prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(O)c(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c2onc1-2 | CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O | CCc1ccc(O)c(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c2onc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCOc2ccc(CCS(=O)(=O)[N-]c3cc(Br)ccc3O)cc2C1 | CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O | CCN1CCOc2ccc(CCS(=O)(=O)[N-]c3cc(Br)ccc3O)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2ccc-2ncn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O | CCc1cc2ccc-2ncn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2nc-2ccn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O | CCc1ccc2nc-2ccn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc2nc-2ccn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | CCOCCS(=O)(=O)[N-]c1cc(Br)ccc1O | CCc1cnc2nc-2ccn(CCS(=O)(=O)[N-]c2cc(Br)ccc2O)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 less soluble in water? The output molecule should be similar to the input molecule. | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3Cl)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3Cl)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 less soluble in water? The output molecule should be similar to the input molecule. | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccc(I)cc3)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccc(I)cc3)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2CCN(C(=O)C[C@@H]3SC(N)=NC3=O)C2)cc1I | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 | Cc1ccc([C@H]2CCN(C(=O)C[C@@H]3SC(N)=NC3=O)C2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 less soluble in water? The output molecule should be similar to the input molecule. | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3cccc(Br)c3)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3cccc(Br)c3)C2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H]2CCN(C(=O)C[C@@H]3SC(N)=NC3=O)C2)c1C | NC1=NC(=O)[C@H](CC(=O)N2CC[C@H](c3ccccc3)C2)S1 | Cc1cccc([C@H]2CCN(C(=O)C[C@@H]3SC(N)=NC3=O)C2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3Cl)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3Cl)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3Br)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3Br)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)c(Cl)c3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)c(Cl)c3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(I)cc3F)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(I)cc3F)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3cc4c(F)cccc4s3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3ccc(F)cc3)C2)n1 | Cc1noc(-c2cccnc2N2CC[C@H](NC(=O)COc3cc4c(F)cccc4s3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c16ccc(F)cc1"
} |
Can you make molecule Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OC(=O)c2cc(I)cc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cc(I)cc(C(=O)Oc3ccc(C)cn3)n2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)cc&n1",
"old_substring": "c18cccc9n1"
} |
Can you make molecule Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OC(=O)c2cc(Cl)nc(C(=O)Oc3ccc(C)cn3)c2)nc1 | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cc(Cl)nc(C(=O)Oc3ccc(C)cn3)c2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&cc(Cl)n1",
"old_substring": "c18cccc9n1"
} |
Can you make molecule Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OC(=O)c2cc(Cl)cc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cc(Cl)cc(C(=O)Oc3ccc(C)cn3)n2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Cl)cc&n1",
"old_substring": "c18cccc9n1"
} |
Can you make molecule Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OC(=O)c2cnc(C(=O)Oc3ccc(C)cn3)c(Cl)c2)nc1 | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cnc(C(=O)Oc3ccc(C)cn3)c(Cl)c2)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c18cccc9n1"
} |
Can you make molecule Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(OC(=O)c2cccn(C(=O)Oc3ccc(C)cn3)c2=O)nc1 | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(C)cn3)n2)nc1 | Cc1ccc(OC(=O)c2cccn(C(=O)Oc3ccc(C)cn3)c2=O)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccn&c1=O",
"old_substring": "c18cccc9n1"
} |
Can you make molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C=C1CCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(C=C1CCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC1CCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CC1CCCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CSC1=CCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CSC1=CCCCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C=CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | CN(C=CC1CCCC1)C(=O)C(=O)Nc1cccc(SC(F)F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&C1CCCC1",
"old_substring": "C16CCCC1"
} |
Can you make molecule COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccnc1SC1=NCCN1C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1SC1=NCCN1C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N24C"
} |
Can you make molecule COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccnc1-c1oc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)nc1C#N | COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1-c1oc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)nc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1nc&oc1&",
"old_substring": "N24C"
} |
