
"old_substring": "C[NH+]5C"
} |
Can you make molecule C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[N+]1(C)CCC([C@@H]2CC[C@H](NC(=O)[C@@H]3CCCc4[nH]ncc43)C2)CC1 | C[NH+](C)[C@@H]1CC[C@H](NC(=O)[C@@H]2CCCc3[nH]ncc32)C1 | C[N+]1(C)CCC([C@@H]2CC[C@H](NC(=O)[C@@H]3CCCc4[nH]ncc43)C2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]1(C)CCC&CC1",
"old_substring": "C[NH+]5C"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.