prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(C[NH+]2CCN(c3ccccc3Cl)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3ccccc3Cl)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c14ccccc1"
} |
Can you make molecule O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(C[NH+]2CCN(c3ccc(I)cc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3ccc(I)cc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c14ccccc1"
} |
Can you make molecule O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2CC[NH+](CN3C(=O)C4(O[C@@H]5CCCC[C@H]5O4)c4ccccc43)CC2)cc1I | O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | Cc1ccc(N2CC[NH+](CN3C(=O)C4(O[C@@H]5CCCC[C@H]5O4)c4ccccc43)CC2)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c14ccccc1"
} |
Can you make molecule O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 less soluble in water? The output molecule should be similar to the input molecule. | O=C1N(C[NH+]2CCN(c3cccc(Br)c3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | O=C1N(C[NH+]2CCN(c3cccc(Br)c3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c14ccccc1"
} |
Can you make molecule O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(N2CC[NH+](CN3C(=O)C4(O[C@@H]5CCCC[C@H]5O4)c4ccccc43)CC2)c1C | O=C1N(C[NH+]2CCN(c3ccccc3)CC2)c2ccccc2C12O[C@@H]1CCCC[C@H]1O2 | Cc1cccc(N2CC[NH+](CN3C(=O)C4(O[C@@H]5CCCC[C@H]5O4)c4ccccc43)CC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c14ccccc1"
} |
Can you make molecule CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1nc(CCCCBr)n(-c2ccccc2F)n1 | CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F | O=C([O-])c1nc(CCCCBr)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1nc(C(=O)[O-])nn1-c1ccccc1F | CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F | C=CCCCCc1nc(C(=O)[O-])nn1-c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1nc(CCCCCBr)n(-c2ccccc2F)n1 | CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F | O=C([O-])c1nc(CCCCCBr)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1nc(CCCCCS)n(-c2ccccc2F)n1 | CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F | O=C([O-])c1nc(CCCCCS)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | O=C([O-])c1nc(CCCCCCS)n(-c2ccccc2F)n1 | CC(C)c1nc(C(=O)[O-])nn1-c1ccccc1F | O=C([O-])c1nc(CCCCCCS)n(-c2ccccc2F)n1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC3C"
} |
Can you make molecule C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](SC2=CCCCCC2)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](SC2=CCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C14CCCCCC1"
} |
Can you make molecule C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCCCCCCC2)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCCCCCCC2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C14CCCCCC1"
} |
Can you make molecule C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C1=CC=C2CCCCC(=C1)C2[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 | C1=CC=C2CCCCC(=C1)C2[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C14CCCCCC1"
} |
Can you make molecule C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC[C@@H](C)[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 | CCCCCC[C@@H](C)[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC[C@H]&C",
"old_substring": "C14CCCCCC1"
} |
Can you make molecule C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(C)(C)C[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | C1=C[C@H]2C[C@@H]1C[C@H]2CN1CC[NH+](C2CCCCCC2)CC1 | CCCCCC(C)(C)C[NH+]1CCN(C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC(C)(C)C&",
"old_substring": "C14CCCCCC1"
} |
Can you make molecule CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](C[NH+]1CCCC1(C)C)Nc1ncncc1N | CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N | CC(C)C[C@H](C[NH+]1CCCC1(C)C)Nc1ncncc1N | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCCC1(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](C[N+](C)(C)C)Nc1ncncc1N | CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N | CC(C)C[C@H](C[N+](C)(C)C)Nc1ncncc1N | 102 | {
"fragment_index": 0,
"new_substring": "C[N+]&(C)C",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](C[NH+]1CC(C)(C)C1)Nc1ncncc1N | CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N | CC(C)C[C@H](C[NH+]1CC(C)(C)C1)Nc1ncncc1N | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@H](C[NH+]1CCC(C)(C)C1)Nc1ncncc1N | CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N | CC(C)C[C@H](C[NH+]1CCC(C)(C)C1)Nc1ncncc1N | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC(C)(C)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C[C@@H]1C[NH+]2CC1(CCCNc1ncncc1N)C2 | CC(C)C[C@H](C[NH+](C)C)Nc1ncncc1N | CC(C)C[C@@H]1C[NH+]2CC1(CCCNc1ncncc1N)C2 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CC2(CCC2)C1",
