prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)N(CC[NH+]2CCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1",
"old_substring": "[NH+]13CCOCC1"
} |
Can you make molecule O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)N(CC[NH+]2CCCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCC1",
"old_substring": "[NH+]13CCOCC1"
} |
Can you make molecule O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)N(CC[NH+]2CCCSCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCCSCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCSCC1",
"old_substring": "[NH+]13CCOCC1"
} |
Can you make molecule O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)N(CC[NH+]2CCCCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCCCCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCCCC1",
"old_substring": "[NH+]13CCOCC1"
} |
Can you make molecule O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)N(CC[NH+]2CC=CCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CCOCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | O=C1C(=O)N(CC[NH+]2CC=CCC2)[C@@H](c2cccc([N+](=O)[O-])c2)C1=C(O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC=CCC1",
"old_substring": "[NH+]13CCOCC1"
} |
Can you make molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(CC)SC(=O)Cc1ccccc1N | CC[C@@H](C)N(CC)C(=O)c1ccccc1N | CC[C@@H](C)N(CC)SC(=O)Cc1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(CC)C(=O)CCCC(=O)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)CCCC(=O)c1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(CC)C(=O)CC(C)(C)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)CC(C)(C)c1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(CC)C(=O)CCC(C)(C)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)CCC(C)(C)c1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](C)N(CC)C(=O)c1ccccc1N less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C)N(CC)SC(=O)[C@@H](C)c1ccccc1N | CC[C@@H](C)N(CC)C(=O)c1ccccc1N | CC[C@@H](C)N(CC)SC(=O)[C@@H](C)c1ccccc1N | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C25=O"
} |
Can you make molecule Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1C(=O)Cn1nc(N)n(Nc2cccs2)c1=S | Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 | Cc1cc(Cl)cc(Cl)c1C(=O)Cn1nc(N)n(Nc2cccs2)c1=S | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(Cl)cc(Cl)c1&",
"old_substring": "Cc1cc(C)c4c(C)c1"
} |
Can you make molecule Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(Br)c(C)c1Cl | Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 | Cc1cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(Br)c(C)c1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(Br)c(C)c1Cl",
"old_substring": "Cc1cc(C)c4c(C)c1"
} |
Can you make molecule Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1C | Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 | Cc1c(Br)cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Br)cc&c(C)c1C",
"old_substring": "Cc1cc(C)c4c(C)c1"
} |
Can you make molecule Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)cc1Br | Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 | Cc1cc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&c(C)cc1Br",
"old_substring": "Cc1cc(C)c4c(C)c1"
} |
Can you make molecule Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1c(Br)ccc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c1C | Cc1cc(C)c(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c(C)c1 | Cc1c(Br)ccc(C(=O)Cn2nc(N)n(Nc3cccs3)c2=S)c1C | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c(Br)ccc&c1C",
"old_substring": "Cc1cc(C)c4c(C)c1"
} |
Can you make molecule C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 | CC(C)[C@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)[C@@H]&CC&",
"old_substring": "C3(=O)CC[C@@H]4C"
} |
Can you make molecule C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 | CCC[C@@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCC[C@H]&CC&",
"old_substring": "C3(=O)CC[C@@H]4C"
} |
Can you make molecule C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC[C@@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 | CCCC[C@@H](CCc1ccccc1)N1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CCCC[C@H]&CC&",
"old_substring": "C3(=O)CC[C@@H]4C"
} |
Can you make molecule C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(CCC2=CCC[C@@H]2c2ccccc2)C(C)(C)CO1 | C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 | C[C@H]1CN(CCC2=CCC[C@@H]2c2ccccc2)C(C)(C)CO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC1=CCC[C@@H]1&",
"old_substring": "C3(=O)CC[C@@H]4C"
} |
Can you make molecule C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@](C)(CCc1ccccc1)N1C[C@H](C)OCC1(C)C | C[C@H]1CN(C(=O)CC[C@H](C)c2ccccc2)C(C)(C)CO1 | CC[C@](C)(CCc1ccccc1)N1C[C@H](C)OCC1(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@]&(C)CC&",
"old_substring": "C3(=O)CC[C@@H]4C"
} |
Can you make molecule CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(-c2nc(N(C)C)nc3c2CCCC3)ccc1C=O | CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 | Cc1cc(-c2nc(N(C)C)nc3c2CCCC3)ccc1C=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C=O)c(C)c1",
"old_substring": "c15ccc(S(C)(=O)=O)cc1"
} |
Can you make molecule CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1nc2c(c(-c3ccc(C(N)=S)cc3Cl)n1)CCCC2 | CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 | CN(C)c1nc2c(c(-c3ccc(C(N)=S)cc3Cl)n1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(C(N)=S)cc1Cl",
"old_substring": "c15ccc(S(C)(=O)=O)cc1"
} |
