prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCCC[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(CCCC[NH2+]Cc2cccc(Br)c2OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C68"
} |
Can you make molecule COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCCCC[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(CCCCC[NH2+]Cc2cccc(Br)c2OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C68"
} |
Can you make molecule COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(C2CC([NH2+]Cc3cccc(Br)c3OC)C2)c1OC | COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(C2CC([NH2+]Cc3cccc(Br)c3OC)C2)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C68"
} |
Can you make molecule COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(SC(=S)O[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(SC(=S)O[NH2+]Cc2cccc(Br)c2OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C68"
} |
Can you make molecule COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(NC(=S)S[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(C[NH2+]Cc2cccc(Br)c2OC)c1OC | COc1cccc(NC(=S)S[NH2+]Cc2cccc(Br)c2OC)c1OC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C68"
} |
Can you make molecule Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(=O)[nH]c(SCCC(CO)=Nc2nc(-c3ccc(Br)cc3)cs2)n1 | Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | Nc1cc(=O)[nH]c(SCCC(CO)=Nc2nc(-c3ccc(Br)cc3)cs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C4=O"
} |
Can you make molecule Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CSc1nc(N)cc(=O)[nH]1)=N/ONc1nc(-c2ccc(Br)cc2)cs1 | Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | C/C(CSc1nc(N)cc(=O)[nH]1)=N/ONc1nc(-c2ccc(Br)cc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc(N)cc(=O)[nH]1)C(=O)CNc1nc(-c2ccc(Br)cc2)cs1 | Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | CCC(CC)(Sc1nc(N)cc(=O)[nH]1)C(=O)CNc1nc(-c2ccc(Br)cc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(=O)[nH]c(SSSC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | Nc1cc(=O)[nH]c(SSSC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Sc1nc(N)cc(=O)[nH]1)C(=O)CCNc1nc(-c2ccc(Br)cc2)cs1 | Nc1cc(=O)[nH]c(SCC(=O)Nc2nc(-c3ccc(Br)cc3)cs2)n1 | CCC(CC)(Sc1nc(N)cc(=O)[nH]1)C(=O)CCNc1nc(-c2ccc(Br)cc2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(CC2(CC)CCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 | CCc1noc(CC2(CC)CCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(CC2(CC)CCCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 | CCc1noc(CC2(CC)CCCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N356"
} |
Can you make molecule CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(Cc2oc(C(=O)C(C)(C)NC(=O)c3cccs3)c(C#N)c2CC)n1 | CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 | CCc1noc(Cc2oc(C(=O)C(C)(C)NC(=O)c3cccs3)c(C#N)c2CC)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N356"
} |
Can you make molecule CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(CC2(CC)CCC(=O)N(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 | CCc1noc(CC2(CC)CCC(=O)N(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N356"
} |
Can you make molecule CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCc1noc(C[C@@]2(CC)CCCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | CCc1noc(CN(CC)C(=O)C(C)(C)NC(=O)c2cccs2)n1 | CCc1noc(C[C@@]2(CC)CCCN(C(=O)C(C)(C)NC(=O)c3cccs3)C2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N356"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)Cl | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC[C@H](C)Cl",
"old_substring": "C1(=O)CC[C@H](C)O"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)CNC(=O)[C@@H](C)C(C)C | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O | CC(C)C[C@](C)(O)CNC(=O)[C@@H](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C)C&=O",
"old_substring": "C1(=O)CC[C@H](C)O"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)NC[C@@](C)(O)CC(C)C | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O | C=C(C)[C@@](C)(O)NC[C@@](C)(O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)[C@@]&(C)O",
"old_substring": "C1(=O)CC[C@H](C)O"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@](C)(O)CNC[C@@H](C)C(C)C | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O | CC(C)C[C@](C)(O)CNC[C@@H](C)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@H](C)C&",
"old_substring": "C1(=O)CC[C@H](C)O"
} |
Can you make molecule CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)C(=O)NC[C@@](C)(O)CC(C)C | CC(C)C[C@](C)(O)CNC(=O)CC[C@H](C)O | CC[C@@H](C)C(=O)NC[C@@](C)(O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)[C@H](C)CC",
"old_substring": "C1(=O)CC[C@H](C)O"
} |
Can you make molecule C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C[C@@H](C)NSC(=O)Cc1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NSC(=O)Cc1c(C)cc(C)c([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C24=O"