"old_substring": "[NH+]3(C)C"
} |
Can you make molecule O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1c(=O)cnn([C@@H]2C(=O)C=C(c3cccs3)C[C@@H]2c2cccs2)c1=O | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 | Cn1c(=O)cnn([C@@H]2C(=O)C=C(c3cccs3)C[C@@H]2c2cccs2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "n1&ncc(=O)n(C)c1=O",
"old_substring": "n13cnc([N+](=O)[O-])n1"
} |
Can you make molecule O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1c1cn[nH]c(=O)n1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1c1cn[nH]c(=O)n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cn[nH]c(=O)n1",
"old_substring": "n13cnc([N+](=O)[O-])n1"
} |
Can you make molecule O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1c1n[nH]c(=O)[nH]1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1c1n[nH]c(=O)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&n[nH]c(=O)[nH]1",
"old_substring": "n13cnc([N+](=O)[O-])n1"
} |
Can you make molecule O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1ccc(S(=O)(=O)[C@@H]2C(=O)C=C(c3cccs3)C[C@@H]2c2cccs2)c1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 | Cn1ccc(S(=O)(=O)[C@@H]2C(=O)C=C(c3cccs3)C[C@@H]2c2cccs2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cn1ccc(S&(=O)=O)c1",
"old_substring": "n13cnc([N+](=O)[O-])n1"
} |
Can you make molecule O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnc([S-])n1[C@@H]1C(=O)C=C(c2cccs2)C[C@@H]1c1cccs1 | O=C1C=C(c2cccs2)C[C@H](c2cccs2)[C@@H]1n1cnc([N+](=O)[O-])n1 | Cc1nnc([S-])n1[C@@H]1C(=O)C=C(c2cccs2)C[C@@H]1c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1nnc([S-])n1&",
"old_substring": "n13cnc([N+](=O)[O-])n1"
} |
Can you make molecule C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(I)o2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(I)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(Br)o2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(Br)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(Cl)o2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccc(Cl)o2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)o1",
"old_substring": "c18ccco1"
} |
Can you make molecule C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2occc2Br)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2occc2Br)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&occc1Br",
"old_substring": "c18ccco1"
} |
Can you make molecule C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2sccc2C)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2ccco2)CC1 | C[NH2+]C1CCC([NH+](C)CC(=O)N[C@H](C)c2sccc2C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1C",
"old_substring": "c18ccco1"
} |
Can you make molecule CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCBr)nc32)C1 | CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCBr)nc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCCc1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | C=CCCCCc1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCBr)nc32)C1 | CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCBr)nc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCCBr",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCS)nc32)C1 | CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCS)nc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCCS)nc32)C1 | CC(C)c1nc2n(n1)CCC[C@H]2[NH2+]C[C@@H]1CCC[C@H](C)C1 | C[C@H]1CCC[C@@H](C[NH2+][C@@H]2CCCn3nc(CCCCCCS)nc32)C1 | 102 | {
"fragment_index": 0,
"new_substring": "SCCCCCC&",
"old_substring": "CC4C"
} |
Can you make molecule CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=O)c1ccc(NC(=O)c2cc[n+](CCBr)cc2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2cc[n+](CCBr)cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc[n+](CCBr)cc1",
"old_substring": "c18ccc[n+]([O-])c1"
} |
Can you make molecule CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=O)c1ccc(NC(=O)c2ccc(=O)oc2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc(=O)oc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(=O)oc1",
"old_substring": "c18ccc[n+]([O-])c1"
} |
Can you make molecule CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=O)c1ccc(NC(=O)c2ccc([S-])cc2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc([S-])cc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc([S-])cc1",
"old_substring": "c18ccc[n+]([O-])c1"
} |
Can you make molecule CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=O)c1ccc(NC(=O)c2ccc(I)nc2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc(I)nc2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)nc1",
"old_substring": "c18ccc[n+]([O-])c1"
} |
Can you make molecule CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCCOC(=O)c1ccc(NC(=O)c2ccc[nH]c2=S)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[n+]([O-])c2)cc1 | CCCOC(=O)c1ccc(NC(=O)c2ccc[nH]c2=S)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc[nH]c1=S",
