prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc([C@@H](C)CC[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc([C@@H](C)CC[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4[C@H]5N"
} |
Can you make molecule Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@H](N)C(C)(C)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@H](N)C(C)(C)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](N)C&(C)C",
"old_substring": "C4[C@H]5N"
} |
Can you make molecule Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@@H](N)C(C)(C)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)C(C)(C)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@@H](N)C&(C)C",
"old_substring": "C4[C@H]5N"
} |
Can you make molecule Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C(=O)[C@@H](C)N(C)O[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C(=O)[C@@H](C)N(C)O[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](C&=O)N(C)O&",
"old_substring": "C4[C@H]5N"
} |
Can you make molecule Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nc(C[C@H](S)C[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@@H](N)[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | Cc1nc(C[C@H](S)C[C@]2([NH+](C)C)CCC[C@H](C)C2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[C@H](S)C&",
"old_substring": "C4[C@H]5N"
} |
Can you make molecule CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | C=CSOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | C=CCCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCCl)C3=O)CC1 | CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCCl)C3=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCCS)C3=O)CC1 | CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCCS)C3=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC3"
} |
Can you make molecule CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCBr)C3=O)CC1 | CCOc1ccccc1C=C1Oc2c(ccc([O-])c2C[NH+]2CCN(C)CC2)C1=O | CN1CC[NH+](Cc2c([O-])ccc3c2OC(=Cc2ccccc2OCCCBr)C3=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC3"
} |
Can you make molecule CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(C(C)C)n1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)C(C(C)C)n1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)n1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)CCCC(=O)n1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCc1[nH+]ccn1CC(C)(C)CCC#N)c1ccccc1 | CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)[C@@H](NCc1[nH+]ccn1CC(C)(C)CCC#N)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)CCC#N",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCc1[nH+]ccn1[C@@H](CI)C(C)C)c1ccccc1 | CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)[C@@H](NCc1[nH+]ccn1[C@@H](CI)C(C)C)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CI",
"old_substring": "CC(C)C4"
} |
Can you make molecule CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@@H](NCc1[nH+]ccn1C(C)(C)CCBr)c1ccccc1 | CC(C)Cn1cc[nH+]c1CN[C@@H](c1ccccc1)C(C)C | CC(C)[C@@H](NCc1[nH+]ccn1C(C)(C)CCBr)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC(C)C4"
} |
Can you make molecule Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[C@@H]2CN(c3ccc4c(c3)OCO4)C[C@H]2C)cc(C#N)n1C | Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C | Cc1c(C[C@@H]2CN(c3ccc4c(c3)OCO4)C[C@H]2C)cc(C#N)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[NH+]14CCC[C@H]16"
} |
Can you make molecule Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[C@H]2CN(c3ccc4c(c3)OCO4)C[C@@H]2C)cc(C#N)n1C | Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C | Cc1c(C[C@H]2CN(c3ccc4c(c3)OCO4)C[C@@H]2C)cc(C#N)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]14CCC[C@H]16"
} |
Can you make molecule Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[NH+]2CCc3sc(-c4ccc5c(c4)OCO5)cc3C2)cc(C#N)n1C | Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C | Cc1c(C[NH+]2CCc3sc(-c4ccc5c(c4)OCO5)cc3C2)cc(C#N)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCc2sc&cc2C1",
"old_substring": "[NH+]14CCC[C@H]16"
} |
Can you make molecule Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[C@H]2CC[C@H](c3ccc4c(c3)OCO4)O2)cc(C#N)n1C | Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C | Cc1c(C[C@H]2CC[C@H](c3ccc4c(c3)OCO4)O2)cc(C#N)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CC[C@H]&O1",
"old_substring": "[NH+]14CCC[C@H]16"
} |
Can you make molecule Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C[C@@]2(N)CC[C@H](c3ccc4c(c3)OCO4)C2)cc(C#N)n1C | Cc1c(C[NH+]2CCC[C@H]2c2ccc3c(c2)OCO3)cc(C#N)n1C | Cc1c(C[C@@]2(N)CC[C@H](c3ccc4c(c3)OCO4)C2)cc(C#N)n1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@]1&(N)CC[C@H]&C1",
"old_substring": "[NH+]14CCC[C@H]16"
} |
Can you make molecule O=C(CBr)c1cnc2ccc(Cl)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc2ncc(CCCBr)n2c1 | O=C(CBr)c1cnc2ccc(Cl)cn12 | Clc1ccc2ncc(CCCBr)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "O=C3CBr"
} |
Can you make molecule O=C(CBr)c1cnc2ccc(Cl)cn12 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CCCBr)c1cnc2ccc(Cl)cn12 | O=C(CBr)c1cnc2ccc(Cl)cn12 | O=C(CCCBr)c1cnc2ccc(Cl)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCBr",
"old_substring": "O=C3CBr"
} |
Can you make molecule O=C(CBr)c1cnc2ccc(Cl)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc2ncc(CCCCBr)n2c1 | O=C(CBr)c1cnc2ccc(Cl)cn12 | Clc1ccc2ncc(CCCCBr)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "O=C3CBr"
} |
Can you make molecule O=C(CBr)c1cnc2ccc(Cl)cn12 less soluble in water? The output molecule should be similar to the input molecule. | Clc1ccc2ncc(CCCCCBr)n2c1 | O=C(CBr)c1cnc2ccc(Cl)cn12 | Clc1ccc2ncc(CCCCCBr)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "O=C3CBr"