Can you make molecule CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1nc2c(c(-c3ccc(Br)c(C=O)c3)n1)CCCC2 | CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 | CN(C)c1nc2c(c(-c3ccc(Br)c(C=O)c3)n1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)c(C=O)c1",
"old_substring": "c15ccc(S(C)(=O)=O)cc1"
} |
Can you make molecule CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(C=O)cc(C)c1-c1nc(N(C)C)nc2c1CCCC2 | CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 | Cc1cc(C=O)cc(C)c1-c1nc(N(C)C)nc2c1CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&c(C)cc(C=O)cc1C",
"old_substring": "c15ccc(S(C)(=O)=O)cc1"
} |
Can you make molecule CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 less soluble in water? The output molecule should be similar to the input molecule. | CN(C)c1nc2c(c(-c3cccc(C(=N)O)c3)n1)CCCC2 | CN(C)c1nc2c(c(-c3ccc(S(C)(=O)=O)cc3)n1)CCCC2 | CN(C)c1nc2c(c(-c3cccc(C(=N)O)c3)n1)CCCC2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C(=N)O)c1",
"old_substring": "c15ccc(S(C)(=O)=O)cc1"
} |
Can you make molecule CC(C)c1ccc(CNC(N)=[NH2+])cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=[NH2+])NCc1ccc(CCCCBr)cc1 | CC(C)c1ccc(CNC(N)=[NH2+])cc1 | NC(=[NH2+])NCc1ccc(CCCCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1ccc(CNC(N)=[NH2+])cc1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1ccc(CNC(N)=[NH2+])cc1 | CC(C)c1ccc(CNC(N)=[NH2+])cc1 | C=CCCCCc1ccc(CNC(N)=[NH2+])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1ccc(CNC(N)=[NH2+])cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=[NH2+])NCc1ccc(CCCCCBr)cc1 | CC(C)c1ccc(CNC(N)=[NH2+])cc1 | NC(=[NH2+])NCc1ccc(CCCCCBr)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1ccc(CNC(N)=[NH2+])cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=[NH2+])NCc1ccc(CCCCCS)cc1 | CC(C)c1ccc(CNC(N)=[NH2+])cc1 | NC(=[NH2+])NCc1ccc(CCCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1ccc(CNC(N)=[NH2+])cc1 less soluble in water? The output molecule should be similar to the input molecule. | NC(=[NH2+])NCc1ccc(CCCCCCS)cc1 | CC(C)c1ccc(CNC(N)=[NH2+])cc1 | NC(=[NH2+])NCc1ccc(CCCCCCS)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)N1C(N)=C(C#N)[C@@H](c2ccc(Cl)s2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2ccc(Cl)s2)C2=C1CCCC2=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)N1C(N)=C(C#N)[C@@H](c2ccc(Br)s2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2ccc(Br)s2)C2=C1CCCC2=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c13cccs1"
} |
Can you make molecule CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)N1C(N)=C(C#N)[C@@H](c2sccc2Br)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2sccc2Br)C2=C1CCCC2=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c13cccs1"
} |
Can you make molecule CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)N1C(N)=C(C#N)[C@@H](c2csc(I)c2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2csc(I)c2)C2=C1CCCC2=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c13cccs1"
} |
Can you make molecule CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O less soluble in water? The output molecule should be similar to the input molecule. | CN(C)N1C(N)=C(C#N)[C@@H](c2cc3c(s2)CSC3)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cccs2)C2=C1CCCC2=O | CN(C)N1C(N)=C(C#N)[C@@H](c2cc3c(s2)CSC3)C2=C1CCCC2=O | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c13cccs1"
} |
Can you make molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C=C[C@H](CCS(=O)(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](CCS(=O)(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C=C[C@H](C(=O)CO)C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(=O)CO)C1)c1cc(F)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C=C[C@H](C(O)O)C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(O)O)C1)c1cc(F)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H]1C=C[C@H](C(F)(F)C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | O=C(N[C@H]1C=C[C@H](C(F)(F)C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(F)(F)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)[O-])[C@H]1C=C[C@H](NC(=O)c2cc(F)c(Cl)cc2Cl)C1 | O=C(N[C@H]1C=C[C@H](C(=O)[O-])C1)c1cc(F)c(Cl)cc1Cl | CCC(CC)(C(=O)[O-])[C@H]1C=C[C@H](NC(=O)c2cc(F)c(Cl)cc2Cl)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C4(=O)[O-]"
} |
Can you make molecule CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCBr)c1 | CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCn1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | C=CCCCCn1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCBr)c1 | CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCBr)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCS)c1 | CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCCS)c1 | CC(C)n1nnnc1COc1cccc(C(=O)NC2CCCCCC2)c1 | O=C(NC1CCCCCC1)c1cccc(OCc2nnnn2CCCCCCS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC8C"
} |
Can you make molecule O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1=C(Cc2ccc(Cl)cc2Cl)CN2CCC2=NO1)c1ccccc1Br | O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br | O=S(=O)(C1=C(Cc2ccc(Cl)cc2Cl)CN2CCC2=NO1)c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2noc&c2C1",
"old_substring": "N23"
} |
Can you make molecule O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1=NN2CCCN2C(Cc2ccc(Cl)cc2Cl)=C1)c1ccccc1Br | O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br | O=S(=O)(C1=NN2CCCN2C(Cc2ccc(Cl)cc2Cl)=C1)c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCn2nc&cc21",
"old_substring": "N23"
} |