"old_substring": "c18ccc[n+]([O-])c1"
} |
Can you make molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(CO)cc(Br)c1OCc1ccc(I)cc1F | CCOc1cc(CO)cc(Br)c1OCc1ccccc1F | CCOc1cc(CO)cc(Br)c1OCc1ccc(I)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(CO)cc(Br)c1OCc1cc(I)ccc1F | CCOc1cc(CO)cc(Br)c1OCc1ccccc1F | CCOc1cc(CO)cc(Br)c1OCc1cc(I)ccc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(CO)cc(Br)c1OCc1ccccc1Cl | CCOc1cc(CO)cc(Br)c1OCc1ccccc1F | CCOc1cc(CO)cc(Br)c1OCc1ccccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(CO)cc(Br)c1OC=C(C)c1ccccc1F | CCOc1cc(CO)cc(Br)c1OCc1ccccc1F | CCOc1cc(CO)cc(Br)c1OC=C(C)c1ccccc1F | 102 | {
"fragment_index": 0,
"new_substring": "CC=&c1ccccc1F",
"old_substring": "c17ccccc1F"
} |
Can you make molecule CCOc1cc(CO)cc(Br)c1OCc1ccccc1F less soluble in water? The output molecule should be similar to the input molecule. | CCOc1cc(CO)cc(Br)c1OCc1cc(F)ccc1Br | CCOc1cc(CO)cc(Br)c1OCc1ccccc1F | CCOc1cc(CO)cc(Br)c1OCc1cc(F)ccc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(F)ccc1Br",
"old_substring": "c17ccccc1F"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnn(-c2ccc(Cl)s2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2ccc(Cl)s2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c19cccs1"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnn(-c2ccc(Br)s2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2ccc(Br)s2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c19cccs1"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnn(-c2sccc2Br)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2sccc2Br)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c19cccs1"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnn(-c2csc(I)c2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2csc(I)c2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c19cccs1"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Cn1nnn(-c2cc3c(s2)CSC3)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cccs2)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | O=C(Cn1nnn(-c2cc3c(s2)CSC3)c1=O)NC[C@@H]1CN(Cc2ccccc2)CCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c19cccs1"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNC(=O)CCCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)CCCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNC(=O)CCC(=O)CNc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)CCC(=O)CNc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC(=O)C&",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNC[S@+]([O-])CCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC[S@+]([O-])CCC(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNC(=O)CCCS(=O)(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)CCCS(=O)(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCS&(=O)=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)[C@H](O)CCNC(=O)C(C)(F)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | CC(C)[C@H](O)CCNC(=O)C(C)(F)C(=O)Nc1ccn(-c2ncccc2Cl)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(F)C&=O",
"old_substring": "C3(=O)C4=O"
} |
Can you make molecule Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)c1cccc(C)c1C)S(=O)(=O)CNCC1CCC1 | Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C | CC[C@H](NC(=O)c1cccc(C)c1C)S(=O)(=O)CNCC1CCC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H]&S(=O)(=O)C&",
"old_substring": "C4CS6(=O)=O"
} |
Can you make molecule Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)N=CC(=O)C=NCC2CCC2)c1C | Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C | Cc1cccc(C(=O)N=CC(=O)C=NCC2CCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C=&C(=O)C=&",
"old_substring": "C4CS6(=O)=O"
} |
Can you make molecule Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](C(=O)NCC1CCC1)C(=O)NC(=O)c1cccc(C)c1C | Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C | CC[C@@H](C(=O)NCC1CCC1)C(=O)NC(=O)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC[C@H](C&=O)C&=O",
"old_substring": "C4CS6(=O)=O"
} |
Can you make molecule Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)[C@@H](CC(=O)NCC1CCC1)NC(=O)c1cccc(C)c1C | Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C | CC(=O)[C@@H](CC(=O)NCC1CCC1)NC(=O)c1cccc(C)c1C | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)[C@H]&CC&=O",
"old_substring": "C4CS6(=O)=O"
} |
Can you make molecule Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)NC[S@+]([O-])CCCC(=O)NCC2CCC2)c1C | Cc1cccc(C(=O)NCCS(=O)(=O)NCC2CCC2)c1C | Cc1cccc(C(=O)NC[S@+]([O-])CCCC(=O)NCC2CCC2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCCC&=O",
"old_substring": "C4CS6(=O)=O"
} |