} |
Can you make molecule C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C[C@@H](C)NC(=O)CCCC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)CCCC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C24=O"
} |
Can you make molecule C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C[C@@H](C)NC(=O)CC(C)(C)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)CC(C)(C)c1c(C)cc(C)c([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C[C@@H](C)NC(=O)CCC(C)(C)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)CCC(C)(C)c1c(C)cc(C)c([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C24=O"
} |
Can you make molecule C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C less soluble in water? The output molecule should be similar to the input molecule. | C=C[C@@H](C)NSC(=O)[C@@H](C)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NC(=O)c1c(C)cc(C)c([N+](=O)[O-])c1C | C=C[C@@H](C)NSC(=O)[C@@H](C)c1c(C)cc(C)c([N+](=O)[O-])c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C24=O"
} |
Can you make molecule O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCSC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCSC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCSC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2C=CCC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2C=CCC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&C=CCC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCSC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCSC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCSC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(S(=O)(=O)NC[C@H]2CCCOCC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | O=C(Nc1ccc(S(=O)(=O)NC[C@H]2CCCOCC2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCCOCC1",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1OCCC[C@H]1CNS(=O)(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(c3ccc(F)c(Cl)c3)C2)cc1 | O=C(Nc1ccc(S(=O)(=O)NC[C@@H]2CCCO2)cc1)[C@H]1CC(=O)N(c2ccc(F)c(Cl)c2)C1 | C[C@@H]1OCCC[C@H]1CNS(=O)(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(c3ccc(F)c(Cl)c3)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCO[C@H]1C",
"old_substring": "[C@@H]18CCCO1"
} |
Can you make molecule CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCC1=C(C)C[C@H](N2C(=O)c3cccc(N)c3C2=O)S1 | CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O | CCC1=C(C)C[C@H](N2C(=O)c3cccc(N)c3C2=O)S1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC1=C(C)C[C@H]&S1",
"old_substring": "CC1(C)CCC[C@H]13"
} |
Can you make molecule CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCC[C@H](C)N1C(=O)c2cccc(N)c2C1=O | CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O | CC(C)CCC[C@H](C)N1C(=O)c2cccc(N)c2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC[C@@H]&C",
"old_substring": "CC1(C)CCC[C@H]13"
} |
Can you make molecule CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)N1C(=O)c2cccc(N)c2C1=O | CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O | CCCCCC[C@@H](C)N1C(=O)c2cccc(N)c2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@H]&C",
"old_substring": "CC1(C)CCC[C@H]13"
} |
Can you make molecule CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC[C@@H](CBr)N1C(=O)c2cccc(N)c2C1=O | CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O | CC(C)(C)CC[C@@H](CBr)N1C(=O)c2cccc(N)c2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC[C@H]&CBr",
"old_substring": "CC1(C)CCC[C@H]13"
} |
Can you make molecule CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)C(=O)N1C(=O)c2cccc(N)c2C1=O | CC1(C)CCC[C@H]1N1C(=O)c2cccc(N)c2C1=O | CCCCCC[C@@H](C)C(=O)N1C(=O)c2cccc(N)c2C1=O | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@@H](C)C&=O",
"old_substring": "CC1(C)CCC[C@H]13"
} |
Can you make molecule CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)NSC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NSC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)NC(=O)CCCC(=O)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CCCC(=O)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C5(=O)C7"
} |
Can you make molecule CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)NC(=O)CC(C)(C)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CC(C)(C)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)NC[S@+]([O-])CCCN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC[S@+]([O-])CCCN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C5(=O)C7"
} |
Can you make molecule CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCNC(=O)NC(=O)CCC(C)(C)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CN1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | CCCNC(=O)NC(=O)CCC(C)(C)N1C(=O)N[C@](Cc2ccccc2)(c2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C5(=O)C7"