Can you make molecule COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccnc1-c1sc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)cc1C#N | COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1-c1sc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N24C"
} |
Can you make molecule COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccnc1-c1ccc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)cc1C#N | COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1-c1ccc(C(=O)C[C@H](C)Cc2ccc(Cl)cc2)cc1C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N24C"
} |
Can you make molecule COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccnc1N1CCC(=NOC(=O)C[C@H](C)Cc2ccc(Cl)cc2)CC1 | COc1cccnc1N(C)C(=O)C[C@H](C)Cc1ccc(Cl)cc1 | COc1cccnc1N1CCC(=NOC(=O)C[C@H](C)Cc2ccc(Cl)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&N=C1CCN&CC1",
"old_substring": "N24C"
} |
Can you make molecule O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=C(/C=C/Sc1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCC([C@H](O)c3ccccc3)CC2)nc1-c1cc(=O)[nH]c2ccccc12 | O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=Cc1sc(N2CCC([C@H](O)c3ccccc3)CC2)nc1-c1cc(=O)[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCC([C@H](O)c3ccccc3)CC2)sc1-c1cc(=O)[nH]c2ccccc12 | O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=Cc1nc(N2CCC([C@H](O)c3ccccc3)CC2)sc1-c1cc(=O)[nH]c2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCC([C@H](O)c2ccccc2)CC1)n1nc(-c2cc(=O)[nH]c3ccccc23)oc1=S | O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=C(N1CCC([C@H](O)c2ccccc2)CC1)n1nc(-c2cc(=O)[nH]c3ccccc23)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C34"
} |
Can you make molecule O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1cc(-c2ccc(/C=N/ON3CCC([C@H](O)c4ccccc4)CC3)o2)c2ccccc2[nH]1 | O=C(c1cc(=O)[nH]c2ccccc12)N1CCC([C@H](O)c2ccccc2)CC1 | O=c1cc(-c2ccc(/C=N/ON3CCC([C@H](O)c4ccccc4)CC3)o2)c2ccccc2[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc(O)c([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c2onc1-2 | CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F | CCc1ccc(O)c([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c2onc1-2 | 102 | {
"fragment_index": 0,
"new_substring": "Oc1ccc2c&noc2c1&",
"old_substring": "O23"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCOc2ccc([C@@H]3C[C@@H]([NH3+])[C@@H]3Nc3ncc(Cl)cc3F)cc2C1 | CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F | CCN1CCOc2ccc([C@@H]3C[C@@H]([NH3+])[C@@H]3Nc3ncc(Cl)cc3F)cc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCOc2ccc&cc2C1",
"old_substring": "O23"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2ccc-2ncn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F | CCc1cc2ccc-2ncn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cc&ccc2ncn1&",
"old_substring": "O23"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1ccc2nc-2ccn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F | CCc1ccc2nc-2ccn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2ccc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CCc1cnc2nc-2ccn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | CCO[C@@H]1C[C@@H]([NH3+])[C@@H]1Nc1ncc(Cl)cc1F | CCc1cnc2nc-2ccn([C@@H]2C[C@@H]([NH3+])[C@@H]2Nc2ncc(Cl)cc2F)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O=c1c2cnc&nc2ccn1&",
"old_substring": "O23"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NSC(=O)Cc2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NSC(=O)Cc2ccc3c(c2)Cc2ccccc2-3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C58=O"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NC(=O)CCCC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)CCCC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C58=O"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NC(=O)CC(C)(C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)CC(C)(C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NC(=O)CCC(C)(C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)CCC(C)(C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C58=O"
} |
Can you make molecule CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1ccc(NSC(=O)[C@@H](C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NC(=O)c2ccc3c(c2)Cc2ccccc2-3)cc1 | CC(=O)Nc1ccc(NSC(=O)[C@@H](C)c2ccc3c(c2)Cc2ccccc2-3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C58=O"
} |
Can you make molecule COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | COCSCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | COCSCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | CC(=O)SCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2CC[C@H](COCCC(=O)CI)C2)C[C@@H](C)O1 | COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | C[C@@H]1CC([NH+]2CC[C@H](COCCC(=O)CI)C2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2CC[C@H](COCCC3OCCCO3)C2)C[C@@H](C)O1 | COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | C[C@@H]1CC([NH+]2CC[C@H](COCCC3OCCCO3)C2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&OCCCO1",
"old_substring": "CO3"
} |
Can you make molecule COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1CC([NH+]2CC[C@H](COCCC(=O)CCl)C2)C[C@@H](C)O1 | COCCOC[C@H]1CC[NH+](C2C[C@@H](C)O[C@H](C)C2)C1 | C[C@@H]1CC([NH+]2CC[C@H](COCCC(=O)CCl)C2)C[C@@H](C)O1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCl",
"old_substring": "CO3"
} |
Can you make molecule O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(Cl)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Cl)c1",
"old_substring": "C=4c1cccc(F)c1"
} |