Can you make molecule CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CCSC12CCN(C(=O)NN=C(c1ccccc1)c1ccccc1)CC2 | CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)N1CCSC12CCN(C(=O)NN=C(c1ccccc1)c1ccccc1)CC2 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCSC12CCN&CC2",
"old_substring": "N13CCC4CC1"
} |
Can you make molecule CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)N1CCCc2cc(C(=O)NN=C(c3ccccc3)c3ccccc3)ccc2C1 | CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)N1CCCc2cc(C(=O)NN=C(c3ccccc3)c3ccccc3)ccc2C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCCc2cc&ccc2C1",
"old_substring": "N13CCC4CC1"
} |
Can you make molecule CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)C1CCN(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)C1CCN(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCN&CC1",
"old_substring": "N13CCC4CC1"
} |
Can you make molecule CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)C1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)C1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCC&CC1",
"old_substring": "N13CCC4CC1"
} |
Can you make molecule CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(=O)CCCCCC(=O)NN=C(c1ccccc1)c1ccccc1 | CCCC(=O)N1CCC(C(=O)NN=C(c2ccccc2)c2ccccc2)CC1 | CCCC(=O)CCCCCC(=O)NN=C(c1ccccc1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "N13CCC4CC1"
} |
Can you make molecule O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | N=C(N[C@@H](NC(=O)c1cccc(Br)c1)C(Cl)(Cl)Cl)Sc1ccccc1 | O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | N=C(N[C@@H](NC(=O)c1cccc(Br)c1)C(Cl)(Cl)Cl)Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](SC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](SC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](NC(=S)N1CCC(c2ccccc2)CC1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)N1CCC(c2ccccc2)CC1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](NC(=S)N1CC[C@H](c2ccccc2)C1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)N1CC[C@H](c2ccccc2)C1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CC[C@H]&C1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](NC(=S)NN=C1CCC(c2ccccc2)CC1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)Nc1ccccc1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | O=C(N[C@H](NC(=S)NN=C1CCC(c2ccccc2)CC1)C(Cl)(Cl)Cl)c1cccc(Br)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)NN=C1CCC&CC1",
"old_substring": "N4C(=S)N5"
} |
Can you make molecule CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccccc1)C(=O)c1cc(NSC(C)=O)n(C)n1.c1ccccc1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 | CCN(Cc1ccccc1)C(=O)c1cc(NSC(C)=O)n(C)n1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C%10"
} |
Can you make molecule CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)C2=C(N)CCS2)n(C)n1.c1ccccc1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)C2=C(N)CCS2)n(C)n1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "C4(=O)C%10"
} |
Can you make molecule CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)CCCC=O)n(C)n1.c1ccccc1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)CCCC=O)n(C)n1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)C%10"
} |
Can you make molecule CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)CC(C)C)n(C)n1.c1ccccc1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)CC(C)C)n(C)n1.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C%10"
} |
Can you make molecule CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[S@@+]([O-])CNc1cc(C(=O)N(CC)Cc2ccccc2)nn1C.c1ccccc1 | CCN(Cc1ccccc1)C(=O)c1cc(NC(=O)Cc2ccccc2)n(C)n1 | CCC[S@@+]([O-])CNc1cc(C(=O)N(CC)Cc2ccccc2)nn1C.c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C%10"
} |
Can you make molecule CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CCCC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CCCC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCCC&=O",
"old_substring": "CC(C)CC4=O"
} |
Can you make molecule CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)CC(=O)CCN1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)(C)CC(=O)CCN1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)CC(=O)CC&",
"old_substring": "CC(C)CC4=O"
} |
Can you make molecule CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)C(=O)CCCCN1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)(C)C(=O)CCCCN1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)C(=O)CCCC&",
"old_substring": "CC(C)CC4=O"
} |
Can you make molecule CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)=NON1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CCC(CC)=NON1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC(CC)=NO&",
"old_substring": "CC(C)CC4=O"
} |