} |
Can you make molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1cc(Cl)c(Cl)cc1Cl)SN1CCN(C(=O)Nc2ccccc2)CC1 | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 | O=C(COc1cc(Cl)c(Cl)cc1Cl)SN1CCN(C(=O)Nc2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCCN(C(=O)Nc2ccccc2)C1=O | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCCN(C(=O)Nc2ccccc2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccccc1)SC1=NCCN1C(=O)COc1cc(Cl)c(Cl)cc1Cl | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 | O=C(Nc1ccccc1)SC1=NCCN1C(=O)COc1cc(Cl)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(C)CN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CCN1C(=O)Nc1ccccc1 | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 | CC1(C)CN(C(=O)COc2cc(Cl)c(Cl)cc2Cl)CCN1C(=O)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(C/N=C1\SCCCN1C(=O)COc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1 | O=C(COc1cc(Cl)c(Cl)cc1Cl)N1CCN(C(=O)Nc2ccccc2)CC1 | O=C(C/N=C1\SCCCN1C(=O)COc1cc(Cl)c(Cl)cc1Cl)Nc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCS/C1=N\\C&",
"old_substring": "N13CCN4CC1"
} |
Can you make molecule CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C=CSc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | C=CSc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC7"
} |
Can you make molecule CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | CC(C)c1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "CC7"
} |
Can you make molecule CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | C=CCCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC7"
} |
Can you make molecule CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NCC[NH2+][C@@H]1CCc2nc(CCCCl)nn2C1)c1ccccc1 | CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | O=S(=O)(NCC[NH2+][C@@H]1CCc2nc(CCCCl)nn2C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC7"
} |
Can you make molecule CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(NCC[NH2+][C@@H]1CCc2nc(CCCCS)nn2C1)c1ccccc1 | CCc1nc2n(n1)C[C@H]([NH2+]CCNS(=O)(=O)c1ccccc1)CC2 | O=S(=O)(NCC[NH2+][C@@H]1CCc2nc(CCCCS)nn2C1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC7"
} |
Can you make molecule CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCN(C(=O)c2oc3ccccc3c2C)C1 | CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCN(C(=O)c2oc3ccccc3c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCCN(C(=O)c2oc3ccccc3c2C)C1 | CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCCN(C(=O)c2oc3ccccc3c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCC&&C1",
"old_substring": "N345"
} |
Can you make molecule CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCc1oc(C(=O)c2oc3ccccc3c2C)c(C#N)c1-c1c(N)n(CCC)c(=O)[nH]c1=O | CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O | CCCCc1oc(C(=O)c2oc3ccccc3c2C)c(C#N)c1-c1c(N)n(CCC)c(=O)[nH]c1=O | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1c&oc&c1&",
"old_substring": "N345"
} |
Can you make molecule CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCC(=O)N(C(=O)c2oc3ccccc3c2C)C1 | CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O | CCCCC1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCC(=O)N(C(=O)c2oc3ccccc3c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&&CCC1=O",
"old_substring": "N345"
} |
Can you make molecule CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@]1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCCN(C(=O)c2oc3ccccc3c2C)C1 | CCCCN(C(=O)c1oc2ccccc2c1C)c1c(N)n(CCC)c(=O)[nH]c1=O | CCCC[C@@]1(c2c(N)n(CCC)c(=O)[nH]c2=O)CCCN(C(=O)c2oc3ccccc3c2C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC[C@@]&&C1",
"old_substring": "N345"
} |
Can you make molecule CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2c(=O)n(C3CC(C)C3)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | CCc1cc2c(=O)n(C3CC(C)C3)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1CC&C1",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2c(=O)n(CCC(C)C)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | CCc1cc2c(=O)n(CCC(C)C)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2c(=O)n(CCCCBr)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | CCc1cc2c(=O)n(CCCCBr)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | C=CCCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "CCC4"
} |
Can you make molecule CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1cc2c(=O)n(CCCCCl)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | CCCn1c(S[C@H](C(N)=O)c2ccccc2)nc2sc(CC)cc2c1=O | CCc1cc2c(=O)n(CCCCCl)c(S[C@H](C(N)=O)c3ccccc3)nc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCl",
"old_substring": "CCC4"
} |