Can you make molecule O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(Br)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cccc(Br)c1",
"old_substring": "C=4c1cccc(F)c1"
} |
Can you make molecule O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(F)cc1Br | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(F)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(F)cc1Br",
"old_substring": "C=4c1cccc(F)c1"
} |
Can you make molecule O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(Cl)cc1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Cl)cc1",
"old_substring": "C=4c1cccc(F)c1"
} |
Can you make molecule O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(Br)cc1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1cccc(F)c1 | O=C1OC(c2ccccc2OC(F)F)=NC1=Cc1ccc(Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccc(Br)cc1",
"old_substring": "C=4c1cccc(F)c1"
} |
Can you make molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNSC(=O)Cc1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNSC(=O)Cc1cc2sccc2n1Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)CCCC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)CCCC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)CC(C)(C)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)CC(C)(C)c1cc2sccc2n1Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNC(=O)CCC(C)(C)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)CCC(C)(C)c1cc2sccc2n1Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1CNSC(=O)[C@@H](C)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNC(=O)c1cc2sccc2n1Cc1cccc(F)c1 | COc1ccccc1CNSC(=O)[C@@H](C)c1cc2sccc2n1Cc1cccc(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)CC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOSC(=O)CC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOCC(=C=O)CC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOCC(=C=O)CC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)CCCC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)CC(C)(C)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC[S@+]([O-])CCCC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC(=O)C1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | CCOC[S@+]([O-])CCCC1(NCc2nnc(-c3cc(C)oc3C)o2)CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C48=O"
} |
Can you make molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(NC(=O)N2CCCc3cc(NC(=O)CC4CCCC4)ccc3C2)c1 | N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)N2CCCc3cc(NC(=O)CC4CCCC4)ccc3C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N15CCC8CC1"
} |
Can you make molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(NC(=O)C2CCC(NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)C2CCC(NC(=O)CC3CCCC3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N15CCC8CC1"
} |
Can you make molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(NC(=O)CCCCCNC(=O)CC2CCCC2)c1 | N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)CCCCCNC(=O)CC2CCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N15CCC8CC1"
} |
Can you make molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1cccc(NC(=O)C2CCC(=NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 | N#Cc1cccc(NC(=O)C2CCC(=NC(=O)CC3CCCC3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC=&CC1",
"old_substring": "N15CCC8CC1"
} |
Can you make molecule N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(NC(=O)CC2CCCC2)CCC(C(=O)Nc2cccc(C#N)c2)CC1 | N#Cc1cccc(NC(=O)N2CCC(NC(=O)CC3CCCC3)CC2)c1 | CC1(NC(=O)CC2CCCC2)CCC(C(=O)Nc2cccc(C#N)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&(C)CC1",
"old_substring": "N15CCC8CC1"
} |
Can you make molecule CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCSC(=S)OC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCSC(=S)OC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=N)OC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCCC(=N)OC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=N)C&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCCC[C@@H](O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CC&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCS/C=C/C(=O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCS/C=C/C(=O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O34"
} |
Can you make molecule CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[C@@H](O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCOC(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | CCCCC[C@@H](O)C(=O)C1=C(c2ccccc2)Nc2ncnn2[C@H]1c1ccc(SC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@@H]&CCC&",
"old_substring": "O34"
} |
Can you make molecule Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccc(I)cc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccc(I)cc2F)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2cc(I)ccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2cc(I)ccc2F)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2Cl)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2Cl)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1F"
} |
Can you make molecule Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2cc(F)ccc2Br)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2cc(F)ccc2Br)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c17ccccc1F"
} |
Can you make molecule Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccc(F)cc2Cl)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccccc2F)n(C)n1 | Cc1cc(NC(=O)N[C@@H](Cc2ccccc2)c2ccc(F)cc2Cl)n(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c17ccccc1F"