Can you make molecule O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1=CC=C(Cc2ccc(Cl)cc2Cl)N2CCC2=C1)c1ccccc1Br | O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br | O=S(=O)(C1=CC=C(Cc2ccc(Cl)cc2Cl)N2CCC2=C1)c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCc2cc&ccc21",
"old_substring": "N23"
} |
Can you make molecule O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | Nc1c2sc-2nsc(S(=O)(=O)c2ccccc2Br)c1Cc1ccc(Cl)cc1Cl | O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br | Nc1c2sc-2nsc(S(=O)(=O)c2ccccc2Br)c1Cc1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&sc2nsc&c12",
"old_substring": "N23"
} |
Can you make molecule O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br less soluble in water? The output molecule should be similar to the input molecule. | O=S(=O)(C1=C(Cc2ccc(Cl)cc2Cl)CN2CCN2N=N1)c1ccccc1Br | O=S(=O)(NCc1ccc(Cl)cc1Cl)c1ccccc1Br | O=S(=O)(C1=C(Cc2ccc(Cl)cc2Cl)CN2CCN2N=N1)c1ccccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCn2nnc&c2C1",
"old_substring": "N23"
} |
Can you make molecule COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NSC(=O)Cc1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NSC(=O)Cc1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)CCCC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)CCCC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)CC(C)(C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)CC(C)(C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NC(=O)CCC(C)(C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)CCC(C)(C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O less soluble in water? The output molecule should be similar to the input molecule. | COC[C@H](NSC(=O)[C@@H](C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NC(=O)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | COC[C@H](NSC(=O)[C@@H](C)c1cc(-c2ccccc2)c(C)[nH]c1=O)C(N)=O | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(I)ccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(I)ccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(Br)ccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(Br)ccc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCCC[C@H]1n1cc(-c2sc3sccc3c2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2sc3sccc3c2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCCC[C@H]1n1cc(-c2sc3ccccc3c2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2sc3ccccc3c2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 less soluble in water? The output molecule should be similar to the input molecule. | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(Br)c(F)cc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2ccccc2Cl)cn1 | O[C@H]1CCCCC[C@H]1n1cc(-c2cc(Br)c(F)cc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c14ccccc1Cl"
} |
Can you make molecule CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](C)N(C)Oc3ccccc3)C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](C)N(C)Oc3ccccc3)C(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)N(C)O&",
"old_substring": "[C@@H]4(C5)C(=O)[O-]"
} |
Can you make molecule CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](C)C(C)(C)Cc3ccccc3)C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](C)C(C)(C)Cc3ccccc3)C(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]4(C5)C(=O)[O-]"
} |
Can you make molecule CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](C)[C@H]2C(=O)N([C@@H]3CN(c4ccccc4)C(=O)O3)C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@@H]3CN(c4ccccc4)C(=O)O3)C(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C(=O)O1",
"old_substring": "[C@@H]4(C5)C(=O)[O-]"
} |
Can you make molecule CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](O)C#CCc3ccccc3)C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](O)C#CCc3ccccc3)C(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(O)C#CC&",
"old_substring": "[C@@H]4(C5)C(=O)[O-]"
} |
Can you make molecule CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 less soluble in water? The output molecule should be similar to the input molecule. | CC1=C[C@@H](C)[C@H]2C(=O)N([C@@H](C)/C(N)=N/Oc3ccccc3)C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@H](Cc3ccccc3)C(=O)[O-])C(=O)[C@H]2C1 | CC1=C[C@@H](C)[C@H]2C(=O)N([C@@H](C)/C(N)=N/Oc3ccccc3)C(=O)[C@H]2C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(C)/C(N)=N/O&",
"old_substring": "[C@@H]4(C5)C(=O)[O-]"
} |
Can you make molecule CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCC(C)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCC(C)(C)NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCC(CCC)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC=&CCC",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCCC(C)=NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC=&C",
"old_substring": "CCCC2"
} |
Can you make molecule CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCNS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | CCCCCCC(=O)NS(=O)(=O)Cc1ccc([N+](=O)[O-])cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "CCCC2"
} |
Can you make molecule COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCCC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(CCCC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C6C4"
} |
Can you make molecule COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCCCC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(CCCCC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C6C4"
} |
Can you make molecule COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C2CC([C@H]3C[C@@H](C(C)(C)C)CCC3=O)C2)cc1 | COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(C2CC([C@H]3C[C@@H](C(C)(C)C)CCC3=O)C2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C6C4"