Can you make molecule CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC(CCC)C(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CC(C)CC(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | CCCC(CCC)C(=O)N1CCN(C(=O)c2cnc3c(c2)NC(=O)CO3)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC(CCC)C&=O",
"old_substring": "CC(C)CC4=O"
} |
Can you make molecule O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | O=C(/C=C/Sc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C9"
} |
Can you make molecule O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1ccc(Cl)cc1)NN=C1CCC(c2csc(NC(=O)Nc3ccc(Cl)cc3)n2)CC1 | O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | O=C(NCCc1ccc(Cl)cc1)NN=C1CCC(c2csc(NC(=O)Nc3ccc(Cl)cc3)n2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C9"
} |
Can you make molecule O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ONCCc1ccc(Cl)cc1)C(=O)Sc1csc(NC(=O)Nc2ccc(Cl)cc2)n1 | O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | C/C(=N\ONCCc1ccc(Cl)cc1)C(=O)Sc1csc(NC(=O)Nc2ccc(Cl)cc2)n1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C9"
} |
Can you make molecule O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(Nc1ccc(Cl)cc1)Nc1nc([C@H]2CC=C(C(=O)NCCc3ccc(Cl)cc3)S2)cs1 | O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | O=C(Nc1ccc(Cl)cc1)Nc1nc([C@H]2CC=C(C(=O)NCCc3ccc(Cl)cc3)S2)cs1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C9"
} |
Can you make molecule O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCc1ccc(Cl)cc1)NN=Cc1ccc(-c2csc(NC(=O)Nc3ccc(Cl)cc3)n2)cc1 | O=C(Cc1csc(NC(=O)Nc2ccc(Cl)cc2)n1)NCCc1ccc(Cl)cc1 | O=C(NCCc1ccc(Cl)cc1)NN=Cc1ccc(-c2csc(NC(=O)Nc3ccc(Cl)cc3)n2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C9"
} |
Can you make molecule Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1Cl)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1Cl)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Cl",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1Br)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1Br)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)cc1Br",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)c(Cl)c1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)c(Cl)c1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(F)c(Cl)c1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(I)cc1F)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(I)cc1F)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1F",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1cc3c(F)cccc3s1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1ccc(F)cc1)O2 | Cc1ccc2c(c1)C[C@@H](C[C@@H](C[NH3+])c1cc3c(F)cccc3s1)O2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(F)cccc2s1",
"old_substring": "c14ccc(F)cc1"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC2(C)CCCC2)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC2(C)CCCC2)[C@@H](c2ccc(C)s2)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C)CCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC(Cl)(Cl)Cl)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC(Cl)(Cl)Cl)[C@@H](c2ccc(C)s2)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(Cl)(Cl)Cl",
"old_substring": "C4(C)C"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CCCC(C)(C)OC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccc(C)s1 | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C | CCCC(C)(C)OC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCCC&(C)C",
"old_substring": "C4(C)C"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CCC(C)(CC)OC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccc(C)s1 | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C | CCC(C)(CC)OC(=O)C1=C(C)N(C)C(=O)N[C@@H]1c1ccc(C)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(C)CC",
"old_substring": "C4(C)C"
} |
Can you make molecule CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C less soluble in water? The output molecule should be similar to the input molecule. | CC1=C(C(=O)OC2(C=O)CCCCCC2)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC(C)C)[C@@H](c2ccc(C)s2)NC(=O)N1C | CC1=C(C(=O)OC2(C=O)CCCCCC2)[C@@H](c2ccc(C)s2)NC(=O)N1C | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C=O)CCCCCC1",
"old_substring": "C4(C)C"
} |
Can you make molecule COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | COCc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | COCSc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | CC(=O)Sc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc([C@H](O)CNc2cc(C(=O)CS)cc(F)c2[N+](=O)[O-])cn1 | COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | Cn1cc([C@H](O)CNc2cc(C(=O)CS)cc(F)c2[N+](=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1cc([C@H](O)CNc2cc(C(=O)CI)cc(F)c2[N+](=O)[O-])cn1 | COc1cc(F)c([N+](=O)[O-])c(NC[C@@H](O)c2cnn(C)c2)c1 | Cn1cc([C@H](O)CNc2cc(C(=O)CI)cc(F)c2[N+](=O)[O-])cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.