Can you make molecule COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)CSN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CSN2CCN(c3ccccc3O)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&N1CCN&CC1",
"old_substring": "N17CCN8CC1"
} |
Can you make molecule COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)CN2CC(c3ccccc3O)C2)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CN2CC(c3ccccc3O)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N17CCN8CC1"
} |
Can you make molecule COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)CN2CCCN(c3ccccc3O)C2=O)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CN2CCCN(c3ccccc3O)C2=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCN&C1=O",
"old_substring": "N17CCN8CC1"
} |
Can you make molecule COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)CN2CCN=C2Sc2ccccc2O)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CN2CCN=C2Sc2ccccc2O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N17CCN8CC1"
} |
Can you make molecule COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)C(C)(C)C2)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)CC2)c1 | COc1cccc(CCNC(=O)CN2CCN(c3ccccc3O)C(C)(C)C2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN&C(C)(C)C1",
"old_substring": "N17CCN8CC1"
} |
Can you make molecule c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | CN(Cc1nnc(C2CCC2)o1)C(=S)Sc1cccc2ccccc12 | c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 | CN(Cc1nnc(C2CCC2)o1)C(=S)Sc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc2c(SC3=NCCN3Cc3nnc(C4CCC4)o3)cccc2c1 | c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 | c1ccc2c(SC3=NCCN3Cc3nnc(C4CCC4)o3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N56"
} |
Can you make molecule c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | c1ccc2c(C3CCN(CCc4nnc(C5CCC5)o4)CC3)cccc2c1 | c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 | c1ccc2c(C3CCN(CCc4nnc(C5CCC5)o4)CC3)cccc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(Cc2nnc(C3CCC3)o2)cccc1-c1cccc2ccccc12 | c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 | Nc1c(Cc2nnc(C3CCC3)o2)cccc1-c1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1cc(Cc2nnc(C3CCC3)o2)cc(-c2cccc3ccccc23)c1 | c1ccc2c(NCc3nnc(C4CCC4)o3)cccc2c1 | Nc1cc(Cc2nnc(C3CCC3)o2)cc(-c2cccc3ccccc23)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Nc1cc&cc&c1",
"old_substring": "N56"
} |
Can you make molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)C2=C([O-])C(=O)N(CCCC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CCCC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C4C3"
} |
Can you make molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)C2=C([O-])C(=O)N(CCCCC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CCCCC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C4C3"
} |
Can you make molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)C2=C([O-])C(=O)N(C3CC([NH+](C)C)C3)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(C3CC([NH+](C)C)C3)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C4C3"
} |
Can you make molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)C2=C([O-])C(=O)N([C@@H](C)CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N([C@@H](C)CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C4C3"
} |
Can you make molecule CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)C2=C([O-])C(=O)N(C3CCC([NH+](C)C)CC3)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(CC[NH+](C)C)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | CC1=C(C(=O)C2=C([O-])C(=O)N(C3CCC([NH+](C)C)CC3)[C@H]2c2cccc(Cl)c2)[C@H](C)N=N1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C4C3"
} |
Can you make molecule CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@@H]2Nc3ccc(C(=O)C(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)C(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N4(C)C"
} |
Can you make molecule CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@@H]2Nc3ccc(C(=O)CC(=N)S)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)CC(=N)S)cc3[C@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N4(C)C"
} |
Can you make molecule CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C4=CCCC4)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C4=CCCC4)cc3[C@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N4(C)C"
} |
Can you make molecule CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@@H]2Nc3ccc(C(=O)C(F)(F)C#N)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)C(F)(F)C#N)cc3[C@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N4(C)C"
} |
Can you make molecule CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N4CCC(C)CC4)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N(C)C)cc3[C@H]3C=CC[C@H]32)cc1 | CCOc1ccc([C@@H]2Nc3ccc(C(=O)N4CCC(C)CC4)cc3[C@H]3C=CC[C@H]32)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCC(C)CC1",
"old_substring": "N4(C)C"