} |
Can you make molecule COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H](C)CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc([C@@H](C)CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C6C4"
} |
Can you make molecule COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C2CCC([C@H]3C[C@@H](C(C)(C)C)CCC3=O)CC2)cc1 | COc1ccc(CC[C@H]2C[C@@H](C(C)(C)C)CCC2=O)cc1 | COc1ccc(C2CCC([C@H]3C[C@@H](C(C)(C)C)CCC3=O)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "C6C4"
} |
Can you make molecule C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(CCC(CO)=Nc2nc(-c3ccccc3Cl)cs2)CCO1 | C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | C[C@H]1CN(CCC(CO)=Nc2nc(-c3ccccc3Cl)cs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(CN1CCO[C@@H](C)C1)=N/ONc1nc(-c2ccccc2Cl)cs1 | C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | C/C(CN1CCO[C@@H](C)C1)=N/ONc1nc(-c2ccccc2Cl)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CNc1nc(-c2ccccc2Cl)cs1)N1CCO[C@@H](C)C1 | C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | CCC(CC)(C(=O)CNc1nc(-c2ccccc2Cl)cs1)N1CCO[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN(SSC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | C[C@H]1CN(SSC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C4=O"
} |
Can you make molecule C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(C(=O)CCNc1nc(-c2ccccc2Cl)cs1)N1CCO[C@@H](C)C1 | C[C@H]1CN(CC(=O)Nc2nc(-c3ccccc3Cl)cs2)CCO1 | CCC(CC)(C(=O)CCNc1nc(-c2ccccc2Cl)cs1)N1CCO[C@@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C4=O"
} |
Can you make molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1CCCCNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CCCCNC(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1CCC=NC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CCC=NC(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&CC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1CCCCCNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CCCCCNC(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1C1CC(NC(=O)c2cccs2)C1 | Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1C1CC(NC(=O)c2cccs2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C35"
} |
Can you make molecule Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(Cl)cc(Cl)c1SC(=S)ONC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1CNC(=O)c1cccs1 | Cc1cc(Cl)cc(Cl)c1SC(=S)ONC(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C35"
} |
Can you make molecule CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ccsc2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ccsc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccsc1",
"old_substring": "c18nccs1"
} |
Can you make molecule CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2cnc(Br)s2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2cnc(Br)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1ncc&s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ncc(Cl)s2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ncc(Cl)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Cl)s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ncc(Br)s2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2ncc(Br)s2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(Br)s1",
"old_substring": "c18nccs1"
} |
Can you make molecule CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2scnc2Cl)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2nccs2)CC1 | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2scnc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&scnc1Cl",
"old_substring": "c18nccs1"
} |
Can you make molecule COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCS1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&CCS1",
"old_substring": "[C@@H]17CN6CCO1"
} |
Can you make molecule COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCN(C2CC2)C1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCN(C2CC2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCN&C1",
"old_substring": "[C@@H]17CN6CCO1"
} |
Can you make molecule COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCCN(C2CC2)C1=O | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCCN(C2CC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&C1=O",
"old_substring": "[C@@H]17CN6CCO1"
} |
Can you make molecule COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CC[C@H](C2CC2)O1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CC[C@H](C2CC2)O1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]17CN6CCO1"
} |
Can you make molecule COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCCN(C2CC2)CC1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CN(C2CC2)CCO1 | COc1ccc(C)cc1[C@@H](C)NC[C@@H]1CCCN(C2CC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]17CN6CCO1"
} |
Can you make molecule CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)Cc1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOSC(=O)Cc1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCCC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)CCCC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CC(C)(C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)CC(C)(C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCOC(=O)CCC(C)(C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)CCC(C)(C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCOSC(=O)[C@@H](C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOC(=O)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | CCOSC(=O)[C@@H](C)c1ccn(-c2cccc(NC(=O)C3CCCC3)c2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.