} |
Can you make molecule O=C(CBr)c1cnc2ccc(Cl)cn12 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](Br)C(=O)c1cnc2ccc(Cl)cn12 | O=C(CBr)c1cnc2ccc(Cl)cn12 | CC[C@@H](Br)C(=O)c1cnc2ccc(Cl)cn12 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](Br)CC",
"old_substring": "O=C3CBr"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)C(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C1=CCCC1 | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C1=CCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)C(F)(F)C#N | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)C(F)(F)C#N | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N1CCC(C)CC1 | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N1CCC(C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N1CCC(F)CC1 | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N(C)C | COc1ccc(F)cc1NC(=O)c1sccc1S(=O)(=O)N1CCC(F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(F)CC1",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Cl)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Cl)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(I)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(I)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Cl)c2Cl)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Cl)c2Cl)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1Cl",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Br)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(Cl)c(Br)c2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Br)c1",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(Br)cc1C=C1C(=O)NN(c2c(C)cc(I)cc2C)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2ccc(C)c(C)c2)C1=O | COc1ccc(Br)cc1C=C1C(=O)NN(c2c(C)cc(I)cc2C)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(I)cc(C)c1&",
"old_substring": "c15ccc(C)c(C)c1"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCBr)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)(CCBr)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&(C)CCBr",
"old_substring": "CC7(C)C"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CCCC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CC7(C)C"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1)C(C)C | CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)C(c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&C(C)C",
"old_substring": "CC7(C)C"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC(C)CCCC(=O)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC7(C)C"
} |
Can you make molecule CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CCC(c2ccc(C(=O)N[C@H]3CCN4CCCc5cccc3c54)cc2)CC1 | CC(C)(C)c1ccc(C(=O)N[C@H]2CCN3CCCc4cccc2c43)cc1 | CC1(C)CCC(c2ccc(C(=O)N[C@H]3CCN4CCCc5cccc3c54)cc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1(C)CCC&CC1",
"old_substring": "CC7(C)C"
} |
Can you make molecule CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1Cl | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)cc1Cl",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)cc1I | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)cc1Br | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1cc(C)c(I)cc1C | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1cc(C)c(I)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1I",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)c(I)c1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(C)cc1 | CC[NH+]1CCC[C@@]2(CC1)C[NH+]=C(N)N2c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c14ccc(C)cc1"
} |
Can you make molecule CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=Cc1ccc(N(C)C)cc1)CCc1cccc(C#N)c1 | CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 | CC(=Cc1ccc(N(C)C)cc1)CCc1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=5(C#N)C4=O"
} |
Can you make molecule CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C=Cc1ccc(N(C)C)cc1)C(=O)c1cccc(C#N)c1 | CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 | C=C(C=Cc1ccc(N(C)C)cc1)C(=O)c1cccc(C#N)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C&)C&=O",
"old_substring": "C=5(C#N)C4=O"
} |
Can you make molecule CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc(C=CCCc2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=CCCc2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C=5(C#N)C4=O"
} |
Can you make molecule CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc(C=C/C=C/Nc2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=C/C=C/Nc2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&/C=C/N&",
"old_substring": "C=5(C#N)C4=O"
} |
Can you make molecule CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1ccc(C=C[S@+]([O-])CCCC(=O)c2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=C(C#N)C(=O)c2cccc(C#N)c2)cc1 | CN(C)c1ccc(C=C[S@+]([O-])CCCC(=O)c2cccc(C#N)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C=5(C#N)C4=O"
} |
Can you make molecule CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1nc2c(s1)CN(C(N)=O)C2 | CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1nc2c(s1)CN(C(N)=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2nc&sc2C1",
"old_substring": "N25"
} |
Can you make molecule CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)n1ncc2c1CN(C(N)=O)C2 | CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)n1ncc2c1CN(C(N)=O)C2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&Cc2cnn&c2C1",
"old_substring": "N25"
} |
Can you make molecule CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1onc2c1CN(C(N)=O)CC2 | CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1onc2c1CN(C(N)=O)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N25"
} |