} |
Can you make molecule COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1C.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 | COc1ccccc1C.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1C",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1F.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 | COc1ccccc1F.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1F",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1I.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 | COc1ccccc1I.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1Br.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 | COc1ccccc1Br.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccccc1Cl.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | COc1ccc(Cc2sc(NC(=O)[C@H]3COc4ccccc4O3)nc2C)cc1 | COc1ccccc1Cl.Cc1nc(NC(=O)[C@H]2COc3ccccc3O2)sc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c16ccc%10cc1"
} |
Can you make molecule Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc([C@@H](C)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc([C@@H](C)C(F)(F)F)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)C(F)(F)F",
"old_substring": "C3[C@H](O)C(F)(F)F"
} |
Can you make molecule Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc([C@@H](Cl)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc([C@@H](Cl)C(F)(F)F)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(Cl)C(F)(F)F",
"old_substring": "C3[C@H](O)C(F)(F)F"
} |
Can you make molecule Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(CC(C)(C)C[C@H](C)O)[nH]c2c1 | Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc(CC(C)(C)C[C@H](C)O)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](O)CC(C)(C)C&",
"old_substring": "C3[C@H](O)C(F)(F)F"
} |
Can you make molecule Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc(CC(=O)CCC(F)(F)F)[nH]c2c1 | Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc(CC(=O)CCC(F)(F)F)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=O)CCC(F)(F)F",
"old_substring": "C3[C@H](O)C(F)(F)F"
} |
Can you make molecule Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc2nc([C@@H](O)CC(F)(F)F)[nH]c2c1 | Cc1cnc2nc(C[C@H](O)C(F)(F)F)[nH]c2c1 | Cc1cnc2nc([C@@H](O)CC(F)(F)F)[nH]c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "O[C@H]&CC(F)(F)F",
"old_substring": "C3[C@H](O)C(F)(F)F"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)CCO)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)CCO)C(=O)COCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CCO",
"old_substring": "C6C(C)(C)O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)C)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)C)C(=O)COCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)C",
"old_substring": "C6C(C)(C)O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)COCc1ccccc1Cl)C(=O)CC(C)(C)C | CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl | CCN(C(=O)COCc1ccccc1Cl)C(=O)CC(C)(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC&=O",
"old_substring": "C6C(C)(C)O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(C(=O)COCc1ccccc1Cl)C(=O)C(C)(C)F | CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl | CCN(C(=O)COCc1ccccc1Cl)C(=O)C(C)(C)F | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(F)C&=O",
"old_substring": "C6C(C)(C)O"
} |
Can you make molecule CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC(C)(C)CS)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)O)C(=O)COCc1ccccc1Cl | CCN(CC(C)(C)CS)C(=O)COCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&C(C)(C)CS",
"old_substring": "C6C(C)(C)O"
} |
Can you make molecule O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SNC1CC[NH+](CC(F)F)CC1)Nc1cccc2ccccc12 | O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 | O=C(/C=C/SNC1CC[NH+](CC(F)F)CC1)Nc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=Nc2cccc3ccccc23)CCC1=NC1CC[NH+](CC(F)F)CC1 | O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 | O=C1C(=Nc2cccc3ccccc23)CCC1=NC1CC[NH+](CC(F)F)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1cccc2ccccc12)n1nc(NC2CC[NH+](CC(F)F)CC2)oc1=S | O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 | O=C(Nc1cccc2ccccc12)n1nc(NC2CC[NH+](CC(F)F)CC2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | FC(F)C[NH+]1CCC(Nc2ccc(/C=N/ONc3cccc4ccccc34)o2)CC1 | O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 | FC(F)C[NH+]1CCC(Nc2ccc(/C=N/ONc3cccc4ccccc34)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C34"
} |
Can you make molecule O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(NC2CC[NH+](CC(F)F)CC2)CC1)Nc1cccc2ccccc12 | O=C(Nc1cccc2ccccc12)NC1CC[NH+](CC(F)F)CC1 | O=C(NN=C1CCC(NC2CC[NH+](CC(F)F)CC2)CC1)Nc1cccc2ccccc12 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C34"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.