} |
Can you make molecule C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](SCSc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](SCSc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "S&CS&",
"old_substring": "S57"
} |
Can you make molecule C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NC[C@H]1COc2ccccc2O1)N1CCSc2ccc(-c3cccc[n+]3[O-])cc21 | C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@@H](C(=O)NC[C@H]1COc2ccccc2O1)N1CCSc2ccc(-c3cccc[n+]3[O-])cc21 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSc2ccc&cc21",
"old_substring": "S57"
} |
Can you make molecule C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](C[S@@+]([O-])C(Cl)(Cl)c1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](C[S@@+]([O-])C(Cl)(Cl)c1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "O=[S@](C&)C&(Cl)Cl",
"old_substring": "S57"
} |
Can you make molecule C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](S/C(Cl)=C(\C#N)Nc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@H](S/C(Cl)=C(\C#N)Nc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | 102 | {
"fragment_index": 0,
"new_substring": "S&/C(Cl)=C(\\C#N)N&",
"old_substring": "S57"
} |
Can you make molecule C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](C(=O)NC[C@H]1COc2ccccc2O1)n1c(=S)n(-c2cccc[n+]2[O-])c2ccccc21 | C[C@H](Sc1cccc[n+]1[O-])C(=O)NC[C@H]1COc2ccccc2O1 | C[C@@H](C(=O)NC[C@H]1COc2ccccc2O1)n1c(=S)n(-c2cccc[n+]2[O-])c2ccccc21 | 102 | {
"fragment_index": 0,
"new_substring": "n1&c(=S)n&c2ccccc21",
"old_substring": "S57"
} |
Can you make molecule O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCOc1ccc2c(c1)OCO2)c1ccc(C2CC2)o1 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 | O=C(NCCOc1ccc2c(c1)OCO2)c1ccc(C2CC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&o1",
"old_substring": "c17cc8on1"
} |
Can you make molecule O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1oc(C2CC2)cc1C(=O)NCCOc1ccc2c(c1)OCO2 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 | Cc1oc(C2CC2)cc1C(=O)NCCOc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&oc1C",
"old_substring": "c17cc8on1"
} |
Can you make molecule O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCOc1ccc2c(c1)OCO2)c1ccc2oc(C3CC3)nc2c1 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 | O=C(NCCOc1ccc2c(c1)OCO2)c1ccc2oc(C3CC3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2oc&nc2c1",
"old_substring": "c17cc8on1"
} |
Can you make molecule O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCOc1ccc2c(c1)OCO2)c1cc2occc2c(C2CC2)n1 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc2occc2c(C2CC2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2occc2c&n1",
"old_substring": "c17cc8on1"
} |
Can you make molecule O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C2CC2)ccc1C(=O)NCCOc1ccc2c(c1)OCO2 | O=C(NCCOc1ccc2c(c1)OCO2)c1cc(C2CC2)on1 | Cc1nc(C2CC2)ccc1C(=O)NCCOc1ccc2c(c1)OCO2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&nc1C",
"old_substring": "c17cc8on1"
} |
Can you make molecule N#CCC[NH2+]C1(C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[NH2+]C1(CCS(=O)(=O)[O-])CC1 | N#CCC[NH2+]C1(C(=O)[O-])CC1 | N#CCC[NH2+]C1(CCS(=O)(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule N#CCC[NH2+]C1(C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[NH2+]C1(C(=O)CO)CC1 | N#CCC[NH2+]C1(C(=O)[O-])CC1 | N#CCC[NH2+]C1(C(=O)CO)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule N#CCC[NH2+]C1(C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[NH2+]C1(C(O)O)CC1 | N#CCC[NH2+]C1(C(=O)[O-])CC1 | N#CCC[NH2+]C1(C(O)O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule N#CCC[NH2+]C1(C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | N#CCC[NH2+]C1(C(F)(F)C(=O)[O-])CC1 | N#CCC[NH2+]C1(C(=O)[O-])CC1 | N#CCC[NH2+]C1(C(F)(F)C(=O)[O-])CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule N#CCC[NH2+]C1(C(=O)[O-])CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])C1([NH2+]CCC#N)CC1 | N#CCC[NH2+]C1(C(=O)[O-])CC1 | CCC(CC)(C(=O)[O-])C1([NH2+]CCC#N)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(CC(=O)NCc1ccccn1)Oc1ccccc1OC | CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 | CC[C@@](C)(CC(=O)NCc1ccccn1)Oc1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@]&(C)CC&=O",
"old_substring": "CC[C@@H]3C2=O"
} |
Can you make molecule CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1OCC[C@H](Cl)NCc1ccccn1 | CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 | COc1ccccc1OCC[C@H](Cl)NCc1ccccn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "CC[C@@H]3C2=O"
} |
Can you make molecule CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@](C)(C#CCNCc1ccccn1)Oc1ccccc1OC | CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 | CC[C@@](C)(C#CCNCc1ccccn1)Oc1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@@]&(C)C#CC&",
"old_substring": "CC[C@@H]3C2=O"
} |
Can you make molecule CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)NCc1ccccn1)Oc1ccccc1OC | CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 | CCC[C@H](CC(=O)NCc1ccccn1)Oc1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "CC[C@@H]3C2=O"
} |
Can you make molecule CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CC(=O)NCc1ccccn1)Oc1ccccc1OC | CC[C@@H](Oc1ccccc1OC)C(=O)NCc1ccccn1 | CCC[C@@H](CC(=O)NCc1ccccn1)Oc1ccccc1OC | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&=O",
"old_substring": "CC[C@@H]3C2=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.