Can you make molecule CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1cc2n(n1)CCCN2C(N)=O | CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1cc2n(n1)CCCN2C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N25"
} |
Can you make molecule CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1ccc2c(c1)CCN2C(N)=O | CCCC[C@@H](NC(N)=O)C(=O)Nc1cc(OC)ccc1F | CCCC[C@H](C(=O)Nc1cc(OC)ccc1F)c1ccc2c(c1)CCN2C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N25"
} |
Can you make molecule COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1=CC2=NC(SCc3cc(-c4ccccc4Cl)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4Cl)on3)=NC2=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1=CC2=NC(SCc3cc(-c4ccc(I)cc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccc(I)cc4)on3)=NC2=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1=CC2=NC(SCc3cc(-c4ccc(C)c(I)c4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccc(C)c(I)c4)on3)=NC2=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1=CC2=NC(SCc3cc(-c4cccc(Br)c4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4cccc(Br)c4)on3)=NC2=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c17ccccc1"
} |
Can you make molecule COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 less soluble in water? The output molecule should be similar to the input molecule. | COC1=CC2=NC(SCc3cc(-c4cccc(C)c4C)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4ccccc4)on3)=NC2=CC1 | COC1=CC2=NC(SCc3cc(-c4cccc(C)c4C)on3)=NC2=CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c17ccccc1"
} |
Can you make molecule Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(I)o2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(I)o2)[NH+]2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(Br)o2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(Br)o2)[NH+]2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(Cl)o2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccc(Cl)o2)[NH+]2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2occc2Br)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2occc2Br)[NH+]2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c19ccco1"
} |
Can you make molecule Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2sccc2C)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2ccco2)[NH+]2CCCCC2)o1 | Cc1ccc([C@@](C)(O)CNC(=O)NC[C@@H](c2sccc2C)[NH+]2CCCCC2)o1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c19ccco1"
} |
Can you make molecule C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)c1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 | C[C@H](CC(C)(C)c1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCNC(=O)CSc1ccc2c(c1)OCCCO2)CC(=O)c1ccc2ccccc2c1 | C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 | C[C@@H](CCNC(=O)CSc1ccc2c(c1)OCCCO2)CC(=O)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CSc1ccc2c(c1)OCCCO2)NCC[C@H](Cl)c1ccc2ccccc2c1 | C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 | O=C(CSc1ccc2c(c1)OCCCO2)NCC[C@H](Cl)c1ccc2ccccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C[C@@H]&Cl",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@H](CC(=O)c1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 | CCC[C@H](CC(=O)c1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@@H]&CC&=O",
"old_substring": "C[C@@H]46"
} |
Can you make molecule C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | C[C@@H](NC(=O)CSc1ccc2c(c1)OCCCO2)c1ccc2ccccc2c1 | CC(C)[C@H](CCc1ccc2ccccc2c1)NC(=O)CSc1ccc2c(c1)OCCCO2 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C[C@@H]46"
} |
Can you make molecule CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN(S(=O)(=O)c2cc(-c3nsc(Cl)c3Cl)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3nsc(Cl)c3Cl)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nsc(Cl)c1Cl",
"old_substring": "c16csc(C)n1"
} |
Can you make molecule CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(Cl)nc3C)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(Cl)nc3C)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)nc1C",
"old_substring": "c16csc(C)n1"
} |
Can you make molecule CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(C)s3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(C)s3)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C)s1",
"old_substring": "c16csc(C)n1"
} |
Can you make molecule CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN(S(=O)(=O)c2cc(-c3csc(I)c3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(I)c3)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c16csc(C)n1"
} |
Can you make molecule CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(Cl)s3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3csc(C)n3)ccc2C)CC1 | CCN1CCN(S(=O)(=O)c2cc(-c3ccc(Cl)s3)ccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c16csc(C)n1"
} |
Can you make molecule Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1Cc1ccc(NC(=O)c2ccc(-n3cccc3)cc2I)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2ccc(-n3cccc3)cc2I)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16cccc9c1"
} |
Can you make molecule Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1Cc1ccc(NC(=O)c2cc(-n3cccc3)ccc2Br)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cc(-n3cccc3)ccc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16cccc9c1"
} |
Can you make molecule Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1Cc1ccc(NC(=O)c2ccc(-n3cccc3)cc2Cl)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2ccc(-n3cccc3)cc2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16cccc9c1"
} |
Can you make molecule Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2Br)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c16cccc9c1"
} |
Can you make molecule Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2Cl)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2)cc1 | Cc1nccn1Cc1ccc(NC(=O)c2cccc(-n3cccc3)c2Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c16cccc9c1"
} |
Can you make molecule Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([S@@+]([O-])Cc2ccc(I)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(I)c(F)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(F)c1",
"old_substring": "c13ccc(N)c(F)c1"
} |
Can you make molecule Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(Br)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(Br)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(N)c(Br)c1",
"old_substring": "c13ccc(N)c(F)c1"
} |
Can you make molecule Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([S@@+]([O-])Cc2ccc(Cl)c(F)c2F)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(Cl)c(F)c2F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(F)c1F",
"old_substring": "c13ccc(N)c(F)c1"
} |
Can you make molecule Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([S@@+]([O-])Cc2ccc(I)c(O)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(I)c(O)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)c(O)c1",
"old_substring": "c13ccc(N)c(F)c1"
} |
Can you make molecule Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([S@@+]([O-])Cc2ccc(C#N)c(Cl)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(N)c(F)c2)c1 | Cc1cccc([S@@+]([O-])Cc2ccc(C#N)c(Cl)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C#N)c(Cl)c1",
"old_substring": "c13ccc(N)c(F)c1"
} |
Can you make molecule CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)co1 | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)co1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&co1",
"old_substring": "c13nc4no1"
} |
Can you make molecule CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(C2CCOCC2)ncnc1[C@H](C[NH3+])CC(C)C | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 | Cc1c(C2CCOCC2)ncnc1[C@H](C[NH3+])CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1C",
"old_substring": "c13nc4no1"
} |
Can you make molecule CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C2CCOCC2)nc1[C@H](C[NH3+])CC(C)C | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 | Cc1cnc(C2CCOCC2)nc1[C@H](C[NH3+])CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1C",
"old_substring": "c13nc4no1"
} |
Can you make molecule CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C[NH3+])c1ncnc(C2CCOCC2)c1F | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 | CC(C)C[C@@H](C[NH3+])c1ncnc(C2CCOCC2)c1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncnc&c1F",
"old_substring": "c13nc4no1"
} |
Can you make molecule CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)ncc1I | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)no1 | CC(C)C[C@@H](C[NH3+])c1nc(C2CCOCC2)ncc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ncc1I",
"old_substring": "c13nc4no1"
} |
Can you make molecule CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC(SCC(=O)Nc2ccc(C(F)(F)F)cc2I)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccc(C(F)(F)F)cc2I)=NC(=O)[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c15ccccc17"
} |
Can you make molecule CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC(SCC(=O)Nc2cc(C(F)(F)F)ccc2Br)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2cc(C(F)(F)F)ccc2Br)=NC(=O)[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c15ccccc17"
} |
Can you make molecule CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC(SCC(=O)Nc2ccc(C(F)(F)F)cc2Cl)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccc(C(F)(F)F)cc2Cl)=NC(=O)[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c15ccccc17"
} |
Can you make molecule CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC(SCC(=O)Nc2cccc(C(F)(F)F)c2Br)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2cccc(C(F)(F)F)c2Br)=NC(=O)[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c15ccccc17"
} |
Can you make molecule CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=NC(SCC(=O)Nc2cccc(C(F)(F)F)c2Cl)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2ccccc2C(F)(F)F)=NC(=O)[C@H]1Cc1ccccc1 | CC1=NC(SCC(=O)Nc2cccc(C(F)(F)F)c2Cl)=NC(=O)[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c15ccccc17"
} |
Can you make molecule Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)cc1NC(=O)C(=O)NCCCCCn1cc[nH+]c1 | Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 | Cc1ccc(F)cc1NC(=O)C(=O)NCCCCCn1cc[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4CC6"
} |
Can you make molecule Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(CCn1cc[nH+]c1)=NC(=O)C(=O)Nc1cc(F)ccc1C | Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 | CC(CCn1cc[nH+]c1)=NC(=O)C(=O)Nc1cc(F)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C4CC6"
} |
Can you make molecule Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)cc1NC(=O)C(=O)NC1CCC(n2cc[nH+]c2)CC1 | Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 | Cc1ccc(F)cc1NC(=O)C(=O)NC1CCC(n2cc[nH+]c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4CC6"
} |
Can you make molecule Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(F)cc1NC(=O)C(=O)NCC(C)(C)Cn1cc[nH+]c1 | Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 | Cc1ccc(F)cc1NC(=O)C(=O)NCC(C)(C)Cn1cc[nH+]c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C&)C&",
"old_substring": "C4CC6"
} |
Can you make molecule Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCn1cc[nH+]c1)NC(=O)C(=O)Nc1cc(F)ccc1C | Cc1ccc(F)cc1NC(=O)C(=O)NCCCn1cc[nH+]c1 | CCC[C@@H](CCn1cc[nH+]c1)NC(=O)C(=O)Nc1cc(F)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C4CC6"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.